ES2452722T3 - Complejos de metales para uso en la carbonilación de compuestos etilénicamente insaturados - Google Patents
Complejos de metales para uso en la carbonilación de compuestos etilénicamente insaturados Download PDFInfo
- Publication number
- ES2452722T3 ES2452722T3 ES07733611.3T ES07733611T ES2452722T3 ES 2452722 T3 ES2452722 T3 ES 2452722T3 ES 07733611 T ES07733611 T ES 07733611T ES 2452722 T3 ES2452722 T3 ES 2452722T3
- Authority
- ES
- Spain
- Prior art keywords
- bis
- phosphinomethyl
- butylphosphinomethyl
- decyl
- trioxatricyclo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 104
- 239000002184 metal Substances 0.000 title claims abstract description 104
- 150000001875 compounds Chemical class 0.000 title claims description 168
- 238000005810 carbonylation reaction Methods 0.000 title claims description 40
- 230000006315 carbonylation Effects 0.000 title claims description 31
- 125000003118 aryl group Chemical group 0.000 claims abstract description 191
- 239000001257 hydrogen Substances 0.000 claims abstract description 180
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 180
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 141
- 125000001424 substituent group Chemical group 0.000 claims abstract description 134
- 239000003446 ligand Substances 0.000 claims abstract description 114
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 85
- 239000011574 phosphorus Substances 0.000 claims abstract description 79
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 76
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims abstract description 68
- 125000005843 halogen group Chemical group 0.000 claims abstract description 60
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 57
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 48
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 43
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 37
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims abstract description 35
- 150000004696 coordination complex Chemical class 0.000 claims abstract description 26
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims abstract description 25
- 101000869592 Daucus carota Major allergen Dau c 1 Proteins 0.000 claims abstract description 18
- 101000650136 Homo sapiens WAS/WASL-interacting protein family member 3 Proteins 0.000 claims abstract description 18
- 102100027539 WAS/WASL-interacting protein family member 3 Human genes 0.000 claims abstract description 18
- 229910052785 arsenic Inorganic materials 0.000 claims abstract description 12
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims abstract description 12
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 11
- 230000003647 oxidation Effects 0.000 claims abstract description 9
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 9
- 125000004437 phosphorous atom Chemical group 0.000 claims abstract description 9
- 229910052787 antimony Inorganic materials 0.000 claims abstract description 8
- 125000006832 (C1-C10) alkylene group Chemical group 0.000 claims abstract 6
- -1 nitro, amino Chemical group 0.000 claims description 671
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 331
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 claims description 186
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 134
- 125000000217 alkyl group Chemical group 0.000 claims description 131
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 claims description 109
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 105
- 125000004122 cyclic group Chemical group 0.000 claims description 91
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 88
- 239000003054 catalyst Substances 0.000 claims description 78
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims description 77
- 238000006243 chemical reaction Methods 0.000 claims description 76
- 125000004429 atom Chemical group 0.000 claims description 57
- 238000000034 method Methods 0.000 claims description 50
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 50
- 125000005842 heteroatom Chemical group 0.000 claims description 44
- 229910052760 oxygen Inorganic materials 0.000 claims description 44
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 43
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 41
- 239000001301 oxygen Substances 0.000 claims description 41
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 34
- 230000008569 process Effects 0.000 claims description 32
- 229910052799 carbon Inorganic materials 0.000 claims description 31
- 239000002904 solvent Substances 0.000 claims description 31
- 239000000203 mixture Chemical group 0.000 claims description 30
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 claims description 29
- 229910052717 sulfur Inorganic materials 0.000 claims description 28
- 101100478290 Arabidopsis thaliana SR30 gene Proteins 0.000 claims description 27
- IHOMKOPTBSYOCI-UHFFFAOYSA-N [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 Chemical compound [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 IHOMKOPTBSYOCI-UHFFFAOYSA-N 0.000 claims description 27
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 26
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 24
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 23
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 23
- 239000011593 sulfur Substances 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- 229910052763 palladium Inorganic materials 0.000 claims description 22
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 20
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 19
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical group OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 14
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 14
- 150000001768 cations Chemical class 0.000 claims description 11
- 230000000536 complexating effect Effects 0.000 claims description 10
- 125000002950 monocyclic group Chemical group 0.000 claims description 10
- KXFSUVJPEQYUGN-UHFFFAOYSA-N trimethyl(phenyl)silane Chemical compound C[Si](C)(C)C1=CC=CC=C1 KXFSUVJPEQYUGN-UHFFFAOYSA-N 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- POXXGNVHGDHFGT-UHFFFAOYSA-N ditert-butyl-[(3,4-dimethylcyclohexyl)methyl]phosphane Chemical compound CC1CCC(CP(C(C)(C)C)C(C)(C)C)CC1C POXXGNVHGDHFGT-UHFFFAOYSA-N 0.000 claims description 7
- SFCNPIUDAIFHRD-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C(C)(C)C)C(C)(C)C SFCNPIUDAIFHRD-UHFFFAOYSA-N 0.000 claims description 7
- 229910052707 ruthenium Inorganic materials 0.000 claims description 7
- 125000002619 bicyclic group Chemical group 0.000 claims description 6
- 125000004043 oxo group Chemical group O=* 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 5
- AQOJILMNQXLXLR-UHFFFAOYSA-N ditert-butyl(cyclohexylmethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1CCCCC1 AQOJILMNQXLXLR-UHFFFAOYSA-N 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 239000010970 precious metal Substances 0.000 claims description 4
- QVGGXACWBDGASS-UHFFFAOYSA-N (8-cyclobutyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)C1CCC1 QVGGXACWBDGASS-UHFFFAOYSA-N 0.000 claims description 3
- ZJDNAQRUUYRJLW-UHFFFAOYSA-N 2,2,6,6-tetramethylphosphinan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)P1 ZJDNAQRUUYRJLW-UHFFFAOYSA-N 0.000 claims description 3
- MALIONKMKPITBV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-n-[2-(4-sulfamoylphenyl)ethyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)CC1=CC=C(O)C(Cl)=C1 MALIONKMKPITBV-UHFFFAOYSA-N 0.000 claims description 3
- SYNUGNZEUDMWOZ-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C(C)(C)C)C(C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C(C)(C)C)C(C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] SYNUGNZEUDMWOZ-UHFFFAOYSA-N 0.000 claims description 3
- AVDAJJAPPAYZJH-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] AVDAJJAPPAYZJH-UHFFFAOYSA-N 0.000 claims description 3
- 150000001204 N-oxides Chemical class 0.000 claims description 3
- STZDKJBOBKDXIP-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 STZDKJBOBKDXIP-UHFFFAOYSA-N 0.000 claims description 3
- YLGURJYLNZINMJ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4-trimethylsilylphenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=CC=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 YLGURJYLNZINMJ-UHFFFAOYSA-N 0.000 claims description 3
- SZBXVUKSDKXGMQ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[4-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=C1)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=C1C1=CC=CC=C1 SZBXVUKSDKXGMQ-UHFFFAOYSA-N 0.000 claims description 3
- KNJLLVULIPAWDX-UHFFFAOYSA-N [1-(1-adamantyl)-1-[2-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13C(P)(C(C)(C)C)C1=CC=CC=C1C(P)(C(C)(C)C)C1(C2)CC(C3)CC2CC3C1 KNJLLVULIPAWDX-UHFFFAOYSA-N 0.000 claims description 3
- AZIOGQFFAQETOW-UHFFFAOYSA-N [2,3-bis[(dimethylamino)methyl]cyclopenta-2,4-dien-1-yl]methanol cyclopenta-1,3-diene iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1cc[c-](CO)c1CN(C)C AZIOGQFFAQETOW-UHFFFAOYSA-N 0.000 claims description 3
- SVNWCLLUWXQARZ-UHFFFAOYSA-N [8-(3,4-dimethylcyclohexyl)-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)C2CCC(C(C2)C)C SVNWCLLUWXQARZ-UHFFFAOYSA-N 0.000 claims description 3
- CYMDWWDRVMMQQW-UHFFFAOYSA-N [8-[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=CC=1C=2C=CC=CC=2)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=1C1=CC=CC=C1 CYMDWWDRVMMQQW-UHFFFAOYSA-N 0.000 claims description 3
- FKUMADLCVKODJS-UHFFFAOYSA-N [8-[4-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC=C(C(C)(C)C)C=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 FKUMADLCVKODJS-UHFFFAOYSA-N 0.000 claims description 3
- ATDZUAIRDWAAIK-UHFFFAOYSA-N bis(1-adamantyl)-(cyclopentylmethyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1CCCC1 ATDZUAIRDWAAIK-UHFFFAOYSA-N 0.000 claims description 3
- WIKALRBJIOGSOK-UHFFFAOYSA-N bis(1-adamantyl)-[(2-methylcyclopentyl)methyl]phosphane Chemical compound CC1CCCC1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 WIKALRBJIOGSOK-UHFFFAOYSA-N 0.000 claims description 3
- MSDVMYUDNKFOAL-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C=C([Si](C)(C)C)C([Si](C)(C)C)=C1 MSDVMYUDNKFOAL-UHFFFAOYSA-N 0.000 claims description 3
- IYJFKBUCDIHNLX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-diphenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=CC=1C=2C=CC=CC=2)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=1C1=CC=CC=C1 IYJFKBUCDIHNLX-UHFFFAOYSA-N 0.000 claims description 3
- VGMQJPJIWFUDDR-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-phenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=C1)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=C1C1=CC=CC=C1 VGMQJPJIWFUDDR-UHFFFAOYSA-N 0.000 claims description 3
- OVKHDTCOBBKQRP-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-tert-butylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC(C(C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OVKHDTCOBBKQRP-UHFFFAOYSA-N 0.000 claims description 3
- LIODACAQSUGIIZ-UHFFFAOYSA-N cyclopenta-1,3-diene 1-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-N,N-dimethylmethanamine iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1ccc[c-]1CN(C)C LIODACAQSUGIIZ-UHFFFAOYSA-N 0.000 claims description 3
- OQIMOMVGMYGXKU-UHFFFAOYSA-N cyclopenta-1,3-diene [2-[(dimethylamino)methyl]cyclopenta-1,4-dien-1-yl]methanol iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1ccc[c-]1CO OQIMOMVGMYGXKU-UHFFFAOYSA-N 0.000 claims description 3
- AKJCIXVJQZAAGQ-UHFFFAOYSA-N cyclopenta-1,3-diene dicyclopentyl-[[2-(dicyclopentylphosphanylmethyl)cyclopenta-1,3-dien-1-yl]methyl]phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.C(P(C1CCCC1)C1CCCC1)c1ccc[c-]1CP(C1CCCC1)C1CCCC1 AKJCIXVJQZAAGQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- XXXRLBZTWLBYKW-UHFFFAOYSA-N ditert-butyl(cyclobutylmethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1CCC1 XXXRLBZTWLBYKW-UHFFFAOYSA-N 0.000 claims description 3
- CERHABBTKCVBDQ-UHFFFAOYSA-N ditert-butyl-[(2-methylcyclopentyl)methyl]phosphane Chemical compound CC1CCCC1CP(C(C)(C)C)C(C)(C)C CERHABBTKCVBDQ-UHFFFAOYSA-N 0.000 claims description 3
- RRCKGYDVQRIBDJ-UHFFFAOYSA-N ditert-butyl-[(4-trimethylsilylphenyl)methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C([Si](C)(C)C)C=C1 RRCKGYDVQRIBDJ-UHFFFAOYSA-N 0.000 claims description 3
- RFHJIKLLDUYFCV-UHFFFAOYSA-N ditert-butyl-[[1-(ditert-butylphosphanylmethyl)naphthalen-2-yl]methyl]phosphane Chemical compound C1=CC=CC2=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C21 RFHJIKLLDUYFCV-UHFFFAOYSA-N 0.000 claims description 3
- CXXSPEBWUCMZDG-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C CXXSPEBWUCMZDG-UHFFFAOYSA-N 0.000 claims description 3
- XGTLLXBATZZBDJ-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4,5-diphenylphenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 XGTLLXBATZZBDJ-UHFFFAOYSA-N 0.000 claims description 3
- NVTBDFSZGFVFTF-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4-trimethylsilylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C([Si](C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C NVTBDFSZGFVFTF-UHFFFAOYSA-N 0.000 claims description 3
- WZZIVGQZIQKWLE-UHFFFAOYSA-N ditert-butyl-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-5-trimethylsilylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=CC=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 WZZIVGQZIQKWLE-UHFFFAOYSA-N 0.000 claims description 3
- MWGNUOVYRKMMRJ-UHFFFAOYSA-N ditert-butyl-[[4,5-ditert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC(C(C)(C)C)=C(C(C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C MWGNUOVYRKMMRJ-UHFFFAOYSA-N 0.000 claims description 3
- CJRKTQKOGOVYTO-UHFFFAOYSA-N ditert-butyl-[[4-tert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C(C(C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C CJRKTQKOGOVYTO-UHFFFAOYSA-N 0.000 claims description 3
- HBFGAXXFXLINQU-UHFFFAOYSA-N ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound C=1C=C(C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 HBFGAXXFXLINQU-UHFFFAOYSA-N 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- KYMNSBSWJPFUJH-UHFFFAOYSA-N iron;5-methylcyclopenta-1,3-diene;methylcyclopentane Chemical compound [Fe].C[C-]1C=CC=C1.C[C-]1[CH-][CH-][CH-][CH-]1 KYMNSBSWJPFUJH-UHFFFAOYSA-N 0.000 claims description 3
- 229910052762 osmium Inorganic materials 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- LEMKEQRUQBPKIS-UHFFFAOYSA-N C(C)(C)(CC)C(C1=C(C=CC=C1)C(P(=O)=O)(C(C)(C)CC)C(C)(C)CC)(P(=O)=O)C(C)(C)CC Chemical compound C(C)(C)(CC)C(C1=C(C=CC=C1)C(P(=O)=O)(C(C)(C)CC)C(C)(C)CC)(P(=O)=O)C(C)(C)CC LEMKEQRUQBPKIS-UHFFFAOYSA-N 0.000 claims description 2
- IYLXXNMTVQJTAO-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)CP(C(C)(C)C)C(C)(C)C.[CH-]2C=CC=C2.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)CP(C(C)(C)C)C(C)(C)C.[CH-]2C=CC=C2.[Fe+2] IYLXXNMTVQJTAO-UHFFFAOYSA-N 0.000 claims description 2
- XNQIQPPWJDKFPC-UHFFFAOYSA-N [2-[bis(2-methylpropyl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylpropyl)phosphane cyclopenta-1,3-diene iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CC(C)CP(CC(C)C)Cc1ccc[c-]1CP(CC(C)C)CC(C)C XNQIQPPWJDKFPC-UHFFFAOYSA-N 0.000 claims description 2
- BEORHZNAKPLIOL-UHFFFAOYSA-N bis(1-adamantyl)-[(3,4-dimethylcyclohexyl)methyl]phosphane Chemical compound C1C(C)C(C)CCC1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 BEORHZNAKPLIOL-UHFFFAOYSA-N 0.000 claims description 2
- VAPRXBBLNZKHAQ-UHFFFAOYSA-N cyclopenta-1,3-diene [2-[di(propan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-di(propan-2-yl)phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CC(C)P(Cc1ccc[c-]1CP(C(C)C)C(C)C)C(C)C VAPRXBBLNZKHAQ-UHFFFAOYSA-N 0.000 claims description 2
- YTGPMAJRVUHSAF-UHFFFAOYSA-N ditert-butyl-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 YTGPMAJRVUHSAF-UHFFFAOYSA-N 0.000 claims description 2
- 125000005647 linker group Chemical group 0.000 claims description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 2
- DOUYOVFHQKVSSJ-UHFFFAOYSA-N [Fe].c1cccc1.CC(C)(C)c1cccc1 Chemical compound [Fe].c1cccc1.CC(C)(C)c1cccc1 DOUYOVFHQKVSSJ-UHFFFAOYSA-N 0.000 claims 23
- HULDRXBPSOJSRJ-UHFFFAOYSA-N (8-cyclohexyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C1CCCCC1 HULDRXBPSOJSRJ-UHFFFAOYSA-N 0.000 claims 2
- HGECZKSVSWGGQQ-UHFFFAOYSA-N (8-cyclopentyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C1CCCC1 HGECZKSVSWGGQQ-UHFFFAOYSA-N 0.000 claims 2
- GMBMVDAIJGKWEY-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] GMBMVDAIJGKWEY-UHFFFAOYSA-N 0.000 claims 2
- KCEISFWCCWODBQ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-(2-methylcyclopentyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound CC1CCCC1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 KCEISFWCCWODBQ-UHFFFAOYSA-N 0.000 claims 2
- ZTHCUOODJOPAKX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 ZTHCUOODJOPAKX-UHFFFAOYSA-N 0.000 claims 2
- JQIYDJKEVNWZJU-UHFFFAOYSA-N ditert-butyl(cyclopentylmethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1CCCC1 JQIYDJKEVNWZJU-UHFFFAOYSA-N 0.000 claims 2
- CADVYTVWWILZML-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4-phenylphenyl]methyl]phosphane Chemical compound C1=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 CADVYTVWWILZML-UHFFFAOYSA-N 0.000 claims 2
- FNVYFXOMLKSSFK-UHFFFAOYSA-N ditert-butyl-[[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 FNVYFXOMLKSSFK-UHFFFAOYSA-N 0.000 claims 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 2
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 claims 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 claims 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 claims 1
- QIILBXCUXXUTHA-UHFFFAOYSA-N cyclopenta-2,4-dien-1-ylbenzene;iron(2+) Chemical compound [Fe+2].C1=C[CH-]C(C=2C=CC=CC=2)=C1.C1=C[CH-]C(C=2C=CC=CC=2)=C1 QIILBXCUXXUTHA-UHFFFAOYSA-N 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 88
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 80
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- 150000002431 hydrogen Chemical class 0.000 description 73
- 239000002253 acid Substances 0.000 description 65
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 63
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical group N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 41
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 38
- 239000000243 solution Substances 0.000 description 29
- 239000000047 product Substances 0.000 description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 24
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 23
- 239000003153 chemical reaction reagent Substances 0.000 description 22
- 239000007789 gas Substances 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 20
- 229940017219 methyl propionate Drugs 0.000 description 20
- 125000005037 alkyl phenyl group Chemical group 0.000 description 19
- 125000002947 alkylene group Chemical group 0.000 description 19
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 18
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 17
- 150000007513 acids Chemical class 0.000 description 17
- 239000002270 dispersing agent Substances 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 16
- NCTHHJRIJGFPTG-UHFFFAOYSA-N 6,7-bis(aziridin-1-yl)-4-[7-[[6,7-bis(aziridin-1-yl)-5,8-dioxoquinazolin-4-yl]amino]heptylamino]quinazoline-5,8-dione Chemical compound C1CN1C=1C(=O)C2=C(NCCCCCCCNC=3C=4C(=O)C(N5CC5)=C(N5CC5)C(=O)C=4N=CN=3)N=CN=C2C(=O)C=1N1CC1 NCTHHJRIJGFPTG-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 15
- 125000002015 acyclic group Chemical group 0.000 description 14
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 14
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 14
- 239000012429 reaction media Substances 0.000 description 14
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 13
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 12
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000010 aprotic solvent Substances 0.000 description 12
- 150000001721 carbon Chemical group 0.000 description 11
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- 229910000077 silane Inorganic materials 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 125000003342 alkenyl group Chemical group 0.000 description 10
- 229910021529 ammonia Inorganic materials 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 10
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 10
- 239000002245 particle Substances 0.000 description 10
- 238000006467 substitution reaction Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 229940098779 methanesulfonic acid Drugs 0.000 description 9
- 125000003367 polycyclic group Chemical group 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 8
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 229910052710 silicon Inorganic materials 0.000 description 8
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 7
- 150000001336 alkenes Chemical class 0.000 description 7
- 125000000304 alkynyl group Chemical group 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 150000001559 benzoic acids Chemical class 0.000 description 7
- 150000001735 carboxylic acids Chemical class 0.000 description 7
- 239000002923 metal particle Substances 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 125000000732 arylene group Chemical group 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 125000002843 carboxylic acid group Chemical group 0.000 description 6
- 238000010668 complexation reaction Methods 0.000 description 6
- 150000002148 esters Chemical group 0.000 description 6
- 150000002736 metal compounds Chemical class 0.000 description 6
- 150000002739 metals Chemical class 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 5
- MKHUGLZLKVCOGF-UHFFFAOYSA-N 1-[4-[(6-aminoquinolin-4-yl)amino]phenyl]-3-[5-tert-butyl-2-(3-methylphenyl)pyrazol-3-yl]urea Chemical compound CC1=CC=CC(N2C(=CC(=N2)C(C)(C)C)NC(=O)NC=2C=CC(NC=3C4=CC(N)=CC=C4N=CC=3)=CC=2)=C1 MKHUGLZLKVCOGF-UHFFFAOYSA-N 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 239000006184 cosolvent Substances 0.000 description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 150000003003 phosphines Chemical class 0.000 description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 5
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 5
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 125000006413 ring segment Chemical group 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- 125000004434 sulfur atom Chemical group 0.000 description 5
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical class OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 238000004566 IR spectroscopy Methods 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229910006069 SO3H Inorganic materials 0.000 description 4
- 229920002125 Sokalan® Polymers 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- AQBOUNVXZQRXNP-UHFFFAOYSA-L azane;dichloropalladium Chemical compound N.N.N.N.Cl[Pd]Cl AQBOUNVXZQRXNP-UHFFFAOYSA-L 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 238000006555 catalytic reaction Methods 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 238000001640 fractional crystallisation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 4
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- 239000003586 protic polar solvent Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical class CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 125000006841 cyclic skeleton Chemical group 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- UIUWNILCHFBLEQ-NSCUHMNNSA-N trans-pent-3-enoic acid Chemical compound C\C=C\CC(O)=O UIUWNILCHFBLEQ-NSCUHMNNSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- KLOCTYSYSMCKLV-UHFFFAOYSA-N (1,2-ditert-butyl-4,5-diphenylcyclohexyl)methylphosphane Chemical compound C(C)(C)(C)C1C(CC(C(C1)C1=CC=CC=C1)C1=CC=CC=C1)(CP)C(C)(C)C KLOCTYSYSMCKLV-UHFFFAOYSA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 2
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 2
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 2
- 125000004134 1-norbornyl group Chemical group [H]C1([H])C([H])([H])C2(*)C([H])([H])C([H])([H])C1([H])C2([H])[H] 0.000 description 2
- IBXNCJKFFQIKKY-UHFFFAOYSA-N 1-pentyne Chemical group CCCC#C IBXNCJKFFQIKKY-UHFFFAOYSA-N 0.000 description 2
- FFFIRKXTFQCCKJ-UHFFFAOYSA-N 2,4,6-trimethylbenzoic acid Chemical compound CC1=CC(C)=C(C(O)=O)C(C)=C1 FFFIRKXTFQCCKJ-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 2
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 2
- XHQZJYCNDZAGLW-UHFFFAOYSA-N 3-methoxybenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1 XHQZJYCNDZAGLW-UHFFFAOYSA-N 0.000 description 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- OZJPLYNZGCXSJM-UHFFFAOYSA-N 5-valerolactone Chemical compound O=C1CCCCO1 OZJPLYNZGCXSJM-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical group C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical compound COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 2
- 101150005660 PHY1 gene Proteins 0.000 description 2
- 229910018828 PO3H2 Inorganic materials 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical group C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 229930188620 butyrolactone Natural products 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000001311 chemical methods and process Methods 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- SIKVIDQLMSEYTJ-UHFFFAOYSA-N ditert-butyl-[(1,2,4,5-tetramethylcyclohexyl)methyl]phosphane Chemical compound C(C)(C)(C)P(C(C)(C)C)CC1(C(CC(C(C1)C)C)C)C SIKVIDQLMSEYTJ-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002638 heterogeneous catalyst Substances 0.000 description 2
- 125000006038 hexenyl group Chemical group 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000010952 in-situ formation Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000002469 indenes Chemical class 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N meta--hydroxybenzoic acid Chemical class OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- IJXHLVMUNBOGRR-UHFFFAOYSA-N methyl nonanoate Chemical compound CCCCCCCCC(=O)OC IJXHLVMUNBOGRR-UHFFFAOYSA-N 0.000 description 2
- HNBDRPTVWVGKBR-UHFFFAOYSA-N methyl pentanoate Chemical compound CCCCC(=O)OC HNBDRPTVWVGKBR-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 description 2
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 230000003335 steric effect Effects 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical class CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- CKZCWGMQUJZYQK-UHFFFAOYSA-N (2,3-ditert-butyl-6-phenylphenyl)methylphosphane Chemical compound C(C)(C)(C)C1=C(C(=C(C=C1)C1=CC=CC=C1)CP)C(C)(C)C CKZCWGMQUJZYQK-UHFFFAOYSA-N 0.000 description 1
- MUTGBJKUEZFXGO-WDSKDSINSA-N (3as,7as)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@H]21 MUTGBJKUEZFXGO-WDSKDSINSA-N 0.000 description 1
- GGQQNYXPYWCUHG-RMTFUQJTSA-N (3e,6e)-deca-3,6-diene Chemical compound CCC\C=C\C\C=C\CC GGQQNYXPYWCUHG-RMTFUQJTSA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- JPJGNZQDELRZGE-UHFFFAOYSA-N (phenyl-$l^{2}-phosphanyl)benzene Chemical compound C=1C=CC=CC=1[P]C1=CC=CC=C1 JPJGNZQDELRZGE-UHFFFAOYSA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- ZWVMLYRJXORSEP-UHFFFAOYSA-N 1,2,6-Hexanetriol Chemical compound OCCCCC(O)CO ZWVMLYRJXORSEP-UHFFFAOYSA-N 0.000 description 1
- XUZOLQDPDMJAEZ-UHFFFAOYSA-N 1,3,7-triazecane Chemical compound C1CNCCCNCNC1 XUZOLQDPDMJAEZ-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- WQADWIOXOXRPLN-UHFFFAOYSA-N 1,3-dithiane Chemical compound C1CSCSC1 WQADWIOXOXRPLN-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 1
- 150000000094 1,4-dioxanes Chemical class 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- YKPWFBDMFYSXLS-UHFFFAOYSA-N 1H-indene methane Chemical compound C.C1C=CC2=CC=CC=C12 YKPWFBDMFYSXLS-UHFFFAOYSA-N 0.000 description 1
- XTDQDBVBDLYELW-UHFFFAOYSA-N 2,2,3-trimethylpentane Chemical compound CCC(C)C(C)(C)C XTDQDBVBDLYELW-UHFFFAOYSA-N 0.000 description 1
- AOIYTIDHFMNVOO-UHFFFAOYSA-N 2,3,3a,4,5,6-hexahydro-1h-indene Chemical compound C1CCC=C2CCCC21 AOIYTIDHFMNVOO-UHFFFAOYSA-N 0.000 description 1
- LWTIGYSPAXKMDG-UHFFFAOYSA-N 2,3-dihydro-1h-imidazole Chemical compound C1NC=CN1 LWTIGYSPAXKMDG-UHFFFAOYSA-N 0.000 description 1
- GHVMJSHEGZYRQL-UHFFFAOYSA-N 2,4,6-tribromobenzoic acid Chemical class OC(=O)C1=C(Br)C=C(Br)C=C1Br GHVMJSHEGZYRQL-UHFFFAOYSA-N 0.000 description 1
- BKYWPNROPGQIFZ-UHFFFAOYSA-N 2,4-dimethylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(C)=C1 BKYWPNROPGQIFZ-UHFFFAOYSA-N 0.000 description 1
- ONOTYLMNTZNAQZ-UHFFFAOYSA-N 2,6-difluorobenzoic acid Chemical class OC(=O)C1=C(F)C=CC=C1F ONOTYLMNTZNAQZ-UHFFFAOYSA-N 0.000 description 1
- CJMUVMINGJFKIR-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethanol;methoxymethane Chemical compound COC.OCCOCCO CJMUVMINGJFKIR-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- IVEWTCACRDEAOB-UHFFFAOYSA-N 2-(2-methoxyphenyl)acetic acid Chemical compound COC1=CC=CC=C1CC(O)=O IVEWTCACRDEAOB-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- SFRDXVJWXWOTEW-UHFFFAOYSA-N 2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)CO SFRDXVJWXWOTEW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- QCEPIUWMXRQPIF-UHFFFAOYSA-N 2-chloro-6-hydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C=CC=C1Cl QCEPIUWMXRQPIF-UHFFFAOYSA-N 0.000 description 1
- CEFMMQYDPGCYMG-UHFFFAOYSA-N 2-chloro-6-methylbenzoic acid Chemical compound CC1=CC=CC(Cl)=C1C(O)=O CEFMMQYDPGCYMG-UHFFFAOYSA-N 0.000 description 1
- VMSBGXAJJLPWKV-UHFFFAOYSA-N 2-ethenylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=C VMSBGXAJJLPWKV-UHFFFAOYSA-N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-N 2-ethoxybenzoic acid Chemical compound CCOC1=CC=CC=C1C(O)=O XDZMPRGFOOFSBL-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- NIONDZDPPYHYKY-UHFFFAOYSA-N 2-hexenoic acid Chemical class CCCC=CC(O)=O NIONDZDPPYHYKY-UHFFFAOYSA-N 0.000 description 1
- HSXUNHYXJWDLDK-UHFFFAOYSA-N 2-hydroxypropane-1-sulfonic acid Chemical compound CC(O)CS(O)(=O)=O HSXUNHYXJWDLDK-UHFFFAOYSA-N 0.000 description 1
- XCJGLBWDZKLQCY-UHFFFAOYSA-N 2-methylpropane-2-sulfonic acid Chemical compound CC(C)(C)S(O)(=O)=O XCJGLBWDZKLQCY-UHFFFAOYSA-N 0.000 description 1
- PPDFQRAASCRJAH-UHFFFAOYSA-N 2-methylthiolane 1,1-dioxide Chemical compound CC1CCCS1(=O)=O PPDFQRAASCRJAH-UHFFFAOYSA-N 0.000 description 1
- UOBYKYZJUGYBDK-UHFFFAOYSA-N 2-naphthoic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CC=C21 UOBYKYZJUGYBDK-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 1
- ZDULHUHNYHJYKA-UHFFFAOYSA-N 2-propan-2-ylsulfonylpropane Chemical compound CC(C)S(=O)(=O)C(C)C ZDULHUHNYHJYKA-UHFFFAOYSA-N 0.000 description 1
- OXOWWPXTTOCKKU-UHFFFAOYSA-N 2-propoxybenzoic acid Chemical compound CCCOC1=CC=CC=C1C(O)=O OXOWWPXTTOCKKU-UHFFFAOYSA-N 0.000 description 1
- ZDFKSZDMHJHQHS-UHFFFAOYSA-N 2-tert-butylbenzoic acid Chemical compound CC(C)(C)C1=CC=CC=C1C(O)=O ZDFKSZDMHJHQHS-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- UMVOQQDNEYOJOK-UHFFFAOYSA-N 3,5-dimethylbenzoic acid Chemical compound CC1=CC(C)=CC(C(O)=O)=C1 UMVOQQDNEYOJOK-UHFFFAOYSA-N 0.000 description 1
- NMGODFWGUBLTTA-UHFFFAOYSA-N 3-amino-1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)N(N)C(=O)NC2=C1 NMGODFWGUBLTTA-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- DTFQMPQJMDEWKJ-UHFFFAOYSA-N 3-ethoxybenzoic acid Chemical compound CCOC1=CC=CC(C(O)=O)=C1 DTFQMPQJMDEWKJ-UHFFFAOYSA-N 0.000 description 1
- AFPHTEQTJZKQAQ-UHFFFAOYSA-N 3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1 AFPHTEQTJZKQAQ-UHFFFAOYSA-N 0.000 description 1
- ZMXUPQVAIFGMPS-UHFFFAOYSA-N 3-propoxybenzoic acid Chemical compound CCCOC1=CC=CC(C(O)=O)=C1 ZMXUPQVAIFGMPS-UHFFFAOYSA-N 0.000 description 1
- RRXKRASYPHSAPJ-UHFFFAOYSA-N 3a,4,5,6,7,7a-hexahydro-1h-indene Chemical compound C1CCCC2CC=CC21 RRXKRASYPHSAPJ-UHFFFAOYSA-N 0.000 description 1
- UFERIGCCDYCZLN-UHFFFAOYSA-N 3a,4,7,7a-tetrahydro-1h-indene Chemical compound C1C=CCC2CC=CC21 UFERIGCCDYCZLN-UHFFFAOYSA-N 0.000 description 1
- QSVDFJNXDKTKTJ-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1h-indene Chemical compound C1CCCC2=C1CC=C2 QSVDFJNXDKTKTJ-UHFFFAOYSA-N 0.000 description 1
- PCHMFMSIIFSBTO-UHFFFAOYSA-N 4-[2,3-ditert-butyl-4-(phosphanylmethyl)phenyl]benzoyl chloride Chemical compound CC(C)(C)C1=C(CP)C=CC(C=2C=CC(=CC=2)C(Cl)=O)=C1C(C)(C)C PCHMFMSIIFSBTO-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 1
- ADCUEPOHPCPMCE-UHFFFAOYSA-N 4-cyanobenzoic acid Chemical compound OC(=O)C1=CC=C(C#N)C=C1 ADCUEPOHPCPMCE-UHFFFAOYSA-N 0.000 description 1
- RRZPCBLAZBRYCL-UHFFFAOYSA-N 4-ethyl-2-methylthiolane 1,1-dioxide Chemical compound CCC1CC(C)S(=O)(=O)C1 RRZPCBLAZBRYCL-UHFFFAOYSA-N 0.000 description 1
- KDVYCTOWXSLNNI-UHFFFAOYSA-N 4-t-Butylbenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1 KDVYCTOWXSLNNI-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- WLXNCUWYHHJENK-UHFFFAOYSA-N C(C)(C)(C)C(C1=C(C=C(C=C1)C1=CC(=C(C=C1)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)(P)C(C)(C)C.C1=CC=CC=C1 Chemical compound C(C)(C)(C)C(C1=C(C=C(C=C1)C1=CC(=C(C=C1)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)(P)C(C)(C)C.C1=CC=CC=C1 WLXNCUWYHHJENK-UHFFFAOYSA-N 0.000 description 1
- YYLLCUQPONDAJQ-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.C(C)(C)(C)[C-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.C(C)(C)(C)[C-]1C=CC=C1.[Fe+2] YYLLCUQPONDAJQ-UHFFFAOYSA-N 0.000 description 1
- WHQSNFAZTUWRQI-UHFFFAOYSA-N CC(C)(C)[P]C(C)(C)C Chemical compound CC(C)(C)[P]C(C)(C)C WHQSNFAZTUWRQI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- LKDRXBCSQODPBY-AMVSKUEXSA-N L-(-)-Sorbose Chemical compound OCC1(O)OC[C@H](O)[C@@H](O)[C@@H]1O LKDRXBCSQODPBY-AMVSKUEXSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229910018965 MCl2 Inorganic materials 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 239000012696 Pd precursors Substances 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- YXEAIMWRHUBBOC-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4,5-bis(trimethylsilyl)phenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C YXEAIMWRHUBBOC-UHFFFAOYSA-N 0.000 description 1
- TZVVUBLEXPQJAI-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4-trimethylsilylphenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C TZVVUBLEXPQJAI-UHFFFAOYSA-N 0.000 description 1
- XPLBBAQFWIYEOY-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4-tritert-butylsilylphenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C XPLBBAQFWIYEOY-UHFFFAOYSA-N 0.000 description 1
- OPIZWJDLSMDLIC-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[4-phenyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]pentan-3-yl]phosphane Chemical compound C1=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 OPIZWJDLSMDLIC-UHFFFAOYSA-N 0.000 description 1
- OWLCLSCZKWZNSY-UHFFFAOYSA-N [3,4-bis(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]methylphosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C(CP)C=C1C(P)(C(C)(C)C)C(C)(C)C OWLCLSCZKWZNSY-UHFFFAOYSA-N 0.000 description 1
- UTDVDQSMTUTGHX-UHFFFAOYSA-N [3-[2,5-dimethyl-3,4-diphenyl-6-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound C=1C=CC=CC=1C1=C(C)C(C(P)(C(C)(C)C)C(C)(C)C)=C(C(P)(C(C)(C)C)C(C)(C)C)C(C)=C1C1=CC=CC=C1 UTDVDQSMTUTGHX-UHFFFAOYSA-N 0.000 description 1
- YXKNVDVWBZSDNJ-UHFFFAOYSA-N [3-[2-[2,3-bis(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-6-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=CC(C=2C(=C(C=CC=2)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)=C1C(P)(C(C)(C)C)C(C)(C)C YXKNVDVWBZSDNJ-UHFFFAOYSA-N 0.000 description 1
- SFRIBOXGWOOYSL-UHFFFAOYSA-N [3-[4,5-ditert-butyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C1=CC(C(P)(C(C)(C)C)C(C)(C)C)=C(C(P)(C(C)(C)C)C(C)(C)C)C=C1C(C)(C)C SFRIBOXGWOOYSL-UHFFFAOYSA-N 0.000 description 1
- IKTCEMKIDKMDAH-UHFFFAOYSA-N [3-[4-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C(C(C(C)(C)C)(C(C)(C)C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C IKTCEMKIDKMDAH-UHFFFAOYSA-N 0.000 description 1
- KQTZPQUUATTZJN-UHFFFAOYSA-N [3-[4-[tert-butyl(dimethyl)silyl]-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C)(C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C KQTZPQUUATTZJN-UHFFFAOYSA-N 0.000 description 1
- VPEMLSHVKXWVJN-UHFFFAOYSA-N [3-[4-tert-butyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C1=CC=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=C1 VPEMLSHVKXWVJN-UHFFFAOYSA-N 0.000 description 1
- JFWBIRAGFWPMTI-UHFFFAOYSA-N [Zr].[CH]1C=CC=C1 Chemical compound [Zr].[CH]1C=CC=C1 JFWBIRAGFWPMTI-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical compound N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- LRPDOGHXAWETLI-UHFFFAOYSA-N antimony Chemical group [Sb].[Sb].[Sb].[Sb] LRPDOGHXAWETLI-UHFFFAOYSA-N 0.000 description 1
- 159000000032 aromatic acids Chemical group 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- RPZUBXWEQBPUJR-UHFFFAOYSA-N bicyclo[4.2.0]octane Chemical compound C1CCCC2CCC21 RPZUBXWEQBPUJR-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- APKPODAUXOMPER-UHFFFAOYSA-N bis(1-adamantyl)-[[1-[bis(1-adamantyl)phosphanylmethyl]cyclohexyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)CCCCC1 APKPODAUXOMPER-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000005323 carbonate salts Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- HJZLEGIHUQOJBA-UHFFFAOYSA-N cyclohexane propionic acid Chemical compound OC(=O)CCC1CCCCC1 HJZLEGIHUQOJBA-UHFFFAOYSA-N 0.000 description 1
- OCCBETZKBJOAMB-UHFFFAOYSA-N cyclohexanone;cyclopentanone Chemical class O=C1CCCC1.O=C1CCCCC1 OCCBETZKBJOAMB-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N cyclooctane Chemical compound C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VQJXOEVLGQPXMS-UHFFFAOYSA-N dimethyl hexanedioate methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1.COC(=O)CCCCC(=O)OC VQJXOEVLGQPXMS-UHFFFAOYSA-N 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- FJILYPCZXWVDMD-UHFFFAOYSA-N ditert-butyl(3-ditert-butylphosphanylpropyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CCCP(C(C)(C)C)C(C)(C)C FJILYPCZXWVDMD-UHFFFAOYSA-N 0.000 description 1
- SMCSVOIGWKSUBQ-UHFFFAOYSA-N ditert-butyl-[(2,5-diphenylcyclohexyl)methyl]phosphane Chemical compound C(C)(C)(C)P(C(C)(C)C)CC1CC(CCC1C1=CC=CC=C1)C1=CC=CC=C1 SMCSVOIGWKSUBQ-UHFFFAOYSA-N 0.000 description 1
- CDJVGXLFSWIERS-UHFFFAOYSA-N ditert-butyl-[(3,4-dimethyl-2,5-diphenylcyclohexyl)methyl]phosphane Chemical compound C(C)(C)(C)P(C(C)(C)C)CC1CC(C(C(C1C1=CC=CC=C1)C)C)C1=CC=CC=C1 CDJVGXLFSWIERS-UHFFFAOYSA-N 0.000 description 1
- YZGDASQLFGZFHQ-UHFFFAOYSA-N ditert-butyl-[(3-methylcyclohexyl)methyl]phosphane Chemical compound CC1CCCC(CP(C(C)(C)C)C(C)(C)C)C1 YZGDASQLFGZFHQ-UHFFFAOYSA-N 0.000 description 1
- NBASRKGKDHSQSV-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=C(CP(C(C)(C)C)C(C)(C)C)C(C=2C=CC=CC=2)=CC=C1C1=CC=CC=C1 NBASRKGKDHSQSV-UHFFFAOYSA-N 0.000 description 1
- GASSJTLSIVRDDT-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4,5-dimethyl-3,6-diphenylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC=1C(CP(C(C)(C)C)C(C)(C)C)=C(C=2C=CC=CC=2)C(C)=C(C)C=1C1=CC=CC=C1 GASSJTLSIVRDDT-UHFFFAOYSA-N 0.000 description 1
- JJXBQQDNOWSZPG-UHFFFAOYSA-N ditert-butyl-[[6-(ditert-butylphosphanylmethyl)-1,3-bis(trimethylsilyl)-1,3-dihydro-2-benzofuran-5-yl]methyl]phosphane Chemical compound C1=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC2=C1C([Si](C)(C)C)OC2[Si](C)(C)C JJXBQQDNOWSZPG-UHFFFAOYSA-N 0.000 description 1
- MYRTYDVEIRVNKP-UHFFFAOYSA-N divinylbenzene Substances C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- YURNCBVQZBJDAJ-UHFFFAOYSA-N heptenoic acid group Chemical class C(C=CCCCC)(=O)O YURNCBVQZBJDAJ-UHFFFAOYSA-N 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical class C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910001504 inorganic chloride Inorganic materials 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- KJALUUCEMMPKAC-UHFFFAOYSA-N methyl pent-3-enoate Chemical class COC(=O)CC=CC KJALUUCEMMPKAC-UHFFFAOYSA-N 0.000 description 1
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methylcyclopentane Chemical compound CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000005209 naphthoic acids Chemical class 0.000 description 1
- ZODDGFAZWTZOSI-UHFFFAOYSA-N nitric acid;sulfuric acid Chemical compound O[N+]([O-])=O.OS(O)(=O)=O ZODDGFAZWTZOSI-UHFFFAOYSA-N 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 150000002842 nonanoic acids Chemical class 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical compound OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000005603 pentanoic acids Chemical class 0.000 description 1
- YIYBQIKDCADOSF-UHFFFAOYSA-N pentenoic acid group Chemical class C(C=CCC)(=O)O YIYBQIKDCADOSF-UHFFFAOYSA-N 0.000 description 1
- 125000006194 pentinyl group Chemical group 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 238000011197 physicochemical method Methods 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 108010094020 polyglycine Proteins 0.000 description 1
- 229920000232 polyglycine polymer Polymers 0.000 description 1
- 108010050934 polyleucine Proteins 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 108010087948 polymethionine Proteins 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 108010000222 polyserine Proteins 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000012041 precatalyst Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 229960002429 proline Drugs 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 150000004672 propanoic acids Chemical class 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- ANIDRZQDJXBHHM-UHFFFAOYSA-N pyridin-2-ylphosphane Chemical compound PC1=CC=CC=N1 ANIDRZQDJXBHHM-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 150000003548 thiazolidines Chemical class 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- YIYBQIKDCADOSF-ONEGZZNKSA-N trans-pent-2-enoic acid Chemical compound CC\C=C\C(O)=O YIYBQIKDCADOSF-ONEGZZNKSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- GXQVETCYFIVHCC-UHFFFAOYSA-N trimethyl-(3-trimethylsilyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-1-yl)silane Chemical compound C1CCCC2C([Si](C)(C)C)OC([Si](C)(C)C)C21 GXQVETCYFIVHCC-UHFFFAOYSA-N 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 229960004441 tyrosine Drugs 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F17/00—Metallocenes
- C07F17/02—Metallocenes of metals of Groups 8, 9 or 10 of the Periodic Table
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/36—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates
- C07C67/38—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates by addition to an unsaturated carbon-to-carbon bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
- C07F15/006—Palladium compounds
- C07F15/0066—Palladium compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB0607494 | 2006-04-13 | ||
| GBGB0607494.2A GB0607494D0 (en) | 2006-04-13 | 2006-04-13 | Metal complexes |
| PCT/GB2007/050189 WO2007119079A1 (en) | 2006-04-13 | 2007-04-10 | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2452722T3 true ES2452722T3 (es) | 2014-04-02 |
Family
ID=36571819
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES07733611.3T Active ES2452722T3 (es) | 2006-04-13 | 2007-04-10 | Complejos de metales para uso en la carbonilación de compuestos etilénicamente insaturados |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US8445711B2 (enExample) |
| EP (1) | EP2007703B1 (enExample) |
| JP (1) | JP5583965B2 (enExample) |
| KR (2) | KR101531050B1 (enExample) |
| CN (1) | CN101448773B (enExample) |
| BR (1) | BRPI0710504A2 (enExample) |
| CA (1) | CA2646403C (enExample) |
| ES (1) | ES2452722T3 (enExample) |
| GB (1) | GB0607494D0 (enExample) |
| MY (1) | MY156409A (enExample) |
| RU (1) | RU2470028C2 (enExample) |
| TW (1) | TWI410280B (enExample) |
| WO (1) | WO2007119079A1 (enExample) |
| ZA (1) | ZA200808000B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2007516197A (ja) | 2003-07-03 | 2007-06-21 | ルーサイト インターナショナル ユーケー リミテッド | エチレン性不飽和化合物のヒドロホルミル化方法 |
| GB0403592D0 (en) | 2004-02-18 | 2004-03-24 | Lucite Int Uk Ltd | A catalyst system |
| GB0411951D0 (en) | 2004-05-28 | 2004-06-30 | Lucite Int Uk Ltd | Carbonylation of ester |
| GB0516556D0 (en) * | 2005-08-12 | 2005-09-21 | Lucite Int Uk Ltd | Improved catalyst system |
| AU2006314268C1 (en) | 2005-11-17 | 2014-01-09 | Lucite International Uk Limited | Carbonylation of ethylenically unsaturated compounds |
| GB0607494D0 (en) | 2006-04-13 | 2006-05-24 | Lucite Int Uk Ltd | Metal complexes |
| US9809611B2 (en) * | 2006-12-02 | 2017-11-07 | Lucite International Uk Limited | Carbonylation ligands and their use in the carbonylation of ethylenically unsaturated compounds |
| ATE473991T1 (de) * | 2008-05-07 | 2010-07-15 | Umicore Galvanotechnik Gmbh | Verfahren zur herstellung von komplexen des palladium(hydrogen) carbonats mit aminliganden |
| GB0812297D0 (en) * | 2008-07-04 | 2008-08-13 | Lucite Int Uk Ltd | Novel carbonylation ligand sand thier use of in the carbonylation of ethylenically unsaturated compounds |
| GB201000078D0 (en) * | 2010-01-05 | 2010-02-17 | Lucite Int Uk Ltd | Process for the carbonylation of ethylenically unsaturated compounds, novel carbonylation ligands and catalyst systems incorporatng such ligands |
| US9018387B2 (en) * | 2010-06-11 | 2015-04-28 | Air Products And Chemicals, Inc. | Complexes of imidazole ligands |
| JP6455893B2 (ja) * | 2013-03-11 | 2019-01-23 | ラトガース,ザ ステート ユニバーシティ オブ ニュー ジャージー | 不斉転換のための有機金属の触媒作用 |
| JP2013189715A (ja) * | 2013-06-06 | 2013-09-26 | Umicore Galvanotechnik Gmbh | Pd電解質浴およびPd−Ni電解質浴 |
| CN103450280B (zh) * | 2013-08-14 | 2016-05-18 | 昆明贵金属研究所 | 二水合醋酸四氨合钯(ii)的一步法合成方法 |
| WO2017135897A1 (en) * | 2016-02-02 | 2017-08-10 | Agency For Science, Technology And Research | A catalyst for the carbonylation of alkenes |
| EP3596038B1 (en) | 2017-03-18 | 2022-12-28 | Qatar Foundation for Education, Science and Community Development | Metal-catalyzed alkoxycarbonylation of a lactone |
| EP3606371B1 (en) | 2017-04-04 | 2023-01-04 | Randall Alley | Stretch fastener |
| ES2807542T3 (es) * | 2017-12-21 | 2021-02-23 | Evonik Operations Gmbh | Procedimiento para la hidroxicarbonilación de diisobuteno catalizada con Pd: proporción ácido 3,5,5-trimetilhexanoico/H2O |
| PL3502084T3 (pl) * | 2017-12-21 | 2020-07-13 | Evonik Operations Gmbh | Sposób bezpośredniej przemiany diizobutenu w kwas karboksylowy |
| ES2787299T3 (es) * | 2017-12-21 | 2020-10-15 | Evonik Degussa Gmbh | Proceso para la conversión directa de alquenos en ácidos carboxílicos |
| CN111871461A (zh) * | 2020-04-30 | 2020-11-03 | 杭州师范大学 | 一种海胆状钴基光催化剂及其制备方法 |
| CN115772195A (zh) * | 2021-09-06 | 2023-03-10 | 惠州凯特立斯科技有限公司 | 基于吡啶的膦配体化合物及其应用 |
Family Cites Families (108)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131204A (en) | 1962-02-09 | 1964-04-28 | Grace W R & Co | Novel diquaternary aminophosphonium compounds |
| US3564020A (en) | 1968-07-17 | 1971-02-16 | Union Oil Co | Preparation of angelica lactone |
| US4245115A (en) | 1977-09-14 | 1981-01-13 | Mobil Oil Corporation | Selective carbonylation of olefinically unsaturated hydrocarbons using palladium-arsine or -stibine catalysts |
| US4377708A (en) | 1977-10-14 | 1983-03-22 | Monsanto Company | Hydrocarboxylation of vinyl alkanoates |
| EP0055875B1 (en) | 1981-01-06 | 1986-08-20 | Shell Internationale Researchmaatschappij B.V. | Process for the carbonylation of olefins |
| US4500727A (en) | 1981-03-23 | 1985-02-19 | Kuraray Co., Ltd. | Process for producing methyl lactate |
| US4504684A (en) | 1982-01-06 | 1985-03-12 | The Standard Oil Company | Metal coordination polymers as hydroformylation and hydrogenation catalysts |
| FR2530266B1 (fr) | 1982-07-13 | 1985-07-12 | Comp Generale Electricite | Procede de preparation des acides arylacetiques et arylpropioniques |
| CA1231346A (en) | 1982-09-30 | 1988-01-12 | Eit Drent | Process for the carbonylation of olefinically unsaturated compounds with a palladium catalyst |
| EP0121965B1 (en) | 1983-04-06 | 1989-12-27 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of polyketones |
| CA1247640A (en) | 1983-08-29 | 1988-12-28 | James D. Burrington | Alkoxycarbonylation or carbonylation with co and organic hydroxyl compound |
| NL8403035A (nl) | 1984-10-05 | 1986-05-01 | Shell Int Research | Werkwijze ter bereiding van polyketonen. |
| IN166314B (enExample) | 1985-08-29 | 1990-04-07 | Shell Int Research | |
| GB8531624D0 (en) | 1985-12-23 | 1986-02-05 | Shell Int Research | Carbonylation of ethylenically unsaturated compounds |
| GB8605034D0 (en) | 1986-02-28 | 1986-04-09 | Shell Int Research | Carbonylation of compounds |
| GB2195117B (en) | 1986-09-16 | 1990-10-31 | Agency Ind Science Techn | Process for direct carbonylation of hydrocarbons |
| KR880007426A (ko) | 1986-12-24 | 1988-08-27 | 오노 알버어스 | 팔라듐 촉매를 사용한 올레핀형 불포화 화합물의 카르보닐화 방법 |
| GB8705699D0 (en) | 1987-03-11 | 1987-04-15 | Shell Int Research | Carbonylation of olefinically unsaturated compounds |
| GB8719886D0 (en) | 1987-08-22 | 1987-09-30 | British Petroleum Co Plc | Carboxylic acid esters/acids |
| US4960949A (en) | 1988-12-22 | 1990-10-02 | Eastman Kodak Company | Low pressure rhodium catalyzed hydroformylation of olefins |
| US5158921A (en) | 1989-03-03 | 1992-10-27 | Shell Oil Company | Carbonylation catalyst and process |
| US5099062A (en) | 1989-03-03 | 1992-03-24 | Shell Oil Company | Carbonylation catalyst and process |
| KR0148012B1 (ko) | 1989-03-03 | 1998-08-17 | 오노 알버어스 | 신규한 포스핀으로 구성되는 촉매시스템 및 이를 이용한 아세틸렌형 또는 올레핀형 불포화화합물의 카르보닐화방법 |
| US5103043A (en) | 1989-03-03 | 1992-04-07 | Shell Oil Company | Carbonylation catalyst system |
| US4950703A (en) | 1989-05-15 | 1990-08-21 | Shell Oil Company | Stabilized carbonmonoxide-olefin copolymer compositions |
| GB9014724D0 (en) | 1990-07-03 | 1990-08-22 | Shell Int Research | Process for the preparation of alpha,beta-olefinically unsaturated compounds |
| CA2034971A1 (en) | 1990-02-05 | 1991-08-06 | Eit Drent | Carbonylation catalyst system |
| US5179225A (en) | 1990-02-05 | 1993-01-12 | Shell Oil Company | Carbonylation catalyst system |
| GB9002491D0 (en) | 1990-02-05 | 1990-04-04 | Shell Int Research | Carbonylation catalyst system |
| GB9026211D0 (en) | 1990-12-03 | 1991-01-16 | Shell Int Research | Carbonylation process |
| CA2055628A1 (en) | 1990-12-03 | 1992-06-04 | Eit Drent | Carbonylation process and catalyst composition |
| BE1004336A3 (fr) | 1991-01-15 | 1992-11-03 | Analis Sa | Procede de separation et de quantification de l'hemoglobine glycosylee hb a1c. |
| DE69204691T2 (de) | 1991-01-15 | 1996-04-11 | Shell Int Research | Verfahren zur Karbonylierung von Olefin. |
| GB9105211D0 (en) | 1991-03-12 | 1991-04-24 | Shell Int Research | Process for the preparation of alkanedioic acid derivatives |
| EP0495547B1 (en) * | 1991-01-15 | 1996-04-24 | Shell Internationale Researchmaatschappij B.V. | Carbonylation of olefins |
| AT394735B (de) | 1991-01-16 | 1992-06-10 | Chem Fab Jos Ant Zezi Ges M B | Mittel zum entfernen der oberflaechenschutzschicht fabriksneuer fahrzeuge od. dgl. |
| EP0499329B1 (en) * | 1991-02-15 | 1994-05-04 | Shell Internationale Researchmaatschappij B.V. | Carbonylation catalyst system |
| GB9111583D0 (en) | 1991-05-30 | 1991-07-24 | Shell Int Research | Carbonylation catalyst system |
| US5258546A (en) | 1991-05-30 | 1993-11-02 | Shell Oil Company | Carbonylation catalyst system |
| US5247064A (en) | 1991-08-06 | 1993-09-21 | Shell Oil Company | Polymerization of co/olefin with p bidentate ligand |
| US5245098A (en) | 1992-01-21 | 1993-09-14 | The University Of Akron | Process for preparation of non-conjugated diolefins |
| US5350876A (en) | 1992-06-29 | 1994-09-27 | Shell Oil Company | Carbonylation of conjugated dienes |
| EP0577205B1 (en) | 1992-06-29 | 1997-10-08 | Shell Internationale Researchmaatschappij B.V. | Carbonylation of conjugated dienes |
| US5436356A (en) | 1993-02-09 | 1995-07-25 | Shell Oil Company | Carbonylation process |
| SG42938A1 (en) | 1993-02-26 | 1997-10-17 | Ciba Geigy Ag | Ferrocenc diphosphines as ligands for homogeneous catalysts |
| JP2600112B2 (ja) * | 1994-11-02 | 1997-04-16 | 工業技術院長 | 含ケイ素高分子重合体の製造方法 |
| WO1996016971A1 (de) | 1994-11-29 | 1996-06-06 | Lonza Ag | Verfahren zur herstellung optisch aktiver metallocenylphosphine |
| GB9425911D0 (en) * | 1994-12-22 | 1995-02-22 | Ici Plc | Process for the carbonylation of olefins and catalyst system for use therein |
| US5495041A (en) | 1995-02-22 | 1996-02-27 | Dsm N.W. | Process for the preparation of a pentenoate ester |
| ATE195525T1 (de) | 1995-02-24 | 2000-09-15 | Novartis Ag | Silylierte ferrocenyldiphosphine, an anorganische oder polymere organische träger gebundene silylierte ferrocenyldiphosphine sowie metallkomplexe davon, ihre herstellung und verwendung |
| US5719313A (en) | 1995-03-16 | 1998-02-17 | Shell Oil Company | Carbonylation catalyst system and a process for the carbonylation of acetylenically unsaturated compounds |
| DE69603466T2 (de) | 1995-04-11 | 1999-11-18 | Novartis Ag, Basel | Dihalogenierte ferrocene und verfahren zu deren herstellung |
| US5567856A (en) | 1995-05-30 | 1996-10-22 | Hoechst Celanese Corporation | Synthesis of and hydroformylation with fluoro-substituted bidentate phosphine ligands |
| WO1998001457A1 (en) | 1996-07-10 | 1998-01-15 | Novartis Ag | Functionalized ferrocenyldiphosphines, a process for their preparation and their use |
| US5710344A (en) | 1996-11-08 | 1998-01-20 | E. I. Du Pont De Nemours And Company | Process to prepare a linear aldehyde |
| US6489506B2 (en) | 1997-03-19 | 2002-12-03 | Lucite International Uk Limited | Process for the palladium and phosphine ligand catalyzed carbonylation of ethylene |
| GB9705699D0 (en) | 1997-03-19 | 1997-05-07 | Ici Plc | Process for the carbonylation of ethylene |
| US6156934A (en) | 1997-03-26 | 2000-12-05 | Shell Oil Company | Diphosphines |
| EP0977628B1 (en) | 1997-04-07 | 2001-06-20 | Dsm N.V. | Carbonylation catalyst system |
| US6184391B1 (en) | 1997-04-15 | 2001-02-06 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing epsilon caprolactones and/or hydrates and/or esters thereof |
| DE19721601A1 (de) | 1997-05-23 | 1998-11-26 | Hoechst Ag | Polybetain-stabilisierte, Palladium-haltige Nanopartikel, ein Verfahren zu ihrer Herstellung sowie daraus hergestellte Katalysatoren zur Gewinnung von Vinylacetat |
| GB9717059D0 (en) | 1997-08-13 | 1997-10-15 | Ici Plc | Method of manufacturing phosphine compound |
| DE19745904A1 (de) | 1997-10-17 | 1999-04-22 | Hoechst Ag | Polymerstabilisierte Metallkolloid-Lösungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Katalysatoren für Brennstoffzellen |
| GB9722733D0 (en) | 1997-10-29 | 1998-10-28 | Ici Plc | Production of esters |
| DE19754304A1 (de) | 1997-12-08 | 1999-06-10 | Hoechst Ag | Polybetain-stabilisierte Platin-Nanopartikel, Verfahren zu ihrer Herstellung und Verwendung für Elektrokatalysatoren in Brennstoffzellen |
| EP0967015B1 (de) | 1998-06-19 | 2005-01-12 | Degussa AG | Verwendung von Ferrocenylliganden zur katalytischen enantioselektiven Hydrierung |
| US6337406B1 (en) | 1998-08-21 | 2002-01-08 | The Penn State Research Foundation | Asymmetric catalysis based on chiral phospholanes and hydroxyl phospholanes |
| US5962732A (en) | 1998-12-17 | 1999-10-05 | E. I. Du Pont De Nemours And Company | Process for the preparation of 3-pentenoic acid from butadiene using a nickel catalyst |
| DE19952348A1 (de) | 1998-12-19 | 2000-06-21 | Degussa | Liganden und Komplexe zur enantioselektiven Hydrierung |
| GB9918229D0 (en) | 1999-08-04 | 1999-10-06 | Ici Plc | Improvements relating to metal-compound catalysed processes |
| CA2385421C (en) | 1999-09-20 | 2009-12-15 | The Penn State Research Foundation | Chiral phosphines, transition metal complexes thereof and uses thereof in asymmetric reactions |
| US6258979B1 (en) | 1999-11-22 | 2001-07-10 | Henri Kagan | Chiral ferrocene phosphines active in asymmetric catalysis |
| US6743911B2 (en) | 2000-03-14 | 2004-06-01 | Shell Oil Company | Process for the carbonylation of pentenenitrile |
| US6706912B2 (en) | 2000-03-14 | 2004-03-16 | Shell Oil Company | Process for the carbonylation of ethylenically unsaturated compounds |
| TWI266760B (en) | 2000-03-20 | 2006-11-21 | Kvaerner Process Tech Ltd | Process for the preparation of propane-1,3-diol |
| DE10023470A1 (de) | 2000-05-12 | 2001-11-15 | Basf Ag | Verfahren zur Herstellung von Aldehyden |
| MY127093A (en) | 2000-05-17 | 2006-11-30 | Lucite Int Uk Ltd | Bidentate ligands useful in catalyst systems |
| DE10037961A1 (de) | 2000-07-27 | 2002-02-07 | Aventis Res & Tech Gmbh & Co | Neue Phosphanliganden, deren Herstellung und ihre Verwendung in katalytischen Reaktionen |
| DE10048874A1 (de) | 2000-09-29 | 2002-04-11 | Basf Ag | Katalysatorsystem und Verfahren zur Carbonylierung |
| DE10060313A1 (de) | 2000-12-04 | 2002-06-13 | Basf Ag | Verfahren zur Carbonylierung von Pentensäure und deren Derivate |
| DE60127446T2 (de) | 2000-12-11 | 2007-11-29 | Invista Technologies S.A.R.L., Wilmington | Verfahren zur herstellung von 5-cyanovaleriansäure oder adipinsäure |
| DE10228293A1 (de) | 2001-07-28 | 2003-02-13 | Basf Ag | Verfahren zur Herstellung von Dialkylketonen |
| US20030105348A1 (en) | 2001-11-19 | 2003-06-05 | Bunel Emilio E. | Process for making 5-cyanovaleric acid, adipic acid or dimethyl adipate |
| CN100516017C (zh) | 2002-02-19 | 2009-07-22 | 国际壳牌研究有限公司 | 使烯键式不饱和化合物羰基化的方法以及用于该方法的催化剂 |
| TWI301481B (en) | 2002-08-10 | 2008-10-01 | Lucite Int Uk Ltd | A catalyst system |
| GB0228018D0 (en) | 2002-11-30 | 2003-01-08 | Lucite Int Uk Ltd | Carbonylation of ester |
| GB0218613D0 (en) | 2002-08-10 | 2002-09-18 | Lucite Int Uk Ltd | Process for the carbonylation of ethylenically unsaturated compounds |
| US20040115475A1 (en) | 2002-08-14 | 2004-06-17 | Matsushita Electric Industrial Co., Ltd. | Aromatic methylidene compound, methylstyrul compound for producing the same, production electroluminescent element |
| CA2498293C (en) * | 2002-09-12 | 2012-05-22 | Lucite International Uk Limited | Catalyst system comprising chelating ligand and group viiib metal |
| AU2003269119B2 (en) | 2002-09-12 | 2009-06-18 | Lucite International Uk Limited | A catalyst system comprising a metallocene ligand |
| CA2500095C (en) | 2002-09-26 | 2011-10-18 | Shell Internationale Research Maatschappij B.V. | Process for the hydroformylation of an ethylenically unsaturated compound |
| WO2004072088A2 (en) * | 2003-02-14 | 2004-08-26 | Takasago International Corporation | Phosphine compound, intermediate, palladium-complex, and use thereof |
| US20060235241A1 (en) | 2003-05-22 | 2006-10-19 | Eit Drent | Process for the carbonylation of a conuugated diene |
| JP2007516197A (ja) | 2003-07-03 | 2007-06-21 | ルーサイト インターナショナル ユーケー リミテッド | エチレン性不飽和化合物のヒドロホルミル化方法 |
| GB0403592D0 (en) * | 2004-02-18 | 2004-03-24 | Lucite Int Uk Ltd | A catalyst system |
| CA2557362A1 (en) | 2004-02-26 | 2005-09-09 | Shell Internationale Research Maatschappij B.V. | Process for the carbonylation of ethylenically or acetylenically unsaturated compounds |
| GB0411951D0 (en) * | 2004-05-28 | 2004-06-30 | Lucite Int Uk Ltd | Carbonylation of ester |
| SE527991C2 (sv) | 2004-12-07 | 2006-08-01 | Glow Ab | Vattenrenare med UV-lampa och filter samt demonterbara delar |
| WO2006084892A2 (en) | 2005-02-11 | 2006-08-17 | Shell Internationale Research Maatschappij B.V. | Process for the preparation of a dicarboxylic acid |
| TW200633972A (en) | 2005-02-11 | 2006-10-01 | Shell Int Research | Process for the carbonylation of a conjugated diene |
| GB0516556D0 (en) | 2005-08-12 | 2005-09-21 | Lucite Int Uk Ltd | Improved catalyst system |
| AU2006314268C1 (en) | 2005-11-17 | 2014-01-09 | Lucite International Uk Limited | Carbonylation of ethylenically unsaturated compounds |
| CN101437808A (zh) | 2006-03-21 | 2009-05-20 | 耶鲁大学 | 由芳香化合物与氨或金属酰胺反应合成芳基胺的方法 |
| GB0607494D0 (en) | 2006-04-13 | 2006-05-24 | Lucite Int Uk Ltd | Metal complexes |
| GB2437250C (en) | 2006-04-18 | 2012-08-15 | Iti Scotland Ltd | Method and system for monitoring the condition of livestock |
| GB0625518D0 (en) | 2006-12-21 | 2007-01-31 | Lucite Int Uk Ltd | Carbonylation of conjugated dienes |
| TWI473785B (zh) | 2007-06-01 | 2015-02-21 | Bp Chem Int Ltd | 使用金屬螯配位體催化劑用於醋酸之生產的羰基化方法 |
| GB0713624D0 (en) | 2007-07-13 | 2007-08-22 | Lucite Int Uk Ltd | Improved solvent for catalyst system |
-
2006
- 2006-04-13 GB GBGB0607494.2A patent/GB0607494D0/en not_active Ceased
-
2007
- 2007-04-10 BR BRPI0710504-5A patent/BRPI0710504A2/pt not_active Application Discontinuation
- 2007-04-10 KR KR1020087027731A patent/KR101531050B1/ko not_active Expired - Fee Related
- 2007-04-10 RU RU2008144698/04A patent/RU2470028C2/ru not_active IP Right Cessation
- 2007-04-10 US US12/297,023 patent/US8445711B2/en not_active Expired - Fee Related
- 2007-04-10 MY MYPI20084063A patent/MY156409A/en unknown
- 2007-04-10 KR KR1020147009404A patent/KR20140070592A/ko not_active Ceased
- 2007-04-10 JP JP2009504833A patent/JP5583965B2/ja not_active Expired - Fee Related
- 2007-04-10 EP EP07733611.3A patent/EP2007703B1/en not_active Not-in-force
- 2007-04-10 CN CN200780018436.1A patent/CN101448773B/zh not_active Expired - Fee Related
- 2007-04-10 CA CA2646403A patent/CA2646403C/en not_active Expired - Fee Related
- 2007-04-10 ES ES07733611.3T patent/ES2452722T3/es active Active
- 2007-04-10 WO PCT/GB2007/050189 patent/WO2007119079A1/en not_active Ceased
- 2007-04-13 TW TW096113047A patent/TWI410280B/zh not_active IP Right Cessation
-
2008
- 2008-09-17 ZA ZA200808000A patent/ZA200808000B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US20090312561A1 (en) | 2009-12-17 |
| TW200744756A (en) | 2007-12-16 |
| KR20090009860A (ko) | 2009-01-23 |
| KR101531050B1 (ko) | 2015-06-23 |
| CA2646403A1 (en) | 2007-10-25 |
| CN101448773A (zh) | 2009-06-03 |
| CA2646403C (en) | 2014-11-18 |
| EP2007703B1 (en) | 2013-12-18 |
| JP5583965B2 (ja) | 2014-09-03 |
| TWI410280B (zh) | 2013-10-01 |
| BRPI0710504A2 (pt) | 2012-06-05 |
| RU2470028C2 (ru) | 2012-12-20 |
| US8445711B2 (en) | 2013-05-21 |
| ZA200808000B (en) | 2009-12-30 |
| GB0607494D0 (en) | 2006-05-24 |
| CN101448773B (zh) | 2015-02-11 |
| KR20140070592A (ko) | 2014-06-10 |
| JP2009533409A (ja) | 2009-09-17 |
| RU2008144698A (ru) | 2010-05-20 |
| AU2007238407A1 (en) | 2007-10-25 |
| WO2007119079A1 (en) | 2007-10-25 |
| MY156409A (en) | 2016-02-26 |
| EP2007703A1 (en) | 2008-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2452722T3 (es) | Complejos de metales para uso en la carbonilación de compuestos etilénicamente insaturados | |
| JP7116127B2 (ja) | エチレン性不飽和化合物のカルボニル化方法、新規なカルボニル化配位子およびこのような配位子を組み込んだ触媒系 | |
| JP2015110608A (ja) | エチレン性不飽和化合物のカルボニル化 | |
| US9809611B2 (en) | Carbonylation ligands and their use in the carbonylation of ethylenically unsaturated compounds | |
| KR20100057607A (ko) | 에틸렌성 불포화 화합물의 카르보닐화를 위한 방법 및 촉매 시스템 | |
| ES2742329T3 (es) | Un procedimiento continuo de carbonilación de etileno | |
| US20100022799A1 (en) | Carbonylation of conjugated dienes | |
| CN102740972B (zh) | 改进的羰基化工艺 | |
| AU2007238407B2 (en) | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds |