CA2646403C - Metal complexes for use in the carbonylation of ethylenically unsaturated compounds - Google Patents
Metal complexes for use in the carbonylation of ethylenically unsaturated compounds Download PDFInfo
- Publication number
- CA2646403C CA2646403C CA2646403A CA2646403A CA2646403C CA 2646403 C CA2646403 C CA 2646403C CA 2646403 A CA2646403 A CA 2646403A CA 2646403 A CA2646403 A CA 2646403A CA 2646403 C CA2646403 C CA 2646403C
- Authority
- CA
- Canada
- Prior art keywords
- bis
- phosphinomethyl
- butylphosphinomethyl
- trioxatricyclo
- adamantyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 173
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 115
- 239000002184 metal Substances 0.000 title claims abstract description 115
- 238000005810 carbonylation reaction Methods 0.000 title claims description 40
- 230000006315 carbonylation Effects 0.000 title claims description 30
- -1 HCO3- Chemical group 0.000 claims abstract description 257
- 239000003446 ligand Substances 0.000 claims abstract description 118
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims abstract description 80
- 125000005843 halogen group Chemical group 0.000 claims abstract description 58
- 238000000034 method Methods 0.000 claims abstract description 56
- 230000008569 process Effects 0.000 claims abstract description 42
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims abstract description 41
- 150000004696 coordination complex Chemical class 0.000 claims abstract description 31
- 238000002360 preparation method Methods 0.000 claims abstract description 15
- 230000000536 complexating effect Effects 0.000 claims abstract description 11
- 230000003647 oxidation Effects 0.000 claims abstract description 10
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 453
- 125000003118 aryl group Chemical group 0.000 claims description 177
- 239000001257 hydrogen Substances 0.000 claims description 170
- 229910052739 hydrogen Inorganic materials 0.000 claims description 170
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 claims description 166
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 157
- 125000000217 alkyl group Chemical group 0.000 claims description 156
- 125000001424 substituent group Chemical group 0.000 claims description 131
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 claims description 109
- 229910052698 phosphorus Inorganic materials 0.000 claims description 107
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 88
- 125000004122 cyclic group Chemical group 0.000 claims description 88
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 86
- 150000002431 hydrogen Chemical class 0.000 claims description 82
- 239000003054 catalyst Substances 0.000 claims description 80
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims description 80
- 238000006243 chemical reaction Methods 0.000 claims description 78
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 67
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 60
- 125000004432 carbon atom Chemical group C* 0.000 claims description 55
- 125000004429 atom Chemical group 0.000 claims description 54
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 51
- 239000011574 phosphorus Substances 0.000 claims description 51
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 44
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 41
- 239000001301 oxygen Substances 0.000 claims description 41
- 229910052760 oxygen Inorganic materials 0.000 claims description 41
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 40
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 39
- IHOMKOPTBSYOCI-UHFFFAOYSA-N [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 Chemical compound [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 IHOMKOPTBSYOCI-UHFFFAOYSA-N 0.000 claims description 36
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 claims description 35
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 35
- DOUYOVFHQKVSSJ-UHFFFAOYSA-N [Fe].c1cccc1.CC(C)(C)c1cccc1 Chemical compound [Fe].c1cccc1.CC(C)(C)c1cccc1 DOUYOVFHQKVSSJ-UHFFFAOYSA-N 0.000 claims description 34
- 229910052799 carbon Inorganic materials 0.000 claims description 32
- 229910052763 palladium Inorganic materials 0.000 claims description 32
- 239000002904 solvent Substances 0.000 claims description 30
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 27
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 27
- 239000004305 biphenyl Substances 0.000 claims description 26
- 125000002947 alkylene group Chemical group 0.000 claims description 25
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 24
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 22
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 19
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 16
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 12
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 12
- 125000003107 substituted aryl group Chemical group 0.000 claims description 12
- 229910052785 arsenic Inorganic materials 0.000 claims description 11
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 11
- 150000001768 cations Chemical class 0.000 claims description 11
- QEGNUYASOUJEHD-UHFFFAOYSA-N gem-dimethylcyclohexane Natural products CC1(C)CCCCC1 QEGNUYASOUJEHD-UHFFFAOYSA-N 0.000 claims description 11
- 101100478290 Arabidopsis thaliana SR30 gene Proteins 0.000 claims description 10
- HEIVQJRWTUOXSX-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] HEIVQJRWTUOXSX-UHFFFAOYSA-N 0.000 claims description 10
- 101000869592 Daucus carota Major allergen Dau c 1 Proteins 0.000 claims description 10
- 101000650136 Homo sapiens WAS/WASL-interacting protein family member 3 Proteins 0.000 claims description 10
- 102100027539 WAS/WASL-interacting protein family member 3 Human genes 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- SFCNPIUDAIFHRD-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C(C)(C)C)C(C)(C)C SFCNPIUDAIFHRD-UHFFFAOYSA-N 0.000 claims description 8
- 125000004437 phosphorous atom Chemical group 0.000 claims description 8
- 229910052787 antimony Inorganic materials 0.000 claims description 7
- 229910052707 ruthenium Inorganic materials 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- 125000005647 linker group Chemical group 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 239000010970 precious metal Substances 0.000 claims description 5
- CJRKTQKOGOVYTO-UHFFFAOYSA-N ditert-butyl-[[4-tert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C(C(C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C CJRKTQKOGOVYTO-UHFFFAOYSA-N 0.000 claims description 4
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 4
- LMIZIUOAKLGJMK-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=C(C=C1)CP(C(C)(C)C)C(C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=C(C=C1)CP(C(C)(C)C)C(C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] LMIZIUOAKLGJMK-UHFFFAOYSA-N 0.000 claims description 3
- OMCZAJNLRFONCM-UHFFFAOYSA-N C(C)P(CC)C[C-]1C(=CC=C1)CP(CC)CC.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)P(CC)C[C-]1C(=CC=C1)CP(CC)CC.[CH-]1C=CC=C1.[Fe+2] OMCZAJNLRFONCM-UHFFFAOYSA-N 0.000 claims description 3
- VXQXJNWMZUBCKO-UHFFFAOYSA-N C1(CCCCC1)P(C1CCCCC1)C[C-]1C(=CC=C1)CP(C1CCCCC1)C1CCCCC1.[CH-]1C=CC=C1.[Fe+2] Chemical compound C1(CCCCC1)P(C1CCCCC1)C[C-]1C(=CC=C1)CP(C1CCCCC1)C1CCCCC1.[CH-]1C=CC=C1.[Fe+2] VXQXJNWMZUBCKO-UHFFFAOYSA-N 0.000 claims description 3
- ZIKHDOLERGJDEU-UHFFFAOYSA-N C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3C3=CC=CC=C3)C3=CC=CC=C3)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] Chemical compound C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3C3=CC=CC=C3)C3=CC=CC=C3)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] ZIKHDOLERGJDEU-UHFFFAOYSA-N 0.000 claims description 3
- UWQCGLSXZCNRBI-UHFFFAOYSA-N C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3[Si](C)(C)C)[Si](C)(C)C)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] Chemical compound C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3[Si](C)(C)C)[Si](C)(C)C)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] UWQCGLSXZCNRBI-UHFFFAOYSA-N 0.000 claims description 3
- PHEKQPSBRPMZHN-UHFFFAOYSA-N CP(C)C[C-]1C(=CC=C1)CP(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound CP(C)C[C-]1C(=CC=C1)CP(C)C.[CH-]1C=CC=C1.[Fe+2] PHEKQPSBRPMZHN-UHFFFAOYSA-N 0.000 claims description 3
- QPXQNFPJRJRHMW-UHFFFAOYSA-N OC(O)PC[C-]1C(=CC=C1)CPC(O)O.[CH-]1C=CC=C1.[Fe+2] Chemical compound OC(O)PC[C-]1C(=CC=C1)CPC(O)O.[CH-]1C=CC=C1.[Fe+2] QPXQNFPJRJRHMW-UHFFFAOYSA-N 0.000 claims description 3
- DITRSVVQSTZKIM-UHFFFAOYSA-N PC([C-]1C(=CC=C1)C(P)P)P.[CH-]1C=CC=C1.[Fe+2] Chemical compound PC([C-]1C(=CC=C1)C(P)P)P.[CH-]1C=CC=C1.[Fe+2] DITRSVVQSTZKIM-UHFFFAOYSA-N 0.000 claims description 3
- KNJLLVULIPAWDX-UHFFFAOYSA-N [1-(1-adamantyl)-1-[2-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13C(P)(C(C)(C)C)C1=CC=CC=C1C(P)(C(C)(C)C)C1(C2)CC(C3)CC2CC3C1 KNJLLVULIPAWDX-UHFFFAOYSA-N 0.000 claims description 3
- AZIOGQFFAQETOW-UHFFFAOYSA-N [2,3-bis[(dimethylamino)methyl]cyclopenta-2,4-dien-1-yl]methanol cyclopenta-1,3-diene iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1cc[c-](CO)c1CN(C)C AZIOGQFFAQETOW-UHFFFAOYSA-N 0.000 claims description 3
- NRULGPVQXYQMSP-UHFFFAOYSA-N [2-[bis(2-methylbutan-2-yl)phosphanylmethyl]phenyl]methyl-bis(2-methylbutan-2-yl)phosphane Chemical compound CCC(C)(C)P(C(C)(C)CC)CC1=CC=CC=C1CP(C(C)(C)CC)C(C)(C)CC NRULGPVQXYQMSP-UHFFFAOYSA-N 0.000 claims description 3
- XNQIQPPWJDKFPC-UHFFFAOYSA-N [2-[bis(2-methylpropyl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylpropyl)phosphane cyclopenta-1,3-diene iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CC(C)CP(CC(C)C)Cc1ccc[c-]1CP(CC(C)C)CC(C)C XNQIQPPWJDKFPC-UHFFFAOYSA-N 0.000 claims description 3
- VTVFXNKSLYYIIG-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-4,5-diphenylphenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 VTVFXNKSLYYIIG-UHFFFAOYSA-N 0.000 claims description 3
- MNPOPASJOFYBMI-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-5-phenylphenyl]methyl]phosphane Chemical compound C1=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C(CP(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 MNPOPASJOFYBMI-UHFFFAOYSA-N 0.000 claims description 3
- ZTHCUOODJOPAKX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 ZTHCUOODJOPAKX-UHFFFAOYSA-N 0.000 claims description 3
- QVRQKIKWJXZECK-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[1-(1-adamantylphosphanyl)-2,2-dimethylpropyl]phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC=CC=C1C(C(C)(C)C)PC1(C2)CC(C3)CC2CC3C1 QVRQKIKWJXZECK-UHFFFAOYSA-N 0.000 claims description 3
- MSDVMYUDNKFOAL-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C=C([Si](C)(C)C)C([Si](C)(C)C)=C1 MSDVMYUDNKFOAL-UHFFFAOYSA-N 0.000 claims description 3
- IYJFKBUCDIHNLX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-diphenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=CC=1C=2C=CC=CC=2)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=1C1=CC=CC=C1 IYJFKBUCDIHNLX-UHFFFAOYSA-N 0.000 claims description 3
- VGMQJPJIWFUDDR-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-phenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=C1)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=C1C1=CC=CC=C1 VGMQJPJIWFUDDR-UHFFFAOYSA-N 0.000 claims description 3
- OVKHDTCOBBKQRP-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-tert-butylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC(C(C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OVKHDTCOBBKQRP-UHFFFAOYSA-N 0.000 claims description 3
- MIZJPSACHCOTRL-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 MIZJPSACHCOTRL-UHFFFAOYSA-N 0.000 claims description 3
- QDCGGNZTDPKXAB-UHFFFAOYSA-N bis(1-adamantyl)-[[5-tert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C(C(C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 QDCGGNZTDPKXAB-UHFFFAOYSA-N 0.000 claims description 3
- LIODACAQSUGIIZ-UHFFFAOYSA-N cyclopenta-1,3-diene 1-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-N,N-dimethylmethanamine iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1ccc[c-]1CN(C)C LIODACAQSUGIIZ-UHFFFAOYSA-N 0.000 claims description 3
- VAPRXBBLNZKHAQ-UHFFFAOYSA-N cyclopenta-1,3-diene [2-[di(propan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-di(propan-2-yl)phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CC(C)P(Cc1ccc[c-]1CP(C(C)C)C(C)C)C(C)C VAPRXBBLNZKHAQ-UHFFFAOYSA-N 0.000 claims description 3
- AKJCIXVJQZAAGQ-UHFFFAOYSA-N cyclopenta-1,3-diene dicyclopentyl-[[2-(dicyclopentylphosphanylmethyl)cyclopenta-1,3-dien-1-yl]methyl]phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.C(P(C1CCCC1)C1CCCC1)c1ccc[c-]1CP(C1CCCC1)C1CCCC1 AKJCIXVJQZAAGQ-UHFFFAOYSA-N 0.000 claims description 3
- RFHJIKLLDUYFCV-UHFFFAOYSA-N ditert-butyl-[[1-(ditert-butylphosphanylmethyl)naphthalen-2-yl]methyl]phosphane Chemical compound C1=CC=CC2=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C21 RFHJIKLLDUYFCV-UHFFFAOYSA-N 0.000 claims description 3
- XGTLLXBATZZBDJ-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4,5-diphenylphenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 XGTLLXBATZZBDJ-UHFFFAOYSA-N 0.000 claims description 3
- CADVYTVWWILZML-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4-phenylphenyl]methyl]phosphane Chemical compound C1=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 CADVYTVWWILZML-UHFFFAOYSA-N 0.000 claims description 3
- NVTBDFSZGFVFTF-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4-trimethylsilylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C([Si](C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C NVTBDFSZGFVFTF-UHFFFAOYSA-N 0.000 claims description 3
- MWGNUOVYRKMMRJ-UHFFFAOYSA-N ditert-butyl-[[4,5-ditert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC(C(C)(C)C)=C(C(C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C MWGNUOVYRKMMRJ-UHFFFAOYSA-N 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- KYMNSBSWJPFUJH-UHFFFAOYSA-N iron;5-methylcyclopenta-1,3-diene;methylcyclopentane Chemical compound [Fe].C[C-]1C=CC=C1.C[C-]1[CH-][CH-][CH-][CH-]1 KYMNSBSWJPFUJH-UHFFFAOYSA-N 0.000 claims description 3
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methylcyclopentane Chemical compound CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052762 osmium Inorganic materials 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 2
- GMBMVDAIJGKWEY-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] GMBMVDAIJGKWEY-UHFFFAOYSA-N 0.000 claims 2
- UDHXJERAEOSWEH-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2[Si](C)(C)C)[Si](C)(C)C)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2[Si](C)(C)C)[Si](C)(C)C)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] UDHXJERAEOSWEH-UHFFFAOYSA-N 0.000 claims 2
- YYUXOLJFNFMQCX-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2[Si](C)(C)C)[Si](C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]2C=CC=C2.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2[Si](C)(C)C)[Si](C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]2C=CC=C2.[Fe+2] YYUXOLJFNFMQCX-UHFFFAOYSA-N 0.000 claims 2
- STZDKJBOBKDXIP-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 STZDKJBOBKDXIP-UHFFFAOYSA-N 0.000 claims 2
- YLGURJYLNZINMJ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4-trimethylsilylphenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=CC=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 YLGURJYLNZINMJ-UHFFFAOYSA-N 0.000 claims 2
- SZBXVUKSDKXGMQ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[4-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=C1)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=C1C1=CC=CC=C1 SZBXVUKSDKXGMQ-UHFFFAOYSA-N 0.000 claims 2
- CYMDWWDRVMMQQW-UHFFFAOYSA-N [8-[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=CC=1C=2C=CC=CC=2)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=1C1=CC=CC=C1 CYMDWWDRVMMQQW-UHFFFAOYSA-N 0.000 claims 2
- FKUMADLCVKODJS-UHFFFAOYSA-N [8-[4-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC=C(C(C)(C)C)C=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 FKUMADLCVKODJS-UHFFFAOYSA-N 0.000 claims 2
- MXPSHWBHUIQVPY-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 MXPSHWBHUIQVPY-UHFFFAOYSA-N 0.000 claims 2
- QRYPNXSAZAEQNA-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-5-trimethylsilylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=CC=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 QRYPNXSAZAEQNA-UHFFFAOYSA-N 0.000 claims 2
- OXOFOTRVVAMBDF-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-trimethylsilylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OXOFOTRVVAMBDF-UHFFFAOYSA-N 0.000 claims 2
- YGJWIGLZUMMAJJ-UHFFFAOYSA-N bis(1-adamantyl)-[[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=CC=1C=2C=CC=CC=2)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=1C1=CC=CC=C1 YGJWIGLZUMMAJJ-UHFFFAOYSA-N 0.000 claims 2
- BWSNJKVSHLWCQO-UHFFFAOYSA-N bis(1-adamantyl)-[[5-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC=C(C(C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 BWSNJKVSHLWCQO-UHFFFAOYSA-N 0.000 claims 2
- OQIMOMVGMYGXKU-UHFFFAOYSA-N cyclopenta-1,3-diene [2-[(dimethylamino)methyl]cyclopenta-1,4-dien-1-yl]methanol iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.CN(C)Cc1ccc[c-]1CO OQIMOMVGMYGXKU-UHFFFAOYSA-N 0.000 claims 2
- CXXSPEBWUCMZDG-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C CXXSPEBWUCMZDG-UHFFFAOYSA-N 0.000 claims 2
- YTGPMAJRVUHSAF-UHFFFAOYSA-N ditert-butyl-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 YTGPMAJRVUHSAF-UHFFFAOYSA-N 0.000 claims 2
- FNVYFXOMLKSSFK-UHFFFAOYSA-N ditert-butyl-[[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 FNVYFXOMLKSSFK-UHFFFAOYSA-N 0.000 claims 2
- HBFGAXXFXLINQU-UHFFFAOYSA-N ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound C=1C=C(C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 HBFGAXXFXLINQU-UHFFFAOYSA-N 0.000 claims 2
- YKLBAUXVBKHXAY-UHFFFAOYSA-N ditert-butyl-[[5-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC(C(C)(C)C)=CC=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 YKLBAUXVBKHXAY-UHFFFAOYSA-N 0.000 claims 2
- RHKRUKUHXVBJJD-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 RHKRUKUHXVBJJD-UHFFFAOYSA-N 0.000 claims 1
- OESSXRJOTGVSMA-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-5-trimethylsilylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C([Si](C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OESSXRJOTGVSMA-UHFFFAOYSA-N 0.000 claims 1
- KIFJCWKPBJMROL-UHFFFAOYSA-N bis(1-adamantyl)-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=C1)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=C1C1=CC=CC=C1 KIFJCWKPBJMROL-UHFFFAOYSA-N 0.000 claims 1
- WZZIVGQZIQKWLE-UHFFFAOYSA-N ditert-butyl-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-5-trimethylsilylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=CC=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 WZZIVGQZIQKWLE-UHFFFAOYSA-N 0.000 claims 1
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 10
- 150000007942 carboxylates Chemical class 0.000 abstract description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 88
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- 239000002253 acid Substances 0.000 description 63
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 60
- 125000005842 heteroatom Chemical group 0.000 description 44
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 44
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical group N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 41
- 239000000460 chlorine Substances 0.000 description 41
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 41
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 35
- 239000000243 solution Substances 0.000 description 30
- 239000000203 mixture Substances 0.000 description 29
- 239000000047 product Substances 0.000 description 27
- 239000000376 reactant Substances 0.000 description 25
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 24
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 23
- 229940017219 methyl propionate Drugs 0.000 description 23
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- 239000007789 gas Substances 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 17
- 150000007513 acids Chemical class 0.000 description 17
- 239000002270 dispersing agent Substances 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 16
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 16
- 229920006395 saturated elastomer Polymers 0.000 description 15
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 14
- NCTHHJRIJGFPTG-UHFFFAOYSA-N 6,7-bis(aziridin-1-yl)-4-[7-[[6,7-bis(aziridin-1-yl)-5,8-dioxoquinazolin-4-yl]amino]heptylamino]quinazoline-5,8-dione Chemical compound C1CN1C=1C(=O)C2=C(NCCCCCCCNC=3C=4C(=O)C(N5CC5)=C(N5CC5)C(=O)C=4N=CN=3)N=CN=C2C(=O)C=1N1CC1 NCTHHJRIJGFPTG-UHFFFAOYSA-N 0.000 description 14
- 239000005864 Sulphur Substances 0.000 description 14
- 125000005037 alkyl phenyl group Chemical group 0.000 description 14
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 14
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 14
- 239000012429 reaction media Substances 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 13
- 239000000010 aprotic solvent Substances 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 12
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 12
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical group [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 12
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002015 acyclic group Chemical group 0.000 description 12
- 150000001721 carbon Chemical group 0.000 description 12
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 12
- 238000006467 substitution reaction Methods 0.000 description 12
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- 239000002245 particle Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- MKHUGLZLKVCOGF-UHFFFAOYSA-N 1-[4-[(6-aminoquinolin-4-yl)amino]phenyl]-3-[5-tert-butyl-2-(3-methylphenyl)pyrazol-3-yl]urea Chemical compound CC1=CC=CC(N2C(=CC(=N2)C(C)(C)C)NC(=O)NC=2C=CC(NC=3C4=CC(N)=CC=C4N=CC=3)=CC=2)=C1 MKHUGLZLKVCOGF-UHFFFAOYSA-N 0.000 description 10
- 125000003342 alkenyl group Chemical group 0.000 description 10
- 229910021529 ammonia Inorganic materials 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 125000002950 monocyclic group Chemical group 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 229940098779 methanesulfonic acid Drugs 0.000 description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 7
- 150000001336 alkenes Chemical class 0.000 description 7
- 125000000304 alkynyl group Chemical group 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 150000001559 benzoic acids Chemical class 0.000 description 7
- 125000002843 carboxylic acid group Chemical group 0.000 description 7
- 150000001735 carboxylic acids Chemical class 0.000 description 7
- 238000010668 complexation reaction Methods 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- OZJPLYNZGCXSJM-UHFFFAOYSA-N 5-valerolactone Chemical compound O=C1CCCCO1 OZJPLYNZGCXSJM-UHFFFAOYSA-N 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 125000000732 arylene group Chemical group 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000002736 metal compounds Chemical class 0.000 description 6
- 239000002923 metal particle Substances 0.000 description 6
- 150000002739 metals Chemical class 0.000 description 6
- 150000003003 phosphines Chemical class 0.000 description 6
- 125000003367 polycyclic group Chemical group 0.000 description 6
- LOZWAPSEEHRYPG-UHFFFAOYSA-N 1,4-dithiane Chemical compound C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 125000002619 bicyclic group Chemical group 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000006184 cosolvent Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000004043 oxo group Chemical group O=* 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- 238000010926 purge Methods 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- VWWAILZUSKHANH-UHFFFAOYSA-N 1,2,4,5-tetramethylcyclohexane Chemical compound CC1CC(C)C(C)CC1C VWWAILZUSKHANH-UHFFFAOYSA-N 0.000 description 4
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical class OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000004566 IR spectroscopy Methods 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 238000006555 catalytic reaction Methods 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 238000001640 fractional crystallisation Methods 0.000 description 4
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 239000003586 protic polar solvent Substances 0.000 description 4
- 150000003254 radicals Chemical group 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 125000006413 ring segment Chemical group 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 230000003319 supportive effect Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- RRXKRASYPHSAPJ-UHFFFAOYSA-N 3a,4,5,6,7,7a-hexahydro-1h-indene Chemical group C1CCCC2CC=CC21 RRXKRASYPHSAPJ-UHFFFAOYSA-N 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 3
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical group [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 3
- 239000001099 ammonium carbonate Substances 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 125000006841 cyclic skeleton Chemical group 0.000 description 3
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexyloxide Natural products O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 238000011067 equilibration Methods 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 150000002940 palladium Chemical class 0.000 description 3
- WXHIJDCHNDBCNY-UHFFFAOYSA-N palladium dihydride Chemical compound [PdH2] WXHIJDCHNDBCNY-UHFFFAOYSA-N 0.000 description 3
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 230000003019 stabilising effect Effects 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 3
- UIUWNILCHFBLEQ-NSCUHMNNSA-N trans-pent-3-enoic acid Chemical class C\C=C\CC(O)=O UIUWNILCHFBLEQ-NSCUHMNNSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- KLOCTYSYSMCKLV-UHFFFAOYSA-N (1,2-ditert-butyl-4,5-diphenylcyclohexyl)methylphosphane Chemical compound C(C)(C)(C)C1C(CC(C(C1)C1=CC=CC=C1)C1=CC=CC=C1)(CP)C(C)(C)C KLOCTYSYSMCKLV-UHFFFAOYSA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 description 2
- ARXKVVRQIIOZGF-UHFFFAOYSA-N 1,2,4-butanetriol Chemical compound OCCC(O)CO ARXKVVRQIIOZGF-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- KVZJLSYJROEPSQ-UHFFFAOYSA-N 1,2-dimethylcyclohexane Chemical compound CC1CCCCC1C KVZJLSYJROEPSQ-UHFFFAOYSA-N 0.000 description 2
- XUZOLQDPDMJAEZ-UHFFFAOYSA-N 1,3,7-triazecane Chemical compound C1CNCCCNCNC1 XUZOLQDPDMJAEZ-UHFFFAOYSA-N 0.000 description 2
- WQADWIOXOXRPLN-UHFFFAOYSA-N 1,3-dithiane Chemical compound C1CSCSC1 WQADWIOXOXRPLN-UHFFFAOYSA-N 0.000 description 2
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 2
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 2
- 125000004134 1-norbornyl group Chemical group [H]C1([H])C([H])([H])C2(*)C([H])([H])C([H])([H])C1([H])C2([H])[H] 0.000 description 2
- IBXNCJKFFQIKKY-UHFFFAOYSA-N 1-pentyne Chemical group CCCC#C IBXNCJKFFQIKKY-UHFFFAOYSA-N 0.000 description 2
- FFFIRKXTFQCCKJ-UHFFFAOYSA-N 2,4,6-trimethylbenzoic acid Chemical class CC1=CC(C)=C(C(O)=O)C(C)=C1 FFFIRKXTFQCCKJ-UHFFFAOYSA-N 0.000 description 2
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical class CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 2
- MALIONKMKPITBV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-n-[2-(4-sulfamoylphenyl)ethyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)CC1=CC=C(O)C(Cl)=C1 MALIONKMKPITBV-UHFFFAOYSA-N 0.000 description 2
- XHQZJYCNDZAGLW-UHFFFAOYSA-N 3-methoxybenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1 XHQZJYCNDZAGLW-UHFFFAOYSA-N 0.000 description 2
- FNAYAXPWEKXHQU-UHFFFAOYSA-N 4-dimethylphosphanylbutyl(dimethyl)phosphane Chemical compound CP(C)CCCCP(C)C FNAYAXPWEKXHQU-UHFFFAOYSA-N 0.000 description 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical group C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical compound COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 2
- 101150005660 PHY1 gene Proteins 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical group C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910006069 SO3H Inorganic materials 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical class C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 229930188620 butyrolactone Natural products 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical class C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical class C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical class O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical class C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- FJILYPCZXWVDMD-UHFFFAOYSA-N ditert-butyl(3-ditert-butylphosphanylpropyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CCCP(C(C)(C)C)C(C)(C)C FJILYPCZXWVDMD-UHFFFAOYSA-N 0.000 description 2
- 150000002240 furans Chemical class 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002638 heterogeneous catalyst Substances 0.000 description 2
- 125000006038 hexenyl group Chemical group 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000010952 in-situ formation Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N meta--hydroxybenzoic acid Chemical class OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- IJXHLVMUNBOGRR-UHFFFAOYSA-N methyl nonanoate Chemical compound CCCCCCCCC(=O)OC IJXHLVMUNBOGRR-UHFFFAOYSA-N 0.000 description 2
- HNBDRPTVWVGKBR-UHFFFAOYSA-N methyl pentanoate Chemical compound CCCCC(=O)OC HNBDRPTVWVGKBR-UHFFFAOYSA-N 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical class CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 description 2
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 230000003335 steric effect Effects 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical class CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- WLHJCCUFRCTNRZ-UHFFFAOYSA-N (1-phenylcyclohexyl)benzene Chemical compound C1CCCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 WLHJCCUFRCTNRZ-UHFFFAOYSA-N 0.000 description 1
- HQWHAJJICYFZDT-UHFFFAOYSA-N (2,3-ditert-butyl-4,5-diphenylphenyl)methylphosphane Chemical compound C=1C=CC=CC=1C1=C(C(C)(C)C)C(C(C)(C)C)=C(CP)C=C1C1=CC=CC=C1 HQWHAJJICYFZDT-UHFFFAOYSA-N 0.000 description 1
- WWXFZLVLAJUATK-UHFFFAOYSA-N (2-diethylphosphanylphenyl)-diethylphosphane Chemical compound CCP(CC)C1=CC=CC=C1P(CC)CC WWXFZLVLAJUATK-UHFFFAOYSA-N 0.000 description 1
- QRRVMWPNMMLSGD-UHFFFAOYSA-N (2-dimethylphosphanylphenyl)-dimethylphosphane Chemical compound CP(C)C1=CC=CC=C1P(C)C QRRVMWPNMMLSGD-UHFFFAOYSA-N 0.000 description 1
- MUTGBJKUEZFXGO-WDSKDSINSA-N (3as,7as)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@H]21 MUTGBJKUEZFXGO-WDSKDSINSA-N 0.000 description 1
- GGQQNYXPYWCUHG-RMTFUQJTSA-N (3e,6e)-deca-3,6-diene Chemical compound CCC\C=C\C\C=C\CC GGQQNYXPYWCUHG-RMTFUQJTSA-N 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- ZWVMLYRJXORSEP-UHFFFAOYSA-N 1,2,6-Hexanetriol Chemical compound OCCCCC(O)CO ZWVMLYRJXORSEP-UHFFFAOYSA-N 0.000 description 1
- RMFRFTSSEHRKKW-UHFFFAOYSA-N 1,2-bis(diisopropylphosphino)ethane Chemical compound CC(C)P(C(C)C)CCP(C(C)C)C(C)C RMFRFTSSEHRKKW-UHFFFAOYSA-N 0.000 description 1
- ZKWQSBFSGZJNFP-UHFFFAOYSA-N 1,2-bis(dimethylphosphino)ethane Chemical compound CP(C)CCP(C)C ZKWQSBFSGZJNFP-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 150000000094 1,4-dioxanes Chemical class 0.000 description 1
- 150000004890 1,4-dithianes Chemical class 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- XTDQDBVBDLYELW-UHFFFAOYSA-N 2,2,3-trimethylpentane Chemical compound CCC(C)C(C)(C)C XTDQDBVBDLYELW-UHFFFAOYSA-N 0.000 description 1
- KPKMRDFVTMCLQZ-UHFFFAOYSA-N 2,3,3a,4,5,6,7,7a-octahydro-1H-indene bicyclo[4.2.0]octane Chemical compound C1CCCC2CCC21.C1CCCC2CCCC21 KPKMRDFVTMCLQZ-UHFFFAOYSA-N 0.000 description 1
- AOIYTIDHFMNVOO-UHFFFAOYSA-N 2,3,3a,4,5,6-hexahydro-1h-indene Chemical compound C1CCC=C2CCCC21 AOIYTIDHFMNVOO-UHFFFAOYSA-N 0.000 description 1
- LWTIGYSPAXKMDG-UHFFFAOYSA-N 2,3-dihydro-1h-imidazole Chemical class C1NC=CN1 LWTIGYSPAXKMDG-UHFFFAOYSA-N 0.000 description 1
- GHVMJSHEGZYRQL-UHFFFAOYSA-N 2,4,6-tribromobenzoic acid Chemical class OC(=O)C1=C(Br)C=C(Br)C=C1Br GHVMJSHEGZYRQL-UHFFFAOYSA-N 0.000 description 1
- BKYWPNROPGQIFZ-UHFFFAOYSA-N 2,4-dimethylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(C)=C1 BKYWPNROPGQIFZ-UHFFFAOYSA-N 0.000 description 1
- ONOTYLMNTZNAQZ-UHFFFAOYSA-N 2,6-difluorobenzoic acid Chemical class OC(=O)C1=C(F)C=CC=C1F ONOTYLMNTZNAQZ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- SFRDXVJWXWOTEW-UHFFFAOYSA-N 2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)CO SFRDXVJWXWOTEW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- UKPCJWKHOPODFP-UHFFFAOYSA-N 2-bis(3,5-dimethylphenyl)phosphanylethyl-bis(3,5-dimethylphenyl)phosphane Chemical compound CC1=CC(C)=CC(P(CCP(C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)=C1 UKPCJWKHOPODFP-UHFFFAOYSA-N 0.000 description 1
- PKEKIUOXBNSHDE-UHFFFAOYSA-N 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylethyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(P(CCP(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1 PKEKIUOXBNSHDE-UHFFFAOYSA-N 0.000 description 1
- FBLCQMCAGQYGFC-UHFFFAOYSA-N 2-chloro-6-(hydroxymethyl)benzoic acid Chemical compound OCC1=CC=CC(Cl)=C1C(O)=O FBLCQMCAGQYGFC-UHFFFAOYSA-N 0.000 description 1
- QCEPIUWMXRQPIF-UHFFFAOYSA-N 2-chloro-6-hydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C=CC=C1Cl QCEPIUWMXRQPIF-UHFFFAOYSA-N 0.000 description 1
- DTNSDCJFTHMDAK-UHFFFAOYSA-N 2-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C#N DTNSDCJFTHMDAK-UHFFFAOYSA-N 0.000 description 1
- MIOCUERTSIJEDP-UHFFFAOYSA-N 2-diethylphosphanylethyl(diethyl)phosphane Chemical compound CCP(CC)CCP(CC)CC MIOCUERTSIJEDP-UHFFFAOYSA-N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-N 2-ethoxybenzoic acid Chemical compound CCOC1=CC=CC=C1C(O)=O XDZMPRGFOOFSBL-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- NIONDZDPPYHYKY-UHFFFAOYSA-N 2-hexenoic acid Chemical class CCCC=CC(O)=O NIONDZDPPYHYKY-UHFFFAOYSA-N 0.000 description 1
- HSXUNHYXJWDLDK-UHFFFAOYSA-N 2-hydroxypropane-1-sulfonic acid Chemical compound CC(O)CS(O)(=O)=O HSXUNHYXJWDLDK-UHFFFAOYSA-N 0.000 description 1
- JCNWMZGWLFRHEJ-UHFFFAOYSA-N 2-methylbenzoic acid Chemical compound CC1=CC=CC=C1C(O)=O.CC1=CC=CC=C1C(O)=O JCNWMZGWLFRHEJ-UHFFFAOYSA-N 0.000 description 1
- XCJGLBWDZKLQCY-UHFFFAOYSA-N 2-methylpropane-2-sulfonic acid Chemical compound CC(C)(C)S(O)(=O)=O XCJGLBWDZKLQCY-UHFFFAOYSA-N 0.000 description 1
- PPDFQRAASCRJAH-UHFFFAOYSA-N 2-methylthiolane 1,1-dioxide Chemical compound CC1CCCS1(=O)=O PPDFQRAASCRJAH-UHFFFAOYSA-N 0.000 description 1
- UOBYKYZJUGYBDK-UHFFFAOYSA-N 2-naphthoic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CC=C21 UOBYKYZJUGYBDK-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 1
- ZDULHUHNYHJYKA-UHFFFAOYSA-N 2-propan-2-ylsulfonylpropane Chemical compound CC(C)S(=O)(=O)C(C)C ZDULHUHNYHJYKA-UHFFFAOYSA-N 0.000 description 1
- OXOWWPXTTOCKKU-UHFFFAOYSA-N 2-propoxybenzoic acid Chemical compound CCCOC1=CC=CC=C1C(O)=O OXOWWPXTTOCKKU-UHFFFAOYSA-N 0.000 description 1
- ZDFKSZDMHJHQHS-UHFFFAOYSA-N 2-tert-butylbenzoic acid Chemical compound CC(C)(C)C1=CC=CC=C1C(O)=O ZDFKSZDMHJHQHS-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- UMVOQQDNEYOJOK-UHFFFAOYSA-N 3,5-dimethylbenzoic acid Chemical compound CC1=CC(C)=CC(C(O)=O)=C1 UMVOQQDNEYOJOK-UHFFFAOYSA-N 0.000 description 1
- MQLMCMRCMGKYFQ-UHFFFAOYSA-N 3-acetyloxy-2-methylpropanoic acid Chemical compound OC(=O)C(C)COC(C)=O MQLMCMRCMGKYFQ-UHFFFAOYSA-N 0.000 description 1
- NMGODFWGUBLTTA-UHFFFAOYSA-N 3-amino-1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)N(N)C(=O)NC2=C1 NMGODFWGUBLTTA-UHFFFAOYSA-N 0.000 description 1
- XQPOLASIBOJBPP-UHFFFAOYSA-N 3-bis(3,5-dimethylphenyl)phosphanylpropyl-bis(3,5-dimethylphenyl)phosphane Chemical compound CC1=CC(C)=CC(P(CCCP(C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)=C1 XQPOLASIBOJBPP-UHFFFAOYSA-N 0.000 description 1
- KUCKQBNXASRTQX-UHFFFAOYSA-N 3-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylpropyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(P(CCCP(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1 KUCKQBNXASRTQX-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- QRPNDOFSVHOGCK-UHFFFAOYSA-N 3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane Chemical compound CC(C)P(C(C)C)CCCP(C(C)C)C(C)C QRPNDOFSVHOGCK-UHFFFAOYSA-N 0.000 description 1
- UDQOBFJTYHSIPJ-UHFFFAOYSA-N 3-diethylphosphanylpropyl(diethyl)phosphane Chemical compound CCP(CC)CCCP(CC)CC UDQOBFJTYHSIPJ-UHFFFAOYSA-N 0.000 description 1
- GZDVNUHKYJNVNT-UHFFFAOYSA-N 3-dimethylphosphanylpropyl(dimethyl)phosphane Chemical compound CP(C)CCCP(C)C GZDVNUHKYJNVNT-UHFFFAOYSA-N 0.000 description 1
- DTFQMPQJMDEWKJ-UHFFFAOYSA-N 3-ethoxybenzoic acid Chemical compound CCOC1=CC=CC(C(O)=O)=C1 DTFQMPQJMDEWKJ-UHFFFAOYSA-N 0.000 description 1
- AFPHTEQTJZKQAQ-UHFFFAOYSA-N 3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1 AFPHTEQTJZKQAQ-UHFFFAOYSA-N 0.000 description 1
- ZMXUPQVAIFGMPS-UHFFFAOYSA-N 3-propoxybenzoic acid Chemical compound CCCOC1=CC=CC(C(O)=O)=C1 ZMXUPQVAIFGMPS-UHFFFAOYSA-N 0.000 description 1
- UFERIGCCDYCZLN-UHFFFAOYSA-N 3a,4,7,7a-tetrahydro-1h-indene Chemical compound C1C=CCC2CC=CC21 UFERIGCCDYCZLN-UHFFFAOYSA-N 0.000 description 1
- QSVDFJNXDKTKTJ-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1h-indene Chemical compound C1CCCC2=C1CC=C2 QSVDFJNXDKTKTJ-UHFFFAOYSA-N 0.000 description 1
- PCHMFMSIIFSBTO-UHFFFAOYSA-N 4-[2,3-ditert-butyl-4-(phosphanylmethyl)phenyl]benzoyl chloride Chemical compound CC(C)(C)C1=C(CP)C=CC(C=2C=CC(=CC=2)C(Cl)=O)=C1C(C)(C)C PCHMFMSIIFSBTO-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 1
- RNPCSNOMEQKYEQ-UHFFFAOYSA-N 4-bis(3,5-dimethylphenyl)phosphanylbutyl-bis(3,5-dimethylphenyl)phosphane Chemical compound CC1=CC(C)=CC(P(CCCCP(C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)=C1 RNPCSNOMEQKYEQ-UHFFFAOYSA-N 0.000 description 1
- KPMRSCJWVBYMJM-UHFFFAOYSA-N 4-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylbutyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(P(CCCCP(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1 KPMRSCJWVBYMJM-UHFFFAOYSA-N 0.000 description 1
- ADCUEPOHPCPMCE-UHFFFAOYSA-N 4-cyanobenzoic acid Chemical compound OC(=O)C1=CC=C(C#N)C=C1 ADCUEPOHPCPMCE-UHFFFAOYSA-N 0.000 description 1
- KDVYCTOWXSLNNI-UHFFFAOYSA-N 4-t-Butylbenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1 KDVYCTOWXSLNNI-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- 101100365011 Arabidopsis thaliana SCL33 gene Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical class CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- CUZNYICFDCBLSQ-UHFFFAOYSA-N C1(CCCCC1)C(C(=O)O)C.C(CCC)(=O)O Chemical class C1(CCCCC1)C(C(=O)O)C.C(CCC)(=O)O CUZNYICFDCBLSQ-UHFFFAOYSA-N 0.000 description 1
- NAZIEFODBBSYQY-UHFFFAOYSA-N C=C.C1(C=CC=C1)[Zr] Chemical compound C=C.C1(C=CC=C1)[Zr] NAZIEFODBBSYQY-UHFFFAOYSA-N 0.000 description 1
- 101100275770 Caenorhabditis elegans cri-3 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910021120 PdC12 Inorganic materials 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical class C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- MXGXXBYVDMVJAO-UHFFFAOYSA-N [1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane Chemical group CC1=CC(C)=CC(P(C=2C=C(C)C=C(C)C=2)C=2C(=C3C=CC=CC3=CC=2)C=2C3=CC=CC=C3C=CC=2P(C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)=C1 MXGXXBYVDMVJAO-UHFFFAOYSA-N 0.000 description 1
- IOQCSIFZTLDUHN-UHFFFAOYSA-N [1-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane Chemical group FC(F)(F)C1=CC(C(F)(F)F)=CC(P(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C(=C3C=CC=CC3=CC=2)C=2C3=CC=CC=C3C=CC=2P(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1 IOQCSIFZTLDUHN-UHFFFAOYSA-N 0.000 description 1
- RYQWRHUSMUEYST-UHFFFAOYSA-N [14]annulene Chemical compound C1=CC=CC=CC=CC=CC=CC=C1 RYQWRHUSMUEYST-UHFFFAOYSA-N 0.000 description 1
- STQWAGYDANTDNA-UHFFFAOYSA-N [18]annulene Chemical compound C1=CC=CC=CC=CC=CC=CC=CC=CC=C1 STQWAGYDANTDNA-UHFFFAOYSA-N 0.000 description 1
- KKXGNCIWHWVWGK-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2,3,4,5-tetraphenyl-6-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]pentan-3-yl]phosphane Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC=CC=2)C(C=2C=CC=CC=2)=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=C1C1=CC=CC=C1 KKXGNCIWHWVWGK-UHFFFAOYSA-N 0.000 description 1
- YXEAIMWRHUBBOC-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4,5-bis(trimethylsilyl)phenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C YXEAIMWRHUBBOC-UHFFFAOYSA-N 0.000 description 1
- XPLBBAQFWIYEOY-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4-tritert-butylsilylphenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C XPLBBAQFWIYEOY-UHFFFAOYSA-N 0.000 description 1
- OPIZWJDLSMDLIC-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[4-phenyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]pentan-3-yl]phosphane Chemical compound C1=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 OPIZWJDLSMDLIC-UHFFFAOYSA-N 0.000 description 1
- UKKBPQHWDOUSEO-UHFFFAOYSA-N [2-(2-dimethylphosphanylphenyl)phenyl]-dimethylphosphane Chemical group CP(C)C1=CC=CC=C1C1=CC=CC=C1P(C)C UKKBPQHWDOUSEO-UHFFFAOYSA-N 0.000 description 1
- KCHNTEUKVCNEJS-UHFFFAOYSA-N [2-di(propan-2-yl)phosphanylphenyl]-di(propan-2-yl)phosphane Chemical compound CC(C)P(C(C)C)C1=CC=CC=C1P(C(C)C)C(C)C KCHNTEUKVCNEJS-UHFFFAOYSA-N 0.000 description 1
- OWLCLSCZKWZNSY-UHFFFAOYSA-N [3,4-bis(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]methylphosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C(CP)C=C1C(P)(C(C)(C)C)C(C)(C)C OWLCLSCZKWZNSY-UHFFFAOYSA-N 0.000 description 1
- RKRQBEDIQLNDQO-UHFFFAOYSA-N [3-(dimethylphosphanylmethyl)phenyl]methyl-dimethylphosphane Chemical compound CP(C)CC1=CC=CC(CP(C)C)=C1 RKRQBEDIQLNDQO-UHFFFAOYSA-N 0.000 description 1
- YXKNVDVWBZSDNJ-UHFFFAOYSA-N [3-[2-[2,3-bis(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-6-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=CC(C=2C(=C(C=CC=2)C(P)(C(C)(C)C)C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C)=C1C(P)(C(C)(C)C)C(C)(C)C YXKNVDVWBZSDNJ-UHFFFAOYSA-N 0.000 description 1
- GTGBJQCMKMXTQN-UHFFFAOYSA-N [3-[4,5-bis(4-tert-butylphenyl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound C1=CC(C(C)(C)C)=CC=C1C1=CC(C(P)(C(C)(C)C)C(C)(C)C)=C(C(P)(C(C)(C)C)C(C)(C)C)C=C1C1=CC=C(C(C)(C)C)C=C1 GTGBJQCMKMXTQN-UHFFFAOYSA-N 0.000 description 1
- SFRIBOXGWOOYSL-UHFFFAOYSA-N [3-[4,5-ditert-butyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C1=CC(C(P)(C(C)(C)C)C(C)(C)C)=C(C(P)(C(C)(C)C)C(C)(C)C)C=C1C(C)(C)C SFRIBOXGWOOYSL-UHFFFAOYSA-N 0.000 description 1
- IKTCEMKIDKMDAH-UHFFFAOYSA-N [3-[4-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C(C(C(C)(C)C)(C(C)(C)C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C IKTCEMKIDKMDAH-UHFFFAOYSA-N 0.000 description 1
- YPEPZBQLMDSGAJ-UHFFFAOYSA-N [3-[4-[3,4-bis(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound C1=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=C1 YPEPZBQLMDSGAJ-UHFFFAOYSA-N 0.000 description 1
- KQTZPQUUATTZJN-UHFFFAOYSA-N [3-[4-[tert-butyl(dimethyl)silyl]-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C)(C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C KQTZPQUUATTZJN-UHFFFAOYSA-N 0.000 description 1
- VPEMLSHVKXWVJN-UHFFFAOYSA-N [3-[4-tert-butyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C1=CC=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=C1 VPEMLSHVKXWVJN-UHFFFAOYSA-N 0.000 description 1
- GOVNVPJYMDJYSR-UHFFFAOYSA-N aceburic acid Chemical compound CC(=O)OCCCC(O)=O GOVNVPJYMDJYSR-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Chemical class 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical compound N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- 229910000074 antimony hydride Inorganic materials 0.000 description 1
- 159000000032 aromatic acids Chemical group 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- RPZUBXWEQBPUJR-UHFFFAOYSA-N bicyclo[4.2.0]octane Chemical class C1CCCC2CCC21 RPZUBXWEQBPUJR-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- CCWHPMYNOUFYEU-UHFFFAOYSA-N bis(1-adamantyl)-(cyclobutylmethyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1CCC1 CCWHPMYNOUFYEU-UHFFFAOYSA-N 0.000 description 1
- PPYKRIVFPTWIJA-UHFFFAOYSA-N bis(3,5-dimethylphenyl)phosphanylmethyl-bis(3,5-dimethylphenyl)phosphane Chemical compound CC1=CC(C)=CC(P(CP(C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)C=2C=C(C)C=C(C)C=2)=C1 PPYKRIVFPTWIJA-UHFFFAOYSA-N 0.000 description 1
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000005323 carbonate salts Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- KSDIHKMNSYWRFB-UHFFFAOYSA-N chrysen-2-amine Chemical compound C1=CC=CC2=CC=C3C4=CC=C(N)C=C4C=CC3=C21 KSDIHKMNSYWRFB-UHFFFAOYSA-N 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical class O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- VNLZLLDMKRKVEX-UHFFFAOYSA-N cyclohex-3-enone Chemical class O=C1CCC=CC1 VNLZLLDMKRKVEX-UHFFFAOYSA-N 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical group *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- GPTJTTCOVDDHER-UHFFFAOYSA-N cyclononane Chemical group C1CCCCCCCC1 GPTJTTCOVDDHER-UHFFFAOYSA-N 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N cyclooctane Chemical group C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Chemical group 0.000 description 1
- UBLCREXFPCOOSX-UHFFFAOYSA-N cyclopenta-1,4-dien-1-yl(dimethyl)phosphane iron(2+) Chemical compound [Fe++].CP(C)[c-]1cccc1.CP(C)[c-]1cccc1 UBLCREXFPCOOSX-UHFFFAOYSA-N 0.000 description 1
- BCPVFKXAPLQYIE-UHFFFAOYSA-N cyclopenta-2,4-dien-1-yl(diethyl)phosphane iron(2+) Chemical compound [Fe++].CCP(CC)[c-]1cccc1.CCP(CC)[c-]1cccc1 BCPVFKXAPLQYIE-UHFFFAOYSA-N 0.000 description 1
- IDLVJIDYJDJHOI-UHFFFAOYSA-N cyclopenta-2,4-dien-1-yl-di(propan-2-yl)phosphane;iron(2+) Chemical compound [Fe+2].CC(C)P(C(C)C)C1=CC=C[CH-]1.CC(C)P(C(C)C)C1=CC=C[CH-]1 IDLVJIDYJDJHOI-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004855 decalinyl group Chemical class C1(CCCC2CCCCC12)* 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- BOUYBUIVMHNXQB-UHFFFAOYSA-N dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane Chemical compound C1CCCCC1P(C1CCCCC1)CCP(C1CCCCC1)C1CCCCC1 BOUYBUIVMHNXQB-UHFFFAOYSA-N 0.000 description 1
- RSJBEKXKEUQLER-UHFFFAOYSA-N dicyclohexyl(3-dicyclohexylphosphanylpropyl)phosphane Chemical compound C1CCCCC1P(C1CCCCC1)CCCP(C1CCCCC1)C1CCCCC1 RSJBEKXKEUQLER-UHFFFAOYSA-N 0.000 description 1
- WNZGLXFLSFWPMP-UHFFFAOYSA-N dicyclohexyl(4-dicyclohexylphosphanylbutyl)phosphane Chemical compound C1CCCCC1P(C1CCCCC1)CCCCP(C1CCCCC1)C1CCCCC1 WNZGLXFLSFWPMP-UHFFFAOYSA-N 0.000 description 1
- DTQIHJBOJNZKNL-UHFFFAOYSA-N dicyclohexyl(cyclopenta-2,4-dien-1-yl)phosphane;iron(2+) Chemical compound [Fe+2].C1CCCCC1P([C-]1C=CC=C1)C1CCCCC1.C1CCCCC1P([C-]1C=CC=C1)C1CCCCC1 DTQIHJBOJNZKNL-UHFFFAOYSA-N 0.000 description 1
- DZNBZPKZOBDXEL-UHFFFAOYSA-N dicyclohexyl-(2-dicyclohexylphosphanylphenyl)phosphane Chemical compound C1CCCCC1P(C=1C(=CC=CC=1)P(C1CCCCC1)C1CCCCC1)C1CCCCC1 DZNBZPKZOBDXEL-UHFFFAOYSA-N 0.000 description 1
- BSSFMHHLTVJPGW-UHFFFAOYSA-N dicyclohexyl-[2-(2-dicyclohexylphosphanylphenyl)phenyl]phosphane Chemical group C1CCCCC1P(C=1C(=CC=CC=1)C=1C(=CC=CC=1)P(C1CCCCC1)C1CCCCC1)C1CCCCC1 BSSFMHHLTVJPGW-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 125000005047 dihydroimidazolyl group Chemical group N1(CNC=C1)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VQJXOEVLGQPXMS-UHFFFAOYSA-N dimethyl hexanedioate methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1.COC(=O)CCCCC(=O)OC VQJXOEVLGQPXMS-UHFFFAOYSA-N 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- MWVXFEZPEPOQRE-UHFFFAOYSA-N ditert-butyl(2-ditert-butylphosphanylethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CCP(C(C)(C)C)C(C)(C)C MWVXFEZPEPOQRE-UHFFFAOYSA-N 0.000 description 1
- NKTXGLZUTMMZST-UHFFFAOYSA-N ditert-butyl(3-ditert-butylphosphanylpropyl)phosphane;phosphane Chemical compound P.CC(C)(C)P(C(C)(C)C)CCCP(C(C)(C)C)C(C)(C)C NKTXGLZUTMMZST-UHFFFAOYSA-N 0.000 description 1
- UIYGJYHQLCCIQS-UHFFFAOYSA-N ditert-butyl(4-ditert-butylphosphanylbutyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CCCCP(C(C)(C)C)C(C)(C)C UIYGJYHQLCCIQS-UHFFFAOYSA-N 0.000 description 1
- LZOGYLUPNPTZLL-UHFFFAOYSA-N ditert-butyl(5-ditert-butylphosphanylpentyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CCCCCP(C(C)(C)C)C(C)(C)C LZOGYLUPNPTZLL-UHFFFAOYSA-N 0.000 description 1
- WDUDHEOUGWAKFD-UHFFFAOYSA-N ditert-butyl(cyclopenta-2,4-dien-1-yl)phosphane;iron(2+) Chemical compound [Fe+2].CC(C)(C)P(C(C)(C)C)C1=CC=C[CH-]1.CC(C)(C)P(C(C)(C)C)C1=CC=C[CH-]1 WDUDHEOUGWAKFD-UHFFFAOYSA-N 0.000 description 1
- JQIYDJKEVNWZJU-UHFFFAOYSA-N ditert-butyl(cyclopentylmethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1CCCC1 JQIYDJKEVNWZJU-UHFFFAOYSA-N 0.000 description 1
- WBMJFMFJCWPAIT-UHFFFAOYSA-N ditert-butyl(ditert-butylphosphanylmethyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CP(C(C)(C)C)C(C)(C)C WBMJFMFJCWPAIT-UHFFFAOYSA-N 0.000 description 1
- WWUOMCDYYCYMIK-UHFFFAOYSA-N ditert-butyl-(2-ditert-butylphosphanylphenyl)phosphane Chemical compound CC(C)(C)P(C(C)(C)C)C1=CC=CC=C1P(C(C)(C)C)C(C)(C)C WWUOMCDYYCYMIK-UHFFFAOYSA-N 0.000 description 1
- RSYBCCPWMWWVFE-UHFFFAOYSA-N ditert-butyl-[(4-tert-butylphenyl)methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C(C(C)(C)C)C=C1 RSYBCCPWMWWVFE-UHFFFAOYSA-N 0.000 description 1
- LMAJREOZDVKQCZ-UHFFFAOYSA-N ditert-butyl-[2-(2-ditert-butylphosphanylphenyl)phenyl]phosphane Chemical group CC(C)(C)P(C(C)(C)C)C1=CC=CC=C1C1=CC=CC=C1P(C(C)(C)C)C(C)(C)C LMAJREOZDVKQCZ-UHFFFAOYSA-N 0.000 description 1
- NBASRKGKDHSQSV-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=C(CP(C(C)(C)C)C(C)(C)C)C(C=2C=CC=CC=2)=CC=C1C1=CC=CC=C1 NBASRKGKDHSQSV-UHFFFAOYSA-N 0.000 description 1
- VNLHPVUKSKTUPA-UHFFFAOYSA-N ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC(CP(C(C)(C)C)C(C)(C)C)=C1 VNLHPVUKSKTUPA-UHFFFAOYSA-N 0.000 description 1
- MYRTYDVEIRVNKP-UHFFFAOYSA-N divinylbenzene Substances C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- CVXDNAAVZJWUKJ-UHFFFAOYSA-N ethylbenzene;1,2-xylene Chemical group CCC1=CC=CC=C1.CC1=CC=CC=C1C CVXDNAAVZJWUKJ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- YURNCBVQZBJDAJ-UHFFFAOYSA-N heptenoic acid group Chemical class C(C=CCCCC)(=O)O YURNCBVQZBJDAJ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical class C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- BNRNAKTVFSZAFA-UHFFFAOYSA-N hydrindane Chemical class C1CCCC2CCCC21 BNRNAKTVFSZAFA-UHFFFAOYSA-N 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910001504 inorganic chloride Inorganic materials 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- KJALUUCEMMPKAC-UHFFFAOYSA-N methyl pent-3-enoate Chemical class COC(=O)CC=CC KJALUUCEMMPKAC-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000005209 naphthoic acids Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 150000002842 nonanoic acids Chemical class 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical class OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000005603 pentanoic acids Chemical class 0.000 description 1
- YIYBQIKDCADOSF-UHFFFAOYSA-N pentenoic acid group Chemical class C(C=CCC)(=O)O YIYBQIKDCADOSF-UHFFFAOYSA-N 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 238000011197 physicochemical method Methods 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 108010094020 polyglycine Proteins 0.000 description 1
- 229920000232 polyglycine polymer Polymers 0.000 description 1
- 108010050934 polyleucine Proteins 0.000 description 1
- 108010087948 polymethionine Proteins 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 108010000222 polyserine Proteins 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000012041 precatalyst Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 229960002429 proline Drugs 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 150000004672 propanoic acids Chemical class 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004309 pyranyl group Chemical class O1C(C=CC=C1)* 0.000 description 1
- ANIDRZQDJXBHHM-UHFFFAOYSA-N pyridin-2-ylphosphane Chemical compound PC1=CC=CC=N1 ANIDRZQDJXBHHM-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 238000004467 single crystal X-ray diffraction Methods 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000009469 supplementation Effects 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 150000003527 tetrahydropyrans Chemical class 0.000 description 1
- 150000003548 thiazolidines Chemical class 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- NNBZCPXTIHJBJL-UHFFFAOYSA-N trans-decahydronaphthalene Natural products C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 1
- YIYBQIKDCADOSF-ONEGZZNKSA-N trans-pent-2-enoic acid Chemical class CC\C=C\C(O)=O YIYBQIKDCADOSF-ONEGZZNKSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- WXAZIUYTQHYBFW-UHFFFAOYSA-N tris(4-methylphenyl)phosphane Chemical compound C1=CC(C)=CC=C1P(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 WXAZIUYTQHYBFW-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 229960004441 tyrosine Drugs 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F17/00—Metallocenes
- C07F17/02—Metallocenes of metals of Groups 8, 9 or 10 of the Periodic Table
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/36—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates
- C07C67/38—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates by addition to an unsaturated carbon-to-carbon bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
- C07F15/006—Palladium compounds
- C07F15/0066—Palladium compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0607494.2A GB0607494D0 (en) | 2006-04-13 | 2006-04-13 | Metal complexes |
| GB0607494.2 | 2006-04-13 | ||
| PCT/GB2007/050189 WO2007119079A1 (en) | 2006-04-13 | 2007-04-10 | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2646403A1 CA2646403A1 (en) | 2007-10-25 |
| CA2646403C true CA2646403C (en) | 2014-11-18 |
Family
ID=36571819
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2646403A Expired - Fee Related CA2646403C (en) | 2006-04-13 | 2007-04-10 | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US8445711B2 (enExample) |
| EP (1) | EP2007703B1 (enExample) |
| JP (1) | JP5583965B2 (enExample) |
| KR (2) | KR101531050B1 (enExample) |
| CN (1) | CN101448773B (enExample) |
| BR (1) | BRPI0710504A2 (enExample) |
| CA (1) | CA2646403C (enExample) |
| ES (1) | ES2452722T3 (enExample) |
| GB (1) | GB0607494D0 (enExample) |
| MY (1) | MY156409A (enExample) |
| RU (1) | RU2470028C2 (enExample) |
| TW (1) | TWI410280B (enExample) |
| WO (1) | WO2007119079A1 (enExample) |
| ZA (1) | ZA200808000B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2007516197A (ja) | 2003-07-03 | 2007-06-21 | ルーサイト インターナショナル ユーケー リミテッド | エチレン性不飽和化合物のヒドロホルミル化方法 |
| GB0403592D0 (en) | 2004-02-18 | 2004-03-24 | Lucite Int Uk Ltd | A catalyst system |
| GB0411951D0 (en) | 2004-05-28 | 2004-06-30 | Lucite Int Uk Ltd | Carbonylation of ester |
| GB0516556D0 (en) * | 2005-08-12 | 2005-09-21 | Lucite Int Uk Ltd | Improved catalyst system |
| AU2006314268C1 (en) | 2005-11-17 | 2014-01-09 | Lucite International Uk Limited | Carbonylation of ethylenically unsaturated compounds |
| GB0607494D0 (en) | 2006-04-13 | 2006-05-24 | Lucite Int Uk Ltd | Metal complexes |
| US9809611B2 (en) * | 2006-12-02 | 2017-11-07 | Lucite International Uk Limited | Carbonylation ligands and their use in the carbonylation of ethylenically unsaturated compounds |
| ATE473991T1 (de) * | 2008-05-07 | 2010-07-15 | Umicore Galvanotechnik Gmbh | Verfahren zur herstellung von komplexen des palladium(hydrogen) carbonats mit aminliganden |
| GB0812297D0 (en) * | 2008-07-04 | 2008-08-13 | Lucite Int Uk Ltd | Novel carbonylation ligand sand thier use of in the carbonylation of ethylenically unsaturated compounds |
| GB201000078D0 (en) * | 2010-01-05 | 2010-02-17 | Lucite Int Uk Ltd | Process for the carbonylation of ethylenically unsaturated compounds, novel carbonylation ligands and catalyst systems incorporatng such ligands |
| US9018387B2 (en) * | 2010-06-11 | 2015-04-28 | Air Products And Chemicals, Inc. | Complexes of imidazole ligands |
| JP6455893B2 (ja) * | 2013-03-11 | 2019-01-23 | ラトガース,ザ ステート ユニバーシティ オブ ニュー ジャージー | 不斉転換のための有機金属の触媒作用 |
| JP2013189715A (ja) * | 2013-06-06 | 2013-09-26 | Umicore Galvanotechnik Gmbh | Pd電解質浴およびPd−Ni電解質浴 |
| CN103450280B (zh) * | 2013-08-14 | 2016-05-18 | 昆明贵金属研究所 | 二水合醋酸四氨合钯(ii)的一步法合成方法 |
| WO2017135897A1 (en) * | 2016-02-02 | 2017-08-10 | Agency For Science, Technology And Research | A catalyst for the carbonylation of alkenes |
| EP3596038B1 (en) | 2017-03-18 | 2022-12-28 | Qatar Foundation for Education, Science and Community Development | Metal-catalyzed alkoxycarbonylation of a lactone |
| EP3606371B1 (en) | 2017-04-04 | 2023-01-04 | Randall Alley | Stretch fastener |
| ES2807542T3 (es) * | 2017-12-21 | 2021-02-23 | Evonik Operations Gmbh | Procedimiento para la hidroxicarbonilación de diisobuteno catalizada con Pd: proporción ácido 3,5,5-trimetilhexanoico/H2O |
| PL3502084T3 (pl) * | 2017-12-21 | 2020-07-13 | Evonik Operations Gmbh | Sposób bezpośredniej przemiany diizobutenu w kwas karboksylowy |
| ES2787299T3 (es) * | 2017-12-21 | 2020-10-15 | Evonik Degussa Gmbh | Proceso para la conversión directa de alquenos en ácidos carboxílicos |
| CN111871461A (zh) * | 2020-04-30 | 2020-11-03 | 杭州师范大学 | 一种海胆状钴基光催化剂及其制备方法 |
| CN115772195A (zh) * | 2021-09-06 | 2023-03-10 | 惠州凯特立斯科技有限公司 | 基于吡啶的膦配体化合物及其应用 |
Family Cites Families (108)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131204A (en) | 1962-02-09 | 1964-04-28 | Grace W R & Co | Novel diquaternary aminophosphonium compounds |
| US3564020A (en) | 1968-07-17 | 1971-02-16 | Union Oil Co | Preparation of angelica lactone |
| US4245115A (en) | 1977-09-14 | 1981-01-13 | Mobil Oil Corporation | Selective carbonylation of olefinically unsaturated hydrocarbons using palladium-arsine or -stibine catalysts |
| US4377708A (en) | 1977-10-14 | 1983-03-22 | Monsanto Company | Hydrocarboxylation of vinyl alkanoates |
| EP0055875B1 (en) | 1981-01-06 | 1986-08-20 | Shell Internationale Researchmaatschappij B.V. | Process for the carbonylation of olefins |
| US4500727A (en) | 1981-03-23 | 1985-02-19 | Kuraray Co., Ltd. | Process for producing methyl lactate |
| US4504684A (en) | 1982-01-06 | 1985-03-12 | The Standard Oil Company | Metal coordination polymers as hydroformylation and hydrogenation catalysts |
| FR2530266B1 (fr) | 1982-07-13 | 1985-07-12 | Comp Generale Electricite | Procede de preparation des acides arylacetiques et arylpropioniques |
| CA1231346A (en) | 1982-09-30 | 1988-01-12 | Eit Drent | Process for the carbonylation of olefinically unsaturated compounds with a palladium catalyst |
| EP0121965B1 (en) | 1983-04-06 | 1989-12-27 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of polyketones |
| CA1247640A (en) | 1983-08-29 | 1988-12-28 | James D. Burrington | Alkoxycarbonylation or carbonylation with co and organic hydroxyl compound |
| NL8403035A (nl) | 1984-10-05 | 1986-05-01 | Shell Int Research | Werkwijze ter bereiding van polyketonen. |
| IN166314B (enExample) | 1985-08-29 | 1990-04-07 | Shell Int Research | |
| GB8531624D0 (en) | 1985-12-23 | 1986-02-05 | Shell Int Research | Carbonylation of ethylenically unsaturated compounds |
| GB8605034D0 (en) | 1986-02-28 | 1986-04-09 | Shell Int Research | Carbonylation of compounds |
| GB2195117B (en) | 1986-09-16 | 1990-10-31 | Agency Ind Science Techn | Process for direct carbonylation of hydrocarbons |
| KR880007426A (ko) | 1986-12-24 | 1988-08-27 | 오노 알버어스 | 팔라듐 촉매를 사용한 올레핀형 불포화 화합물의 카르보닐화 방법 |
| GB8705699D0 (en) | 1987-03-11 | 1987-04-15 | Shell Int Research | Carbonylation of olefinically unsaturated compounds |
| GB8719886D0 (en) | 1987-08-22 | 1987-09-30 | British Petroleum Co Plc | Carboxylic acid esters/acids |
| US4960949A (en) | 1988-12-22 | 1990-10-02 | Eastman Kodak Company | Low pressure rhodium catalyzed hydroformylation of olefins |
| US5158921A (en) | 1989-03-03 | 1992-10-27 | Shell Oil Company | Carbonylation catalyst and process |
| US5099062A (en) | 1989-03-03 | 1992-03-24 | Shell Oil Company | Carbonylation catalyst and process |
| KR0148012B1 (ko) | 1989-03-03 | 1998-08-17 | 오노 알버어스 | 신규한 포스핀으로 구성되는 촉매시스템 및 이를 이용한 아세틸렌형 또는 올레핀형 불포화화합물의 카르보닐화방법 |
| US5103043A (en) | 1989-03-03 | 1992-04-07 | Shell Oil Company | Carbonylation catalyst system |
| US4950703A (en) | 1989-05-15 | 1990-08-21 | Shell Oil Company | Stabilized carbonmonoxide-olefin copolymer compositions |
| GB9014724D0 (en) | 1990-07-03 | 1990-08-22 | Shell Int Research | Process for the preparation of alpha,beta-olefinically unsaturated compounds |
| CA2034971A1 (en) | 1990-02-05 | 1991-08-06 | Eit Drent | Carbonylation catalyst system |
| US5179225A (en) | 1990-02-05 | 1993-01-12 | Shell Oil Company | Carbonylation catalyst system |
| GB9002491D0 (en) | 1990-02-05 | 1990-04-04 | Shell Int Research | Carbonylation catalyst system |
| GB9026211D0 (en) | 1990-12-03 | 1991-01-16 | Shell Int Research | Carbonylation process |
| CA2055628A1 (en) | 1990-12-03 | 1992-06-04 | Eit Drent | Carbonylation process and catalyst composition |
| BE1004336A3 (fr) | 1991-01-15 | 1992-11-03 | Analis Sa | Procede de separation et de quantification de l'hemoglobine glycosylee hb a1c. |
| DE69204691T2 (de) | 1991-01-15 | 1996-04-11 | Shell Int Research | Verfahren zur Karbonylierung von Olefin. |
| GB9105211D0 (en) | 1991-03-12 | 1991-04-24 | Shell Int Research | Process for the preparation of alkanedioic acid derivatives |
| EP0495547B1 (en) * | 1991-01-15 | 1996-04-24 | Shell Internationale Researchmaatschappij B.V. | Carbonylation of olefins |
| AT394735B (de) | 1991-01-16 | 1992-06-10 | Chem Fab Jos Ant Zezi Ges M B | Mittel zum entfernen der oberflaechenschutzschicht fabriksneuer fahrzeuge od. dgl. |
| EP0499329B1 (en) * | 1991-02-15 | 1994-05-04 | Shell Internationale Researchmaatschappij B.V. | Carbonylation catalyst system |
| GB9111583D0 (en) | 1991-05-30 | 1991-07-24 | Shell Int Research | Carbonylation catalyst system |
| US5258546A (en) | 1991-05-30 | 1993-11-02 | Shell Oil Company | Carbonylation catalyst system |
| US5247064A (en) | 1991-08-06 | 1993-09-21 | Shell Oil Company | Polymerization of co/olefin with p bidentate ligand |
| US5245098A (en) | 1992-01-21 | 1993-09-14 | The University Of Akron | Process for preparation of non-conjugated diolefins |
| US5350876A (en) | 1992-06-29 | 1994-09-27 | Shell Oil Company | Carbonylation of conjugated dienes |
| EP0577205B1 (en) | 1992-06-29 | 1997-10-08 | Shell Internationale Researchmaatschappij B.V. | Carbonylation of conjugated dienes |
| US5436356A (en) | 1993-02-09 | 1995-07-25 | Shell Oil Company | Carbonylation process |
| SG42938A1 (en) | 1993-02-26 | 1997-10-17 | Ciba Geigy Ag | Ferrocenc diphosphines as ligands for homogeneous catalysts |
| JP2600112B2 (ja) * | 1994-11-02 | 1997-04-16 | 工業技術院長 | 含ケイ素高分子重合体の製造方法 |
| WO1996016971A1 (de) | 1994-11-29 | 1996-06-06 | Lonza Ag | Verfahren zur herstellung optisch aktiver metallocenylphosphine |
| GB9425911D0 (en) * | 1994-12-22 | 1995-02-22 | Ici Plc | Process for the carbonylation of olefins and catalyst system for use therein |
| US5495041A (en) | 1995-02-22 | 1996-02-27 | Dsm N.W. | Process for the preparation of a pentenoate ester |
| ATE195525T1 (de) | 1995-02-24 | 2000-09-15 | Novartis Ag | Silylierte ferrocenyldiphosphine, an anorganische oder polymere organische träger gebundene silylierte ferrocenyldiphosphine sowie metallkomplexe davon, ihre herstellung und verwendung |
| US5719313A (en) | 1995-03-16 | 1998-02-17 | Shell Oil Company | Carbonylation catalyst system and a process for the carbonylation of acetylenically unsaturated compounds |
| DE69603466T2 (de) | 1995-04-11 | 1999-11-18 | Novartis Ag, Basel | Dihalogenierte ferrocene und verfahren zu deren herstellung |
| US5567856A (en) | 1995-05-30 | 1996-10-22 | Hoechst Celanese Corporation | Synthesis of and hydroformylation with fluoro-substituted bidentate phosphine ligands |
| WO1998001457A1 (en) | 1996-07-10 | 1998-01-15 | Novartis Ag | Functionalized ferrocenyldiphosphines, a process for their preparation and their use |
| US5710344A (en) | 1996-11-08 | 1998-01-20 | E. I. Du Pont De Nemours And Company | Process to prepare a linear aldehyde |
| US6489506B2 (en) | 1997-03-19 | 2002-12-03 | Lucite International Uk Limited | Process for the palladium and phosphine ligand catalyzed carbonylation of ethylene |
| GB9705699D0 (en) | 1997-03-19 | 1997-05-07 | Ici Plc | Process for the carbonylation of ethylene |
| US6156934A (en) | 1997-03-26 | 2000-12-05 | Shell Oil Company | Diphosphines |
| EP0977628B1 (en) | 1997-04-07 | 2001-06-20 | Dsm N.V. | Carbonylation catalyst system |
| US6184391B1 (en) | 1997-04-15 | 2001-02-06 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing epsilon caprolactones and/or hydrates and/or esters thereof |
| DE19721601A1 (de) | 1997-05-23 | 1998-11-26 | Hoechst Ag | Polybetain-stabilisierte, Palladium-haltige Nanopartikel, ein Verfahren zu ihrer Herstellung sowie daraus hergestellte Katalysatoren zur Gewinnung von Vinylacetat |
| GB9717059D0 (en) | 1997-08-13 | 1997-10-15 | Ici Plc | Method of manufacturing phosphine compound |
| DE19745904A1 (de) | 1997-10-17 | 1999-04-22 | Hoechst Ag | Polymerstabilisierte Metallkolloid-Lösungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Katalysatoren für Brennstoffzellen |
| GB9722733D0 (en) | 1997-10-29 | 1998-10-28 | Ici Plc | Production of esters |
| DE19754304A1 (de) | 1997-12-08 | 1999-06-10 | Hoechst Ag | Polybetain-stabilisierte Platin-Nanopartikel, Verfahren zu ihrer Herstellung und Verwendung für Elektrokatalysatoren in Brennstoffzellen |
| EP0967015B1 (de) | 1998-06-19 | 2005-01-12 | Degussa AG | Verwendung von Ferrocenylliganden zur katalytischen enantioselektiven Hydrierung |
| US6337406B1 (en) | 1998-08-21 | 2002-01-08 | The Penn State Research Foundation | Asymmetric catalysis based on chiral phospholanes and hydroxyl phospholanes |
| US5962732A (en) | 1998-12-17 | 1999-10-05 | E. I. Du Pont De Nemours And Company | Process for the preparation of 3-pentenoic acid from butadiene using a nickel catalyst |
| DE19952348A1 (de) | 1998-12-19 | 2000-06-21 | Degussa | Liganden und Komplexe zur enantioselektiven Hydrierung |
| GB9918229D0 (en) | 1999-08-04 | 1999-10-06 | Ici Plc | Improvements relating to metal-compound catalysed processes |
| CA2385421C (en) | 1999-09-20 | 2009-12-15 | The Penn State Research Foundation | Chiral phosphines, transition metal complexes thereof and uses thereof in asymmetric reactions |
| US6258979B1 (en) | 1999-11-22 | 2001-07-10 | Henri Kagan | Chiral ferrocene phosphines active in asymmetric catalysis |
| US6743911B2 (en) | 2000-03-14 | 2004-06-01 | Shell Oil Company | Process for the carbonylation of pentenenitrile |
| US6706912B2 (en) | 2000-03-14 | 2004-03-16 | Shell Oil Company | Process for the carbonylation of ethylenically unsaturated compounds |
| TWI266760B (en) | 2000-03-20 | 2006-11-21 | Kvaerner Process Tech Ltd | Process for the preparation of propane-1,3-diol |
| DE10023470A1 (de) | 2000-05-12 | 2001-11-15 | Basf Ag | Verfahren zur Herstellung von Aldehyden |
| MY127093A (en) | 2000-05-17 | 2006-11-30 | Lucite Int Uk Ltd | Bidentate ligands useful in catalyst systems |
| DE10037961A1 (de) | 2000-07-27 | 2002-02-07 | Aventis Res & Tech Gmbh & Co | Neue Phosphanliganden, deren Herstellung und ihre Verwendung in katalytischen Reaktionen |
| DE10048874A1 (de) | 2000-09-29 | 2002-04-11 | Basf Ag | Katalysatorsystem und Verfahren zur Carbonylierung |
| DE10060313A1 (de) | 2000-12-04 | 2002-06-13 | Basf Ag | Verfahren zur Carbonylierung von Pentensäure und deren Derivate |
| DE60127446T2 (de) | 2000-12-11 | 2007-11-29 | Invista Technologies S.A.R.L., Wilmington | Verfahren zur herstellung von 5-cyanovaleriansäure oder adipinsäure |
| DE10228293A1 (de) | 2001-07-28 | 2003-02-13 | Basf Ag | Verfahren zur Herstellung von Dialkylketonen |
| US20030105348A1 (en) | 2001-11-19 | 2003-06-05 | Bunel Emilio E. | Process for making 5-cyanovaleric acid, adipic acid or dimethyl adipate |
| CN100516017C (zh) | 2002-02-19 | 2009-07-22 | 国际壳牌研究有限公司 | 使烯键式不饱和化合物羰基化的方法以及用于该方法的催化剂 |
| TWI301481B (en) | 2002-08-10 | 2008-10-01 | Lucite Int Uk Ltd | A catalyst system |
| GB0228018D0 (en) | 2002-11-30 | 2003-01-08 | Lucite Int Uk Ltd | Carbonylation of ester |
| GB0218613D0 (en) | 2002-08-10 | 2002-09-18 | Lucite Int Uk Ltd | Process for the carbonylation of ethylenically unsaturated compounds |
| US20040115475A1 (en) | 2002-08-14 | 2004-06-17 | Matsushita Electric Industrial Co., Ltd. | Aromatic methylidene compound, methylstyrul compound for producing the same, production electroluminescent element |
| CA2498293C (en) * | 2002-09-12 | 2012-05-22 | Lucite International Uk Limited | Catalyst system comprising chelating ligand and group viiib metal |
| AU2003269119B2 (en) | 2002-09-12 | 2009-06-18 | Lucite International Uk Limited | A catalyst system comprising a metallocene ligand |
| CA2500095C (en) | 2002-09-26 | 2011-10-18 | Shell Internationale Research Maatschappij B.V. | Process for the hydroformylation of an ethylenically unsaturated compound |
| WO2004072088A2 (en) * | 2003-02-14 | 2004-08-26 | Takasago International Corporation | Phosphine compound, intermediate, palladium-complex, and use thereof |
| US20060235241A1 (en) | 2003-05-22 | 2006-10-19 | Eit Drent | Process for the carbonylation of a conuugated diene |
| JP2007516197A (ja) | 2003-07-03 | 2007-06-21 | ルーサイト インターナショナル ユーケー リミテッド | エチレン性不飽和化合物のヒドロホルミル化方法 |
| GB0403592D0 (en) * | 2004-02-18 | 2004-03-24 | Lucite Int Uk Ltd | A catalyst system |
| CA2557362A1 (en) | 2004-02-26 | 2005-09-09 | Shell Internationale Research Maatschappij B.V. | Process for the carbonylation of ethylenically or acetylenically unsaturated compounds |
| GB0411951D0 (en) * | 2004-05-28 | 2004-06-30 | Lucite Int Uk Ltd | Carbonylation of ester |
| SE527991C2 (sv) | 2004-12-07 | 2006-08-01 | Glow Ab | Vattenrenare med UV-lampa och filter samt demonterbara delar |
| WO2006084892A2 (en) | 2005-02-11 | 2006-08-17 | Shell Internationale Research Maatschappij B.V. | Process for the preparation of a dicarboxylic acid |
| TW200633972A (en) | 2005-02-11 | 2006-10-01 | Shell Int Research | Process for the carbonylation of a conjugated diene |
| GB0516556D0 (en) | 2005-08-12 | 2005-09-21 | Lucite Int Uk Ltd | Improved catalyst system |
| AU2006314268C1 (en) | 2005-11-17 | 2014-01-09 | Lucite International Uk Limited | Carbonylation of ethylenically unsaturated compounds |
| CN101437808A (zh) | 2006-03-21 | 2009-05-20 | 耶鲁大学 | 由芳香化合物与氨或金属酰胺反应合成芳基胺的方法 |
| GB0607494D0 (en) | 2006-04-13 | 2006-05-24 | Lucite Int Uk Ltd | Metal complexes |
| GB2437250C (en) | 2006-04-18 | 2012-08-15 | Iti Scotland Ltd | Method and system for monitoring the condition of livestock |
| GB0625518D0 (en) | 2006-12-21 | 2007-01-31 | Lucite Int Uk Ltd | Carbonylation of conjugated dienes |
| TWI473785B (zh) | 2007-06-01 | 2015-02-21 | Bp Chem Int Ltd | 使用金屬螯配位體催化劑用於醋酸之生產的羰基化方法 |
| GB0713624D0 (en) | 2007-07-13 | 2007-08-22 | Lucite Int Uk Ltd | Improved solvent for catalyst system |
-
2006
- 2006-04-13 GB GBGB0607494.2A patent/GB0607494D0/en not_active Ceased
-
2007
- 2007-04-10 BR BRPI0710504-5A patent/BRPI0710504A2/pt not_active Application Discontinuation
- 2007-04-10 KR KR1020087027731A patent/KR101531050B1/ko not_active Expired - Fee Related
- 2007-04-10 RU RU2008144698/04A patent/RU2470028C2/ru not_active IP Right Cessation
- 2007-04-10 US US12/297,023 patent/US8445711B2/en not_active Expired - Fee Related
- 2007-04-10 MY MYPI20084063A patent/MY156409A/en unknown
- 2007-04-10 KR KR1020147009404A patent/KR20140070592A/ko not_active Ceased
- 2007-04-10 JP JP2009504833A patent/JP5583965B2/ja not_active Expired - Fee Related
- 2007-04-10 EP EP07733611.3A patent/EP2007703B1/en not_active Not-in-force
- 2007-04-10 CN CN200780018436.1A patent/CN101448773B/zh not_active Expired - Fee Related
- 2007-04-10 CA CA2646403A patent/CA2646403C/en not_active Expired - Fee Related
- 2007-04-10 ES ES07733611.3T patent/ES2452722T3/es active Active
- 2007-04-10 WO PCT/GB2007/050189 patent/WO2007119079A1/en not_active Ceased
- 2007-04-13 TW TW096113047A patent/TWI410280B/zh not_active IP Right Cessation
-
2008
- 2008-09-17 ZA ZA200808000A patent/ZA200808000B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US20090312561A1 (en) | 2009-12-17 |
| TW200744756A (en) | 2007-12-16 |
| KR20090009860A (ko) | 2009-01-23 |
| KR101531050B1 (ko) | 2015-06-23 |
| CA2646403A1 (en) | 2007-10-25 |
| CN101448773A (zh) | 2009-06-03 |
| EP2007703B1 (en) | 2013-12-18 |
| JP5583965B2 (ja) | 2014-09-03 |
| TWI410280B (zh) | 2013-10-01 |
| BRPI0710504A2 (pt) | 2012-06-05 |
| RU2470028C2 (ru) | 2012-12-20 |
| US8445711B2 (en) | 2013-05-21 |
| ZA200808000B (en) | 2009-12-30 |
| GB0607494D0 (en) | 2006-05-24 |
| CN101448773B (zh) | 2015-02-11 |
| KR20140070592A (ko) | 2014-06-10 |
| JP2009533409A (ja) | 2009-09-17 |
| RU2008144698A (ru) | 2010-05-20 |
| AU2007238407A1 (en) | 2007-10-25 |
| WO2007119079A1 (en) | 2007-10-25 |
| MY156409A (en) | 2016-02-26 |
| EP2007703A1 (en) | 2008-12-31 |
| ES2452722T3 (es) | 2014-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2646403C (en) | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds | |
| CA2784616C (en) | Process for the carbonylation of ethylenically unsaturated compounds, novel carbonylation ligands and catalyst systems incorporating such ligands | |
| CA2727163C (en) | Process for the carbonylation of ethylenically unsaturated compounds, novel carbonylation ligands and catalyst systems incorporating such ligands | |
| CA2691698A1 (en) | A process for the carbonylation of an ethylenically unsaturated compound and a catalyst system | |
| CA2671409C (en) | Novel carbonylation ligands and their use in the carbonylation of ethylenically unsaturated compounds | |
| CA2857572C (en) | A continuous process for the carbonylation of ethylene | |
| EP2094635A1 (en) | Carbonylation of conjugated dienes | |
| CA2618574C (en) | Improved catalyst system | |
| AU2010332501B2 (en) | Improved carbonylation process | |
| AU2007238407B2 (en) | Metal complexes for use in the carbonylation of ethylenically unsaturated compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20180410 |