DK170256B1 - 3-Substituerede beta-carbolinderivater, analogifremgangsmåde til fremstilling heraf samt lægemiddel på basis af samme - Google Patents
3-Substituerede beta-carbolinderivater, analogifremgangsmåde til fremstilling heraf samt lægemiddel på basis af samme Download PDFInfo
- Publication number
- DK170256B1 DK170256B1 DK456484A DK456484A DK170256B1 DK 170256 B1 DK170256 B1 DK 170256B1 DK 456484 A DK456484 A DK 456484A DK 456484 A DK456484 A DK 456484A DK 170256 B1 DK170256 B1 DK 170256B1
- Authority
- DK
- Denmark
- Prior art keywords
- formula
- carboxylic acid
- carbon atoms
- carboline
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 7
- 239000003814 drug Substances 0.000 title claims description 5
- 230000008569 process Effects 0.000 title claims description 5
- 229940079593 drug Drugs 0.000 title claims description 3
- AIFRHYZBTHREPW-UHFFFAOYSA-N β-carboline Chemical class N1=CC=C2C3=CC=CC=C3NC2=C1 AIFRHYZBTHREPW-UHFFFAOYSA-N 0.000 title abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 150000002148 esters Chemical class 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 6
- 239000001301 oxygen Substances 0.000 claims abstract description 6
- 125000002015 acyclic group Chemical group 0.000 claims abstract description 4
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 4
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract 3
- -1 2-amine compound Chemical class 0.000 claims description 47
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 22
- 229960000583 acetic acid Drugs 0.000 claims description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 239000012362 glacial acetic acid Substances 0.000 claims description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 150000002475 indoles Chemical class 0.000 claims description 6
- 229910052763 palladium Inorganic materials 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- 239000007868 Raney catalyst Substances 0.000 claims description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 5
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 229960001760 dimethyl sulfoxide Drugs 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 238000010992 reflux Methods 0.000 claims description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 claims description 4
- 239000003586 protic polar solvent Substances 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 3
- 229910001385 heavy metal Inorganic materials 0.000 claims description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 150000004820 halides Chemical class 0.000 claims 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 150000001336 alkenes Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000002826 coolant Substances 0.000 claims 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 229910000510 noble metal Inorganic materials 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 8
- 210000003169 central nervous system Anatomy 0.000 abstract description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 2
- 150000002431 hydrogen Chemical group 0.000 abstract description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 abstract 1
- 125000001715 oxadiazolyl group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 59
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000002168 ethanoic acid esters Chemical class 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000003480 eluent Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- ARLVFKCLBYUINL-UHFFFAOYSA-N 9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical class N1C2=CC=CC=C2C2=C1C=NC(C(=O)O)=C2 ARLVFKCLBYUINL-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 4
- VJYXZGFGOFUMLM-UHFFFAOYSA-N ethyl 6-cyclohex-3-en-1-yl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C1CCC=CC1 VJYXZGFGOFUMLM-UHFFFAOYSA-N 0.000 description 4
- 229960002200 flunitrazepam Drugs 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 102000004300 GABA-A Receptors Human genes 0.000 description 3
- 108090000839 GABA-A Receptors Proteins 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- STLZXEMZEUYYJJ-UHFFFAOYSA-N 6-cyclohex-3-en-1-yl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical compound C1=C2C=3C(C)=C(C(O)=O)N=CC=3NC2=CC=C1C1CCC=CC1 STLZXEMZEUYYJJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 210000004129 prosencephalon Anatomy 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- UUAMLBIYJDPGFU-UHFFFAOYSA-N 1,3-dimethoxypropane Chemical compound COCCCOC UUAMLBIYJDPGFU-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- ZVAPWJGRRUHKGP-UHFFFAOYSA-N 1h-1,5-benzodiazepine Chemical class N1C=CC=NC2=CC=CC=C12 ZVAPWJGRRUHKGP-UHFFFAOYSA-N 0.000 description 1
- BYDRTKVGBRTTIT-UHFFFAOYSA-N 2-methylprop-2-en-1-ol Chemical compound CC(=C)CO BYDRTKVGBRTTIT-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UWWDSFRFGQOVPB-UHFFFAOYSA-N 4-benzyl-1h-indole Chemical compound C=1C=CC=2NC=CC=2C=1CC1=CC=CC=C1 UWWDSFRFGQOVPB-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- LCTDIQQSJICLJM-UHFFFAOYSA-N 4-phenyl-1h-indole Chemical compound C1=CC=C2NC=CC2=C1C1=CC=CC=C1 LCTDIQQSJICLJM-UHFFFAOYSA-N 0.000 description 1
- OIANCBGGZXRAIY-UHFFFAOYSA-N 5-(9H-pyrido[3,4-b]indol-4-yl)oxadiazole Chemical compound O1N=NC=C1C1=CN=CC=2NC3=CC=CC=C3C12 OIANCBGGZXRAIY-UHFFFAOYSA-N 0.000 description 1
- UFXCGBOQGDMUKE-UHFFFAOYSA-N 5-[6-(cycloocten-1-yl)-4-methyl-9h-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2C(=C3C4=CC(=CC=C4NC3=CN=2)C=2CCCCCCC=2)C)=N1 UFXCGBOQGDMUKE-UHFFFAOYSA-N 0.000 description 1
- RDMFHRSPDKWERA-UHFFFAOYSA-N 5H-Pyrido[4,3-b]indole Chemical class C1=NC=C2C3=CC=CC=C3NC2=C1 RDMFHRSPDKWERA-UHFFFAOYSA-N 0.000 description 1
- XDDKNUGHFYHNSA-UHFFFAOYSA-N 6-(cycloocten-1-yl)-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical compound C1=C2C=3C(C)=C(C(O)=O)N=CC=3NC2=CC=C1C1=CCCCCCC1 XDDKNUGHFYHNSA-UHFFFAOYSA-N 0.000 description 1
- XZCRYSISSZDQSJ-UHFFFAOYSA-N 6-tert-butyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical compound N1C2=CC=C(C(C)(C)C)C=C2C2=C1C=NC(C(O)=O)=C2C XZCRYSISSZDQSJ-UHFFFAOYSA-N 0.000 description 1
- BPMFPOGUJAAYHL-UHFFFAOYSA-N 9H-Pyrido[2,3-b]indole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=N1 BPMFPOGUJAAYHL-UHFFFAOYSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- FDYBFMAONXWAAF-UHFFFAOYSA-N C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C=CC1CCCCC1 Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C=CC1CCCCC1 FDYBFMAONXWAAF-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PPTYJKAXVCCBDU-UHFFFAOYSA-N Rohypnol Chemical compound N=1CC(=O)N(C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1F PPTYJKAXVCCBDU-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- ZYPFNUFGBPXFGS-UHFFFAOYSA-N ethyl 2-amino-3-(4-benzyl-1h-indol-3-yl)-4-methoxybutanoate Chemical compound C=12C(C(COC)C(N)C(=O)OCC)=CNC2=CC=CC=1CC1=CC=CC=C1 ZYPFNUFGBPXFGS-UHFFFAOYSA-N 0.000 description 1
- NMDCSIMFVXCFBS-UHFFFAOYSA-N ethyl 3-(4-benzyl-1h-indol-3-yl)-4-methoxy-2-nitrobutanoate Chemical compound C=12C(C(COC)C(C(=O)OCC)[N+]([O-])=O)=CNC2=CC=CC=1CC1=CC=CC=C1 NMDCSIMFVXCFBS-UHFFFAOYSA-N 0.000 description 1
- RVKCXUGERFCGHY-UHFFFAOYSA-N ethyl 3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(C)C)N=CN(C)C RVKCXUGERFCGHY-UHFFFAOYSA-N 0.000 description 1
- JYFXBZLFXXEYDJ-UHFFFAOYSA-N ethyl 3-hydroxy-4-methoxy-2-nitrobutanoate Chemical compound CCOC(=O)C([N+]([O-])=O)C(O)COC JYFXBZLFXXEYDJ-UHFFFAOYSA-N 0.000 description 1
- NQTHDXNSZBASTD-UHFFFAOYSA-N ethyl 4-(methoxymethyl)-5-propan-2-yl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=CC(C(C)C)=C2C3=C(COC)C(C(=O)OCC)=NC=C3NC2=C1 NQTHDXNSZBASTD-UHFFFAOYSA-N 0.000 description 1
- APUGSQNGDURZJL-UHFFFAOYSA-N ethyl 4-methyl-6-octan-4-yl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound N1=C(C(=O)OCC)C(C)=C2C3=CC(C(CCC)CCCC)=CC=C3NC2=C1 APUGSQNGDURZJL-UHFFFAOYSA-N 0.000 description 1
- YXABMPKBDUPMEF-UHFFFAOYSA-N ethyl 4-methyl-6-phenyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C1=CC=CC=C1 YXABMPKBDUPMEF-UHFFFAOYSA-N 0.000 description 1
- NZCQKMJJZUJUAW-UHFFFAOYSA-N ethyl 4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=CC=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=C1 NZCQKMJJZUJUAW-UHFFFAOYSA-N 0.000 description 1
- WPTXZSOWOQVDPC-UHFFFAOYSA-N ethyl 5-cyclohexyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=NC(C(=O)OCC)=CC(C=23)=C1NC3=CC=CC=2C1CCCCC1 WPTXZSOWOQVDPC-UHFFFAOYSA-N 0.000 description 1
- ZQTOYQFGHNLAIN-UHFFFAOYSA-N ethyl 6,8-ditert-butyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C(C(C)(C)C)C=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=C1C(C)(C)C ZQTOYQFGHNLAIN-UHFFFAOYSA-N 0.000 description 1
- BAXZPAKHEFTNEN-UHFFFAOYSA-N ethyl 6-benzyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1CC1=CC=CC=C1 BAXZPAKHEFTNEN-UHFFFAOYSA-N 0.000 description 1
- ASABEFSXQAMSPC-UHFFFAOYSA-N ethyl 6-cycloheptyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C1CCCCCC1 ASABEFSXQAMSPC-UHFFFAOYSA-N 0.000 description 1
- LVUROWQFHUIGND-UHFFFAOYSA-N ethyl 6-cyclooctyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=CC=C1C1CCCCCCC1 LVUROWQFHUIGND-UHFFFAOYSA-N 0.000 description 1
- YDKITNHRFQMPMH-UHFFFAOYSA-N ethyl 6-propan-2-yl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound N1C2=CC=C(C(C)C)C=C2C2=C1C=NC(C(=O)OCC)=C2 YDKITNHRFQMPMH-UHFFFAOYSA-N 0.000 description 1
- LIRYERVVOBXIOO-UHFFFAOYSA-N ethyl 6-tert-butyl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C(C(C)(C)C)C=C2C3=C(C)C(C(=O)OCC)=NC=C3NC2=C1 LIRYERVVOBXIOO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002496 iodine Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- WPHGSKGZRAQSGP-UHFFFAOYSA-N methylenecyclohexane Natural products C1CCCC2CC21 WPHGSKGZRAQSGP-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- RLZPCFQNZGINRP-UHFFFAOYSA-N n'-hydroxypropanimidamide Chemical compound CCC(N)=NO RLZPCFQNZGINRP-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- MOOYVEVEDVVKGD-UHFFFAOYSA-N oxaldehydic acid;hydrate Chemical compound O.OC(=O)C=O MOOYVEVEDVVKGD-UHFFFAOYSA-N 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- YLOVYOQKFPEOLM-UHFFFAOYSA-N phosphooxychloride Chemical compound ClOP(=O)=O YLOVYOQKFPEOLM-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- WGDRAVMHLDKGGA-UHFFFAOYSA-N prop-2-en-1-imine Chemical compound [CH2]C=C[NH] WGDRAVMHLDKGGA-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- LXLYWTMQHYKYRL-UHFFFAOYSA-N propyl 6-cyclohex-3-en-1-yl-4-methyl-9h-pyrido[3,4-b]indole-3-carboxylate Chemical compound C1=C2C3=C(C)C(C(=O)OCCC)=NC=C3NC2=CC=C1C1CCC=CC1 LXLYWTMQHYKYRL-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000001003 psychopharmacologic effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Neurology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Photoreceptors In Electrophotography (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Treating Waste Gases (AREA)
- Carbon And Carbon Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3335323 | 1983-09-27 | ||
| DE3335323A DE3335323A1 (de) | 1983-09-27 | 1983-09-27 | Substituierte ss-carboline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK456484D0 DK456484D0 (da) | 1984-09-25 |
| DK456484A DK456484A (da) | 1985-03-28 |
| DK170256B1 true DK170256B1 (da) | 1995-07-17 |
Family
ID=6210425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK456484A DK170256B1 (da) | 1983-09-27 | 1984-09-25 | 3-Substituerede beta-carbolinderivater, analogifremgangsmåde til fremstilling heraf samt lægemiddel på basis af samme |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4623649A (fr) |
| EP (1) | EP0137390B1 (fr) |
| JP (1) | JPS60100577A (fr) |
| AT (1) | ATE55604T1 (fr) |
| AU (1) | AU578043B2 (fr) |
| CA (1) | CA1263394A (fr) |
| DD (1) | DD223714A5 (fr) |
| DE (2) | DE3335323A1 (fr) |
| DK (1) | DK170256B1 (fr) |
| ES (1) | ES536199A0 (fr) |
| FI (1) | FI843777L (fr) |
| GR (1) | GR80482B (fr) |
| HU (1) | HU200457B (fr) |
| IE (1) | IE57670B1 (fr) |
| IL (1) | IL73071A (fr) |
| NO (1) | NO160998C (fr) |
| PT (1) | PT79264B (fr) |
| ZA (1) | ZA847619B (fr) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK240184D0 (da) * | 1984-05-15 | 1984-05-15 | Ferrosan As | Beta-carboline-3-carboxylic acid derivatives and method of preparing the same |
| DK240084D0 (da) * | 1984-05-15 | 1984-05-15 | Ferrosan As | New beta-carboline-3-oxadiazolyl derivatives |
| DE3535927A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 3-vinyl- und 3-ethinyl-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE3540653A1 (de) * | 1985-11-13 | 1987-05-14 | Schering Ag | Neue 3-oxadiazol- und 3-carbonsaeure-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE3545776A1 (de) * | 1985-12-20 | 1987-06-25 | Schering Ag | 5-aminoalkyl-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| US4952584A (en) * | 1986-01-11 | 1990-08-28 | Beecham Group P.L.C. | 9H-pyrido[2,B-8]indole-3-carboxylic acid ester compounds having useful pharmaceutical activity |
| DE3609699A1 (de) * | 1986-03-20 | 1987-09-24 | Schering Ag | 5- oder 6-substituierte-(beta)-carbolin-3-carbonsaeureester |
| DE3608089A1 (de) * | 1986-03-08 | 1987-09-10 | Schering Ag | Heteroaryl-oxy-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE4130933A1 (de) * | 1991-09-13 | 1993-03-18 | Schering Ag | Neue (beta)-carbolinderivate, deren herstellung und verwendung in arzneimitteln |
| US5585490A (en) * | 1991-10-08 | 1996-12-17 | Neurogen Corporation | Certain cycloalkyl and azacycloalkyl pyrrolopyrimidines; a new class of GABA brain receptor ligands |
| WO1994025463A1 (fr) * | 1992-04-08 | 1994-11-10 | Neurogen Corporation | Pyrrolapyrimidines condensees par un aryle constituant une nouvelle categorie de ligands des recepteurs cerebraux du gaba |
| US5367077A (en) * | 1992-04-08 | 1994-11-22 | Neurogen Corporation | Certain cycloalkyl and azacycloalkyl pyrrolopyridines; a new class of gaba rain receptor ligands |
| US5286860A (en) * | 1992-11-12 | 1994-02-15 | Neurogen Corporation | Certain aryl substituted pyrrolopyrazines; a new class of GABA brain receptor ligands |
| US5750702A (en) * | 1993-10-27 | 1998-05-12 | Neurogen Corporation | Certain pyrrolo pyridine-3-carboxamides; a new class of GABA brain receptor ligands |
| US5484944A (en) * | 1993-10-27 | 1996-01-16 | Neurogen Corporation | Certain fused pyrrolecarboxanilides and their use as GABA brain receptor ligands |
| US6211365B1 (en) | 1996-01-19 | 2001-04-03 | Neurogen Corporation | Fused pyrrolecarboxamides; a new class of GABA brain receptor ligands |
| US5804686A (en) * | 1996-01-19 | 1998-09-08 | Neurogen Corporation | fused pyrrolecarboxamides; a new class of GABA brain receptor ligands |
| WO1997034870A1 (fr) | 1996-03-22 | 1997-09-25 | Neurogen Corporation | Certains pyrrolecarboxamides fusionnes utilises comme ligands de recepteurs cerebraux gaba |
| US5723462A (en) * | 1996-04-26 | 1998-03-03 | Neurogen Corporation | Certain fused pyrrolecarboxamides a new class of GABA brain receptor ligands |
| MXPA02001709A (es) | 1999-08-31 | 2002-10-23 | Neurogen Corp | Pirrolocarboxamidas fusionadas: ligandos receptores de acido gaba-aminobutirico cerebral. |
| US20050014939A1 (en) * | 1999-08-31 | 2005-01-20 | Neurogen Corporation | Fused pyrrolecarboxamides: GABA brain receptor ligands |
| US20030045541A1 (en) * | 2001-07-23 | 2003-03-06 | Christopher Bruckner | GABA-Receptor modulators with NMDA-Antagonistic activity |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3058909A (en) | 1957-07-23 | 1962-10-16 | Atlantic Refining Co | Method and composition for formation fracturing |
| US3163219A (en) | 1961-06-22 | 1964-12-29 | Atlantic Refining Co | Borate-gum gel breakers |
| US3215634A (en) | 1962-10-16 | 1965-11-02 | Jersey Prod Res Co | Method for stabilizing viscous liquids |
| GB1084256A (fr) * | 1963-11-06 | |||
| US3741894A (en) | 1967-06-15 | 1973-06-26 | Exxon Production Research Co | Chemically modified organic polymers |
| US3696035A (en) | 1970-11-04 | 1972-10-03 | Dow Chemical Co | Well treatments with thickened aqueous alcohol mixtures |
| US3727688A (en) | 1972-02-09 | 1973-04-17 | Phillips Petroleum Co | Hydraulic fracturing method |
| US3768566A (en) | 1972-04-18 | 1973-10-30 | Halliburton Co | Methods for fracturing high temperature well formations |
| US3848673A (en) | 1973-02-26 | 1974-11-19 | Phillips Petroleum Co | Recovery of hydrocarbons |
| US4033415A (en) | 1973-03-30 | 1977-07-05 | Halliburton Company | Methods for fracturing well formations |
| DE2415155C2 (de) | 1974-03-29 | 1985-05-23 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur Herstellung von 2,3-Dihydroxypropylcellulose |
| DE2415154C2 (de) | 1974-03-29 | 1985-05-23 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur Herstellung von Cellulosemischethern, die neben Alkylgruppen, Hydroxyalkylgruppen oder Carboxyalkylgruppen noch 2,3-Dihydroxypropylgruppen enthalten |
| US3888312A (en) | 1974-04-29 | 1975-06-10 | Halliburton Co | Method and compositions for fracturing well formations |
| US3978928A (en) | 1975-04-14 | 1976-09-07 | Phillips Petroleum Company | Process for the production of fluids from subterranean formations |
| US4144179A (en) | 1975-07-21 | 1979-03-13 | Halliburton Company | Composition for treating low temperature subterranean well formations |
| US4096326A (en) | 1976-10-13 | 1978-06-20 | Hercules Incorporated | Dihydroxypropyl cellulose |
| US4323123A (en) | 1978-07-17 | 1982-04-06 | Phillips Petroleum Company | Gelled compositions and well treating |
| DE3023567A1 (de) * | 1980-06-20 | 1982-01-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Substituierte (beta) -carbolin-3-carbonsaeurederivate |
| NZ194747A (en) * | 1979-08-29 | 1988-11-29 | Schering Ag | 9h-pyrido(3,4-b)indol-3-ylcarboxylic acid derivatives |
| JPS574987A (en) * | 1980-06-09 | 1982-01-11 | Sankyo Co Ltd | Pyridoindolecarboxylic acid derivative and its preparation |
| DE3048318A1 (de) * | 1980-12-17 | 1982-07-22 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-alkoxyalkyl substituierte (beta)-carbolin-3-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3136857A1 (de) * | 1981-09-14 | 1983-03-31 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Substituierte (beta)-carbolin-3-carbonsaeurealkylester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| JPS57123180A (en) * | 1980-12-17 | 1982-07-31 | Schering Ag | 3-substituted beta-carboline, manufacture and psychotropic drug containing same |
| GB2115408B (en) * | 1982-02-09 | 1985-10-16 | Ici Plc | Triazole and imidazole derivatives |
| DE3240513A1 (de) * | 1982-10-29 | 1984-05-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Indolderivate, verfahren zu ihrer herstellung und deren verwendung zur weiterverarbeitung |
| DE3240511A1 (de) * | 1982-10-29 | 1984-05-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von ss-carbolinderivaten |
| DE3322894A1 (de) * | 1983-06-23 | 1985-01-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue (beta)-carboline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel (h) |
-
1983
- 1983-09-27 DE DE3335323A patent/DE3335323A1/de not_active Withdrawn
-
1984
- 1984-09-22 AT AT84111337T patent/ATE55604T1/de not_active IP Right Cessation
- 1984-09-22 DE DE8484111337T patent/DE3482984D1/de not_active Expired - Lifetime
- 1984-09-22 EP EP84111337A patent/EP0137390B1/fr not_active Expired - Lifetime
- 1984-09-25 DK DK456484A patent/DK170256B1/da not_active IP Right Cessation
- 1984-09-25 PT PT79264A patent/PT79264B/pt not_active IP Right Cessation
- 1984-09-25 DD DD84267607A patent/DD223714A5/de not_active IP Right Cessation
- 1984-09-25 ES ES536199A patent/ES536199A0/es active Granted
- 1984-09-26 CA CA000464082A patent/CA1263394A/fr not_active Expired
- 1984-09-26 IE IE2447/84A patent/IE57670B1/en not_active IP Right Cessation
- 1984-09-26 FI FI843777A patent/FI843777L/fi not_active Application Discontinuation
- 1984-09-26 US US06/654,594 patent/US4623649A/en not_active Expired - Fee Related
- 1984-09-26 HU HU843650A patent/HU200457B/hu not_active IP Right Cessation
- 1984-09-26 NO NO843861A patent/NO160998C/no unknown
- 1984-09-26 IL IL73071A patent/IL73071A/xx unknown
- 1984-09-26 AU AU33570/84A patent/AU578043B2/en not_active Ceased
- 1984-09-26 GR GR80482A patent/GR80482B/el unknown
- 1984-09-27 ZA ZA847619A patent/ZA847619B/xx unknown
- 1984-09-27 JP JP59200717A patent/JPS60100577A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NO843861L (no) | 1985-03-28 |
| DK456484D0 (da) | 1984-09-25 |
| IE57670B1 (en) | 1993-02-24 |
| CA1263394A (fr) | 1989-11-28 |
| PT79264A (de) | 1984-10-01 |
| AU3357084A (en) | 1985-04-04 |
| IL73071A (en) | 1988-06-30 |
| ES8505368A1 (es) | 1985-06-01 |
| FI843777L (fi) | 1985-03-28 |
| FI843777A0 (fi) | 1984-09-26 |
| JPH0586390B2 (fr) | 1993-12-10 |
| GR80482B (en) | 1985-01-28 |
| DE3335323A1 (de) | 1985-04-04 |
| HU200457B (en) | 1990-06-28 |
| DK456484A (da) | 1985-03-28 |
| EP0137390B1 (fr) | 1990-08-16 |
| EP0137390A1 (fr) | 1985-04-17 |
| US4623649A (en) | 1986-11-18 |
| PT79264B (de) | 1986-08-08 |
| IE842447L (en) | 1985-03-27 |
| ATE55604T1 (de) | 1990-09-15 |
| HUT35673A (en) | 1985-07-29 |
| IL73071A0 (en) | 1984-12-31 |
| ZA847619B (en) | 1985-05-29 |
| NO160998B (no) | 1989-03-13 |
| JPS60100577A (ja) | 1985-06-04 |
| ES536199A0 (es) | 1985-06-01 |
| NO160998C (no) | 1989-06-21 |
| DE3482984D1 (de) | 1990-09-20 |
| DD223714A5 (de) | 1985-06-19 |
| AU578043B2 (en) | 1988-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK170256B1 (da) | 3-Substituerede beta-carbolinderivater, analogifremgangsmåde til fremstilling heraf samt lægemiddel på basis af samme | |
| JP2716146B2 (ja) | 縮合インドール誘導体およびその製造方法 | |
| US4731358A (en) | β-carbolines and their use as tranquilizers | |
| HU187395B (en) | Process for preparing 3-substituted beta-carboline derivatives | |
| NO851862L (no) | Fremgangsmaate ved fremstilling av nye pyrrolobenzimidazoler | |
| JPS6350354B2 (fr) | ||
| IE910022A1 (en) | Azaoxindole derivatives | |
| NO834609L (no) | Substituerte 5h-pyrimido(5,4-b)indoler, farmasoeytisk preparat inneholdende samme og fremgangsmaate til fremstilling av substituerte 5h-pyrimido(5,4-b)indoler | |
| AU594388B2 (en) | New 3-oxadiazole and 3-carboxylic acid ester beta-carboline derivatives, their production and their use as drugs | |
| WO1999058525A1 (fr) | Derives d'indole agissant comme des ligands de 5-ht2a et comme des inhibiteurs de reabsorption de la serotonine | |
| NO744183L (fr) | ||
| JPH07116184B2 (ja) | ヘテロアリ−ルオキシ−β−カルボリン誘導体、その製法及び該化合物を含有する向精神用薬 | |
| NO160612B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive beta-karbolinderivater. | |
| HU200767B (en) | Process for producing beta-carboline-3-carboxylic acid ethyl ester derivatives and pharmaceutical compositions comprising same | |
| JPH09501949A (ja) | ベンゾジアゼピン受容体部位アゴニスト及びアンタゴニストとしての５−ヘテロアリールインドール誘導体 | |
| Nagarathnam | A facile synthesis of 3‐substituted indoles | |
| KR20060115384A (ko) | 셀렉틴 억제방법 및 이를 위한 조성물 | |
| JPS59118784A (ja) | 置換イミダゾ〔１，５−ａ〕ピリジン及びその製造方法，並びに該化合物を含有する医薬 | |
| DK165179B (da) | N-chlorsulfonyl-3-acyl-2-oxindol-1-carboxamid-forbindelser | |
| US4757070A (en) | 3-oxadiazolyl-5-aminoalkyl-beta-carboline derivatives compositions and use | |
| HU195814B (en) | Process for the production of derivatives of tetrahydrobeta-carbolins and medical preparatives containing thereof | |
| NO173277B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyridobenzoindolderivater | |
| HU194165B (en) | Process for preparing 1,3-oxyacyl-2-oxindole derivatives | |
| HRP940109A2 (en) | Benzylimidazopyridine derivative as angiotenzin receptor antagonist | |
| IE68666B1 (en) | 3-aroyl-2-oxindole-1-carboxamides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) | ||
| PBP | Patent lapsed |