DEV0004499MA - - Google Patents
Info
- Publication number
- DEV0004499MA DEV0004499MA DEV0004499MA DE V0004499M A DEV0004499M A DE V0004499MA DE V0004499M A DEV0004499M A DE V0004499MA
- Authority
- DE
- Germany
- Prior art keywords
- nitric acid
- oxidation
- xylylene dichloride
- acid
- terephthalic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 22
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 20
- 229910017604 nitric acid Inorganic materials 0.000 claims description 20
- ZZHIDJWUJRKHGX-UHFFFAOYSA-N 1,4-bis(chloromethyl)benzene Chemical compound ClCC1=CC=C(CCl)C=C1 ZZHIDJWUJRKHGX-UHFFFAOYSA-N 0.000 claims description 9
- 230000003647 oxidation Effects 0.000 claims description 9
- 238000007254 oxidation reaction Methods 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 claims description 5
- 239000012452 mother liquor Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 1
- 235000019392 nitrosyl chloride Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH471240A (de) | Verfahren zur Herstellung eines Oxydbelages auf einem Körper aus Halbleitermaterial | |
| DE949052C (de) | Verfahren zur Herstellung von Terephthalsaeure aus p-Xylylendichlorid | |
| DEV0004499MA (h) | ||
| DE1133716B (de) | Verfahren zur Herstellung von aliphatischen Di- und Polychlor-verbindungen | |
| DE448009C (de) | Verfahren zur Erzeugung einer rostsicheren Schicht auf Eisen und Stahl | |
| DE574838C (de) | Verfahren zur Darstellung von cyclischen Glykolen und ihren Derivaten bzw. von Ketonen | |
| DE1618245A1 (de) | Verfahren zur gefahrlosen Herstellung von Derivaten des epsilon-Caprolactons | |
| DE953165C (de) | Verfahren zur Herstellung von Terephthalsaeure aus p-Xylylendichlorid | |
| DE955859C (de) | Verfahren zur Herstellung von Terephthalsaeure | |
| DE925288C (de) | Verfahren zum Herstellen von Chlor | |
| DEV0005430MA (h) | ||
| DE329591C (de) | Verfahren zur Darstellung von Oxalsaeure aus Kohlenhydraten durch Oxydation mit Salpetersaeure | |
| DE966055C (de) | Verfahren zur Herstellung von Oximen aliphatischer und cycloaliphatischer Ketone | |
| DE2616768A1 (de) | Verfahren zur regeneration von abfallschwefelsaeure | |
| DE403253C (de) | Verfahren zur Gewinnung von Wasserstoffsuperoxyd | |
| DE899501C (de) | Verfahren zur Herstellung von Isopropylbenzolhydroperoxyd | |
| DE682663C (de) | Verfahren zur Herstellung eines Praeparates aus Hefe | |
| DE1261833B (de) | Verfahren zur Herstellung von Chlor und Alkalinitrat | |
| DE362747C (de) | Verfahren zur Herstellung des ª‰-Chloraethylessigesters | |
| AT11344B (de) | Verfahren zur Herstellung von künstlichem Kampfer. | |
| DE267906C (h) | ||
| DE1903441C (de) | Verfahren zur kontinuierlichen Her Stellung von Glycerin | |
| DE110249C (h) | ||
| DE1060857B (de) | Verfahren zur Herstellung stabiler, hochkonzentrierter Cyclohexanonperoxydloesungen | |
| DE340360C (de) | Verfahren zur Herstellung von hochkonzentrierter Salpetersaeure aus Stickstofftetroxyd, Sauerstoff und Wasser |