DEST004916MA - - Google Patents
Info
- Publication number
- DEST004916MA DEST004916MA DEST004916MA DE ST004916M A DEST004916M A DE ST004916MA DE ST004916M A DEST004916M A DE ST004916MA
- Authority
- DE
- Germany
- Prior art keywords
- oil
- salt
- detergent
- sulfonates
- complex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000003921 oil Substances 0.000 claims description 47
- 150000003839 salts Chemical class 0.000 claims description 37
- 239000011734 sodium Substances 0.000 claims description 30
- 238000010438 heat treatment Methods 0.000 claims description 24
- 239000003208 petroleum Substances 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 18
- 229910052708 sodium Inorganic materials 0.000 claims description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 14
- 150000003871 sulfonates Chemical class 0.000 claims description 13
- 229910019142 PO4 Inorganic materials 0.000 claims description 12
- 239000003599 detergent Substances 0.000 claims description 12
- 239000001488 sodium phosphate Substances 0.000 claims description 12
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical group [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 12
- 239000010452 phosphate Substances 0.000 claims description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 229910052797 bismuth Inorganic materials 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052787 antimony Inorganic materials 0.000 claims description 6
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052785 arsenic Inorganic materials 0.000 claims description 6
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000000344 soap Substances 0.000 claims description 5
- 229910000406 trisodium phosphate Inorganic materials 0.000 claims description 5
- 235000019801 trisodium phosphate Nutrition 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 238000005336 cracking Methods 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 2
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical compound [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229940000489 arsenate Drugs 0.000 claims 1
- AQLMHYSWFMLWBS-UHFFFAOYSA-N arsenite(1-) Chemical compound O[As](O)[O-] AQLMHYSWFMLWBS-UHFFFAOYSA-N 0.000 claims 1
- 150000002902 organometallic compounds Chemical class 0.000 claims 1
- 239000003209 petroleum derivative Substances 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 25
- 235000021317 phosphate Nutrition 0.000 description 9
- 239000000295 fuel oil Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 229910000162 sodium phosphate Inorganic materials 0.000 description 7
- 235000011008 sodium phosphates Nutrition 0.000 description 7
- 239000000654 additive Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 229910052788 barium Inorganic materials 0.000 description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000010687 lubricating oil Substances 0.000 description 3
- 150000003016 phosphoric acids Chemical class 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000013112 stability test Methods 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- QYIPLVLJYQHNDN-UHFFFAOYSA-N 6-(6-methylheptyl)-7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol Chemical compound C(CCCCC(C)C)C12C(C=CC=C1)(O)S2 QYIPLVLJYQHNDN-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- -1 polycyclic hydrocarbons Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000004227 thermal cracking Methods 0.000 description 2
- LJKQIQSBHFNMDV-UHFFFAOYSA-N 7-thiabicyclo[4.1.0]hepta-2,4-dien-6-ol Chemical compound C1=CC=CC2(O)C1S2 LJKQIQSBHFNMDV-UHFFFAOYSA-N 0.000 description 1
- MHUWZNTUIIFHAS-XPWSMXQVSA-N 9-octadecenoic acid 1-[(phosphonoxy)methyl]-1,2-ethanediyl ester Chemical compound CCCCCCCC\C=C\CCCCCCCC(=O)OCC(COP(O)(O)=O)OC(=O)CCCCCCC\C=C\CCCCCCCC MHUWZNTUIIFHAS-XPWSMXQVSA-N 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical class O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZYFVLHYHXNFROE-KRWDZBQOSA-N N'-[(5S)-1-(hydroxyamino)-1-oxononan-5-yl]-N-phenylhexanediamide Chemical compound ONC(CCC[C@H](CCCC)NC(CCCCC(=O)NC1=CC=CC=C1)=O)=O ZYFVLHYHXNFROE-KRWDZBQOSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004523 catalytic cracking Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005608 naphthenic acid group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229940047047 sodium arsenate Drugs 0.000 description 1
- PTLRDCMBXHILCL-UHFFFAOYSA-M sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1792242A1 (de) | Verfahren zum Unterbinden von Kesselsteinbildung | |
| CH634344A5 (de) | Verfahren zum stabilisieren organischer verbindungen gegen autoxydation. | |
| DE1903651A1 (de) | Korrosionsinhibierende Zubereitungen,Verfahren zu ihrer Herstellung und Verfahren zur Korrosionsinhibierung | |
| DE961481C (de) | Verfahren zum Stabilisieren von Heizoelen | |
| DE832030C (de) | Schmiermittel auf Mineraloelbasis | |
| DE2349446A1 (de) | Homogene fluessige zusammensetzung zur stabilisierung von metallseifen | |
| DE1545274A1 (de) | Verfahren zur Verhinderung der Korrosion von Erdoeldestillationsanlagen | |
| DE2229012B2 (de) | Wässrige, Benztriazol und ToIytriazol enthaltende Lösung mit die Korrosion von Metallen hemmender Wirkung | |
| DE2539687A1 (de) | Mittel zur regelung von kesselsteinablagerungen | |
| DE944811C (de) | Das Anlaufen verhindernde Mittel enthaltende Reinigungsmittel | |
| DE1211892B (de) | Nichtwaessriges Phosphatierungsbad | |
| DE1642436C3 (de) | Verfahren zur Verhinderung von steinbildenden Ablagerungen in wäßrigen Systemen | |
| DE1217950B (de) | Verfahren zur Herstellung neuer Perhydrate von Aminoalkylphosphonsaeuren | |
| DE2524543A1 (de) | Bakterizid wirkender zusatz fuer oel-in-wasser-emulsionen | |
| DE1769651B1 (de) | Antikorrosionsadditiv fuer Schmierfette | |
| DEST004916MA (cg-RX-API-DMAC10.html) | ||
| DE1164591B (de) | Verfahren zur Stabilisierung von Kohlenwasserstoffen | |
| EP0094630B1 (de) | Verfahren zum Entfernen von Cadmium aus durch Aufschluss von Rohphosphaten mit Schwefelsäure erhaltener Rohphosphorsäure | |
| DE961478C (de) | Verfahren zum Schutz von Erdoelprodukten gegen Oxydation | |
| DEST004915MA (cg-RX-API-DMAC10.html) | ||
| DE556797C (de) | Verfahren zur Herstellung von oelloeslichen Molybdaenverbindungen | |
| DE875384C (de) | Hochdruckschmieroele | |
| DE2402051A1 (de) | Verfahren zur phosphatierung von metallen | |
| DE947418C (de) | Hochdruckzusatz fuer Schmiermittel | |
| DE753626C (de) | Verfahren zur Verbesserung der oxydationsverhindernden Wirkung von Alkylphenolsulfiden |