DEP0007677MA - - Google Patents
Info
- Publication number
- DEP0007677MA DEP0007677MA DEP0007677MA DE P0007677M A DEP0007677M A DE P0007677MA DE P0007677M A DEP0007677M A DE P0007677MA
- Authority
- DE
- Germany
- Prior art keywords
- compound
- dimethylamino
- oxide
- plants
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 241000196324 Embryophyta Species 0.000 claims description 16
- 241000238631 Hexapoda Species 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- XXWPHBWBNJKLMD-UHFFFAOYSA-N N-[dimethylamino(fluoro)phosphoryl]propan-2-amine Chemical compound CN(C)P(F)(NC(C)C)=O XXWPHBWBNJKLMD-UHFFFAOYSA-N 0.000 claims description 6
- 238000010521 absorption reaction Methods 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 238000002347 injection Methods 0.000 claims description 3
- 239000007924 injection Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 239000000243 solution Substances 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims 4
- 230000009286 beneficial effect Effects 0.000 claims 1
- 239000012895 dilution Substances 0.000 claims 1
- 238000010790 dilution Methods 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- 239000003621 irrigation water Substances 0.000 claims 1
- 235000015097 nutrients Nutrition 0.000 claims 1
- 239000000575 pesticide Substances 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 238000002474 experimental method Methods 0.000 description 8
- PGJBQBDNXAZHBP-UHFFFAOYSA-N Dimefox Chemical compound CN(C)P(F)(=O)N(C)C PGJBQBDNXAZHBP-UHFFFAOYSA-N 0.000 description 6
- 239000002917 insecticide Substances 0.000 description 6
- 241000124008 Mammalia Species 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 231100000419 toxicity Toxicity 0.000 description 5
- 230000001988 toxicity Effects 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 241000700198 Cavia Species 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000723353 Chrysanthemum Species 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- UOSHUBFBCPGQAY-UHFFFAOYSA-N Mipafox Chemical compound CC(C)NP(F)(=O)NC(C)C UOSHUBFBCPGQAY-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- -1 monoisopropylamino Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 101100520660 Drosophila melanogaster Poc1 gene Proteins 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000109852 Macrosiphoniella sanborni Species 0.000 description 1
- 241000171274 Megoura Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 101100520662 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PBA1 gene Proteins 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- YNHXBEVSSILHPI-UHFFFAOYSA-N dimethylamidophosphoric dichloride Chemical compound CN(C)P(Cl)(Cl)=O YNHXBEVSSILHPI-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- MTHFROHDIWGWFD-UHFFFAOYSA-N n-butyl-n-methylbutan-1-amine Chemical compound CCCCN(C)CCCC MTHFROHDIWGWFD-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- HHFOOWPWAXNJNY-UHFFFAOYSA-N promoxolane Chemical compound CC(C)C1(C(C)C)OCC(CO)O1 HHFOOWPWAXNJNY-UHFFFAOYSA-N 0.000 description 1
- 229950008352 promoxolane Drugs 0.000 description 1
- GFKPETVGJZJVHZ-UHFFFAOYSA-N propan-2-amine;hydrofluoride Chemical compound F.CC(C)N GFKPETVGJZJVHZ-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD246245A5 (de) | Herbizide zusammensetzung | |
| DE1046938B (de) | Schaedlingsbekaempfungsmittel | |
| DE1217695B (de) | Insekticide Mittel mit acaricider Wirkung | |
| DE69515881T2 (de) | Pestizide zusammensetzungen, die ethoxylierte fettamine zur steigerung der effektivität von endothall und dessen salzen enthalten. | |
| DE944404C (de) | Insektenbekaempfungsmittel | |
| DE1567084A1 (de) | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses | |
| DEP0007677MA (Home) | ||
| DE1158745B (de) | Nematodicide Mittel | |
| DE956549C (de) | Schaedlings- und Pflanzenvernichtungsmittel | |
| DE1801861A1 (de) | Phytologisch wirksame Mittel und die darin enthaltenen chemischen Wirkstoffe sowie hiermit durchgefuehrte Pflanzenbehandlungsverfahren | |
| DE2425237A1 (de) | Organophosphorverbindungen | |
| DE2805941C2 (de) | Hydraziniumphosphite, ihre Herstellung und funigzide Zusammensetzungen | |
| EP0005227B1 (de) | Akarizide und insektizide Mittel sowie deren Verwendung zur Schädlingsbekämpfung | |
| DE69411962T2 (de) | Natürliches Verbesserungsmittel zum Schutz von Pflanzen gegen Pathogene und zur Stimulation des Pflanzenwachstums | |
| DD236868A5 (de) | Mittel zum protahieren der wirkungsdauer und zur erhoehung der selektivitaet von herbiziden zusammensetzungen | |
| DE937497C (de) | Behandlung von Pflanzen zwecks Bekaempfung von Krankheitserregern | |
| DE2041627C3 (de) | Pestizide Mittel | |
| AT329925B (de) | Systemisch wirkende fungizide | |
| DE952666C (de) | Behandlung von Pflanzen zwecks Bekaempfung von tierischen Parasiten sowie von Krankheitserregern | |
| AT253861B (de) | Insektizide Mischung | |
| DE976686C (de) | Fungicides Mittel | |
| DE1075373B (de) | Insektenbekämpfungsmittel | |
| DE2513864A1 (de) | Heterocyclische verbindungen und verfahren zur herstellung derselben | |
| DE2512556A1 (de) | Cyclische diphosphorverbindungen | |
| DE1200060B (de) | Insektizides und acarizides Mittel |