DEN0008040MA - - Google Patents
Info
- Publication number
- DEN0008040MA DEN0008040MA DEN0008040MA DE N0008040M A DEN0008040M A DE N0008040MA DE N0008040M A DEN0008040M A DE N0008040MA
- Authority
- DE
- Germany
- Prior art keywords
- cellulose
- silicon dioxide
- sodium
- added
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 29
- 239000000377 silicon dioxide Substances 0.000 claims description 14
- 235000012239 silicon dioxide Nutrition 0.000 claims description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000001913 cellulose Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 8
- 229920003086 cellulose ether Polymers 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 5
- 239000006185 dispersion Substances 0.000 claims description 5
- 235000019353 potassium silicate Nutrition 0.000 claims description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 2
- 238000001035 drying Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000004115 Sodium Silicate Substances 0.000 description 3
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000011363 dried mixture Substances 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1239284B (de) | Verfahren zur Herstellung von in Wasser leicht gelierbaren Carboxymethylderivaten der Amylose oder der Staerke | |
| DE2840011C2 (de) | Verfahren zur Herstellung hoch substituierter Polysaccharide | |
| EP0319865A2 (de) | Carboxymethylsulfoethylcellulose und Verfahren zu ihrer Herstellung | |
| DE956125C (de) | Verfahren zur Herstellung eines Siliciumdioxyd enthaltenden, wasserloeslichen Celluloseaethers | |
| DE1244145B (de) | Verfahren zum Reinigen von wasserloeslicher Hydroxyaethylcellulose | |
| DE1668308B2 (de) | Verfahren zur Reinigung von roher, wasserlösliche Salze enthaltender Hydroxyläthylcellulose | |
| DEN0008040MA (show.php) | ||
| DE2535311A1 (de) | Verfahren zur herstellung von celluloseaethern mit verbesserter dispergierbarkeit in waessrigen fluessigkeiten und nach dem verfahren hergestellte celluloseaether | |
| DE3151681A1 (de) | "hydroxyalkylcellulosen mit verbesserter stabilitaet gegen abbau, verfahren zu ihrer herstellung und ihre verwendung" | |
| DE322586C (de) | Verfahren zur Darstellung von Cellulosederivaten | |
| DE1205217B (de) | Verfahren zur Herstellung ueberzogener Barium-silicat-Teilchen | |
| DE1801553A1 (de) | Verfahren zur Herstellung von Carboxymethylcellulose mit glattem,langfliessendem Loesungsverhalten | |
| DE712666C (de) | Verfahren zur Herstellung von in Wasser loeslichen oder quellbaren Holzveredlungsprodukten | |
| DE731794C (de) | Verfahren zur Herstellung von Alkalisalzen der Celluloseaethercarbonsaeuren, die mit Wasser Loesungen von erhoehter Viskositaet ergeben | |
| DE851947C (de) | Verfahren zur Herstellung von Cyanaethylaethern der Cellulose | |
| DE711429C (de) | Verfahren zur Herstellung von alkaliloeslichen Salzen von Celluloseaethercarbonsaeuren | |
| DE693030C (de) | Verfahren zur Herstellung von hochmolekularen Kohlenhydrataethern | |
| DE408523C (de) | Verfahren zur Herstellung von Staerkeemulsionen | |
| CH258295A (de) | Verfahren zur Herstellung von in Alkalien löslichem Zelluloseoxyäthyläther. | |
| AT221535B (de) | Verfahren zur Herstellung von neuen wasserlöslichen, polymerisierbaren Allyl-carboxymethel-Mischäthern der Cellulose | |
| DE2138905A1 (de) | Kornförmige substituierte Cellulose | |
| DE519138C (de) | Verfahren zur Herstellung neuartiger Cellulosederivate | |
| AT102306B (de) | Verfahren zur Herstellung von neuen Zellulosederivaten. | |
| DE511019C (de) | Verfahren zur Verbesserung von Celluloseaethern | |
| DE869946C (de) | Verfahren zur Herstellung wasserloeslicher Celluloseaether |