DEI0007270MA - - Google Patents
Info
- Publication number
- DEI0007270MA DEI0007270MA DEI0007270MA DE I0007270M A DEI0007270M A DE I0007270MA DE I0007270M A DEI0007270M A DE I0007270MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- anhydride
- ethylene oxide
- chlorinated diphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000008064 anhydrides Chemical class 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 7
- 125000006267 biphenyl group Chemical group 0.000 claims description 7
- 239000000057 synthetic resin Substances 0.000 claims description 6
- 229920003002 synthetic resin Polymers 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229920005989 resin Polymers 0.000 claims description 4
- 239000011347 resin Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000203 mixture Substances 0.000 description 7
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 5
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 5
- 238000005266 casting Methods 0.000 description 3
- 239000011253 protective coating Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- -1 B. maleic anhydride Chemical class 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- GGMPTLAAIUQMIE-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobiphenyl Chemical group ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=CC=CC=C1 GGMPTLAAIUQMIE-UHFFFAOYSA-N 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000221013 Viscum album Species 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940116901 diethyldithiocarbamate Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- QJIJQNUQORKBKY-UHFFFAOYSA-N piperidin-1-ium;benzoate Chemical compound C1CCNCC1.OC(=O)C1=CC=CC=C1 QJIJQNUQORKBKY-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1910758A1 (de) | Verfahren zum Haerten von Polyepoxiden | |
| DE1096600B (de) | Verfahren zur Herstellung ausgehaerteter Kunstharze durch Umsetzung von Epoxydgruppen aufweisenden Kunstharzen | |
| DE2019816A1 (de) | Formmassen aus Epoxyharzen | |
| DE1494525C3 (de) | Härtbare Kunststoffmischungen | |
| DE1745795B2 (de) | Verfahren zur Herstellung von Epoxy gruppen enthaltenden Reaktions produkten | |
| DE1520862B2 (de) | Verfahren zur herstellung von formkoerpern | |
| DE1283527C2 (de) | Form- oder ueberzugsmassen, die mehrwertige epoxyde enthalten | |
| DE2811476B2 (de) | Härtbare Gemische und ihre Verwendung zur Herstellung von Formteilen | |
| DE1041246B (de) | Verfahren zur Herstellung kalt- oder warmgehaerteter modifizierter Epoxyharze | |
| DE2254487C2 (de) | Heisshärtbare Mischungen auf Epoxidharzbasis | |
| DE2811475C3 (de) | Verfahren zur Herstellung von porösen Behältern | |
| DEI0007270MA (enrdf_load_stackoverflow) | ||
| DE1932305A1 (de) | Verfahren zur Herstellung von Epoxydharzformstoffen | |
| DE3442375A1 (de) | Selbstloeschende epoxykunststoffe, epoxyharzzusammensetzung und die verwendung derselben fuer elektrische zwecke | |
| DE1033410B (de) | Viskositaetserhoehung der Loesungen von haertbaren Organopolysiloxanharzen | |
| DE1019083B (de) | Verfahren zur Herstellung von Kunststoffen durch Haerten von Epoxyverbindungen | |
| DE1040783B (de) | Verfahren zur Herstellung von gehaerteten Kunststoffen auf Grundlage von Polyestern und Epoxyverbindungen | |
| DE1103023B (de) | Verfahren zum Haerten von Epoxyharzen | |
| DE1107934B (de) | Hitzehaertbare, plastische Form-, Kleb- und UEberzugsmasse | |
| DE1035897B (de) | Verfahren zur Haertung von Epoxyharzen | |
| DE1570408A1 (de) | Epoxydharz-Pressmassen | |
| DE1113812B (de) | Verfahren zur Herstellung von gefuellten kriechstromfesten Kunststoffen auf Grundlage von Epoxyharzen | |
| DE888293C (de) | Verfahren zur Herstellung durch Hitze haertbarer, chemikalienfeste UEberzuege ergebender Harnstoff-Formaldehydharze | |
| AT233836B (de) | Verfahren zum Härten von Epoxydharzen bei Raumtemperatur | |
| AT237167B (de) | Verfahren zum Härten von insbesondere als 2-Komponentenkleber oder Spachtelmassen verwendeten, kalthärtenden Kunstharzen |