DEF0017464MA - - Google Patents
Info
- Publication number
- DEF0017464MA DEF0017464MA DEF0017464MA DE F0017464M A DEF0017464M A DE F0017464MA DE F0017464M A DEF0017464M A DE F0017464MA
- Authority
- DE
- Germany
- Prior art keywords
- amino
- methyl
- thiochromones
- thiochromanones
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 S-Amino-S-methyl-thiochromenones Chemical class 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 10
- WSGFMNIFJJFMRP-UHFFFAOYSA-N 5-amino-8-methyl-3,4-dihydrothiochromen-2-one Chemical class NC1=C2CCC(SC2=C(C=C1)C)=O WSGFMNIFJJFMRP-UHFFFAOYSA-N 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 150000001414 amino alcohols Chemical class 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 150000002825 nitriles Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- FLGZHHJNRZUPIL-UHFFFAOYSA-N chromene-4-thione Chemical compound C1=CC=C2C(=S)C=COC2=C1 FLGZHHJNRZUPIL-UHFFFAOYSA-N 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 150000002466 imines Chemical class 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 201000004409 schistosomiasis Diseases 0.000 description 5
- 239000003921 oil Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CJKRXEBLWJVYJD-UHFFFAOYSA-N N,N'-diethylethylenediamine Chemical compound CCNCCNCC CJKRXEBLWJVYJD-UHFFFAOYSA-N 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- KGBXHAVIEYXXRU-UHFFFAOYSA-N 2h-thiopyran 1-oxide Chemical group O=S1CC=CC=C1 KGBXHAVIEYXXRU-UHFFFAOYSA-N 0.000 description 1
- GUFIAHXZZSDQBB-UHFFFAOYSA-N 5-[2-(diethylamino)ethylamino]-3,8-dimethyl-3,4-dihydrothiochromen-2-one Chemical compound C(C)N(CC)CCNC1=C2CC(C(SC2=C(C=C1)C)=O)C GUFIAHXZZSDQBB-UHFFFAOYSA-N 0.000 description 1
- RWDOZGUXWFFODF-UHFFFAOYSA-N 5-[2-(diethylamino)ethylamino]-8-methyl-3,4-dihydrothiochromen-2-one Chemical compound C(C)N(CC)CCNC1=C2CCC(SC2=C(C=C1)C)=O RWDOZGUXWFFODF-UHFFFAOYSA-N 0.000 description 1
- OGEZGAWRAGSJOQ-UHFFFAOYSA-N 5-amino-2,8-dimethylchromene-4-thione Chemical compound CC=1OC2=C(C=CC(=C2C(C1)=S)N)C OGEZGAWRAGSJOQ-UHFFFAOYSA-N 0.000 description 1
- IYKKNXHAITVLGN-UHFFFAOYSA-N 5-amino-3-methoxy-8-methylchromene-4-thione Chemical compound COC1=COC2=C(C=CC(=C2C1=S)N)C IYKKNXHAITVLGN-UHFFFAOYSA-N 0.000 description 1
- KLGVOLWBHYUTSE-UHFFFAOYSA-N 5-amino-8-methylchromene-4-thione Chemical compound NC1=C2C(C=COC2=C(C=C1)C)=S KLGVOLWBHYUTSE-UHFFFAOYSA-N 0.000 description 1
- YVGRWAZOAGMHNY-UHFFFAOYSA-N 5-chloro-3,8-dimethyl-3,4-dihydrothiochromen-2-one Chemical compound ClC1=C2CC(C(SC2=C(C=C1)C)=O)C YVGRWAZOAGMHNY-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008378 aryl ethers Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 208000037972 tropical disease Diseases 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 150000007964 xanthones Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH422758A (de) | Verfahren zur Herstellung neuer quaternärer Ammoniumverbindungen | |
| EP0428939B1 (de) | Cumarinderivate, Verfahren zu ihrer Herstellung, ihre Verwendung und Thiazolyl-essigsäurederivate als Zwischenprodukte | |
| DE941288C (de) | Verfahren zur Herstellung substituierter 2-Imino-4-thiazoline oder von Salzen derselben bzw. von substituierten 2-Aminothiazolen | |
| DEF0017464MA (pl) | ||
| DE919107C (de) | Verfahren zur Herstellung von Xanthenen oder Thioxanthenen | |
| DE954599C (de) | Verfahren zur Herstellung von Derivaten des 5-Amino-8-methyl-thiochromanons und -thiochromons | |
| DE2114884A1 (de) | Basisch substituierte Derivate des 1(2H)-Phthalazinons | |
| DE1206879B (de) | Verfahren zur Herstellung von p-Aminoarylaldehyden | |
| DE1926076B2 (de) | 3-(3-Amino-2-hydroxy-propyl)-6,7>8trimethoxy-SH-M^-benzotriazin^-on-Derivate und ihre Herstellung | |
| DE488890C (de) | Verfahren zur Darstellung von Aminoalkylaminosubstitutionsprodukten der Acridinreihe | |
| DE1046063B (de) | Verfahren zur Herstellung neuer, amoebicid wirkender Acetanilide | |
| DE544087C (de) | Verfahren zur Darstellung aromatischer N-Dialkylaminoalkylaminoaldehyde und ihrer Derivate | |
| DE954155C (de) | Verfahren zur Herstellung von 4-Aminochromanen | |
| AT242132B (de) | Verfahren zur Herstellung von neuen Succinimidderivaten | |
| DE695331C (de) | Verfahren zur Herstellung organischer Sulfonsaeureamide | |
| AT212470B (de) | Verfahren zur Herstellung von neuen Oxydationsfarbstoffen | |
| DE1911893A1 (de) | Verfahren zur Herstellung von N-(Halogen-aryl)-2-methyl-5-alkoxy-indol-3-essigsaeuren | |
| DE916055C (de) | Verfahren zur Herstellung von Aminoverbindungen | |
| DE905244C (de) | Verfahren zur Herstellung neuer Thioaether und ihrer quaternaeren und Saeuresalze | |
| AT329052B (de) | Verfahren zur herstellung neuer phthalimidinderivate | |
| DEH0024974MA (pl) | ||
| DE1812135A1 (de) | 1,2,3,4-Tetrahydrochinoline | |
| DE1112251B (de) | Roentgenkontrastmittel | |
| DE1035142B (de) | Verfahren zur Herstellung von diquartaeren Salzen von Pyrimidylaminochinolinabkoemmlingen | |
| DE1001277B (de) | Verfahren zur Herstellung von lokalanaesthetisch wirksamen Dialkylaminoacylaniliden |