DEF0016187MA - - Google Patents
Info
- Publication number
- DEF0016187MA DEF0016187MA DEF0016187MA DE F0016187M A DEF0016187M A DE F0016187MA DE F0016187M A DEF0016187M A DE F0016187MA
- Authority
- DE
- Germany
- Prior art keywords
- red
- amino group
- ivb
- amino
- monoazo dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000975 dye Substances 0.000 claims description 15
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 230000001808 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 239000011528 polyamide (building material) Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 229920002955 Art silk Polymers 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 210000004940 Nucleus Anatomy 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229960000583 Acetic Acid Drugs 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N Nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N Sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- -1 amino group Amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 235000019571 color Nutrition 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- RNCAJLLRSYSZAM-UHFFFAOYSA-N diazinane-3,6-dione Chemical compound O=C1CCC(=O)NN1 RNCAJLLRSYSZAM-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N sulfonic acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644177B2 (de) | Verfahren zur Herstellung sulfonsäuregruppenfreier Monoazofarbstoffe | |
| DE1644150A1 (de) | Wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung und Verwendung | |
| DE1769398C3 (de) | Wasserlösliche Phthalocyanin-Azofarbstoffe sowie Verfahren zu deren Herstellung und deren Verwendung | |
| DE963093C (de) | Verfahren zur Herstellung wasserunloeslicher Disazofarbstoffe | |
| DE951525C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DEF0016187MA (hu) | ||
| DE574463C (de) | Verfahren zur Darstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE942221C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE953548C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE636952C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| AT211447B (de) | Verfahren zur Herstellung neuer, wasserlöslicher Azofarbstoffe | |
| DE515231C (de) | Verfahren zur Darstellung von Disazofarbstoffen | |
| DE692648C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE928902C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE513763C (de) | Verfahren zur Herstellung von zum Faerben von Acetylcellulose geeigneten Disazofarbstoffen | |
| DE634005C (de) | Verfahren zur Herstellung von Wasserloeslichen Monoaxofarbstoffen | |
| DE633266C (de) | Verfahren zur Herstellung von o-Oxyazofarbstoffen | |
| DE767692C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe | |
| DE1005926B (de) | Verfahren zum Faerben von Polyterephthalsaeureglykolesterfasern | |
| DE2111734A1 (de) | Azofarbstoffe,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE621394C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DEF0016186MA (hu) | ||
| DE548393C (de) | Verfahren zur Darstellung von Monoazofarbstoffen | |
| DE1260654B (de) | Verfahren zur Herstellung von Monoazofarbstoffen |