DEF0015148MA - - Google Patents
Info
- Publication number
- DEF0015148MA DEF0015148MA DEF0015148MA DE F0015148M A DEF0015148M A DE F0015148MA DE F0015148M A DEF0015148M A DE F0015148MA
- Authority
- DE
- Germany
- Prior art keywords
- dye
- quinone
- glacial acetic
- acetic acid
- dichloropyrene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- 229960000583 acetic acid Drugs 0.000 claims description 5
- 239000012362 glacial acetic acid Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 4
- 239000000984 vat dye Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000975 dye Substances 0.000 description 16
- 238000004043 dyeing Methods 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000007639 printing Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 150000001243 acetic acids Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- ACCZVDBKHUXECO-UHFFFAOYSA-N 3,4,5,6-tetrachloropyrene-1,2-dione Chemical compound C1=CC(C(C(=O)C=2Cl)=O)=C3C=2C(Cl)=C(Cl)C2=C3C1=CC=C2Cl ACCZVDBKHUXECO-UHFFFAOYSA-N 0.000 description 1
- 229940122930 Alkalising agent Drugs 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- -1 kolloplex Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- CJABVFCUCRAVOK-UHFFFAOYSA-N pyrene-1,2-dione Chemical class C1=C2C(=O)C(=O)C=C(C=C3)C2=C2C3=CC=CC2=C1 CJABVFCUCRAVOK-UHFFFAOYSA-N 0.000 description 1
- 150000003220 pyrenes Chemical class 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2122521C3 (de) | Modifiziertes Diarylidpigment und Verfahren zu seiner Herstellung | |
| DE949942C (de) | Verfahren zur Herstellung eines fein vertrilten Kuepenfarbstoffes | |
| DE2705107C2 (lt) | ||
| DEF0015148MA (lt) | ||
| DE2301638C3 (de) | Verfahren zur Herstellung von sulfongruppenhaltigen Phenol-Formaldehyd-Kondensationsprodukten | |
| DE313724C (lt) | ||
| CH337286A (de) | Verfahren zur Überführung eines Küpenfarbstoffes in feine Verteilung | |
| DE909384C (de) | Verfahren zur Herstellung von wasserloeslichen Schwefelsaeurehalbestersalzen von Leuko-Anthrachinonverbindungen | |
| EP0018008A2 (de) | Verfahren zur Herstellung von lasierenden Pigmentformen des 4,4',7,7'-Tetrachlorthioindigo | |
| DE897092C (de) | Farbstoffpraeparate zum Faerben und Bedrucken von Textilstoffen aller Art | |
| DE707419C (de) | Verfahren zur Herstellung spinngefaerbter kuenstlicher Gebilde, insbesondere Eaeden,aus regenerierter Cellulose | |
| AT166228B (de) | Farbstoffpräparate bzw. Färbebäder, insbesondere zum Färben von Celluloseestern. | |
| DE523464C (de) | Verfahren zur Herstellung von Farblacken | |
| DE462041C (de) | Verfahren zur Herstellung der ªÏ-Methylsulfonsaeuren von Diaminoanthrachinonen | |
| DE733754C (de) | Verfahren zur Herstellung von stickstoffhaltigen Anthrachinonfarbstoffen | |
| DE611966C (de) | Verfahren zur Herstellung von Farbstoffen der Azinreihe | |
| DE890404C (de) | Verfahren zur Herstellung von wasserloeslichen Schwefelsaeureestersalzen von Leuko-Kuepenfarbstoffen | |
| AT78396B (de) | Verfahren zum Gerben tierischer Häute und zur Herstellung von Gerbmitteln. | |
| DE899200C (de) | Verfahren zur Herstellung von 2, 7-Diaminodibenzothiophendioxyd-3, 6-disulfonsaeure | |
| DE843724C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen der Phthalocyaninreihe | |
| DE179020C (lt) | ||
| DE861300C (de) | Verfahren zur Herstellung von Kobaltphthalocyanin | |
| DE626862C (de) | Verfahren zum Drucken von pflanzlichen Fasern | |
| EP0012369A1 (de) | Verfahren zur Herstellung von lasierenden Pigmentformen des Indanthrons und des chlorierten Indanthrons | |
| DE2417253C2 (de) | Flüssige Farbstoffzubereitungen eines Reaktivfarbstoffes |