DE974477C - Verfahren zur Reinigung aliphatischer Alkohole - Google Patents
Verfahren zur Reinigung aliphatischer AlkoholeInfo
- Publication number
- DE974477C DE974477C DEST810A DEST000810A DE974477C DE 974477 C DE974477 C DE 974477C DE ST810 A DEST810 A DE ST810A DE ST000810 A DEST000810 A DE ST000810A DE 974477 C DE974477 C DE 974477C
- Authority
- DE
- Germany
- Prior art keywords
- alcohol
- water
- column
- percent
- distillation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 21
- -1 aliphatic alcohols Chemical class 0.000 title claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 117
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 95
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 78
- 238000004821 distillation Methods 0.000 claims description 55
- 238000010992 reflux Methods 0.000 claims description 43
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 32
- 239000003921 oil Substances 0.000 claims description 31
- 239000012535 impurity Substances 0.000 claims description 27
- 238000009835 boiling Methods 0.000 claims description 26
- 150000001298 alcohols Chemical class 0.000 claims description 24
- 239000002904 solvent Substances 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 17
- 238000000895 extractive distillation Methods 0.000 claims description 13
- 229920000642 polymer Polymers 0.000 claims description 12
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 claims description 10
- 239000007788 liquid Substances 0.000 claims description 10
- 230000036571 hydration Effects 0.000 claims description 9
- 238000006703 hydration reaction Methods 0.000 claims description 9
- 150000001336 alkenes Chemical class 0.000 claims description 7
- 239000008346 aqueous phase Substances 0.000 claims description 5
- 238000005194 fractionation Methods 0.000 claims description 5
- 238000000746 purification Methods 0.000 claims description 5
- 239000000356 contaminant Substances 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims description 2
- 239000012530 fluid Substances 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 235000019441 ethanol Nutrition 0.000 description 127
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- 238000000926 separation method Methods 0.000 description 15
- 239000000126 substance Substances 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 150000002430 hydrocarbons Chemical class 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000000605 extraction Methods 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 9
- 238000011068 loading method Methods 0.000 description 9
- 230000003287 optical effect Effects 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000001476 alcoholic effect Effects 0.000 description 5
- 238000004140 cleaning Methods 0.000 description 5
- 239000000470 constituent Substances 0.000 description 5
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 230000000630 rising effect Effects 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 150000003464 sulfur compounds Chemical class 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 description 2
- HSJKGGMUJITCBW-UHFFFAOYSA-N 3-hydroxybutanal Chemical compound CC(O)CC=O HSJKGGMUJITCBW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- SYJRVVFAAIUVDH-UHFFFAOYSA-N ipa isopropanol Chemical compound CC(C)O.CC(C)O SYJRVVFAAIUVDH-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000005673 monoalkenes Chemical class 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- HNFSPSWQNZVCTB-UHFFFAOYSA-N 2-methyl-2-propan-2-yloxypropane Chemical compound CC(C)OC(C)(C)C HNFSPSWQNZVCTB-UHFFFAOYSA-N 0.000 description 1
- HTXWKZDRDRFVHN-UHFFFAOYSA-N 2-methyloxiran-2-ol Chemical compound CC1(O)CO1 HTXWKZDRDRFVHN-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000008141 laxative Substances 0.000 description 1
- 230000002475 laxative effect Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000011017 operating method Methods 0.000 description 1
- 238000000424 optical density measurement Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005606 polypropylene copolymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008137 solubility enhancer Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D3/00—Distillation or related exchange processes in which liquids are contacted with gaseous media, e.g. stripping
- B01D3/34—Distillation or related exchange processes in which liquids are contacted with gaseous media, e.g. stripping with one or more auxiliary substances
- B01D3/40—Extractive distillation
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68453A US2663679A (en) | 1948-12-31 | 1948-12-31 | Extractive distillation of alcohols obtained from olefins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE974477C true DE974477C (de) | 1961-01-05 |
Family
ID=22188456
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEST810A Expired DE974477C (de) | 1948-12-31 | 1950-04-01 | Verfahren zur Reinigung aliphatischer Alkohole |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US2663679A (en, 2012) |
| BE (1) | BE494834A (en, 2012) |
| DE (1) | DE974477C (en, 2012) |
| FR (2) | FR975923A (en, 2012) |
| GB (1) | GB673768A (en, 2012) |
| NL (1) | NL78159C (en, 2012) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997008120A1 (de) * | 1995-08-30 | 1997-03-06 | Basf Aktiengesellschaft | Verfahren zur abtrennung von butanol und dibutylether mit hilfe einer zweidruckdestillation |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2791550A (en) * | 1957-05-07 | Resolution of aqueous carbonyl-carbinol mixtures | ||
| US2729682A (en) * | 1950-05-20 | 1956-01-03 | Exxon Research Engineering Co | Preparation of isopropanol of improved odor quality |
| US2878167A (en) * | 1952-11-25 | 1959-03-17 | Melle Usines Sa | Manufacture of highly pure ethyl alcohol |
| US2801211A (en) * | 1954-10-12 | 1957-07-30 | Nat Petro Chem | Purification of ethanol |
| US2801210A (en) * | 1954-11-16 | 1957-07-30 | Nat Petro Chem | Extractive distillation process for the purification of ethanol |
| US2801209A (en) * | 1954-11-16 | 1957-07-30 | Nat Petro Chem | Alcohol purification process |
| US2836545A (en) * | 1954-12-23 | 1958-05-27 | Exxon Research Engineering Co | Water extractive distillation of ethanol |
| US2875138A (en) * | 1955-01-17 | 1959-02-24 | Exxon Research Engineering Co | Purification of secondary butyl alcohol |
| US2865818A (en) * | 1955-06-13 | 1958-12-23 | Nat Petro Chem | Processing of alcohols |
| US2993840A (en) * | 1957-10-07 | 1961-07-25 | Melle Usines Sa | Process of producing highly pure alcohol by extractive distillation with water |
| DE1196635B (de) * | 1959-09-18 | 1965-07-15 | Kurashiki Rayon Co | Verfahren zur Trennung von Gemischen aus Carbonsaeureestern und den entsprechenden Alkoholen |
| NL268208A (en, 2012) * | 1960-08-15 | |||
| US3331757A (en) * | 1964-03-14 | 1967-07-18 | Kyowa Hakko Kogyo Kk | Distillation of crotyl alcohol-butanol mixture with water addition |
| US3406100A (en) * | 1966-12-16 | 1968-10-15 | Chemical Construction Corp | Purification of synthetic methanol by extractive distillation and subsequent distillation with plural side stream purges |
| US3445345A (en) * | 1968-05-08 | 1969-05-20 | Raphael Katzen Associates | Extractive distillation of c1 to c3 alcohols and subsequent distillation of purge streams |
| US3847756A (en) * | 1972-11-09 | 1974-11-12 | Eastman Kodak Co | Recovery of diethyl ether from an olefin hydration product stream by extractive distillation with water |
| IE48505B1 (en) * | 1978-10-28 | 1985-02-06 | Bp Chem Int Ltd | Improved method of producing ethanol-water azeotrope from crude ethanol |
| JPS6051451B2 (ja) * | 1978-11-06 | 1985-11-14 | 三菱レイヨン株式会社 | 第３級ブチルアルコ−ルの製造法 |
| NL190870C (nl) * | 1979-10-16 | 1994-10-03 | Sumitomo Chemical Co | Werkwijze voor het zuiveren van ruwe beta-fenethylalcohol. |
| US4601791A (en) * | 1985-07-15 | 1986-07-22 | Lloyd Berg | Separation of n-propanol from allyl alcohol by extractive distillation |
| US5718810A (en) * | 1996-03-19 | 1998-02-17 | The Dow Chemical Company | Methanol recovery using extractive distillation |
| US5759359A (en) * | 1997-09-08 | 1998-06-02 | Berg; Lloyd | Separation of 2-butanol from tert.amyl alcohol by azeotropic distillation |
| US6906229B1 (en) | 2000-02-29 | 2005-06-14 | Exxonmobil Chemical Patents, Inc. | Process for hydrolyzing di-isopropyl ether to isopropyl alcohol by catalytic distillation using a solid acid catalyst |
| US9593090B2 (en) | 2013-07-29 | 2017-03-14 | Lyondell Chemical Technology, L.P. | Alkylene oxide separation systems, methods, and apparatuses |
| CN106659945B (zh) * | 2014-07-08 | 2019-07-05 | 巴斯夫欧洲公司 | 具有通过使用选择性溶剂的萃取蒸馏来分离烃和/或烃的衍生物的混合物的分离用装置的塔 |
| RU2667286C1 (ru) * | 2018-03-23 | 2018-09-18 | Никита Вячеславович Малыхин | Ректификационная колонна и способ очистки спирта с ее применением |
| ES2889223T3 (es) * | 2019-05-06 | 2022-01-11 | Gea Wiegand Gmbh | Procedimiento e instalación para separar terpenos de una mezcla acuosa de alcohol |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB191105794A (en) * | 1911-03-08 | 1911-05-18 | Sarah Jane Hudson | An Improved Liquid Rouge Compound. |
| US2080111A (en) * | 1934-05-28 | 1937-05-11 | Monsanto Chemicals | Purification of alcohols obtained from olefines |
| US2148846A (en) * | 1936-04-11 | 1939-02-28 | Firm Of Deutsche Gold Und Silb | Process for the separation of alcohol from the first runnings |
| US2290442A (en) * | 1938-07-27 | 1942-07-21 | Dizem Sa | Process for the rectification of impure alcoholic liquids |
| US2339576A (en) * | 1941-04-28 | 1944-01-18 | Shell Dev | Separation of phenols from thiophenols |
| US2357028A (en) * | 1943-08-04 | 1944-08-29 | Shell Dev | Solvent extraction process |
| US2455803A (en) * | 1944-02-11 | 1948-12-07 | Shell Dev | Extractive distillation process |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US996328A (en) * | 1902-03-26 | 1911-06-27 | Emile Guillaume | Process for the distillation of alcoholic liquids. |
| US887793A (en) * | 1902-12-09 | 1908-05-19 | Emile Guillaume | Rectifying of alcoholic liquid. |
| GB304756A (en) * | 1928-01-26 | 1929-11-28 | Distilleries Des Deux Sevres | Improvements relating to the separation of liquids by distillation |
| US2198651A (en) * | 1936-10-31 | 1940-04-30 | Celanese Corp | Organic compound |
| US2179991A (en) * | 1937-01-09 | 1939-11-14 | Eastman Kodak Co | Process for the separation of methanol and acetone mixtures |
| US2215915A (en) * | 1937-08-17 | 1940-09-24 | Standard Oil Co California | Selective solvent extraction of petroleum |
| US2283911A (en) * | 1939-09-07 | 1942-05-26 | Eastman Kodak Co | Method for treating unsaturated ketones containing aldehyde |
| US2321748A (en) * | 1940-05-04 | 1943-06-15 | Du Pont | Separation of mixtures of methanol and butyraldehyde |
| US2324755A (en) * | 1940-06-14 | 1943-07-20 | Standard Alcohol Co | Distillation process |
| US2339160A (en) * | 1940-08-02 | 1944-01-11 | Shell Dev | Distillation process |
| US2290636A (en) * | 1940-12-24 | 1942-07-21 | Shell Dev | Distillation process |
| US2360655A (en) * | 1940-12-24 | 1944-10-17 | Shell Dev | Distillation process |
| US2379110A (en) * | 1942-07-01 | 1945-06-26 | Shell Dev | Distillation process |
| US2377049A (en) * | 1942-11-03 | 1945-05-29 | Shell Dev | Extraction process |
| US2551593A (en) * | 1947-01-28 | 1951-05-08 | Standard Oil Dev Co | Extractive distillation of alcohols from close-boiling aqueous mixtures |
-
1948
- 1948-12-07 FR FR975923D patent/FR975923A/fr not_active Expired
- 1948-12-31 US US68453A patent/US2663679A/en not_active Expired - Lifetime
-
1949
- 1949-04-01 US US84987A patent/US2610141A/en not_active Expired - Lifetime
-
1950
- 1950-03-10 GB GB6070/50A patent/GB673768A/en not_active Expired
- 1950-03-20 FR FR60565D patent/FR60565E/fr not_active Expired
- 1950-03-20 NL NL152416A patent/NL78159C/xx active
- 1950-03-29 BE BE494834D patent/BE494834A/xx unknown
- 1950-04-01 DE DEST810A patent/DE974477C/de not_active Expired
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB191105794A (en) * | 1911-03-08 | 1911-05-18 | Sarah Jane Hudson | An Improved Liquid Rouge Compound. |
| US2080111A (en) * | 1934-05-28 | 1937-05-11 | Monsanto Chemicals | Purification of alcohols obtained from olefines |
| US2148846A (en) * | 1936-04-11 | 1939-02-28 | Firm Of Deutsche Gold Und Silb | Process for the separation of alcohol from the first runnings |
| US2290442A (en) * | 1938-07-27 | 1942-07-21 | Dizem Sa | Process for the rectification of impure alcoholic liquids |
| US2339576A (en) * | 1941-04-28 | 1944-01-18 | Shell Dev | Separation of phenols from thiophenols |
| US2357028A (en) * | 1943-08-04 | 1944-08-29 | Shell Dev | Solvent extraction process |
| US2455803A (en) * | 1944-02-11 | 1948-12-07 | Shell Dev | Extractive distillation process |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997008120A1 (de) * | 1995-08-30 | 1997-03-06 | Basf Aktiengesellschaft | Verfahren zur abtrennung von butanol und dibutylether mit hilfe einer zweidruckdestillation |
| US5985100A (en) * | 1995-08-30 | 1999-11-16 | Basf Aktiengesellschaft | Process for separating butanol and dibutyl ether by means of dual-pressure distillation |
Also Published As
| Publication number | Publication date |
|---|---|
| FR60565E (fr) | 1954-11-09 |
| US2610141A (en) | 1952-09-09 |
| BE494834A (en, 2012) | 1950-07-17 |
| GB673768A (en) | 1952-06-11 |
| FR975923A (fr) | 1951-03-12 |
| NL78159C (en, 2012) | 1955-01-15 |
| US2663679A (en) | 1953-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE974477C (de) | Verfahren zur Reinigung aliphatischer Alkohole | |
| DE69413667T2 (de) | Einsäule Extraktivdestillation zur Trennung von aromatischen Kohlenwasserstoffen aus einem Kohlenwasserstoffgemisch | |
| DE3142518C2 (en, 2012) | ||
| DE1903552C3 (de) | Verfahren zur Reinigung von gesättigten aliphatischen Alkoholen | |
| DE3322535A1 (de) | Verbessertes verfahren zur schonenden destillation von fettsaeuren | |
| DE3728428A1 (de) | Verfahren zur destillativen reinigung von rohem sec-butylalkohol | |
| DE1468600A1 (de) | Verfahren zur Auftrennung einer Mischung mittels einer Fluessig-Fluessig-Extraktion | |
| DE857954C (de) | Verfahren zur Abtrennung von Isopren aus einer Kohlenwasserstofffraktion | |
| DE102005047460A1 (de) | Verfahren zur Behandlung von Abwasser aus Aldolisierungsverfahren | |
| DE1444357A1 (de) | Verfahren zur Auftrennung eines Gemisches mit Hilfe einer Extraktionsdestillation | |
| DE10154052A1 (de) | Einsatz ionischer Flüssigkeiten als selektive Lösungsmittel für die Trennung aromatischer Kohlenwasserstoffe von nichtaromatischen Kohlenwasserstoffen durch extraktive Rektifikation und Extraktion | |
| DE866786C (de) | Verfahren zur Trennung von Gemischen organischer Substanzen | |
| EP0086890A1 (de) | Verfahren zur Trennung von Gemischen aus Paraffin bzw. Paraffinen mit 6 bis 14 C-Atomen und Alkohol bzw. Alkoholen mit 4 bis 8 C-Atomen | |
| DE2201827A1 (de) | Verfahren zur abtrennung von essigsaeure durch extraktivrektifikation | |
| DE3124783A1 (de) | "verfahren zur loesungsmittelextraktion von mineraloelfraktionen" | |
| DE2212815A1 (de) | Verfahren zur Gewinnung von Trimethylolpropan | |
| DE19914260A1 (de) | Verfahren zur destillativen Auftrennung eines flüssigen Rohalkoholgemisches | |
| DE1033194B (de) | Verfahren zur Reinigung von AEthanol | |
| DE831237C (de) | Verfahren zum Trennen von AEthylalkohol von hoeheren Alkoholen | |
| DE2354038B2 (de) | Verfahren zur Gewinnung von ätherischen und fetten ölen u.dgl | |
| DE566915C (de) | Verfahren zur Gewinnung von Fettsaeuren aus den Oxydationsprodukten von Kohlenwasserstoffen | |
| DE610645C (de) | Verfahren zur Herstellung konzentrierter Essigsaeure aus ihren verduennten, waesserigen Loesungen durch Behandlung mit chloriertem Kohlenwasserstoff | |
| DE965967C (de) | Verfahren und Vorrichtung zur Herstellung von Alkoholen aus Alkylsulfaten | |
| DE1013638B (de) | Verfahren zur Abtrennung in Wasser schwerloeslicher C-bis C-Alkohole aus deren Gemischen mit Kohlenwasserstoffen | |
| DE1645823C (de) | Verfahren zur Gewinnung aromatischer Kohlenwasserstoffe |