DE969266C - Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von Cumol - Google Patents
Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von CumolInfo
- Publication number
- DE969266C DE969266C DES27969A DES0027969A DE969266C DE 969266 C DE969266 C DE 969266C DE S27969 A DES27969 A DE S27969A DE S0027969 A DES0027969 A DE S0027969A DE 969266 C DE969266 C DE 969266C
- Authority
- DE
- Germany
- Prior art keywords
- cumene
- benzoic acid
- oxidation
- hydroperoxide
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 title claims description 20
- 230000003647 oxidation Effects 0.000 title claims description 15
- 238000007254 oxidation reaction Methods 0.000 title claims description 15
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 title claims description 8
- 230000003197 catalytic effect Effects 0.000 title claims description 3
- 238000000034 method Methods 0.000 title claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 15
- 239000005711 Benzoic acid Substances 0.000 claims description 14
- 235000010233 benzoic acid Nutrition 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 2
- -1 aromatic hydroperoxides Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000007789 gas Substances 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 14
- 239000006227 byproduct Substances 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 210000004124 hock Anatomy 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/02—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides
- C07C409/04—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides the carbon atom being acyclic
- C07C409/08—Compounds containing six-membered aromatic rings
- C07C409/10—Cumene hydroperoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR969266X | 1951-04-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE969266C true DE969266C (de) | 1958-05-14 |
Family
ID=9501823
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES27969A Expired DE969266C (de) | 1951-04-28 | 1952-04-04 | Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von Cumol |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE509545A (enExample) |
| CH (1) | CH295670A (enExample) |
| DE (1) | DE969266C (enExample) |
| FR (1) | FR1036335A (enExample) |
| GB (1) | GB697776A (enExample) |
| NL (1) | NL80287C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1131674B (de) * | 1960-05-10 | 1962-06-20 | Phenolchemie Ges Mit Beschraen | Verfahren zur Herstellung von Aralkylmonohydroperoxyden |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL92425C (enExample) * | 1955-01-26 |
Citations (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2245528A (en) * | 1938-10-18 | 1941-06-10 | Du Pont | Catalytic oxidation of alkyl substituted aromatic compounds |
| GB610293A (en) * | 1946-04-08 | 1948-10-13 | Distillers Co Yeast Ltd | Improvements in or relating to the manufacture of alkyl benzene peroxides |
| GB626095A (en) * | 1947-02-13 | 1949-07-08 | Distillers Co Yeast Ltd | Manufacture of phenols |
| GB630286A (en) * | 1947-04-01 | 1949-10-10 | Distillers Co Yeast Ltd | Manufacture of peroxides |
| GB641250A (en) * | 1947-06-28 | 1950-08-09 | Distillers Co Yeast Ltd | Process for the manufacture of di-isopropyl-benzene hydro-peroxides and products resulting therefrom |
| GB646102A (en) * | 1948-05-19 | 1950-11-15 | Distillers Co Yeast Ltd | Manufacture of organic oxidation products |
| GB653761A (en) * | 1948-05-06 | 1951-05-23 | Distillers Co Yeast Ltd | Improvements in the manufacture of isopropyl benzene hydroperoxide |
| GB654035A (en) * | 1948-10-30 | 1951-05-30 | Distillers Co Yeast Ltd | Manufacture of beta-isopropylnaphthalene hydroperoxide and beta-naphthol |
| GB673576A (en) * | 1949-08-23 | 1952-06-11 | Allied Chem & Dye Corp | Decomposition of aralkyl alpha hydroperoxides |
| GB676771A (en) * | 1948-06-05 | 1952-08-06 | Distillers Co Yeast Ltd | Improvements in or relating to phenol production |
| GB676770A (en) * | 1948-06-05 | 1952-08-06 | Distillers Co Yeast Ltd | Improvements in or relating to phenol production |
| GB681990A (en) * | 1949-01-25 | 1952-11-05 | Distillers Co Yeast Ltd | Oxidation of aromatic hydrocarbons |
| US2632026A (en) * | 1950-02-18 | 1953-03-17 | Hercules Powder Co Ltd | Oxidation of aromatic hydrocarbons |
| GB695717A (en) * | 1949-07-19 | 1953-08-19 | Allied Chem & Dye Corp | Sodium carbonate in cumene oxidation |
| US2663740A (en) * | 1952-03-05 | 1953-12-22 | Hercules Powder Co Ltd | Oxidation of aromatic hydrocarbons |
| GB701298A (en) * | 1950-05-23 | 1953-12-23 | Allied Chem & Dye Corp | Cumene oxidation |
| GB713138A (en) * | 1951-07-03 | 1954-08-04 | Bataafsche Petroleum | A process for the production of aralkyl hydroperoxides and the resulting aralkyl hydroperoxides |
| GB726362A (en) * | 1952-07-26 | 1955-03-16 | Stamicarbon | Hydroperoxides of diparatolyl methane and 1:1-diparatolyl ethane, and the production thereof |
| GB741507A (en) * | 1952-09-09 | 1955-12-07 | Koppers Co Inc | Improvements in or relating to hydroperoxidation of cumene |
| FR1111244A (fr) * | 1953-10-12 | 1956-02-23 | Ici Ltd | Oxydation des hydrocarbures aromatiques |
-
0
- BE BE509545D patent/BE509545A/xx unknown
- NL NL80287D patent/NL80287C/xx active
-
1951
- 1951-04-28 FR FR1036335D patent/FR1036335A/fr not_active Expired
-
1952
- 1952-03-12 GB GB6460/52A patent/GB697776A/en not_active Expired
- 1952-03-31 CH CH295670D patent/CH295670A/fr unknown
- 1952-04-04 DE DES27969A patent/DE969266C/de not_active Expired
Patent Citations (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2245528A (en) * | 1938-10-18 | 1941-06-10 | Du Pont | Catalytic oxidation of alkyl substituted aromatic compounds |
| GB610293A (en) * | 1946-04-08 | 1948-10-13 | Distillers Co Yeast Ltd | Improvements in or relating to the manufacture of alkyl benzene peroxides |
| GB626095A (en) * | 1947-02-13 | 1949-07-08 | Distillers Co Yeast Ltd | Manufacture of phenols |
| GB630286A (en) * | 1947-04-01 | 1949-10-10 | Distillers Co Yeast Ltd | Manufacture of peroxides |
| GB641250A (en) * | 1947-06-28 | 1950-08-09 | Distillers Co Yeast Ltd | Process for the manufacture of di-isopropyl-benzene hydro-peroxides and products resulting therefrom |
| GB653761A (en) * | 1948-05-06 | 1951-05-23 | Distillers Co Yeast Ltd | Improvements in the manufacture of isopropyl benzene hydroperoxide |
| GB646102A (en) * | 1948-05-19 | 1950-11-15 | Distillers Co Yeast Ltd | Manufacture of organic oxidation products |
| GB676770A (en) * | 1948-06-05 | 1952-08-06 | Distillers Co Yeast Ltd | Improvements in or relating to phenol production |
| GB676771A (en) * | 1948-06-05 | 1952-08-06 | Distillers Co Yeast Ltd | Improvements in or relating to phenol production |
| GB654035A (en) * | 1948-10-30 | 1951-05-30 | Distillers Co Yeast Ltd | Manufacture of beta-isopropylnaphthalene hydroperoxide and beta-naphthol |
| GB681990A (en) * | 1949-01-25 | 1952-11-05 | Distillers Co Yeast Ltd | Oxidation of aromatic hydrocarbons |
| GB695717A (en) * | 1949-07-19 | 1953-08-19 | Allied Chem & Dye Corp | Sodium carbonate in cumene oxidation |
| GB673576A (en) * | 1949-08-23 | 1952-06-11 | Allied Chem & Dye Corp | Decomposition of aralkyl alpha hydroperoxides |
| US2632026A (en) * | 1950-02-18 | 1953-03-17 | Hercules Powder Co Ltd | Oxidation of aromatic hydrocarbons |
| GB701298A (en) * | 1950-05-23 | 1953-12-23 | Allied Chem & Dye Corp | Cumene oxidation |
| GB713138A (en) * | 1951-07-03 | 1954-08-04 | Bataafsche Petroleum | A process for the production of aralkyl hydroperoxides and the resulting aralkyl hydroperoxides |
| US2663740A (en) * | 1952-03-05 | 1953-12-22 | Hercules Powder Co Ltd | Oxidation of aromatic hydrocarbons |
| GB726362A (en) * | 1952-07-26 | 1955-03-16 | Stamicarbon | Hydroperoxides of diparatolyl methane and 1:1-diparatolyl ethane, and the production thereof |
| GB741507A (en) * | 1952-09-09 | 1955-12-07 | Koppers Co Inc | Improvements in or relating to hydroperoxidation of cumene |
| FR1111244A (fr) * | 1953-10-12 | 1956-02-23 | Ici Ltd | Oxydation des hydrocarbures aromatiques |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1131674B (de) * | 1960-05-10 | 1962-06-20 | Phenolchemie Ges Mit Beschraen | Verfahren zur Herstellung von Aralkylmonohydroperoxyden |
Also Published As
| Publication number | Publication date |
|---|---|
| GB697776A (en) | 1953-09-30 |
| NL80287C (enExample) | |
| BE509545A (enExample) | |
| FR1036335A (fr) | 1953-09-07 |
| CH295670A (fr) | 1954-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0304763A1 (de) | Verfahren zur Herstellung von Ethercarbonsäuren | |
| DE2213435A1 (de) | Verfahren zur herstellung von oxalsaeure und estern dieser saeure | |
| DE969266C (de) | Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von Cumol | |
| DE945506C (de) | Verfahren zur Herstellung von Hydroperoxyden durch katalytische Oxydation von alkylaromatischen Kohlenwasserstoffen | |
| DE3134047C2 (enExample) | ||
| DE1518630C3 (de) | Verfahren zur Herstellung von oxydierter Stärke | |
| DE1618972B1 (de) | Verfahren zur Herstellung von Cumolhydroperoxyd | |
| DE2238289A1 (de) | Verfahren zum reformieren von rohen synthetischen fettsaeuren | |
| DES0027969MA (enExample) | ||
| EP0866060B1 (de) | Verfahren zur Herstellung von 1,2,3,6-Tetrahydro-2,2,6,6,-tetramethylpyridin-N-oxyl | |
| DES0027026MA (enExample) | ||
| DE1041949B (de) | Verfahren zur Herstellung von Loesungen von Alkaliacrylaten durch Oxydation von Acrolein | |
| DE2421039C2 (de) | Verfahren zur Gewinnung von Diisopropylbenzolmonohydroperoxid | |
| DE60005905T2 (de) | Herstellung von peroxyketalen | |
| DE969234C (de) | Verfahren zur Herstellung von aromatischen oder hydroaromatischen Hydroperoxyden | |
| DE878652C (de) | Verfahren zur Herstellung von Alkylolgruppen enthaltenden Aryloxycarbonsaeuren | |
| DE1147934B (de) | Verfahren zur Herstellung von Benzoldicarbonsaeuren | |
| DE2134209C3 (de) | Verfahren zur Herstellung von Diacetyl | |
| DE2031782A1 (enExample) | ||
| DE2035504C3 (de) | Verfahren zur Herstellung von Cumolhydroperoxid | |
| DE930637C (de) | Verfahren zur Herstellung von Phenol und Aceton | |
| DE579308C (de) | Verfahren zur Herstellung dialkylsubstituierter Malonsaeuren | |
| DE2364044A1 (de) | Verfahren zur herstellung von methacrylsaeure | |
| DE2818150A1 (de) | Verfahren zur herstellung terpenoider formiate und terpenoider carbinole | |
| DE1618972C2 (de) | Verfahren zur Herstellung von Cumolhydroperoxyd |