DES0027026MA - - Google Patents
Info
- Publication number
- DES0027026MA DES0027026MA DES0027026MA DE S0027026M A DES0027026M A DE S0027026MA DE S0027026M A DES0027026M A DE S0027026MA
- Authority
- DE
- Germany
- Prior art keywords
- formate
- hydroperoxide
- cumene
- hours
- hour
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- RWGFKTVRMDUZSP-UHFFFAOYSA-N isopropyl-benzene Natural products CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 21
- 230000003647 oxidation Effects 0.000 claims description 9
- 238000007254 oxidation reaction Methods 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 150000002430 hydrocarbons Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 150000002432 hydroperoxides Chemical class 0.000 claims description 5
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- KXUHSQYYJYAXGZ-UHFFFAOYSA-N isobutylbenzene Chemical compound CC(C)CC1=CC=CC=C1 KXUHSQYYJYAXGZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- -1 alkaline earth metal formates Chemical class 0.000 claims description 3
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 claims description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims description 2
- 150000003891 oxalate salts Chemical class 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 claims 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 25
- 229940044170 formate Drugs 0.000 description 25
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 15
- 239000004280 Sodium formate Substances 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 9
- 235000019254 sodium formate Nutrition 0.000 description 9
- 239000006227 byproduct Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- GNKZMNRKLCTJAY-UHFFFAOYSA-N 4'-Methylacetophenone Chemical compound CC(=O)C1=CC=C(C)C=C1 GNKZMNRKLCTJAY-UHFFFAOYSA-N 0.000 description 2
- CBOCVOKPQGJKKJ-UHFFFAOYSA-L Calcium formate Chemical compound [Ca+2].[O-]C=O.[O-]C=O CBOCVOKPQGJKKJ-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229940044172 calcium formate Drugs 0.000 description 2
- 235000019255 calcium formate Nutrition 0.000 description 2
- 239000004281 calcium formate Substances 0.000 description 2
- QXDMQSPYEZFLGF-UHFFFAOYSA-L calcium oxalate Chemical compound [Ca+2].[O-]C(=O)C([O-])=O QXDMQSPYEZFLGF-UHFFFAOYSA-L 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- ZNCPFRVNHGOPAG-UHFFFAOYSA-L sodium oxalate Chemical compound [Na+].[Na+].[O-]C(=O)C([O-])=O ZNCPFRVNHGOPAG-UHFFFAOYSA-L 0.000 description 2
- 229940039790 sodium oxalate Drugs 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BANZVKGLDQDFDV-UHFFFAOYSA-N 2-propan-2-ylbenzoic acid Chemical group CC(C)C1=CC=CC=C1C(O)=O BANZVKGLDQDFDV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 238000010543 cumene process Methods 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 210000004124 hock Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- XLPDVYGDNRIQFV-UHFFFAOYSA-N p-Cymen-8-ol Chemical compound CC1=CC=C(C(C)(C)O)C=C1 XLPDVYGDNRIQFV-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2737302C3 (de) | Verfahren zur Herstellung von Resorcin | |
| DE69209445T2 (de) | Katalytische Herstellung von Aryl-Alkyl-Hydroperoxiden mit Mangan-Komplexen | |
| DE1216283C2 (de) | Verfahren zur herstellung von epsilon-caprolactonen und bzw. oder 6-formyloxycapronsaeuren | |
| DE2800324C2 (enExample) | ||
| DE945506C (de) | Verfahren zur Herstellung von Hydroperoxyden durch katalytische Oxydation von alkylaromatischen Kohlenwasserstoffen | |
| DE2846892C2 (de) | Verfahren zur Herstellung von m-Diisopropylbenzoldihydroperoxid durch Oxidation von m-Diisopropylbenzol in flüssiger Phase | |
| DE2842044C2 (enExample) | ||
| DE3602254A1 (de) | Verfahren zur herstellung von oxiranylcarbonsaeureestern | |
| DE2345355C2 (de) | Verfahren zum Stabilisieren von Dihydroperoxiden dialkylsubstituierter aromatischer Kohlenwasserstoffe | |
| DE1618972B1 (de) | Verfahren zur Herstellung von Cumolhydroperoxyd | |
| DES0027026MA (enExample) | ||
| EP0796833B1 (de) | Verfahren zur Herstellung von beta-Naphthol | |
| DE1210771C2 (de) | Verfahren zur Herstellung von araliphatischen Dicarbinolen | |
| EP0161485A2 (de) | Verfahren zur Herstellung wasserunlöslicher Peroxycarbonsäuren | |
| DE69411012T2 (de) | Verfahren zur herstellung von cumenhydroperoxyd | |
| DE3872204T2 (de) | Hydroperoxidation von diisopropylbenzolen. | |
| DE2603269C3 (de) | Verfahren zur Herstellung von Cyclohexanon und methylsubstituiertem oder unsubstituiertem Phenol | |
| DE3838028A1 (de) | Verfahren zur herstellung von aralkylhydroperoxiden | |
| DE928230C (de) | Verfahren zur Herstellung von Hydroperoxyden alkylaromatischer Kohlenwasserstoffe | |
| DE969266C (de) | Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von Cumol | |
| DE60005905T2 (de) | Herstellung von peroxyketalen | |
| DE602004010193T2 (de) | Verfahren zur Herstellung von Ketonen | |
| DE924449C (de) | Verfahren zur Herstellung von tertiaeren organischen Hydroperoxyden durch Oxydation alkylsubstituierter aromatischer Verbindungen | |
| DE2344386A1 (de) | Verfahren zur herstellung von hydrochinon | |
| DE3440407C2 (enExample) |