DES0027969MA - - Google Patents
Info
- Publication number
- DES0027969MA DES0027969MA DES0027969MA DE S0027969M A DES0027969M A DE S0027969MA DE S0027969M A DES0027969M A DE S0027969MA
- Authority
- DE
- Germany
- Prior art keywords
- benzoic acid
- cumene
- oxidation
- hydroperoxide
- hours
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 24
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 18
- 230000003647 oxidation Effects 0.000 claims description 14
- 238000007254 oxidation reaction Methods 0.000 claims description 14
- 239000005711 Benzoic acid Substances 0.000 claims description 12
- 235000010233 benzoic acid Nutrition 0.000 claims description 12
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims 1
- 239000006227 byproduct Substances 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 2
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 210000004124 hock Anatomy 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102007017179A1 (de) | Verfahren zur Herstellung von Alkylpolyglykolcarbonsäuren und Polyglykoldicarbonsäuren mittels Direktoxidation | |
| DE3728222A1 (de) | Verfahren zur herstellung von ethercarbonsaeuren | |
| DE2737302B2 (de) | Verfahren zur Herstellung von Resorcin | |
| DE2800324A1 (de) | Verfahren zur herstellung von 2,5-dichlorphenol | |
| DE969266C (de) | Verfahren zur Herstellung von Cumolhydroperoxyd durch katalytische Oxydation von Cumol | |
| DE945506C (de) | Verfahren zur Herstellung von Hydroperoxyden durch katalytische Oxydation von alkylaromatischen Kohlenwasserstoffen | |
| DES0027969MA (enExample) | ||
| EP0005471B1 (de) | Verfahren zur Herstellung von 3-Hydroxy-2,2,4-trimethylpentylisobutyrat | |
| DE1618972B1 (de) | Verfahren zur Herstellung von Cumolhydroperoxyd | |
| DE2508452C2 (de) | Verfahren zur Herstellung von Alkylphenolen | |
| DE69411012T2 (de) | Verfahren zur herstellung von cumenhydroperoxyd | |
| EP0161485A2 (de) | Verfahren zur Herstellung wasserunlöslicher Peroxycarbonsäuren | |
| DE3872204T2 (de) | Hydroperoxidation von diisopropylbenzolen. | |
| DE69900528T2 (de) | Herstellung von Di-tert-peroxiden | |
| DE3838028A1 (de) | Verfahren zur herstellung von aralkylhydroperoxiden | |
| DE3602180C2 (enExample) | ||
| DES0027026MA (enExample) | ||
| EP0004889B1 (de) | Verfahren zur Herstellung terpenoider Formiate und terpenoider Carbinole | |
| DE60005905T2 (de) | Herstellung von peroxyketalen | |
| DE2031782A1 (enExample) | ||
| DE1618972C2 (de) | Verfahren zur Herstellung von Cumolhydroperoxyd | |
| DE2951956A1 (de) | Verfahren zur herstellung von gemischen aus cyclohexylhydroperoxid | |
| DE3407100A1 (de) | Verfahren zur herstellung von 6-acetoxy-2-naphthoesaeure | |
| DE1165604B (de) | Verfahren zur sterischen Umlagerung von Chinaalkaloiden | |
| DE969234C (de) | Verfahren zur Herstellung von aromatischen oder hydroaromatischen Hydroperoxyden |