DE859867C - Wiederholt verwendbarer Zuendstab - Google Patents
Wiederholt verwendbarer ZuendstabInfo
- Publication number
- DE859867C DE859867C DEP23019A DEP0023019A DE859867C DE 859867 C DE859867 C DE 859867C DE P23019 A DEP23019 A DE P23019A DE P0023019 A DEP0023019 A DE P0023019A DE 859867 C DE859867 C DE 859867C
- Authority
- DE
- Germany
- Prior art keywords
- ignition
- ignition rod
- rod according
- mass
- releasing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 4
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- VKCLPVFDVVKEKU-UHFFFAOYSA-N S=[P] Chemical compound S=[P] VKCLPVFDVVKEKU-UHFFFAOYSA-N 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000002966 varnish Substances 0.000 claims description 3
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims description 2
- 239000005956 Metaldehyde Substances 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims description 2
- GKKDCARASOJPNG-UHFFFAOYSA-N metaldehyde Chemical compound CC1OC(C)OC(C)OC(C)O1 GKKDCARASOJPNG-UHFFFAOYSA-N 0.000 claims description 2
- 239000002699 waste material Substances 0.000 claims description 2
- 239000003232 water-soluble binding agent Substances 0.000 claims description 2
- 230000007423 decrease Effects 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- 238000012423 maintenance Methods 0.000 claims 1
- -1 metaldehyde Chemical class 0.000 claims 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 12
- 239000002585 base Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06F—MATCHES; MANUFACTURE OF MATCHES
- C06F5/00—Matches
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE260581X | 1946-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE859867C true DE859867C (de) | 1952-12-18 |
Family
ID=20306429
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP23019A Expired DE859867C (de) | 1946-11-13 | 1947-11-13 | Wiederholt verwendbarer Zuendstab |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2568285A (cs) |
| BE (1) | BE477261A (cs) |
| CH (1) | CH260581A (cs) |
| DE (1) | DE859867C (cs) |
| ES (1) | ES180420A1 (cs) |
| FR (1) | FR1015446A (cs) |
| GB (1) | GB642754A (cs) |
| NL (1) | NL69843C (cs) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1208227B (de) * | 1962-01-15 | 1965-12-30 | John Burton Tigrett | Wiederentzuendbares Streichholz |
| DE1208226B (de) * | 1962-01-15 | 1965-12-30 | John Burton Tigrett | Wiederentzuendbares Streichholz |
| DE1208669B (de) * | 1962-01-15 | 1966-01-05 | John Burton Tigrett | Wiederentzuendbares Streichholz |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3065063A (en) * | 1956-01-30 | 1962-11-20 | Knutsson-Hall Folke Knut | Ignition rods intended to be lit and extinguished repeatedly |
| US3321342A (en) * | 1965-03-15 | 1967-05-23 | Tigrett | Re-ignitable match |
| US3272604A (en) * | 1965-12-09 | 1966-09-13 | Tigrett | Re-ignitible match |
| US3634152A (en) * | 1969-09-08 | 1972-01-11 | Kawase Bussan Kk | Match head composition |
| GB2563248A (en) * | 2017-06-07 | 2018-12-12 | Mtfx Ltd | Visual effect device |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE638694C (de) * | 1931-06-08 | 1936-11-21 | Svenska Taendsticks Aktiebolag | Dauerzuendstab |
| US2004436A (en) * | 1931-12-09 | 1935-06-11 | American Cyanamid & Chem Corp | Match |
| FR825228A (fr) * | 1936-08-06 | 1938-02-25 | Allumeur à multiple allumage | |
| NL64798C (cs) * | 1946-01-30 |
-
0
- NL NL69843D patent/NL69843C/xx active
- BE BE477261D patent/BE477261A/xx unknown
-
1947
- 1947-11-04 CH CH260581D patent/CH260581A/de unknown
- 1947-11-07 GB GB29764/47A patent/GB642754A/en not_active Expired
- 1947-11-08 ES ES180420A patent/ES180420A1/es not_active Expired
- 1947-11-10 FR FR1015446D patent/FR1015446A/fr not_active Expired
- 1947-11-13 DE DEP23019A patent/DE859867C/de not_active Expired
-
1949
- 1949-10-14 US US121455A patent/US2568285A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1208227B (de) * | 1962-01-15 | 1965-12-30 | John Burton Tigrett | Wiederentzuendbares Streichholz |
| DE1208226B (de) * | 1962-01-15 | 1965-12-30 | John Burton Tigrett | Wiederentzuendbares Streichholz |
| DE1208669B (de) * | 1962-01-15 | 1966-01-05 | John Burton Tigrett | Wiederentzuendbares Streichholz |
Also Published As
| Publication number | Publication date |
|---|---|
| CH260581A (de) | 1949-03-31 |
| BE477261A (cs) | |
| FR1015446A (fr) | 1952-09-29 |
| NL69843C (cs) | |
| US2568285A (en) | 1951-09-18 |
| GB642754A (en) | 1950-09-13 |
| ES180420A1 (es) | 1947-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE638694C (de) | Dauerzuendstab | |
| DE859867C (de) | Wiederholt verwendbarer Zuendstab | |
| DE2619554C2 (de) | Leicht entzündbares künstliches Feuerscheit | |
| DE646129C (de) | Verfahren zur Herstellung farbig brennender Kerzen | |
| AT146374B (de) | Dauerzündstab. | |
| DE1571709C3 (de) | Örennstoffbnketts | |
| DE271174C (cs) | ||
| DE878014C (de) | Zigarette, Zigarre od. dgl. | |
| DE3018210C1 (de) | Sturmfeuerzuender und Verfahren zu seiner Herstellung | |
| DE349584C (de) | Verfahren zur Benutzung von Verbindungen der Stickstoffwasserstoffsaeure | |
| EP0215093B1 (de) | Brennbares Mehrstoffgemisch und Verfahren zu seiner Verbrennung | |
| AT218939B (de) | Zündholz mit einem zumindest aus einer Umhüllung und einem verschiebbar in dieser Umhüllung befindlichen Kern bestehenden Schaft | |
| AT155256B (de) | Wiederholt entflammbarer Zündstab. | |
| DE283995C (cs) | ||
| DE1129408B (de) | Leuchtsatz und Zuendsatz dafuer | |
| AT159122B (de) | Zündstab zum wiederholten Entzünden und Auslöschen. | |
| CH240427A (de) | Zündmittel. | |
| DE66613C (de) | Verfahren zur Herstellung von Blitzlichtstreichhölzern, Zündbändern und dergl | |
| DE825295C (de) | Blocklicht | |
| DE144456C (cs) | ||
| DE555458C (de) | Sicherheitszuender mit einstellbarer Brenndauer | |
| DE2027801C3 (de) | Treibsatz für Feuerwerksraketen und ein Verfahren zu dessen Herstellung | |
| AT99205B (de) | Zündpille als Zündholzersatz. | |
| DE961602C (de) | Kontaktzuender auf der Basis Oxydations- und Reduktionsmittel | |
| AT123834B (de) | Unterzünder. |