DE851901C - Schichten fuer die Diazotypie - Google Patents
Schichten fuer die DiazotypieInfo
- Publication number
- DE851901C DE851901C DEP39508D DEP0039508D DE851901C DE 851901 C DE851901 C DE 851901C DE P39508 D DEP39508 D DE P39508D DE P0039508 D DEP0039508 D DE P0039508D DE 851901 C DE851901 C DE 851901C
- Authority
- DE
- Germany
- Prior art keywords
- negative
- compound
- image
- parts
- silver
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000008049 diazo compounds Chemical class 0.000 claims description 40
- 229910052751 metal Inorganic materials 0.000 claims description 36
- 239000002184 metal Substances 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 25
- -1 secondary amino compound Chemical class 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000000354 decomposition reaction Methods 0.000 claims description 12
- 239000003513 alkali Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 32
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 20
- 239000011248 coating agent Substances 0.000 description 17
- 238000000576 coating method Methods 0.000 description 17
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 16
- 229910021529 ammonia Inorganic materials 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- 239000000203 mixture Substances 0.000 description 10
- 230000008569 process Effects 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 229910001961 silver nitrate Inorganic materials 0.000 description 10
- 239000000126 substance Substances 0.000 description 9
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 8
- 229910052709 silver Inorganic materials 0.000 description 8
- 239000004332 silver Substances 0.000 description 8
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 8
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical class OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 7
- 230000001603 reducing effect Effects 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000003335 secondary amines Chemical class 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 150000003141 primary amines Chemical class 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 4
- TZMGLOFLKLBEFW-UHFFFAOYSA-M silver;sulfamate Chemical compound [Ag+].NS([O-])(=O)=O TZMGLOFLKLBEFW-UHFFFAOYSA-M 0.000 description 4
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 3
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- FRHBOQMZUOWXQL-UHFFFAOYSA-L ammonium ferric citrate Chemical compound [NH4+].[Fe+3].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FRHBOQMZUOWXQL-UHFFFAOYSA-L 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 229960004642 ferric ammonium citrate Drugs 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000004313 iron ammonium citrate Substances 0.000 description 3
- 235000000011 iron ammonium citrate Nutrition 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 229910052716 thallium Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NETIXPOFUYPXNI-UHFFFAOYSA-N 2-aminopropane-2-sulfonic acid Chemical compound CC(C)(N)S(O)(=O)=O NETIXPOFUYPXNI-UHFFFAOYSA-N 0.000 description 2
- YNAKESQZGPZDDZ-UHFFFAOYSA-N 2-n,2-n-diethylbenzene-1,2-diamine Chemical compound CCN(CC)C1=CC=CC=C1N YNAKESQZGPZDDZ-UHFFFAOYSA-N 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 108010077895 Sarcosine Proteins 0.000 description 2
- 241000238370 Sepia Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229940043230 sarcosine Drugs 0.000 description 2
- 150000003378 silver Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- 150000003475 thallium Chemical class 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical class [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- ZENKESXKWBIZCV-UHFFFAOYSA-N 2,2,4,4-tetrafluoro-1,3-benzodioxin-6-amine Chemical group O1C(F)(F)OC(F)(F)C2=CC(N)=CC=C21 ZENKESXKWBIZCV-UHFFFAOYSA-N 0.000 description 1
- RRWZZMHRVSMLCT-UHFFFAOYSA-N 2-(butylazaniumyl)acetate Chemical compound CCCCNCC(O)=O RRWZZMHRVSMLCT-UHFFFAOYSA-N 0.000 description 1
- OQMYZVWIXPPDDE-UHFFFAOYSA-N 2-(cyclohexylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCCC1 OQMYZVWIXPPDDE-UHFFFAOYSA-N 0.000 description 1
- MNURPFVONZPVLA-UHFFFAOYSA-N 2-chlorobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1Cl MNURPFVONZPVLA-UHFFFAOYSA-N 0.000 description 1
- HWFZRYAWMWEGOT-UHFFFAOYSA-N 2-methyl-1-n-phenylnaphthalene-1,4-diamine Chemical compound CC1=CC(N)=C2C=CC=CC2=C1NC1=CC=CC=C1 HWFZRYAWMWEGOT-UHFFFAOYSA-N 0.000 description 1
- MHJPTEUSFBRSKR-UHFFFAOYSA-N 4-cyclohexylcyclohexa-1,5-diene-1,4-diamine Chemical compound NC1=CCC(N)(C=C1)C1CCCCC1 MHJPTEUSFBRSKR-UHFFFAOYSA-N 0.000 description 1
- PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 description 1
- IJAVOBIKGWKGQY-UHFFFAOYSA-N 4-n,4-n-diethylnaphthalene-1,4-diamine Chemical compound C1=CC=C2C(N(CC)CC)=CC=C(N)C2=C1 IJAVOBIKGWKGQY-UHFFFAOYSA-N 0.000 description 1
- IMDARUXWNKRPJK-UHFFFAOYSA-N 4-n-cyclohexyl-4-n-ethylbenzene-1,4-diamine Chemical compound C=1C=C(N)C=CC=1N(CC)C1CCCCC1 IMDARUXWNKRPJK-UHFFFAOYSA-N 0.000 description 1
- TVOSOIXYPHKEAR-UHFFFAOYSA-N 4-piperidin-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCCCC1 TVOSOIXYPHKEAR-UHFFFAOYSA-N 0.000 description 1
- URAARCWOADCWLA-UHFFFAOYSA-N 4-pyrrolidin-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCCC1 URAARCWOADCWLA-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-N ferricyanide Chemical compound [Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-N 0.000 description 1
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 150000002730 mercury Chemical class 0.000 description 1
- QCIFLGSATTWUQJ-UHFFFAOYSA-N n,4-dimethylaniline Chemical compound CNC1=CC=C(C)C=C1 QCIFLGSATTWUQJ-UHFFFAOYSA-N 0.000 description 1
- FYWSTUCDSVYLPV-UHFFFAOYSA-N nitrooxythallium Chemical compound [Tl+].[O-][N+]([O-])=O FYWSTUCDSVYLPV-UHFFFAOYSA-N 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- XNGYKPINNDWGGF-UHFFFAOYSA-L silver oxalate Chemical compound [Ag+].[Ag+].[O-]C(=O)C([O-])=O XNGYKPINNDWGGF-UHFFFAOYSA-L 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 208000011117 substance-related disease Diseases 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 150000003530 tetrahydroquinolines Chemical class 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/62—Metal compounds reducible to metal
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL76649D NL76649C (enFirst) | 1949-04-09 | ||
| DEP39508D DE851901C (de) | 1949-04-09 | 1949-04-09 | Schichten fuer die Diazotypie |
| US108864A US2618555A (en) | 1949-04-09 | 1949-08-05 | Process for positive diazotype and negative metal reduction images and light-sensitive material therefor |
| FR1057774D FR1057774A (fr) | 1949-04-09 | 1950-03-18 | Couches pour diazotypie |
| GB8344/50A GB682614A (en) | 1949-04-09 | 1950-04-03 | Improvements relating to diazotype printing materials and processes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP39508D DE851901C (de) | 1949-04-09 | 1949-04-09 | Schichten fuer die Diazotypie |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE851901C true DE851901C (de) | 1952-10-09 |
Family
ID=6597198
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP39508D Expired DE851901C (de) | 1949-04-09 | 1949-04-09 | Schichten fuer die Diazotypie |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2618555A (enFirst) |
| DE (1) | DE851901C (enFirst) |
| FR (1) | FR1057774A (enFirst) |
| GB (1) | GB682614A (enFirst) |
| NL (1) | NL76649C (enFirst) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL99741C (enFirst) * | 1958-11-10 | |||
| NL275942A (enFirst) * | 1962-03-14 | |||
| US3199982A (en) * | 1963-03-19 | 1965-08-10 | Keuffel & Esser Co | Diazotype reproduction material |
| US3203803A (en) * | 1964-01-20 | 1965-08-31 | Tecnifax Corp | Light-sensitive diazo hexafluoro-phosphate compositions |
| US3387975A (en) * | 1965-03-10 | 1968-06-11 | Sony Corp | Method of making color screen of a cathode ray tube |
| US3539345A (en) * | 1967-02-01 | 1970-11-10 | Gaf Corp | Thermal diazotype papers |
| US3779758A (en) * | 1969-03-25 | 1973-12-18 | Photocircuits Corp | Photosensitive process for producing printed circuits employing electroless deposition |
| US4055425A (en) * | 1975-03-10 | 1977-10-25 | Gaf Corporation | Diazotype material and graphic reproduction processes employing the same |
| FR2411432A1 (fr) * | 1977-12-09 | 1979-07-06 | Issec Labo Physicochimie Appli | Procede d'impressions couleur photochimique et dispositif pour sa mise en oeuvre |
| GB2139369B (en) * | 1983-05-06 | 1987-01-21 | Sericol Group Ltd | Photosensitive systems showing visible indication of exposure |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE407603A (enFirst) * | 1930-02-05 | |||
| US2066918A (en) * | 1931-09-21 | 1937-01-05 | Light-sensitive material and a proc | |
| US2150834A (en) * | 1936-02-17 | 1939-03-14 | Philips Nv | Sound record and method of making same |
| NL53832C (enFirst) * | 1937-08-09 | |||
| BE431763A (enFirst) * | 1938-01-26 | |||
| BE468903A (enFirst) * | 1945-08-18 | |||
| US2537106A (en) * | 1946-10-18 | 1951-01-09 | Gen Aniline & Film Corp | Poly-acetoacetyl derivatives of polyamines as azo components in diazotype photoprinting material |
| US2537007A (en) * | 1946-11-27 | 1951-01-09 | Jr William G Abbott | Separating, positioning, and uniting thread |
-
0
- NL NL76649D patent/NL76649C/xx active
-
1949
- 1949-04-09 DE DEP39508D patent/DE851901C/de not_active Expired
- 1949-08-05 US US108864A patent/US2618555A/en not_active Expired - Lifetime
-
1950
- 1950-03-18 FR FR1057774D patent/FR1057774A/fr not_active Expired
- 1950-04-03 GB GB8344/50A patent/GB682614A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US2618555A (en) | 1952-11-18 |
| GB682614A (en) | 1952-11-12 |
| FR1057774A (fr) | 1954-03-10 |
| NL76649C (enFirst) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE857738C (de) | Verfahren zur Verhinderung von Fleckenbildungen auf Farbbildern | |
| DE1447737A1 (de) | Durch Waerme entwickelbares Reproduktionsmaterial fuer die Diazotypie | |
| DE851901C (de) | Schichten fuer die Diazotypie | |
| DE1422468B2 (de) | Verfahren zur herstellung von lithographischen druckplatten | |
| DE1199614B (de) | Filmmaterial fuer Farbenphotographie | |
| DE929171C (de) | Verfahren und Material zum Herstellen farbiger photographischer Bilder | |
| DE876506C (de) | Photographischer Entwickler | |
| CH652216A5 (de) | Verfahren zur herstellung eines optischen mehrfarbenfilters. | |
| DE561020C (de) | Verfahren zur Herstellung photographischer Bilder durch Veraenderung der Haerte einer Gelatineschicht | |
| DE855051C (de) | Lichtempfindliche Materialien | |
| DE1106171B (de) | Diazotypiematerial und Verfahren zur Herstellung von Lichtpausen | |
| DE831803C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE2038242A1 (de) | Verfahren zur Diazotypie-Mehrfarbenreproduktion sowie lichtempfindliches Material zur Durchfuehrung desselben | |
| DE848911C (de) | Entwickler fuer Schwarzweiss- und Mehrfarbenbilder | |
| DE1448785A1 (de) | Verfahren zur Auszeichnung von zeitlich veraenderlichen elektrischen Vorgaengen in einem registrierenden Instrument und Material zur Durchfuehrung des Verfahrens | |
| DE1244575C2 (de) | Diazotypiematerial | |
| DE2310825C2 (de) | Verfahren zur Herstellung von gefärbten Reliefstrukturen | |
| DE1016127B (de) | Verfahren zur Herstellung hektographischer Abzuege und photographisches Material hierfuer | |
| DE1471670A1 (de) | Verfahren zur Vervielfaeltigung von Aufzeichnungen | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE1572101A1 (de) | Diazotypieverfahren zur Herstellung negativer Kopien | |
| DE2360328C3 (de) | Verfahren zur Erzeugung eines Bildes in einem Bildempfangsteil | |
| AT247717B (de) | Verfahren zur Herstellung farbiger Bilder nach der Silberfarbbleichmethode | |
| DE2609221C3 (de) | Verfahren zur Herstellung von silberfreien Bildern | |
| DE874705C (de) | Verfahren zur Herstellung einer farbigen Kolloidschicht, insbesondere in Mehrschichtenmaterial fuer die Farbenphotographie |