DE825206C - Farbbleichbad fuer die Herstellung von farbigen Bildern in photographischen Emulsionsschichten - Google Patents
Farbbleichbad fuer die Herstellung von farbigen Bildern in photographischen EmulsionsschichtenInfo
- Publication number
- DE825206C DE825206C DEP37726A DEP0037726A DE825206C DE 825206 C DE825206 C DE 825206C DE P37726 A DEP37726 A DE P37726A DE P0037726 A DEP0037726 A DE P0037726A DE 825206 C DE825206 C DE 825206C
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- ber
- dye
- methyl group
- silver
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000839 emulsion Substances 0.000 title claims description 18
- 239000007844 bleaching agent Substances 0.000 title description 10
- 238000004519 manufacturing process Methods 0.000 title description 6
- 229910052709 silver Inorganic materials 0.000 claims description 16
- 239000004332 silver Substances 0.000 claims description 16
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 15
- 238000004061 bleaching Methods 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000000987 azo dye Substances 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 235000019270 ammonium chloride Nutrition 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 2
- 239000011780 sodium chloride Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- HAUGRYOERYOXHX-UHFFFAOYSA-N Alloxazine Chemical compound C1=CC=C2N=C(C(=O)NC(=O)N3)C3=NC2=C1 HAUGRYOERYOXHX-UHFFFAOYSA-N 0.000 description 15
- 239000000975 dye Substances 0.000 description 15
- 229920000159 gelatin Polymers 0.000 description 10
- 235000019322 gelatine Nutrition 0.000 description 10
- UYEUUXMDVNYCAM-UHFFFAOYSA-N lumazine Chemical compound N1=CC=NC2=NC(O)=NC(O)=C21 UYEUUXMDVNYCAM-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 108010010803 Gelatin Proteins 0.000 description 7
- 239000008273 gelatin Substances 0.000 description 7
- 235000011852 gelatine desserts Nutrition 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- ZJTJUVIJVLLGSP-UHFFFAOYSA-N lumichrome Chemical compound N1C(=O)NC(=O)C2=C1N=C1C=C(C)C(C)=CC1=N2 ZJTJUVIJVLLGSP-UHFFFAOYSA-N 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000001828 Gelatine Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- -1 etc. Chemical group 0.000 description 3
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- HIMXGTXNXJYFGB-UHFFFAOYSA-N alloxan Chemical compound O=C1NC(=O)C(=O)C(=O)N1 HIMXGTXNXJYFGB-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- OJUGVDODNPJEEC-UHFFFAOYSA-N phenylglyoxal Chemical compound O=CC(=O)C1=CC=CC=C1 OJUGVDODNPJEEC-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- NTTLKRPWPKPUAI-UHFFFAOYSA-N (1e)-1-[amino(anilino)methylidene]-2-phenylguanidine Chemical compound C=1C=CC=CC=1N=C(N)\N=C(/N)NC1=CC=CC=C1 NTTLKRPWPKPUAI-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NTAUFBBACPIKFS-UHFFFAOYSA-N 6,7-dimethyl-1h-benzo[g]pteridine-2,4-dione Chemical compound O=C1NC(=O)C2=NC3=C(C)C(C)=CC=C3NC2=N1 NTAUFBBACPIKFS-UHFFFAOYSA-N 0.000 description 1
- YVGIYQOPTPWNER-UHFFFAOYSA-N 6,7-dimethyl-1h-pteridine-2,4-dione Chemical compound N1C(=O)NC(=O)C2=C1N=C(C)C(C)=N2 YVGIYQOPTPWNER-UHFFFAOYSA-N 0.000 description 1
- GOULKEOXQNZISP-UHFFFAOYSA-N 6,7-diphenyl-1h-pteridine-2,4-dione Chemical compound C=1C=CC=CC=1C=1N=C2C(=O)NC(=O)NC2=NC=1C1=CC=CC=C1 GOULKEOXQNZISP-UHFFFAOYSA-N 0.000 description 1
- NYAWGMWFQWTXFQ-UHFFFAOYSA-N 6,8-dimethyl-1h-benzo[g]pteridine-2,4-dione Chemical compound N1C(=O)NC(=O)C=2C1=NC1=CC(C)=CC(C)=C1N=2 NYAWGMWFQWTXFQ-UHFFFAOYSA-N 0.000 description 1
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000011126 aluminium potassium sulphate Nutrition 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- GLNADSQYFUSGOU-UHFFFAOYSA-J chembl1640 Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(N=NC3=CC=C(C=C3C)C=3C=C(C(=CC=3)N=NC=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)C)=C(O)C2=C1N GLNADSQYFUSGOU-UHFFFAOYSA-J 0.000 description 1
- STLZCUYBVPNYED-UHFFFAOYSA-N chlorbetamide Chemical compound OCCN(C(=O)C(Cl)Cl)CC1=CC=C(Cl)C=C1Cl STLZCUYBVPNYED-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- LQJVOKWHGUAUHK-UHFFFAOYSA-L disodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].OC1=C2C(N)=CC(S([O-])(=O)=O)=CC2=CC(S([O-])(=O)=O)=C1N=NC1=CC=CC=C1 LQJVOKWHGUAUHK-UHFFFAOYSA-L 0.000 description 1
- BXUKAXFDABMVND-UHFFFAOYSA-L disodium;1,2-dihydroxyethane-1,2-disulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C(O)C(O)S([O-])(=O)=O BXUKAXFDABMVND-UHFFFAOYSA-L 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- VZPGINJWPPHRLS-UHFFFAOYSA-N phenazine-2,3-diamine Chemical compound C1=CC=C2N=C(C=C(C(N)=C3)N)C3=NC2=C1 VZPGINJWPPHRLS-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940050271 potassium alum Drugs 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 1
- 239000002151 riboflavin Substances 0.000 description 1
- 235000019192 riboflavin Nutrition 0.000 description 1
- 229960002477 riboflavin Drugs 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 229940100890 silver compound Drugs 0.000 description 1
- 150000003379 silver compounds Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Inorganic materials [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- OLSOUGWNONTDCK-UHFFFAOYSA-J tetrasodium 5-amino-3-[[4-[4-[(8-amino-1-hydroxy-3,6-disulfonatonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(N=NC3=CC=C(C=C3OC)C=3C=C(C(=CC=3)N=NC=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)OC)=C(O)C2=C1N OLSOUGWNONTDCK-UHFFFAOYSA-J 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/28—Silver dye bleach processes; Materials therefor; Preparing or processing such materials
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17574A US2518710A (en) | 1948-03-27 | 1948-03-27 | Lumazines and alloxazines as catalysts in dye bleach baths for color photography |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE825206C true DE825206C (de) | 1951-12-17 |
Family
ID=21783357
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP37726A Expired DE825206C (de) | 1948-03-27 | 1949-03-25 | Farbbleichbad fuer die Herstellung von farbigen Bildern in photographischen Emulsionsschichten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2518710A (en:Method) |
| BE (1) | BE488117A (en:Method) |
| CA (1) | CA474965A (en:Method) |
| CH (2) | CH279649A (en:Method) |
| DE (1) | DE825206C (en:Method) |
| FR (1) | FR983723A (en:Method) |
| GB (1) | GB657374A (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE579274A (en:Method) * | 1958-06-03 | |||
| NL286940A (en:Method) * | 1961-12-20 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1758752A (en) * | 1927-02-07 | 1930-05-13 | Cutler Hammer Inc | Means for protecting contacts of electric switches |
| GB486006A (en) * | 1936-10-27 | 1938-05-27 | Christopher William Crouch Whe | Improvements in colour photography |
| US2410025A (en) * | 1936-12-14 | 1946-10-29 | Chromogen Inc | Production of colored photographic pictures |
| USRE22308E (en) * | 1936-12-14 | 1943-05-11 | Production of colored photographic | |
| BE434413A (en:Method) * | 1938-05-17 | |||
| BE437332A (en:Method) * | 1938-12-12 | |||
| US2261608A (en) * | 1940-03-21 | 1941-11-04 | Merck & Co Inc | Alloxazines and isoalloxazines and processes for their production |
| US2346090A (en) * | 1942-08-19 | 1944-04-04 | Eastman Kodak Co | Photographic bleach-out layer |
-
0
- BE BE488117D patent/BE488117A/xx unknown
- CA CA474965A patent/CA474965A/en not_active Expired
-
1948
- 1948-03-27 US US17574A patent/US2518710A/en not_active Expired - Lifetime
-
1949
- 1949-02-16 GB GB4278/49A patent/GB657374A/en not_active Expired
- 1949-03-21 CH CH279649D patent/CH279649A/fr unknown
- 1949-03-21 CH CH285166D patent/CH285166A/fr unknown
- 1949-03-25 DE DEP37726A patent/DE825206C/de not_active Expired
- 1949-03-26 FR FR983723D patent/FR983723A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR983723A (fr) | 1951-06-27 |
| CA474965A (en) | 1951-07-03 |
| GB657374A (en) | 1951-09-19 |
| CH279649A (fr) | 1951-12-15 |
| US2518710A (en) | 1950-08-15 |
| BE488117A (en:Method) | |
| CH285166A (fr) | 1952-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE857738C (de) | Verfahren zur Verhinderung von Fleckenbildungen auf Farbbildern | |
| DE1290812B (de) | Verfahren zum Bleichfixieren von photographischen Silberbildern | |
| DE2043270A1 (de) | Dauerhaftes Farbphoto | |
| DE827900C (de) | Entwickler fuer Schwarz-Weiss- und insbesondere fuer Farbenfotografie | |
| DE851724C (de) | Verfahren zur Herstellung fotografischer Farbbilder in fotografischen Mehrfarbenemulsionen | |
| DE2448433C2 (de) | Wässriges Behandlungsbad zur kombinierten Farb- und Silberbleichung und Verfahren zur Verarbeitung von Silberfarbbleichmaterialien | |
| DE1572125B2 (de) | Fotografisches Material für die Herstellung direktpositiver Bilder | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE941769C (de) | Silber-Farbstoff-Bleichbaeder mit Katalysatoren | |
| DE825206C (de) | Farbbleichbad fuer die Herstellung von farbigen Bildern in photographischen Emulsionsschichten | |
| EP0133163B1 (de) | Verfahren zur Verarbeitung photographischer Silberfarbbleichmaterialien | |
| DE902220C (de) | Farbbleichbad fuer die Farbenphotographie | |
| DE1952253C3 (de) | Verfahren zum Entwickeln farbphotographischer Aufzeichnungsmaterialien | |
| DE2737142A1 (de) | Verfahren fuer die verarbeitung von silberfarbbleichmaterialien und fuer die farbbleichung geeignete zubereitungen | |
| DE1547920A1 (de) | Lichtempfindliches photographisches Material | |
| DE932343C (de) | Verfahren zur Herstellung von Lichthofschutz- und Filterschichten | |
| DE1547910A1 (de) | Verfahren zur Behandlung von lichtempfindlichen Silberhalogenid-Emulsionen sowie lichtempfindliche Silberhalogenid-Emulsionen | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE1269483B (de) | Verwendung von Pyrazinen als Farbbleichkatalysatoren fuer das Silberfarbbleichverfahren | |
| DE2146668A1 (de) | Verfahren zur Stabilisierung eines Farbbildes in der Silberhalogenidfarbphotographie | |
| DE2745955A1 (de) | Verfahren zur erzeugung von farbbildern | |
| DE895407C (de) | Verfahren zur Farbkorrektur bei der Farbphotographie | |
| DE813941C (de) | Verfahren zur Herstellung von farbigen photographischen Bildern | |
| DE1921054C3 (de) | Photographischer Fixierentwickler | |
| DE1013966B (de) | Verfahren zur Herstellung von farbigen Bildern durch Farbentwicklung |