DE699032C - - Google Patents
Info
- Publication number
- DE699032C DE699032C DE1938I0062290 DEI0062290D DE699032C DE 699032 C DE699032 C DE 699032C DE 1938I0062290 DE1938I0062290 DE 1938I0062290 DE I0062290 D DEI0062290 D DE I0062290D DE 699032 C DE699032 C DE 699032C
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- methylpyrrolidine
- acid nitrile
- levulinic acid
- bases
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 7
- JFVBCXHSPKJLRP-UHFFFAOYSA-N 4-oxopentanenitrile Chemical compound CC(=O)CCC#N JFVBCXHSPKJLRP-UHFFFAOYSA-N 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- TVCXVUHHCUYLGX-UHFFFAOYSA-N 2-Methylpyrrole Chemical compound CC1=CC=CN1 TVCXVUHHCUYLGX-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000008262 pumice Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VODXUZDKSDHLHT-UHFFFAOYSA-N 1-(5-methyl-1h-pyrrol-2-yl)ethanone Chemical compound CC(=O)C1=CC=C(C)N1 VODXUZDKSDHLHT-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- PMVSDNDAUGGCCE-TYYBGVCCSA-L Ferrous fumarate Chemical compound [Fe+2].[O-]C(=O)\C=C\C([O-])=O PMVSDNDAUGGCCE-TYYBGVCCSA-L 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- -1 levulin nitrile Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/323—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1938I0062290 DE699032C (enExample) | 1938-08-23 | 1938-08-23 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1938I0062290 DE699032C (enExample) | 1938-08-23 | 1938-08-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE699032C true DE699032C (enExample) | 1940-11-25 |
Family
ID=7195653
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1938I0062290 Expired DE699032C (enExample) | 1938-08-23 | 1938-08-23 |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE699032C (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2984672A (en) * | 1958-05-14 | 1961-05-16 | Rohm & Haas | Method for the preparation of pyrrolinones |
| EP0057890A1 (de) * | 1981-02-11 | 1982-08-18 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Pyridinen oder Pyrrolen aus alpha,omega-Dinitrilen |
| EP0066346A1 (en) * | 1981-06-02 | 1982-12-08 | Stamicarbon B.V. | Process for the preparation of a 2-alkylpyrrole |
| EP0137187A1 (de) * | 1983-08-17 | 1985-04-17 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 5- bis 7-gliedrigen cyclischen Iminen |
-
1938
- 1938-08-23 DE DE1938I0062290 patent/DE699032C/de not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2984672A (en) * | 1958-05-14 | 1961-05-16 | Rohm & Haas | Method for the preparation of pyrrolinones |
| EP0057890A1 (de) * | 1981-02-11 | 1982-08-18 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Pyridinen oder Pyrrolen aus alpha,omega-Dinitrilen |
| EP0066346A1 (en) * | 1981-06-02 | 1982-12-08 | Stamicarbon B.V. | Process for the preparation of a 2-alkylpyrrole |
| US4485243A (en) * | 1981-06-02 | 1984-11-27 | Stamicarbon B.V. | Process for the preparation of a 2-alkylpyrrole |
| EP0137187A1 (de) * | 1983-08-17 | 1985-04-17 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 5- bis 7-gliedrigen cyclischen Iminen |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1618528B1 (de) | Neue Alfa-Methylen-aldehyde | |
| DE2533920A1 (de) | Verfahren zur herstellung von resorcinen | |
| DE699032C (enExample) | ||
| DE2155671B2 (de) | Neue Riechstoffe | |
| DE3122995A1 (de) | Verfahren zur herstellung von oxocyclopentenen | |
| DE1146050B (de) | Verfahren zur Herstellung von Fulvenen | |
| DE1005954B (de) | Verfahren zur Herstellung von Polyencarbonsaeureestern bzw. -nitrilen | |
| DE2314697C3 (de) | 1 -Amino^-hydroxy-SJ-dimethyloctane und Verfahren zu deren Herstellung | |
| DE2053736C3 (de) | Verfahren zur Herstellung von 1- und 2-Formylindan durch die Oxo-Synthese | |
| DE2705602A1 (de) | Verfahren zur herstellung eines ungesaettigten ketons | |
| DE3118656A1 (de) | Verfahren zur herstellung von (alpha),ss-ungesaettigten aldehyden und 2,7-dimethyl-2,6-octadienal | |
| DE523273C (de) | Verfahren zur Darstellung m- oder p-aminosubstituierter aromatischer Carbonsaeurenitrile | |
| DE751910C (de) | Verfahren zur Herstellung von Hydrochinon | |
| DE880136C (de) | Verfahren zur Herstellung von Adipinsäuredinitril | |
| DE892447C (de) | Verfahren zur Herstellung von Dicyclohexylaethanverbindungen | |
| DE2050566A1 (de) | Verfahren zur Herstellung von alpha, beta ungesättigten Ketonen | |
| DE727064C (de) | Verfahren zur Herstellung von Ketocarbonsaeureabkoemmlingen | |
| DE724761C (de) | Verfahren zur Herstellung von Alkanolaminen | |
| AT214909B (de) | Verfahren zur Herstellung von ungesättigten Ketonen | |
| DE652862C (de) | Verfahren zur Darstellung cyclischer ª‡-Cyanketimide und cyclischer ª‡-Cyanketone | |
| DE855256C (de) | Verfahren zur Herstellung von aliphatischen und hydroaromatischen Nitrocarbonsaeuren und ihren Abkoemmlingen | |
| DE898738C (de) | Verfahren zur Herstellung von teilweise veraetherten Diolen | |
| EP0447758B1 (de) | Verfahren zur Herstellung von ungesättigten und gesättigten Carbonylverbindungen | |
| DE940982C (de) | Verfahren zur Herstellung eines Gemisches von isomeren Dimethoxydecadienen | |
| DE865441C (de) | Verfahren zur Herstellung von Ketolverbindungen |