DE69730210T2 - Verarbeitungsfreie diacetylenische salzfilme zur entwicklung eines schwarzen bildes - Google Patents
Verarbeitungsfreie diacetylenische salzfilme zur entwicklung eines schwarzen bildes Download PDFInfo
- Publication number
- DE69730210T2 DE69730210T2 DE69730210T DE69730210T DE69730210T2 DE 69730210 T2 DE69730210 T2 DE 69730210T2 DE 69730210 T DE69730210 T DE 69730210T DE 69730210 T DE69730210 T DE 69730210T DE 69730210 T2 DE69730210 T2 DE 69730210T2
- Authority
- DE
- Germany
- Prior art keywords
- polyacetylene
- color
- imageable
- zinc
- dispersion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 97
- 238000012545 processing Methods 0.000 title description 6
- 239000000203 mixture Substances 0.000 claims abstract description 130
- 229910052751 metal Inorganic materials 0.000 claims abstract description 92
- 239000002184 metal Substances 0.000 claims abstract description 92
- 150000001875 compounds Chemical class 0.000 claims abstract description 81
- 230000000295 complement effect Effects 0.000 claims abstract description 54
- 206010034972 Photosensitivity reaction Diseases 0.000 claims abstract description 39
- 230000036211 photosensitivity Effects 0.000 claims abstract description 39
- 239000003086 colorant Substances 0.000 claims abstract description 35
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229920001197 polyacetylene Polymers 0.000 claims description 164
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 159
- 239000002253 acid Substances 0.000 claims description 51
- -1 diacetylene compound Chemical class 0.000 claims description 48
- 230000005855 radiation Effects 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 38
- 239000011230 binding agent Substances 0.000 claims description 32
- 150000003751 zinc Chemical class 0.000 claims description 32
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 25
- 230000005865 ionizing radiation Effects 0.000 claims description 22
- 239000011734 sodium Substances 0.000 claims description 21
- 229910052708 sodium Inorganic materials 0.000 claims description 20
- 238000010438 heat treatment Methods 0.000 claims description 19
- YXAFJGRZPDKHKZ-UHFFFAOYSA-L zinc;pentacosa-10,12-diynoate Chemical compound [Zn+2].CCCCCCCCCCCCC#CC#CCCCCCCCCC([O-])=O.CCCCCCCCCCCCC#CC#CCCCCCCCCC([O-])=O YXAFJGRZPDKHKZ-UHFFFAOYSA-L 0.000 claims description 19
- 239000013078 crystal Substances 0.000 claims description 17
- 238000011161 development Methods 0.000 claims description 16
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 15
- VZJXSJFKKWUYIW-UHFFFAOYSA-L zinc;icosa-5,7-diynoate Chemical compound [Zn+2].CCCCCCCCCCCCC#CC#CCCCC([O-])=O.CCCCCCCCCCCCC#CC#CCCCC([O-])=O VZJXSJFKKWUYIW-UHFFFAOYSA-L 0.000 claims description 15
- 239000000654 additive Substances 0.000 claims description 13
- 238000003384 imaging method Methods 0.000 claims description 10
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 10
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 9
- 230000000996 additive effect Effects 0.000 claims description 8
- 229920001451 polypropylene glycol Polymers 0.000 claims description 8
- 239000004317 sodium nitrate Substances 0.000 claims description 5
- 235000010344 sodium nitrate Nutrition 0.000 claims description 5
- 238000005054 agglomeration Methods 0.000 claims description 4
- 230000002776 aggregation Effects 0.000 claims description 4
- DKFFITSUIIXFPL-UHFFFAOYSA-N penta-2,4-diynoic acid Chemical compound OC(=O)C#CC#C DKFFITSUIIXFPL-UHFFFAOYSA-N 0.000 claims description 3
- 230000001678 irradiating effect Effects 0.000 claims 1
- LLCSWKVOHICRDD-UHFFFAOYSA-N buta-1,3-diyne Chemical group C#CC#C LLCSWKVOHICRDD-UHFFFAOYSA-N 0.000 abstract description 20
- 238000002360 preparation method Methods 0.000 abstract description 11
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 abstract description 5
- 239000006185 dispersion Substances 0.000 description 159
- 238000000576 coating method Methods 0.000 description 60
- 239000010410 layer Substances 0.000 description 39
- 230000007935 neutral effect Effects 0.000 description 37
- 239000011248 coating agent Substances 0.000 description 36
- 239000011701 zinc Substances 0.000 description 36
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 34
- 229910052725 zinc Inorganic materials 0.000 description 34
- 239000000243 solution Substances 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000004094 surface-active agent Substances 0.000 description 24
- 230000008859 change Effects 0.000 description 19
- 239000000523 sample Substances 0.000 description 18
- 229920000159 gelatin Polymers 0.000 description 17
- 235000019322 gelatine Nutrition 0.000 description 17
- 229920000642 polymer Polymers 0.000 description 17
- 150000007513 acids Chemical class 0.000 description 16
- 150000001991 dicarboxylic acids Chemical class 0.000 description 16
- 230000035945 sensitivity Effects 0.000 description 16
- 108010010803 Gelatin Proteins 0.000 description 14
- 239000008273 gelatin Substances 0.000 description 14
- 235000011852 gelatine desserts Nutrition 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000975 dye Substances 0.000 description 13
- 239000013504 Triton X-100 Substances 0.000 description 11
- 229920004890 Triton X-100 Polymers 0.000 description 11
- 238000007792 addition Methods 0.000 description 11
- 239000008367 deionised water Substances 0.000 description 11
- 229910021641 deionized water Inorganic materials 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 11
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 238000011065 in-situ storage Methods 0.000 description 10
- 159000000000 sodium salts Chemical class 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- 239000006227 byproduct Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 230000002427 irreversible effect Effects 0.000 description 9
- 229910021645 metal ion Inorganic materials 0.000 description 9
- 229910052755 nonmetal Chemical class 0.000 description 9
- ZPUDRBWHCWYMQS-UHFFFAOYSA-N pentacosa-10,12-diynoic acid Chemical compound CCCCCCCCCCCCC#CC#CCCCCCCCCC(O)=O ZPUDRBWHCWYMQS-UHFFFAOYSA-N 0.000 description 9
- 238000006116 polymerization reaction Methods 0.000 description 9
- 150000001450 anions Chemical class 0.000 description 8
- 150000007942 carboxylates Chemical class 0.000 description 8
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- 229920006267 polyester film Polymers 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000000007 visual effect Effects 0.000 description 7
- 239000001043 yellow dye Substances 0.000 description 7
- XIOUDVJTOYVRTB-UHFFFAOYSA-N 1-(1-adamantyl)-3-aminothiourea Chemical compound C1C(C2)CC3CC2CC1(NC(=S)NN)C3 XIOUDVJTOYVRTB-UHFFFAOYSA-N 0.000 description 6
- 229910002651 NO3 Inorganic materials 0.000 description 6
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 229920001519 homopolymer Polymers 0.000 description 6
- 238000005342 ion exchange Methods 0.000 description 6
- 229910003002 lithium salt Inorganic materials 0.000 description 6
- 159000000002 lithium salts Chemical class 0.000 description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 6
- 229910052753 mercury Inorganic materials 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 6
- 125000005599 alkyl carboxylate group Chemical group 0.000 description 5
- 239000001045 blue dye Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 230000035800 maturation Effects 0.000 description 5
- 239000000178 monomer Substances 0.000 description 5
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 229910052701 rubidium Inorganic materials 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- 238000001429 visible spectrum Methods 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000000862 absorption spectrum Methods 0.000 description 4
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- OSIVISXRDMXJQR-UHFFFAOYSA-M potassium;2-[ethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]acetate Chemical compound [K+].[O-]C(=O)CN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F OSIVISXRDMXJQR-UHFFFAOYSA-M 0.000 description 4
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 4
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 4
- 239000004246 zinc acetate Substances 0.000 description 4
- 235000013904 zinc acetate Nutrition 0.000 description 4
- 229960000314 zinc acetate Drugs 0.000 description 4
- WJBBNACNHDMILM-UHFFFAOYSA-L zinc;prop-2-ynoate Chemical compound [Zn+2].[O-]C(=O)C#C.[O-]C(=O)C#C WJBBNACNHDMILM-UHFFFAOYSA-L 0.000 description 4
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 3
- 239000001828 Gelatine Substances 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910052775 Thulium Inorganic materials 0.000 description 3
- 235000011941 Tilia x europaea Nutrition 0.000 description 3
- 159000000009 barium salts Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 210000000988 bone and bone Anatomy 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000004571 lime Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011572 manganese Substances 0.000 description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- QMQBZOVJDLTKAZ-UHFFFAOYSA-N nonadeca-4,6-diynoic acid Chemical compound CCCCCCCCCCCCC#CC#CCCC(O)=O QMQBZOVJDLTKAZ-UHFFFAOYSA-N 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 229920000015 polydiacetylene Polymers 0.000 description 3
- 230000005070 ripening Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 125000003636 chemical group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000002223 garnet Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- ICAKDTKJOYSXGC-UHFFFAOYSA-K lanthanum(iii) chloride Chemical compound Cl[La](Cl)Cl ICAKDTKJOYSXGC-UHFFFAOYSA-K 0.000 description 2
- KQURJLNLARNQPH-UHFFFAOYSA-M lithium;pentacosa-10,12-diynoate Chemical compound [Li+].CCCCCCCCCCCCC#CC#CCCCCCCCCC([O-])=O KQURJLNLARNQPH-UHFFFAOYSA-M 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VSQYNPJPULBZKU-UHFFFAOYSA-N mercury xenon Chemical compound [Xe].[Hg] VSQYNPJPULBZKU-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- RTVZZUKVCUYBRV-UHFFFAOYSA-N prop-2-ynoic acid;zinc Chemical compound [Zn].OC(=O)C#C.OC(=O)C#C RTVZZUKVCUYBRV-UHFFFAOYSA-N 0.000 description 2
- OVPLZYJGTGDFNB-UHFFFAOYSA-N propan-2-yl carbamate Chemical compound CC(C)OC(N)=O OVPLZYJGTGDFNB-UHFFFAOYSA-N 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- UDWXLZLRRVQONG-UHFFFAOYSA-M sodium hexanoate Chemical compound [Na+].CCCCCC([O-])=O UDWXLZLRRVQONG-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical class [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- HQQJVQWCVISFBW-UHFFFAOYSA-L zinc;nonadeca-4,6-diynoate Chemical compound [Zn+2].CCCCCCCCCCCCC#CC#CCCC([O-])=O.CCCCCCCCCCCCC#CC#CCCC([O-])=O HQQJVQWCVISFBW-UHFFFAOYSA-L 0.000 description 2
- XDWXRAYGALQIFG-UHFFFAOYSA-L zinc;propanoate Chemical compound [Zn+2].CCC([O-])=O.CCC([O-])=O XDWXRAYGALQIFG-UHFFFAOYSA-L 0.000 description 2
- ZXAUZSQITFJWPS-UHFFFAOYSA-J zirconium(4+);disulfate Chemical compound [Zr+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZXAUZSQITFJWPS-UHFFFAOYSA-J 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- MXXTVDSLIANCNG-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate;dimethyl sulfate;1-ethenylpyrrolidin-2-one Chemical compound COS(=O)(=O)OC.C=CN1CCCC1=O.CN(C)CCOC(=O)C(C)=C MXXTVDSLIANCNG-UHFFFAOYSA-N 0.000 description 1
- WBHAUHHMPXBZCQ-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound COC1=CC=CC(C)=C1O WBHAUHHMPXBZCQ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 229920002046 Pluronic® L 62 LF Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004349 Polyvinylpyrrolidone-vinyl acetate copolymer Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000404236 Zizina otis Species 0.000 description 1
- IPAVHFVZRLZLGW-UHFFFAOYSA-N acetic acid;1-isocyanatobutane Chemical compound CC(O)=O.CCCCN=C=O IPAVHFVZRLZLGW-UHFFFAOYSA-N 0.000 description 1
- QVTMGLKIERGFFS-UHFFFAOYSA-N acetic acid;isocyanatoethane Chemical compound CC(O)=O.CCN=C=O QVTMGLKIERGFFS-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- ITHZDDVSAWDQPZ-UHFFFAOYSA-L barium acetate Chemical compound [Ba+2].CC([O-])=O.CC([O-])=O ITHZDDVSAWDQPZ-UHFFFAOYSA-L 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000012822 chemical development Methods 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- BLPYWBZRUNDXJH-UHFFFAOYSA-N deca-4,6-diyne-1,10-diol Chemical compound OCCCC#CC#CCCCO BLPYWBZRUNDXJH-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000000586 desensitisation Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- KSOQHQONAHQOCM-UHFFFAOYSA-N dodeca-5,7-diyne Chemical compound CCCCC#CC#CCCCC KSOQHQONAHQOCM-UHFFFAOYSA-N 0.000 description 1
- 229910001254 electrum Inorganic materials 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- HQPMKSGTIOYHJT-UHFFFAOYSA-N ethane-1,2-diol;propane-1,2-diol Chemical compound OCCO.CC(O)CO HQPMKSGTIOYHJT-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 239000010940 green gold Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- HFELYOMSJFEHGV-UHFFFAOYSA-N icosa-5,7-diynoic acid Chemical compound CCCCCCCCCCCCC#CC#CCCCC(O)=O HFELYOMSJFEHGV-UHFFFAOYSA-N 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 238000007648 laser printing Methods 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 238000007431 microscopic evaluation Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001993 poloxamer 188 Polymers 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 235000019448 polyvinylpyrrolidone-vinyl acetate copolymer Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical compound C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 229910001419 rubidium ion Inorganic materials 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- 230000009291 secondary effect Effects 0.000 description 1
- VSZWPYCFIRKVQL-UHFFFAOYSA-N selanylidenegallium;selenium Chemical compound [Se].[Se]=[Ga].[Se]=[Ga] VSZWPYCFIRKVQL-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- MFBOGIVSZKQAPD-UHFFFAOYSA-M sodium butyrate Chemical compound [Na+].CCCC([O-])=O MFBOGIVSZKQAPD-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- JXKPEJDQGNYQSM-UHFFFAOYSA-M sodium propionate Chemical compound [Na+].CCC([O-])=O JXKPEJDQGNYQSM-UHFFFAOYSA-M 0.000 description 1
- 239000004324 sodium propionate Substances 0.000 description 1
- 235000010334 sodium propionate Nutrition 0.000 description 1
- 229960003212 sodium propionate Drugs 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229910052713 technetium Inorganic materials 0.000 description 1
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 1
- JBQYATWDVHIOAR-UHFFFAOYSA-N tellanylidenegermanium Chemical compound [Te]=[Ge] JBQYATWDVHIOAR-UHFFFAOYSA-N 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- FRNOGLGSGLTDKL-UHFFFAOYSA-N thulium atom Chemical compound [Tm] FRNOGLGSGLTDKL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- SRWMQSFFRFWREA-UHFFFAOYSA-M zinc formate Chemical compound [Zn+2].[O-]C=O SRWMQSFFRFWREA-UHFFFAOYSA-M 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/18—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms with only carbon-to-carbon triple bonds as unsaturation
- C07C57/24—Diacetylene or polyacetylene dicarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/18—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms with only carbon-to-carbon triple bonds as unsaturation
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/72—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705
- G03C1/73—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705 containing organic compounds
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/025—Non-macromolecular photopolymerisable compounds having carbon-to-carbon triple bonds, e.g. acetylenic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Materials Engineering (AREA)
- Engineering & Computer Science (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/652,144 US5731112A (en) | 1996-05-23 | 1996-05-23 | Processless diacetylenic salt films capable of developing a black image |
| US652144 | 1996-05-23 | ||
| PCT/US1997/004688 WO1997044708A1 (en) | 1996-05-23 | 1997-03-07 | Processless diacetylenic salt films capable of developing a black image |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69730210D1 DE69730210D1 (de) | 2004-09-16 |
| DE69730210T2 true DE69730210T2 (de) | 2005-08-04 |
Family
ID=24615681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69730210T Expired - Lifetime DE69730210T2 (de) | 1996-05-23 | 1997-03-07 | Verarbeitungsfreie diacetylenische salzfilme zur entwicklung eines schwarzen bildes |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US5731112A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0900409B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2000512627A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE273530T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2541597A (cg-RX-API-DMAC7.html) |
| DE (1) | DE69730210T2 (cg-RX-API-DMAC7.html) |
| WO (1) | WO1997044708A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5731112A (en) * | 1996-05-23 | 1998-03-24 | Isp Investments Inc. | Processless diacetylenic salt films capable of developing a black image |
| JP4373624B2 (ja) * | 2000-09-04 | 2009-11-25 | 富士フイルム株式会社 | 感熱性組成物、それを用いた平版印刷版原版及びスルホニウム塩化合物 |
| AU2003255278A1 (en) * | 2002-08-14 | 2004-03-03 | Jp Laboratories, Inc. | Thick radiation sensitive devices |
| US7399982B2 (en) * | 2003-01-09 | 2008-07-15 | Con-Trol-Cure, Inc | UV curing system and process with increased light intensity |
| US20060204670A1 (en) * | 2003-01-09 | 2006-09-14 | Con-Trol-Cure, Inc. | UV curing method and apparatus |
| US7465909B2 (en) * | 2003-01-09 | 2008-12-16 | Con-Trol-Cure, Inc. | UV LED control loop and controller for causing emitting UV light at a much greater intensity for UV curing |
| US7498065B2 (en) * | 2003-01-09 | 2009-03-03 | Con-Trol-Cure, Inc. | UV printing and curing of CDs, DVDs, Golf Balls And Other Products |
| US7671346B2 (en) * | 2003-01-09 | 2010-03-02 | Con-Trol-Cure, Inc. | Light emitting apparatus and method for curing inks, coatings and adhesives |
| US7137696B2 (en) * | 2003-01-09 | 2006-11-21 | Con-Trol-Cure, Inc. | Ink jet UV curing |
| US20040164325A1 (en) * | 2003-01-09 | 2004-08-26 | Con-Trol-Cure, Inc. | UV curing for ink jet printer |
| US8115182B1 (en) | 2003-02-27 | 2012-02-14 | Gordhanbhai N Patel | Personal and area self-indicating radiation alert dosimeter |
| CA2517873C (en) * | 2003-02-27 | 2012-04-10 | Jp Laboratories Inc. | Personal and area self-indicating instant radation alert dosimeter |
| US7227158B1 (en) | 2003-02-27 | 2007-06-05 | Jp Labs, Inc. | Stick-on self-indicating instant radiation dosimeter |
| US9086489B2 (en) | 2003-02-27 | 2015-07-21 | Jp Laboratories, Inc | Personal and area self-indicating instant radiation alert dosimeter |
| US7445880B2 (en) * | 2003-04-01 | 2008-11-04 | Isp Investments Inc. | Lithium salt of polyacetylene as radiation sensitive filaments and preparation and use thereof |
| US20040197700A1 (en) * | 2003-04-01 | 2004-10-07 | Isp Investments Inc. | Lithium salt of polyacetylene as radiation sensitive filaments and preparation and use thereof |
| US7573048B2 (en) * | 2004-10-08 | 2009-08-11 | Patel Gordhanbhai N | Tamper resistant self indicating instant alert radiation dosimeter |
| US7989781B2 (en) * | 2005-05-14 | 2011-08-02 | Patel Gordhanbhai N | Detector for a UV false positive of radiation sensitive devices |
| US20080029713A1 (en) * | 2006-02-17 | 2008-02-07 | Paul Lovendale | Disposable radioactive contamination control materials |
| US8120811B2 (en) | 2007-11-21 | 2012-02-21 | Quad/Graphics, Inc. | System and method for adding data to a printed publication |
| JP2012502404A (ja) * | 2008-09-10 | 2012-01-26 | データレース リミテッド | データ保存媒体 |
| EP2326753A2 (en) * | 2008-09-10 | 2011-06-01 | DataLase Ltd | Textile colouration with diacetylene compounds |
| WO2010077132A1 (en) | 2008-12-31 | 2010-07-08 | Draka Comteq B.V. | Uvled apparatus for curing glass-fiber coatings |
| WO2010089595A1 (en) * | 2009-02-05 | 2010-08-12 | Datalase Ltd. | Co-crystals and their use |
| BRPI1014310A2 (pt) * | 2009-04-02 | 2016-04-05 | Datalase Ltd | imagem a laser |
| DK2388239T3 (da) | 2010-05-20 | 2017-04-24 | Draka Comteq Bv | Hærdningsapparat, der anvender vinklede UV-LED'er |
| US8871311B2 (en) | 2010-06-03 | 2014-10-28 | Draka Comteq, B.V. | Curing method employing UV sources that emit differing ranges of UV radiation |
| EP2418183B1 (en) | 2010-08-10 | 2018-07-25 | Draka Comteq B.V. | Method for curing coated glass fibres providing increased UVLED intensitiy |
| KR101641665B1 (ko) * | 2013-01-18 | 2016-07-21 | 한양대학교 산학협력단 | 수변색 폴리다이아세틸렌 복합체 조성물, 이를 이용한 수변색 박막필름 및 이의 용도 |
| CN113253509A (zh) * | 2021-05-08 | 2021-08-13 | Tcl华星光电技术有限公司 | 显示面板及其制作方法、显示装置 |
Family Cites Families (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3501303A (en) * | 1966-06-06 | 1970-03-17 | Battelle Development Corp | Photosensitive crystalline polyacetylenic system and method of exposure |
| US3501308A (en) * | 1966-07-01 | 1970-03-17 | Battelle Development Corp | Photosensitive crystalline polyacetylenic sensitized with a pi-acid |
| US3723121A (en) * | 1970-11-03 | 1973-03-27 | Du Pont | Process for recording images with laser beams |
| US3810778A (en) * | 1971-05-03 | 1974-05-14 | Polaroid Corp | Method for production of a photographic film |
| US3743505A (en) * | 1971-06-14 | 1973-07-03 | Eastman Kodak Co | Direct-print process utilizing photosensitive polyacetylenic amine salts containing carboxylate moieties |
| US3844791A (en) * | 1971-06-14 | 1974-10-29 | Eastman Kodak Co | Photosensitive material comprising polyacetylenic amine salts |
| BE789476A (fr) * | 1971-10-01 | 1973-03-29 | Basf Ag | Procede de preparation de cliches |
| US3772011A (en) * | 1971-11-04 | 1973-11-13 | Eastman Kodak Co | Print-out elements and methods using photoconductors and polygnes |
| US3811895A (en) * | 1972-01-14 | 1974-05-21 | Eastman Kodak Co | Sensitized compounds and elements |
| US3822134A (en) * | 1972-01-17 | 1974-07-02 | Eastman Kodak Co | Vacuum deposited radiation-sensitive elements |
| US3772028A (en) * | 1972-02-02 | 1973-11-13 | Eastman Kodak Co | Sensitized photosensitive compounds and elements |
| US3772027A (en) * | 1972-02-04 | 1973-11-13 | Eastman Kodak Co | Photosensitive element containing a photosensitive crystalline polyacetylenic compound and a photoconductive inorganic metal salt |
| US3794491A (en) * | 1972-06-14 | 1974-02-26 | Eastman Kodak Co | Amplification of low-density polyyne images |
| US3954816A (en) * | 1972-12-14 | 1976-05-04 | Eastman Kodak Company | Photosensitive material comprising polyacetylenic amine salts |
| US4066676A (en) * | 1974-02-06 | 1978-01-03 | Eastman Kodak Company | Photosensitive material comprising polyacetylenic amine salts |
| US3999946A (en) * | 1976-02-23 | 1976-12-28 | Allied Chemical Corporation | Time-temperature history indicators |
| US4247613A (en) * | 1976-07-23 | 1981-01-27 | Eastman Kodak Company | Electric field sensitization of polyacetylenic materials |
| US4125534A (en) * | 1977-02-25 | 1978-11-14 | Allied Chemical Corporation | Carbazolyl diacetylenic compounds |
| US4208501A (en) * | 1977-02-25 | 1980-06-17 | Allied Chemical Corporation | Carbazolyl diacetylenic polymers |
| US4189399A (en) * | 1977-07-19 | 1980-02-19 | Allied Chemical Corporation | Co-crystallized acetylenic compounds |
| US4339951A (en) * | 1977-10-05 | 1982-07-20 | Allied Corporation | Tempeature measurement and display of indicia using thermochromic polyacetylenes |
| US4215208A (en) * | 1977-10-05 | 1980-07-29 | Allied Chemical Corporation | Thermochromic polyacetylenes containing urethane groups |
| US4452995A (en) * | 1978-08-30 | 1984-06-05 | Allied Corporation | Dialkoxycarbonylmethyleneurethane diynes |
| US4238352A (en) * | 1978-11-13 | 1980-12-09 | Allied Chemical Corporation | Co-polymerized acetylenic compositions |
| US4235108A (en) * | 1978-11-13 | 1980-11-25 | Allied Chemical Corporation | Device for measuring temperature using co-crystallized acetylenic compositions |
| US4242440A (en) * | 1979-04-30 | 1980-12-30 | Allied Chemical Corporation | Thermochromic polyacetylenes used in laser beam recording method |
| US4439514A (en) * | 1979-06-25 | 1984-03-27 | University Patents, Inc. | Photoresistive compositions |
| US4581315A (en) * | 1979-06-25 | 1986-04-08 | University Patents, Inc. | Photoresistive compositions |
| US4536450A (en) * | 1980-03-12 | 1985-08-20 | University Patents, Inc. | Nonlinear optical materials and processes employing diacetylenes |
| US4699997A (en) * | 1980-06-16 | 1987-10-13 | Allied Corporation | Metal salts of polyacetylenic compounds and uses thereof |
| US4452959A (en) * | 1980-11-19 | 1984-06-05 | Showa Denko K.K. | Process for producing a gel-like composition of a high polymer of acetylene, and process for molding said composition |
| US4562141A (en) * | 1982-09-29 | 1985-12-31 | Ciba Geigy Corporation | Polymerisable composition comprising conjugated diacetylenic compounds, material coated therewith and the use thereof |
| DE3473065D1 (en) * | 1983-11-26 | 1988-09-01 | Basf Ag | Process for the production of resist images and dry resist film for this process |
| US4705742A (en) * | 1985-09-23 | 1987-11-10 | Gaf Corporation | Processless multicolor imaging |
| US4863832A (en) * | 1985-12-16 | 1989-09-05 | Canon Kabushiki Kaisha | Optical recording employing diacetylene compound and dye to change color and form pits |
| US4705741A (en) * | 1986-03-14 | 1987-11-10 | Gaf Corporation | Processless color imaging and film therefor |
| US4698296A (en) * | 1986-03-14 | 1987-10-06 | Gaf Corporation | Processless color imaging and film therefor |
| US4784934A (en) * | 1986-12-15 | 1988-11-15 | Gaf Corporation | Sensitivity of processless recording media |
| US4867917A (en) * | 1986-12-24 | 1989-09-19 | Schnur Joel M | Method for synthesis of diacetylenic compounds |
| JPH0291106A (ja) * | 1988-09-28 | 1990-03-30 | Agency Of Ind Science & Technol | 多次元化高分子結晶の製造方法 |
| JPH02155689A (ja) * | 1988-12-08 | 1990-06-14 | Olympus Optical Co Ltd | 光記録方式 |
| GB9002360D0 (en) * | 1990-02-02 | 1990-04-04 | De La Rue Co Plc | Ink composition and components thereof |
| US5420000A (en) * | 1990-04-09 | 1995-05-30 | Jp Laboratories, Inc. | Heat fixable high energy radiation imaging film |
| US5149616A (en) * | 1990-10-23 | 1992-09-22 | Isp Investments Inc. | Processless imaging to maximize blue light absorption of an image |
| US5139928A (en) * | 1990-10-23 | 1992-08-18 | Isp Investments Inc. | Imageable recording films |
| US5149617A (en) * | 1990-10-23 | 1992-09-22 | Isp Investments Inc. | Imageable diacetylene ethers |
| US5095134A (en) * | 1990-10-23 | 1992-03-10 | Isp Investments Inc. | Thermochromic diacetylene ethers containing ester or urethane groups |
| US5215869A (en) * | 1990-10-23 | 1993-06-01 | Isp Investments Inc. | Process of forming a permanent yellow imaged light modulating film |
| US5215870A (en) * | 1990-10-23 | 1993-06-01 | Isp Investments Inc. | Process of forming a permanent yellow imaged light modulating film |
| US5139927A (en) * | 1990-10-23 | 1992-08-18 | Isp Investments Inc. | Permanent yellow imaged light modulating film |
| US5158862A (en) * | 1990-10-23 | 1992-10-27 | Isp Investments Inc. | Processless imaging to maximize blue light absorption of an image |
| US5153106A (en) * | 1991-03-11 | 1992-10-06 | Isp Investments Inc. | Direct color imaging with laser in a writing mode |
| US5232820A (en) * | 1991-03-18 | 1993-08-03 | Isp Investments Inc. | Process of directly imaging a thermosensitive polyacetylene salt dyes |
| US5137964A (en) * | 1991-03-18 | 1992-08-11 | Isp Investments Inc. | Visually imageable polyacetylene salt dyes |
| TW325477B (en) * | 1992-12-23 | 1998-01-21 | Ciba Sc Holding Ag | Thermochromic compounds, their preparation and the use thereof |
| US5731112A (en) * | 1996-05-23 | 1998-03-24 | Isp Investments Inc. | Processless diacetylenic salt films capable of developing a black image |
-
1996
- 1996-05-23 US US08/652,144 patent/US5731112A/en not_active Expired - Lifetime
-
1997
- 1997-03-07 AT AT97916931T patent/ATE273530T1/de not_active IP Right Cessation
- 1997-03-07 EP EP97916931A patent/EP0900409B1/en not_active Expired - Lifetime
- 1997-03-07 WO PCT/US1997/004688 patent/WO1997044708A1/en not_active Ceased
- 1997-03-07 DE DE69730210T patent/DE69730210T2/de not_active Expired - Lifetime
- 1997-03-07 JP JP09542334A patent/JP2000512627A/ja not_active Ceased
- 1997-03-07 AU AU25415/97A patent/AU2541597A/en not_active Abandoned
-
1998
- 1998-03-05 US US09/035,607 patent/US6177578B1/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JP2000512627A (ja) | 2000-09-26 |
| AU2541597A (en) | 1997-12-09 |
| WO1997044708A1 (en) | 1997-11-27 |
| EP0900409B1 (en) | 2004-08-11 |
| US6177578B1 (en) | 2001-01-23 |
| ATE273530T1 (de) | 2004-08-15 |
| US5731112A (en) | 1998-03-24 |
| EP0900409A4 (en) | 2000-06-28 |
| EP0900409A1 (en) | 1999-03-10 |
| DE69730210D1 (de) | 2004-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69730210T2 (de) | Verarbeitungsfreie diacetylenische salzfilme zur entwicklung eines schwarzen bildes | |
| DE1547651B2 (de) | Verwendung eines kristalline verbindungen mit mehreren acetylenischen bindungen enthaltenden aufzeichnungsmaterials zur herstellung mikroskopischer oder elektronenmikroskopischer bilder und verfahren zur herstellung derartiger bilder | |
| DE2509019A1 (de) | Verfahren zur herstellung eines reliefbildes und lichtempfindliche zusammensetzung fuer dieses verfahren | |
| DE2740505A1 (de) | Verfahren und material zur erzeugung eines lichtstreuenden bildes mittels eines laserstrahls | |
| DE1921641A1 (de) | Verfahren zur Herstellung eines photographischen Aufzeichnungsmaterials | |
| DE69127702T2 (de) | Aufzeichnungsfilm zur bilderzeugung | |
| DE1245729C2 (de) | Verfahren zum optischen Aufhellen von beschichtetem Papier | |
| DE2625026A1 (de) | Verfahren zur haertung photographischer gelatinehaltiger schichten | |
| DE2200063A1 (de) | Polymere Beizmittel | |
| DE1522374C2 (de) | Verfahren zur Herstellung eines direktpositiven photographischen Bildes | |
| DE2617588A1 (de) | Stabile photochrome verbindungen | |
| DE2510873C3 (de) | Photographisches Aufzeichnungsverfahren | |
| DE1547819C3 (de) | Verfahren zur Herstellung von Dispersionen von schwarzem kolloidalem Silber | |
| DE69213434T2 (de) | Boratkoinitiatoren fur photopolymerisierbare zusammensetzungen | |
| DE2640655A1 (de) | Photographisches aufzeichnungsmaterial mit empfindlichkeit im ultravioletten spektralbereich, sensibilisierte halogensilber-emulsion, roentgenbildaufzeichnungsmaterial und verfahren zur herstellung einer mindestens 50 molprozent silberchlorid enthaltenden photographischen emulsion mit empfindlichkeit im ultravioletten spektralbereich | |
| DE69326316T2 (de) | Thermische Farbbleichmittel Tetra-alkylammonium phenylsulfonylacetat | |
| DE2300772C3 (de) | Farbdiffusionsübertragungsverfahren und Aufzeichnungseinheit für Farbdiffusionsübertragungsverfahren | |
| DE1227339C2 (de) | Fluoreszenzschirm mit mehreren schichten | |
| DE2416088C2 (de) | Flächengebilde für die Erzeugung von Farbdiapositiven | |
| EP0376051A2 (de) | Cyanin-Farbstoffe | |
| DE1597543A1 (de) | Photographisches Material mit Lichthofschutzschicht | |
| DE2404202A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE2706532C3 (de) | Silberfreies, photolytisch Radikale bildendes lichtempfindliches Aufzeichnungsmaterial | |
| DE4142936C2 (de) | Fotografisches Silberhalogenidmaterial mit gradationsversteilernden Zusätzen | |
| DE2736098C2 (de) | Fotographisches Aufzeichnungsmaterial und Verfahren zum Entwickeln eines Bildes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |