DE69633679T2 - Substituierte aryl-oder heteroarylamide mit retinoid-ähnlicher biologischer aktivität - Google Patents
Substituierte aryl-oder heteroarylamide mit retinoid-ähnlicher biologischer aktivität Download PDFInfo
- Publication number
- DE69633679T2 DE69633679T2 DE69633679T DE69633679T DE69633679T2 DE 69633679 T2 DE69633679 T2 DE 69633679T2 DE 69633679 T DE69633679 T DE 69633679T DE 69633679 T DE69633679 T DE 69633679T DE 69633679 T2 DE69633679 T2 DE 69633679T2
- Authority
- DE
- Germany
- Prior art keywords
- compound
- acid
- compounds
- carbamoyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 230000004071 biological effect Effects 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 143
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 60
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 39
- 239000005711 Benzoic acid Substances 0.000 claims description 18
- 235000010233 benzoic acid Nutrition 0.000 claims description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 229910052731 fluorine Inorganic materials 0.000 claims description 12
- 229910004013 NO 2 Inorganic materials 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- 210000004027 cell Anatomy 0.000 description 29
- 239000002253 acid Substances 0.000 description 28
- 239000000243 solution Substances 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 25
- 238000000034 method Methods 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- -1 Retinoid compounds Chemical class 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 150000002148 esters Chemical class 0.000 description 20
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 19
- 235000019441 ethanol Nutrition 0.000 description 19
- 108090000064 retinoic acid receptors Proteins 0.000 description 18
- 102000003702 retinoic acid receptors Human genes 0.000 description 18
- 150000001408 amides Chemical class 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- 201000010099 disease Diseases 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 230000000694 effects Effects 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 238000004440 column chromatography Methods 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 108010038912 Retinoid X Receptors Proteins 0.000 description 11
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 10
- 238000003556 assay Methods 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 230000002265 prevention Effects 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- BWHIWEBPMRLTOT-UHFFFAOYSA-N 2,6-ditert-butylpyridine-4-carboxylic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=CC(C(C)(C)C)=N1 BWHIWEBPMRLTOT-UHFFFAOYSA-N 0.000 description 9
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- NNMJPCUZFNRTEG-UHFFFAOYSA-N ethyl 4-amino-2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=C(N)C=C1F NNMJPCUZFNRTEG-UHFFFAOYSA-N 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 102000027483 retinoid hormone receptors Human genes 0.000 description 7
- 108091008679 retinoid hormone receptors Proteins 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 150000001805 chlorine compounds Chemical class 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229940104230 thymidine Drugs 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 5
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 5
- UWPLTCWTTVMXCM-UHFFFAOYSA-N methyl 4-amino-2,6-difluorobenzoate Chemical compound COC(=O)C1=C(F)C=C(N)C=C1F UWPLTCWTTVMXCM-UHFFFAOYSA-N 0.000 description 5
- 210000000056 organ Anatomy 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 4
- 229940126062 Compound A Drugs 0.000 description 4
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 4
- 241000701806 Human papillomavirus Species 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 206010028980 Neoplasm Diseases 0.000 description 4
- 208000002158 Proliferative Vitreoretinopathy Diseases 0.000 description 4
- 206010038934 Retinopathy proliferative Diseases 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 4
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 4
- 150000001241 acetals Chemical class 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 4
- 230000006907 apoptotic process Effects 0.000 description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229940125904 compound 1 Drugs 0.000 description 4
- 229940125773 compound 10 Drugs 0.000 description 4
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 229910052588 hydroxylapatite Inorganic materials 0.000 description 4
- 230000003463 hyperproliferative effect Effects 0.000 description 4
- 230000002757 inflammatory effect Effects 0.000 description 4
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 238000000670 ligand binding assay Methods 0.000 description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 4
- 208000021971 neovascular inflammatory vitreoretinopathy Diseases 0.000 description 4
- XYJRXVWERLGGKC-UHFFFAOYSA-D pentacalcium;hydroxide;triphosphate Chemical compound [OH-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O XYJRXVWERLGGKC-UHFFFAOYSA-D 0.000 description 4
- 230000006785 proliferative vitreoretinopathy Effects 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229930002330 retinoic acid Natural products 0.000 description 4
- 208000017520 skin disease Diseases 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229960000187 tissue plasminogen activator Drugs 0.000 description 4
- VQRKWJCOWABFNN-UHFFFAOYSA-N 1-bromo-3,5-ditert-butyl-2-(methoxymethoxy)benzene Chemical compound COCOC1=C(Br)C=C(C(C)(C)C)C=C1C(C)(C)C VQRKWJCOWABFNN-UHFFFAOYSA-N 0.000 description 3
- DIWZVAHZEOFSLS-UHFFFAOYSA-N 2-bromo-4,6-ditert-butylphenol Chemical compound CC(C)(C)C1=CC(Br)=C(O)C(C(C)(C)C)=C1 DIWZVAHZEOFSLS-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- KRGQGAXLBUQGQP-UHFFFAOYSA-N 4-(bromomethyl)-2,6-ditert-butylpyridine Chemical compound CC(C)(C)C1=CC(CBr)=CC(C(C)(C)C)=N1 KRGQGAXLBUQGQP-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 208000002874 Acne Vulgaris Diseases 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229910004373 HOAc Inorganic materials 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 3
- 206010000496 acne Diseases 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 239000012091 fetal bovine serum Substances 0.000 description 3
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 230000003780 keratinization Effects 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 3
- CWNMNVHDDCDSPU-UHFFFAOYSA-N methyl 4-amino-2-nitrobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1[N+]([O-])=O CWNMNVHDDCDSPU-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 208000003154 papilloma Diseases 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 150000004492 retinoid derivatives Chemical class 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 239000011534 wash buffer Substances 0.000 description 3
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 2
- PKYVQVQJIMJETB-UHFFFAOYSA-N (2,6-ditert-butylpyridin-4-yl)methanol Chemical compound CC(C)(C)C1=CC(CO)=CC(C(C)(C)C)=N1 PKYVQVQJIMJETB-UHFFFAOYSA-N 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 2
- IQFYYKKMVGJFEH-HVMUMPLKSA-N 1-[(2r,4s,5r)-4-hydroxy-5-[hydroxy(tritio)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione Chemical compound C1[C@H](O)[C@@H](C(O)[3H])O[C@H]1N1C(=O)NC(=O)C(C)=C1 IQFYYKKMVGJFEH-HVMUMPLKSA-N 0.000 description 2
- ICKWICRCANNIBI-UHFFFAOYSA-N 2,4-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(C(C)(C)C)=C1 ICKWICRCANNIBI-UHFFFAOYSA-N 0.000 description 2
- HVHZEKKZMFRULH-UHFFFAOYSA-N 2,6-ditert-butyl-4-methylpyridine Chemical compound CC1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1 HVHZEKKZMFRULH-UHFFFAOYSA-N 0.000 description 2
- WIQISTBTOQNVCE-UHFFFAOYSA-N 2-fluoro-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1F WIQISTBTOQNVCE-UHFFFAOYSA-N 0.000 description 2
- NCTSLPBQVXUAHR-UHFFFAOYSA-N 3,5-ditert-butylbenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=CC(C(C)(C)C)=C1 NCTSLPBQVXUAHR-UHFFFAOYSA-N 0.000 description 2
- UMCMPZBLKLEWAF-BCTGSCMUSA-N 3-[(3-cholamidopropyl)dimethylammonio]propane-1-sulfonate Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)C)[C@@]2(C)[C@@H](O)C1 UMCMPZBLKLEWAF-BCTGSCMUSA-N 0.000 description 2
- GPFHESLUFJWHMC-UHFFFAOYSA-N 4-[(3,5-ditert-butylphenyl)carbamoyl]-2-fluorobenzoic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(NC(=O)C=2C=C(F)C(C(O)=O)=CC=2)=C1 GPFHESLUFJWHMC-UHFFFAOYSA-N 0.000 description 2
- SAJYSJVBNGUWJK-UHFFFAOYSA-N 4-amino-2-nitrobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C([N+]([O-])=O)=C1 SAJYSJVBNGUWJK-UHFFFAOYSA-N 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 206010059313 Anogenital warts Diseases 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010003694 Atrophy Diseases 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- 208000000907 Condylomata Acuminata Diseases 0.000 description 2
- 208000011231 Crohn disease Diseases 0.000 description 2
- 201000004624 Dermatitis Diseases 0.000 description 2
- 206010012438 Dermatitis atopic Diseases 0.000 description 2
- 208000003556 Dry Eye Syndromes Diseases 0.000 description 2
- 206010013774 Dry eye Diseases 0.000 description 2
- 208000032928 Dyslipidaemia Diseases 0.000 description 2
- 206010058314 Dysplasia Diseases 0.000 description 2
- 102000018997 Growth Hormone Human genes 0.000 description 2
- 108010051696 Growth Hormone Proteins 0.000 description 2
- 101001093899 Homo sapiens Retinoic acid receptor RXR-alpha Proteins 0.000 description 2
- 206010062767 Hypophysitis Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- 208000007766 Kaposi sarcoma Diseases 0.000 description 2
- 208000001126 Keratosis Diseases 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 206010054949 Metaplasia Diseases 0.000 description 2
- ZFMITUMMTDLWHR-UHFFFAOYSA-N Minoxidil Chemical compound NC1=[N+]([O-])C(N)=CC(N2CCCCC2)=N1 ZFMITUMMTDLWHR-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 208000006994 Precancerous Conditions Diseases 0.000 description 2
- 206010038848 Retinal detachment Diseases 0.000 description 2
- 102100035178 Retinoic acid receptor RXR-alpha Human genes 0.000 description 2
- 102100023606 Retinoic acid receptor alpha Human genes 0.000 description 2
- 208000006011 Stroke Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 206010052779 Transplant rejections Diseases 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 208000000260 Warts Diseases 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 208000009621 actinic keratosis Diseases 0.000 description 2
- 238000010640 amide synthesis reaction Methods 0.000 description 2
- 238000002399 angioplasty Methods 0.000 description 2
- 208000025009 anogenital human papillomavirus infection Diseases 0.000 description 2
- 201000004201 anogenital venereal wart Diseases 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 201000008937 atopic dermatitis Diseases 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 230000037444 atrophy Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000000481 breast Anatomy 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 210000003679 cervix uteri Anatomy 0.000 description 2
- 206010009887 colitis Diseases 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 229940125797 compound 12 Drugs 0.000 description 2
- 229940126543 compound 14 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- KGLJHQMYPYCYCR-UHFFFAOYSA-N ethyl 2-fluoro-4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C=C1F KGLJHQMYPYCYCR-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000003862 glucocorticoid Substances 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 239000000122 growth hormone Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 230000003779 hair growth Effects 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 208000009326 ileitis Diseases 0.000 description 2
- 210000000987 immune system Anatomy 0.000 description 2
- 229960001438 immunostimulant agent Drugs 0.000 description 2
- 239000003022 immunostimulating agent Substances 0.000 description 2
- 230000003308 immunostimulating effect Effects 0.000 description 2
- 230000006882 induction of apoptosis Effects 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- 210000000867 larynx Anatomy 0.000 description 2
- 208000002741 leukoplakia Diseases 0.000 description 2
- 201000011486 lichen planus Diseases 0.000 description 2
- 230000037356 lipid metabolism Effects 0.000 description 2
- 238000005567 liquid scintillation counting Methods 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 210000004324 lymphatic system Anatomy 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 230000015689 metaplastic ossification Effects 0.000 description 2
- IKWXQSKHOBFLFE-UHFFFAOYSA-N methoxymethyl 3,5-ditert-butyl-2-hydroxybenzoate Chemical compound COCOC(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O IKWXQSKHOBFLFE-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229960003632 minoxidil Drugs 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- 230000009826 neoplastic cell growth Effects 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 230000008832 photodamage Effects 0.000 description 2
- 210000003635 pituitary gland Anatomy 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 238000000159 protein binding assay Methods 0.000 description 2
- 208000005069 pulmonary fibrosis Diseases 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000004264 retinal detachment Effects 0.000 description 2
- 108091008726 retinoic acid receptors α Proteins 0.000 description 2
- 102000027478 retinoid receptor subtypes Human genes 0.000 description 2
- 108091008678 retinoid receptor subtypes Proteins 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 201000010153 skin papilloma Diseases 0.000 description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 description 2
- 150000003431 steroids Chemical class 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 239000012049 topical pharmaceutical composition Substances 0.000 description 2
- 229960001727 tretinoin Drugs 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WEPXLRANFJEOFZ-UHFFFAOYSA-N 2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1F WEPXLRANFJEOFZ-UHFFFAOYSA-N 0.000 description 1
- WFNRNCNCXRGUKN-UHFFFAOYSA-N 2,3,5,6-tetrafluoroterephthalic acid Chemical compound OC(=O)C1=C(F)C(F)=C(C(O)=O)C(F)=C1F WFNRNCNCXRGUKN-UHFFFAOYSA-N 0.000 description 1
- FJYDIMWZTHUSAW-UHFFFAOYSA-N 2,3-ditert-butylpyridine-4-carboxylic acid Chemical compound CC(C)(C)C1=NC=CC(C(O)=O)=C1C(C)(C)C FJYDIMWZTHUSAW-UHFFFAOYSA-N 0.000 description 1
- SJZATRRXUILGHH-UHFFFAOYSA-N 2,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(F)C=C1F SJZATRRXUILGHH-UHFFFAOYSA-N 0.000 description 1
- LWKOWFVDUSZDRA-UHFFFAOYSA-N 2,5-difluoroterephthalic acid Chemical compound OC(=O)C1=CC(F)=C(C(O)=O)C=C1F LWKOWFVDUSZDRA-UHFFFAOYSA-N 0.000 description 1
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 1
- YWZSTHLOAZTDFJ-UHFFFAOYSA-N 4-bromo-2,5-difluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(Br)C=C1F YWZSTHLOAZTDFJ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- SHGAZHPCJJPHSC-ZVCIMWCZSA-N 9-cis-retinoic acid Chemical compound OC(=O)/C=C(\C)/C=C/C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-ZVCIMWCZSA-N 0.000 description 1
- 206010000503 Acne cystic Diseases 0.000 description 1
- 206010000871 Acute monocytic leukaemia Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 102000004457 Granulocyte-Macrophage Colony-Stimulating Factor Human genes 0.000 description 1
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 239000007760 Iscove's Modified Dulbecco's Medium Substances 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 238000006809 Jones oxidation reaction Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000035489 Monocytic Acute Leukemia Diseases 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- 241000315040 Omura Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 239000012979 RPMI medium Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 238000006959 Williamson synthesis reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 210000003969 blast cell Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 108091092356 cellular DNA Proteins 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 108700010039 chimeric receptor Proteins 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000013265 extended release Methods 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 210000003714 granulocyte Anatomy 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 125000005241 heteroarylamino group Chemical group 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 229960003444 immunosuppressant agent Drugs 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002485 inorganic esters Chemical class 0.000 description 1
- 229910001410 inorganic ion Inorganic materials 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- JHPAOEXOUXURFL-UHFFFAOYSA-N methyl 2,3,4-trifluorobenzoate Chemical compound COC(=O)C1=CC=C(F)C(F)=C1F JHPAOEXOUXURFL-UHFFFAOYSA-N 0.000 description 1
- 238000004264 monolayer culture Methods 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000023603 positive regulation of transcription initiation, DNA-dependent Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 230000030541 receptor transactivation Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000037390 scarring Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 230000036620 skin dryness Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000004114 suspension culture Methods 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/66—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings being part of condensed ring systems and singly-bound oxygen atoms, bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/81—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US561999 | 1995-11-22 | ||
| US08/561,999 US5663357A (en) | 1995-11-22 | 1995-11-22 | Substituted heteroarylamides having retinoid-like biological activity |
| PCT/US1996/018529 WO1997019062A1 (en) | 1995-11-22 | 1996-11-19 | Substituted aryl or heteroarylamides having retinoid-like biological activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69633679D1 DE69633679D1 (de) | 2004-11-25 |
| DE69633679T2 true DE69633679T2 (de) | 2006-02-09 |
Family
ID=24244378
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69633679T Expired - Fee Related DE69633679T2 (de) | 1995-11-22 | 1996-11-19 | Substituierte aryl-oder heteroarylamide mit retinoid-ähnlicher biologischer aktivität |
Country Status (16)
| Country | Link |
|---|---|
| US (6) | US5663357A (show.php) |
| EP (1) | EP0862555B1 (show.php) |
| JP (1) | JP4125785B2 (show.php) |
| KR (1) | KR100483442B1 (show.php) |
| CN (1) | CN1207727A (show.php) |
| AT (1) | ATE280160T1 (show.php) |
| AU (1) | AU715624B2 (show.php) |
| BR (1) | BR9611615A (show.php) |
| CA (1) | CA2238310A1 (show.php) |
| DE (1) | DE69633679T2 (show.php) |
| HU (1) | HUP9901993A3 (show.php) |
| IL (3) | IL124593A (show.php) |
| MX (2) | MX230771B (show.php) |
| NZ (1) | NZ323574A (show.php) |
| PL (1) | PL326925A1 (show.php) |
| WO (1) | WO1997019062A1 (show.php) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5264578A (en) * | 1987-03-20 | 1993-11-23 | Allergan, Inc. | Disubstituted acetylenes bearing heterobicyclic groups and heteroaromatic or phenyl groups having retinoid like activity |
| US5534641A (en) * | 1994-12-29 | 1996-07-09 | Allergan | Acetylenes disubstituted with 2-tetrahydropyranoxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5648514A (en) * | 1994-12-29 | 1997-07-15 | Allergan | Substituted acetylenes having retinoid-like biological activity |
| US5917082A (en) * | 1995-06-06 | 1999-06-29 | Allergan Sales, Inc. | 2,4-pentadienoic acid derivatives having retinoid-like biological activity |
| US5675033A (en) * | 1995-06-06 | 1997-10-07 | Allergan | 2,4-pentadienoic acid derivatives having retinoid-like biological activity |
| US6008204A (en) | 1995-09-01 | 1999-12-28 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US6218128B1 (en) | 1997-09-12 | 2001-04-17 | Allergan Sales, Inc. | Methods of identifying compounds having nuclear receptor negative hormone and/or antagonist activities |
| US5952345A (en) | 1995-09-01 | 1999-09-14 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US6942980B1 (en) | 1995-09-01 | 2005-09-13 | Allergan, Inc. | Methods of identifying compounds having nuclear receptor negative hormone and/or antagonist activities |
| US5958954A (en) | 1995-09-01 | 1999-09-28 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US5675024A (en) * | 1995-11-22 | 1997-10-07 | Allergan | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thiochroman and 1,2,3,4,-tetrahydroquinoline carboxylic acids, having an electron withdrawing substituent in the aromatic or heteroaromatic moiety, having retinoid-like biological activity |
| US5663357A (en) * | 1995-11-22 | 1997-09-02 | Allergan | Substituted heteroarylamides having retinoid-like biological activity |
| US20030219832A1 (en) * | 1996-03-11 | 2003-11-27 | Klein Elliott S. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US5763635A (en) * | 1996-06-21 | 1998-06-09 | Allergan | Tetrahydronaphthalene derivatives substituted in the 8 position with alkyhidene groups having retinoid and/or retinoid antagonist-like biological activity |
| US5741896A (en) | 1996-06-21 | 1998-04-21 | Allergan | O- or S- substituted tetrahydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| US5773594A (en) | 1996-06-21 | 1998-06-30 | Allergan | Alkyl or aryl substituted dihydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| US6555690B2 (en) * | 1996-06-21 | 2003-04-29 | Allergan, Inc. | Alkyl or aryl substituted dihydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| US5728846A (en) * | 1996-12-12 | 1998-03-17 | Allergan | Benzo 1,2-g!-chrom-3-ene and benzo 1,2-g!-thiochrom-3-ene derivatives |
| US6037488A (en) * | 1997-04-19 | 2000-03-14 | Allergan Sales, Inc. | Trisubstituted phenyl derivatives having retinoid agonist, antagonist or inverse agonist type biological activity |
| US5919970A (en) * | 1997-04-24 | 1999-07-06 | Allergan Sales, Inc. | Substituted diaryl or diheteroaryl methanes, ethers and amines having retinoid agonist, antagonist or inverse agonist type biological activity |
| KR100703640B1 (ko) * | 1998-02-24 | 2007-04-05 | 웨이크 포리스트 유니버시티 | 만성 통증 및 여성에 특유한 통증을 비롯한 통증의 치료 방법 |
| JP2002539185A (ja) * | 1999-03-16 | 2002-11-19 | グラクソ グループ リミテッド | 核内受容体アリール化化合物 |
| PT1165494E (pt) | 1999-03-25 | 2004-03-31 | Boehringer Ingelheim Ca Ltd | Inibidores da primase do vhs |
| WO2000061182A2 (en) * | 1999-04-14 | 2000-10-19 | Allergan Sales, Inc. | Methods and compositions for the treatment and prevention of lung disease involving a selective rar-alpha agonist |
| WO2000061233A2 (en) * | 1999-04-14 | 2000-10-19 | Allergan Sales, Inc. | Methods and compositions for the treatment and prevention of lung disease involving a specific rar-gamma agonist |
| HN2000000052A (es) * | 1999-05-28 | 2001-02-02 | Pfizer Prod Inc | Hidroxiamidas de acidos 3- (arilsulfonilamino)- tetrahidrofuran-3-carboxilicos. |
| US6387951B1 (en) | 2000-08-29 | 2002-05-14 | Allergan Sales, Inc. | Compounds having activity as inhibitors of cytochrome P450RAI |
| US6369261B1 (en) | 2000-08-29 | 2002-04-09 | Allergan Sales, Inc. | Compounds having activity as inhibitors of cytochrome P450RAI |
| US6313107B1 (en) | 2000-08-29 | 2001-11-06 | Allergan Sales, Inc. | Methods of providing and using compounds having activity as inhibitors of cytochrome P450RAI |
| US20030134836A1 (en) * | 2001-01-12 | 2003-07-17 | Amgen Inc. | Substituted arylamine derivatives and methods of use |
| US6995162B2 (en) * | 2001-01-12 | 2006-02-07 | Amgen Inc. | Substituted alkylamine derivatives and methods of use |
| US7102009B2 (en) | 2001-01-12 | 2006-09-05 | Amgen Inc. | Substituted amine derivatives and methods of use |
| US7105682B2 (en) | 2001-01-12 | 2006-09-12 | Amgen Inc. | Substituted amine derivatives and methods of use |
| US6878714B2 (en) * | 2001-01-12 | 2005-04-12 | Amgen Inc. | Substituted alkylamine derivatives and methods of use |
| US7307088B2 (en) * | 2002-07-09 | 2007-12-11 | Amgen Inc. | Substituted anthranilic amide derivatives and methods of use |
| US7087631B2 (en) * | 2002-07-18 | 2006-08-08 | Inotek Pharmaceuticals Corporation | Aryltetrazole compounds, and compositions thereof |
| US7078423B2 (en) * | 2002-07-18 | 2006-07-18 | Inotek Pharmaceuticals Corporation | 5-Aryltetrazole compounds, compositions thereof, and uses therefor |
| US6620963B1 (en) | 2002-09-19 | 2003-09-16 | Allergan, Inc. | TRICYCLO[6.2.202,7]DODECA-2(7),3,5-TRIEN-4-CARBONYLAMINO-PHENYL AND TRICYCLO[6.2.202,7]DODECA-2(7),3,5-TRIEN-4-CARBONYLAMINO-HETEROARYL AND RELATED COMPOUNDS HAVING RARα RECEPTOR SELECTIVE BIOLOGICAL ACTIVITY |
| US7098189B2 (en) * | 2002-12-16 | 2006-08-29 | Kimberly-Clark Worldwide, Inc. | Wound and skin care compositions |
| GB0302094D0 (en) | 2003-01-29 | 2003-02-26 | Pharmagene Lab Ltd | EP4 receptor antagonists |
| WO2004108673A2 (en) * | 2003-06-09 | 2004-12-16 | Boehringer Ingelheim International Gmbh | Inhibitors of papilloma virus |
| JP4681548B2 (ja) | 2003-07-22 | 2011-05-11 | アステックス・セラピューティクス・リミテッド | 3,4−ジ置換1h−ピラゾール化合物および、そのサイクリン依存性キナーゼ(cdk)およびグリコーゲン・シンセターゼ・キナーゼ−3(gsk−3)調節剤としての使用 |
| GB0324269D0 (en) * | 2003-10-16 | 2003-11-19 | Pharmagene Lab Ltd | EP4 receptor antagonists |
| US7485666B2 (en) * | 2004-06-17 | 2009-02-03 | Kimberly-Clark Worldwide, Inc. | Vaginal health products |
| JP2008513427A (ja) * | 2004-09-20 | 2008-05-01 | バイオリポックス エービー | 炎症の治療に有用なピラゾール化合物 |
| US20070225318A1 (en) * | 2004-09-20 | 2007-09-27 | Biolipox Ab | Pyrazole Compounds Useful In The Treatment Of Inflammation |
| WO2006038980A2 (en) * | 2004-09-30 | 2006-04-13 | Kimberly-Clark Worldwide, Inc. | Non-absorbent and absorbent articles for inhibiting the production of exoproteins |
| US20060067991A1 (en) * | 2004-09-30 | 2006-03-30 | Kimberly-Clark Worldwide, Inc. | Non-absorbent articles for inhibiting the production of exoproteins |
| US20060067990A1 (en) * | 2004-09-30 | 2006-03-30 | Kimberly-Clark Worldwide, Inc. | Absorbent articles for inhibiting the production of exoproteins |
| US8404718B2 (en) | 2005-01-21 | 2013-03-26 | Astex Therapeutics Limited | Combinations of pyrazole kinase inhibitors |
| AR054425A1 (es) | 2005-01-21 | 2007-06-27 | Astex Therapeutics Ltd | Sales de adicion de piperidin 4-il- amida de acido 4-(2,6-dicloro-benzoilamino) 1h-pirazol-3-carboxilico. |
| MX2007008810A (es) | 2005-01-21 | 2007-11-21 | Astex Therapeutics Ltd | Compuestos farmaceuticos. |
| TW200800911A (en) * | 2005-10-20 | 2008-01-01 | Biolipox Ab | Pyrazoles useful in the treatment of inflammation |
| US8247556B2 (en) * | 2005-10-21 | 2012-08-21 | Amgen Inc. | Method for preparing 6-substituted-7-aza-indoles |
| AU2006310367A1 (en) * | 2005-10-31 | 2007-05-10 | Biolipox Ab | Triazole compounds as lipoxygenase inhibitors |
| TW200732320A (en) * | 2005-10-31 | 2007-09-01 | Biolipox Ab | Pyrazoles useful in the treatment of inflammation |
| EP1943225A1 (en) * | 2005-11-01 | 2008-07-16 | Biolipox AB | Pyrazoles useful in the treatment of inflammation |
| CA2635784C (en) * | 2005-12-30 | 2012-06-12 | Revance Therapeutics, Inc. | Arginine heteromers for topical administration |
| WO2008020027A2 (en) | 2006-08-16 | 2008-02-21 | Action Medicines, S.L. | 2,5-dihydroxybenzene compounds for the treatment of skin cancer |
| EP2073803B1 (en) | 2006-10-12 | 2018-09-19 | Astex Therapeutics Limited | Pharmaceutical combinations |
| EP2073807A1 (en) | 2006-10-12 | 2009-07-01 | Astex Therapeutics Limited | Pharmaceutical combinations |
| GB0915196D0 (en) * | 2009-09-01 | 2009-10-07 | King S College London | Therapeutic compounds and their use |
| MX367469B (es) | 2010-06-07 | 2019-08-23 | Novomedix Llc | Compuestos furanilo y su uso. |
Family Cites Families (108)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR208414A1 (es) * | 1974-11-07 | 1976-12-27 | Rhone Poulenc Ind | Procedimiento para obtener nuevos derivados de la((acil-4piperazinil-1)carboniloxi-5 pirrolinona-2) |
| US4258052A (en) * | 1976-08-17 | 1981-03-24 | Yu Ruey J | Treatment of psoriasis with nicotinamide analogues |
| JPS6025402B2 (ja) * | 1976-12-09 | 1985-06-18 | 中外製薬株式会社 | 農園芸用殺菌剤 |
| US4085091A (en) * | 1976-12-16 | 1978-04-18 | E. I. Dupont De Nemours And Company | Thermally stable, rigid polyesters from thermally stable, rigid dibasic acids and aromatic dihydroxy compounds |
| US4326055A (en) * | 1977-12-22 | 1982-04-20 | Hoffmann-La Roche Inc. | Stilbene derivatives |
| EP0006176B1 (de) * | 1978-06-09 | 1982-01-06 | Hoechst Aktiengesellschaft | Neue Stilbenverbindungen, Verfahren zu deren Herstellung und deren Verwendung als optische Aufheller |
| US4261730A (en) * | 1978-08-09 | 1981-04-14 | Monsanto Company | Substituted pyridyl phthalamic acids and their use as plant growth regulants |
| US4195984A (en) * | 1979-03-12 | 1980-04-01 | Abbott Laboratories | Herbicides derived from dihalo isonicotinoyl derivatives of amino acids |
| EP0047817A3 (de) * | 1980-08-14 | 1982-05-26 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Hydrierte Naphthaline, deren Herstellung und Verwendung sowie derartige Naphthaline enthaltende Gemische |
| CH651034A5 (de) * | 1982-05-12 | 1985-08-30 | Hoffmann La Roche | Chroman-, thiochroman- oder 1,2,3,4-tetrahydrochinolinderivate und ihre verwendung als arzneimittel-wirkstoffe. |
| DE3225264A1 (de) | 1982-07-06 | 1984-01-12 | Heimann Gmbh, 6200 Wiesbaden | Verfahren und vorrichtung zum automatischen schalten einer raumbeleuchtung |
| DK158947C (da) * | 1982-07-06 | 1991-01-21 | Hoffmann La Roche | Tetrahydronaphthalin-,benzofuran- og benzothiophenderivater, fremstilling og anvendelse deraf samt rodenticid indeholdende saadanne derivater |
| DE3305569A1 (de) | 1983-02-18 | 1984-08-23 | Bayer Ag, 5090 Leverkusen | Biscarboxamide zur bekaempfung von erkrankungen sowie verfahren zu ihrer herstellung |
| US4539154A (en) * | 1983-06-15 | 1985-09-03 | Hoffmann-La Roche Inc. | Polyene compounds |
| EP0130795B1 (en) * | 1983-07-05 | 1988-11-23 | Pfizer Inc. | Carboxylic acid derivatives useful for inhibiting the degradation of cartilage |
| EP0155940A1 (en) * | 1983-08-08 | 1985-10-02 | Sri International | Benzonorbornenyl, benzopyranyl and benzothiopyranyl retinoic acid analogues |
| US4560549A (en) * | 1983-08-24 | 1985-12-24 | Lever Brothers Company | Method of relieving pain and inflammatory conditions employing substituted salicylamides |
| FR2562539B1 (fr) * | 1984-04-06 | 1987-04-17 | Chauvin Blache Lab | Nouveaux derives de l'acide vinyl-4 benzoique, leur procede de preparation et leurs applications en therapeutique et comme ligands |
| US4826984A (en) * | 1984-04-09 | 1989-05-02 | The Board Of Regents For The Oklahoma Agricultural And Mechanical College Acting For And On Behalf Of Oklahoma State University | Heteroarotinoid compounds as anticancer agents |
| JPS60222445A (ja) * | 1984-04-19 | 1985-11-07 | Yoshitomi Pharmaceut Ind Ltd | フタル酸化合物 |
| EP0170105B1 (en) * | 1984-07-07 | 1990-10-17 | Koichi Prof. Dr. Shudo | Benzoic acid derivatives |
| JPS6122046A (ja) * | 1984-07-07 | 1986-01-30 | Koichi Shiyudo | スチルベン誘導体 |
| LU85544A1 (fr) * | 1984-09-19 | 1986-04-03 | Cird | Derives heterocycliques aromatiques,leur procede de preparation et leur application dans les domaines therapeutique et cosmetique |
| DE3434947A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Isoxazolcarbonsaeure-derivate, ihre herstellung und verwendung |
| DE3434946A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Diarylacetylene, ihre herstellung und verwendung |
| DE3434942A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Tetralin-derivate, ihre herstellung und verwendung |
| IL80270A0 (en) * | 1985-10-11 | 1987-01-30 | Cird | Naphthalene derivatives,their preparation and pharmaceutical compositions containing them |
| DE3602473A1 (de) * | 1986-01-28 | 1987-07-30 | Basf Ag | Vinylphenolderivate, ihre herstellung und verwendung |
| LU86351A1 (fr) * | 1986-03-12 | 1987-11-11 | Oreal | Composes benzopyrannyl et benzothiopyrannyl benzoiques,leur procede de preparation et leur utilisation en cosmetique et en medecine humaine et veterinaire |
| DE3615157A1 (de) * | 1986-05-05 | 1987-11-12 | Schwabe Willmar Gmbh & Co | 5-arylalkyl-4-alkoxy-2(5h)-furanone, zwischenprodukte und verfahren zu ihrer herstellung sowie ihre anwendung als therapeutische wirkstoffe |
| ZW6587A1 (en) * | 1986-05-13 | 1987-12-02 | Hoffmann La Roche | Tetrahydro naphthanline derivatives |
| ZW7487A1 (en) * | 1986-05-23 | 1987-12-16 | Hoffmann La Roche | Tetrahydronaphthaline and indane derivatives |
| ZW10287A1 (en) * | 1986-07-15 | 1988-01-13 | Hoffmann La Roche | Tetrahydronaphthaline and indane derivatives |
| US4739098A (en) * | 1986-09-22 | 1988-04-19 | Allergan, Inc. | Ethynylphenyl-containing retinoic acid derivatives |
| NZ222968A (en) * | 1986-12-24 | 1990-05-28 | Allergan Inc | Ethynylheteroaromatic derivatives and medicaments |
| US4927947A (en) * | 1986-12-24 | 1990-05-22 | Allergan, Inc. | Ethynylheteroaromatic-acids having retinoic acid-like activity |
| US5149705A (en) * | 1987-03-13 | 1992-09-22 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a tetralin group and having retinoid like activity |
| US5089509A (en) * | 1988-09-15 | 1992-02-18 | Allergan, Inc. | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US5264578A (en) * | 1987-03-20 | 1993-11-23 | Allergan, Inc. | Disubstituted acetylenes bearing heterobicyclic groups and heteroaromatic or phenyl groups having retinoid like activity |
| US5234926A (en) * | 1987-03-20 | 1993-08-10 | Allergan, Inc. | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| CA1305480C (en) * | 1987-03-20 | 1992-07-21 | Roshantha A.S. Chandraratna | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US5602130A (en) * | 1987-03-20 | 1997-02-11 | Allergan | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US4810804A (en) * | 1987-03-26 | 1989-03-07 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a heterobicyclic group having retinoid-like activity |
| ZA882251B (en) * | 1987-04-06 | 1989-11-29 | Riker Laboratories Inc | Substituted di-t-butylphenols |
| DE3726806A1 (de) | 1987-08-12 | 1989-02-23 | Basf Ag | Arylphosphorderivate, ihre herstellung und verwendung |
| ZA885192B (en) * | 1987-08-19 | 1989-04-26 | Hoffmann La Roche | Pharmaceutical preparations |
| CA1298309C (en) * | 1987-11-06 | 1992-03-31 | Michael Klaus | Benzocycloheptene derivatives |
| KR0139216B1 (ko) * | 1988-04-11 | 1998-05-01 | 제임스 엠. 캐내지 | 레티노이드 유사활성을 갖는 페놀 또는 벤조산의 테트랄린 에스테르 |
| US5231113A (en) * | 1988-04-11 | 1993-07-27 | Allergan, Inc. | Tetralin esters of phenols or benzoic acids having retinoid like activity |
| US5015658A (en) * | 1988-06-29 | 1991-05-14 | Allergan, Inc. | Thiochroman esters of phenols and terephthallates having retinoid-like activity |
| US4895868A (en) * | 1988-06-29 | 1990-01-23 | Allergan, Inc. | Thiochroman esters of phenols and terephthallates having retinoid-like activity |
| AU626881B2 (en) * | 1988-07-14 | 1992-08-13 | F. Hoffmann-La Roche Ag | Benzofused heterocyclics used as pharmaceuticals |
| US4992468A (en) * | 1989-07-26 | 1991-02-12 | Allergan, Inc. | Phenylethenyl compounds having retinoid-like activity |
| US5068252A (en) * | 1989-07-26 | 1991-11-26 | Allergan, Inc. | Methods of using phenylethenyl compounds having retinoid-like activity |
| DE3926148A1 (de) | 1989-08-08 | 1991-02-28 | Basf Ag | Diarylacetylene, ihre herstellung und verwendung |
| US5248777A (en) * | 1989-09-19 | 1993-09-28 | Allergan, Inc. | Process and intermediates for preparing compounds having a disubstituted acetylene moiety and retinoic acid-like biological activity |
| US5399561A (en) * | 1989-09-19 | 1995-03-21 | Allergan, Inc. | Acetylenes disubstituted with a phenyl or heteroaryl group and a 2-oxochromanyl, 2-oxothiochromanyl or 2-oxo-1,2,3,4-tetrahydro-quinolinyl group having retinoid-like biological activity |
| US5023341A (en) * | 1989-09-19 | 1991-06-11 | Allergan, Inc. | Compounds having a disubstituted acetylene moiety and retinoic acid-like biological activity |
| US4980369A (en) * | 1989-09-19 | 1990-12-25 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a 2-substituted chromanyl or thiochromanyl group having retinoid-like activity |
| US5045551A (en) * | 1989-09-19 | 1991-09-03 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5053523A (en) * | 1989-09-19 | 1991-10-01 | Allergan, Inc. | Ethynyl-chroman compounds |
| US5272156A (en) * | 1989-09-19 | 1993-12-21 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5162546A (en) * | 1989-09-19 | 1992-11-10 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5183827A (en) * | 1989-09-19 | 1993-02-02 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5175185A (en) * | 1989-12-29 | 1992-12-29 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a substituted phenyl group having retinoid like activity |
| US5264456A (en) * | 1989-12-29 | 1993-11-23 | Allergan, Inc. | Acetylenes disubstituted with a furyl group and a substituted phenyl group having retinoid like activity |
| US5013744B1 (en) * | 1989-12-29 | 1994-09-20 | Allegran Inc | Acetylenes disubstituted with a pyridinyl group and a substituted phenyl group having retinoid like activity |
| US5006550A (en) * | 1989-12-29 | 1991-04-09 | Allergan, Inc. | Chroman esters of phenols and benzoic acids having retinoid-like activity |
| US5202471A (en) * | 1990-02-06 | 1993-04-13 | Allergan, Inc. | Alkyl, alkoxy and thioalkoxy substituted diphenyl acetylenes having retinoid like activity |
| WO1991016051A1 (en) * | 1990-04-16 | 1991-10-31 | Rhône-Poulenc Rorer International (Holdings) Inc. | Styryl-substituted monocyclic and bicyclic heteroaryl compounds which inhibit egf receptor tyrosine kinase |
| LU87821A1 (fr) * | 1990-10-12 | 1992-05-25 | Cird Galderma | Composes bi-aromatiques,et leur utilisation en medecine humaine et veterinaire et en cosmetique |
| US5563292A (en) * | 1990-10-17 | 1996-10-08 | Schering Corporation | Lipoxygenase inhibitors |
| JP3062248B2 (ja) * | 1991-02-13 | 2000-07-10 | アラーガン、インコーポレイテッド | レチノイド様生物学的活性を有する7位にフェニルエチニル置換基を有するクロマンおよびチオクロマン |
| EP0577737A1 (en) * | 1991-03-26 | 1994-01-12 | Allergan, Inc. | Chromans and thiochromans with heteroarylethynyl substituents at the 7-position having retinoid-like biological activity |
| US5134159A (en) * | 1991-03-26 | 1992-07-28 | Allergan, Inc. | 7-chromanyl esters of phenols and benzoic acids having retinoid-like activity |
| AU3659293A (en) * | 1992-02-11 | 1993-09-03 | Allergan, Inc. | Heteroaryl substituted phenylethenyl compounds having retinoid-like biological activity |
| US5326898A (en) * | 1992-02-11 | 1994-07-05 | Allergan, Inc. | Substituted phenylethenyl compounds having retinoid-like biological activity |
| US5420145A (en) * | 1993-03-22 | 1995-05-30 | Koichi Shudo | Carboxylic acid derivative |
| EP0617020A1 (en) * | 1992-04-02 | 1994-09-28 | Shudo, Koichi, Prof. Dr. | Carboxylic acid derivatives having retinoic acid-like activity |
| US5324840A (en) * | 1992-06-11 | 1994-06-28 | Allergan, Inc. | Method of treatment with compounds having retinoid-like activity and reduced skin toxicity and lacking teratogenic effects |
| US5466861A (en) * | 1992-11-25 | 1995-11-14 | Sri International | Bridged bicyclic aromatic compounds and their use in modulating gene expression of retinoid receptors |
| JPH06247919A (ja) * | 1992-12-28 | 1994-09-06 | Medicine Inst Chinese Acad Medical Science | 安息香酸誘導体およびその用途 |
| US5455265A (en) * | 1993-02-11 | 1995-10-03 | Allergan, Inc. | Method of treatment with compounds having selective agonist-like activity on RXR retinoid receptors |
| US5399586A (en) * | 1993-03-11 | 1995-03-21 | Allergan, Inc. | Treatment of mammals afflicted with tumors with compounds having RXR retinoid receptor agonist activity |
| EP0619116A3 (en) * | 1993-04-05 | 1994-11-23 | Hoechst Japan | Use of synthetic retinoids for osteopathy. |
| US5344959A (en) * | 1993-05-18 | 1994-09-06 | Allergan, Inc. | Tetrahydronaphthyl and cyclopropyl substituted 1,3-butadienes having retinoid-like activity |
| US5475022A (en) * | 1993-10-18 | 1995-12-12 | Allergan, Inc. | Phenyl or heteroaryl and tetrahydronaphthyl substituted diene compounds having retinoid like biological activity |
| FR2713635B1 (fr) | 1993-12-15 | 1996-01-05 | Cird Galderma | Nouveaux composés propynyl bi-aromatiques, compositions pharmaceutiques et cosmétiques les contenant et utilisations. |
| US5451605A (en) * | 1993-12-30 | 1995-09-19 | Allergan, Inc. | 1,2-epoxycyclohexanyl and bicyclic aromatic substituted ethyne compounds having retinoid-like biological activity |
| US5470999A (en) * | 1993-12-30 | 1995-11-28 | Allergan, Inc. | Cyclohexene and bicyclic aromatic substituted ethyne compounds having retinoid-like biological activity |
| US5426118A (en) * | 1993-12-30 | 1995-06-20 | Allergan, Inc. | [4-(1,2-epoxycyclohexanyl)but-3-en-1-ynyl]aromatic and heteroaromatic acids and derivatives having retinoid-like biological activity |
| CA2137997A1 (en) * | 1994-01-03 | 1995-07-04 | John E. Starrett, Jr. | Retinoid-like compounds |
| CA2138000A1 (en) * | 1994-01-03 | 1995-07-04 | John E. Starrett, Jr. | Retinoid-like compounds |
| US5474022A (en) * | 1994-04-21 | 1995-12-12 | Mitsubishi Materials Corporation | Double crucible for growing a silicon single crystal |
| US5498755A (en) * | 1994-08-23 | 1996-03-12 | Chandraratna; Roshantha A. | Disubstituted aryl and heteroaryl imines having retinoid-like biological activity |
| IL116259A (en) | 1994-12-19 | 2000-07-16 | American Cyanamid Co | Analogs of 9-cis retinoic acid and their use |
| US5543534A (en) * | 1994-12-29 | 1996-08-06 | Allergan | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl or heteroaryl groups having retinoid-like biological activity |
| US5534641A (en) * | 1994-12-29 | 1996-07-09 | Allergan | Acetylenes disubstituted with 2-tetrahydropyranoxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5618943A (en) * | 1994-12-29 | 1997-04-08 | Allergan | Acetylenes disubstituted with a 5 OXO substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5514825A (en) * | 1994-12-29 | 1996-05-07 | Allergan, Inc. | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5556996A (en) * | 1994-12-29 | 1996-09-17 | Allergan | Oxiranyls disubstituted with a phenyl group and a substituted chromanyl or tetrahydroquinolinyl group having retinoid like activity |
| US5489584A (en) * | 1994-12-29 | 1996-02-06 | Allergan, Inc. | Acetylenes disubstituted with a 5-amino or substituted 5-amino substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5498795A (en) * | 1994-12-29 | 1996-03-12 | Allergan, Inc. | Acetylenes disubstituted with hydroxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5618931A (en) * | 1994-12-29 | 1997-04-08 | Allergan | Acetylenes disubstituted with a 5 substituted dihydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5599967A (en) * | 1994-12-29 | 1997-02-04 | Allergan | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl of heteroaryl group having retinoid-like biological activity |
| US5559248A (en) * | 1995-04-05 | 1996-09-24 | Bristol-Myers Squibb Co. | Retinoid-like heterocycles |
| US5616712A (en) * | 1995-05-16 | 1997-04-01 | Allergan | Acetylenes disubstituted with a phenyl or heteroaryl group and a 2-thio-1,2,3,4-tetrahdroquinolinyl, 2-alkylthio-3,4-dihydroquinolinyl or 2-alkoxy-3,4-dihydroquinolinyl group having retinoid-like biological activity |
| US5663357A (en) | 1995-11-22 | 1997-09-02 | Allergan | Substituted heteroarylamides having retinoid-like biological activity |
-
1995
- 1995-11-22 US US08/561,999 patent/US5663357A/en not_active Expired - Lifetime
-
1996
- 1996-11-18 KR KR1019980703816A patent/KR100483442B1/ko not_active Expired - Fee Related
- 1996-11-19 PL PL96326925A patent/PL326925A1/xx unknown
- 1996-11-19 WO PCT/US1996/018529 patent/WO1997019062A1/en not_active Ceased
- 1996-11-19 CA CA002238310A patent/CA2238310A1/en not_active Abandoned
- 1996-11-19 AU AU10551/97A patent/AU715624B2/en not_active Ceased
- 1996-11-19 IL IL12459396A patent/IL124593A/en not_active IP Right Cessation
- 1996-11-19 EP EP96941395A patent/EP0862555B1/en not_active Expired - Lifetime
- 1996-11-19 AT AT96941395T patent/ATE280160T1/de not_active IP Right Cessation
- 1996-11-19 IL IL14374896A patent/IL143748A0/xx unknown
- 1996-11-19 NZ NZ323574A patent/NZ323574A/en unknown
- 1996-11-19 HU HU9901993A patent/HUP9901993A3/hu unknown
- 1996-11-19 IL IL14374796A patent/IL143747A0/xx unknown
- 1996-11-19 JP JP51984097A patent/JP4125785B2/ja not_active Expired - Fee Related
- 1996-11-19 BR BR9611615A patent/BR9611615A/pt not_active Application Discontinuation
- 1996-11-19 CN CN96199731A patent/CN1207727A/zh active Pending
- 1996-11-19 DE DE69633679T patent/DE69633679T2/de not_active Expired - Fee Related
-
1997
- 1997-03-19 US US08/820,792 patent/US5917048A/en not_active Expired - Fee Related
-
1998
- 1998-05-22 MX MX9809697A patent/MX230771B/es unknown
- 1998-05-22 MX MX9804103A patent/MX206851B/es unknown
- 1998-12-17 US US09/215,509 patent/US6051713A/en not_active Expired - Fee Related
-
2000
- 2000-04-17 US US09/550,744 patent/US6245786B1/en not_active Expired - Fee Related
-
2001
- 2001-04-09 US US09/829,310 patent/US6320047B1/en not_active Expired - Fee Related
- 2001-10-16 US US09/982,362 patent/US6437129B1/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JP4125785B2 (ja) | 2008-07-30 |
| KR100483442B1 (ko) | 2006-04-21 |
| PL326925A1 (en) | 1998-11-09 |
| IL124593A (en) | 2002-09-12 |
| DE69633679D1 (de) | 2004-11-25 |
| IL124593A0 (en) | 1998-12-06 |
| MX206851B (es) | 2002-02-25 |
| US5663357A (en) | 1997-09-02 |
| EP0862555A1 (en) | 1998-09-09 |
| US20020091262A1 (en) | 2002-07-11 |
| AU715624B2 (en) | 2000-02-03 |
| WO1997019062A1 (en) | 1997-05-29 |
| EP0862555B1 (en) | 2004-10-20 |
| IL143747A0 (en) | 2002-04-21 |
| US6437129B1 (en) | 2002-08-20 |
| KR19990071542A (ko) | 1999-09-27 |
| HUP9901993A3 (en) | 2001-10-29 |
| CN1207727A (zh) | 1999-02-10 |
| US6320047B1 (en) | 2001-11-20 |
| AU1055197A (en) | 1997-06-11 |
| MX9804103A (es) | 1998-09-30 |
| ATE280160T1 (de) | 2004-11-15 |
| MX230771B (es) | 2005-09-21 |
| US6051713A (en) | 2000-04-18 |
| US6245786B1 (en) | 2001-06-12 |
| HUP9901993A2 (hu) | 1999-10-28 |
| US5917048A (en) | 1999-06-29 |
| JP2000500498A (ja) | 2000-01-18 |
| IL143748A0 (en) | 2002-04-21 |
| CA2238310A1 (en) | 1997-05-29 |
| BR9611615A (pt) | 1999-05-25 |
| NZ323574A (en) | 1999-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69633679T2 (de) | Substituierte aryl-oder heteroarylamide mit retinoid-ähnlicher biologischer aktivität | |
| DE69612303T2 (de) | Aryl oder heteroarylamide von tetrahydronaphthalin, chroman, thiochroman oder 1,2,3,4-tetrahydrochinolin-carbonsäuren mit einer retinoid-ähnlichen biologischen aktivität | |
| DE60034155T2 (de) | Adamantanderivate zur Behandlung von entzündlichen, immunologischen und kardiovaskulären Erkrankungen | |
| DE69808065T2 (de) | Trisubstituierte phenyl derivate mit retinoid agonist, antagonist oder inversagonist biologischer aktivität | |
| DE69500273T2 (de) | Phenyl- oder Phenylalkyl-substituierte Naphthalinderivate mit retinoid-artiger Aktivität und Antitumor-Wirkungen | |
| DE69912973T2 (de) | 2,4-pentadiensäurederivate mit selektiver wirkung auf die retinoid x (rxr) rezeptoren | |
| AT395583B (de) | Verfahren zur herstellung neuer polysubstituierter naphthalinderivate | |
| DE19943636A1 (de) | Neuartige Dicarbonsäurederivate mit pharmazeutischen Eigenschaften | |
| DE69426327T2 (de) | Bicyclische amid-derivate und ihre verwendung als muskel entspannende verbindungen | |
| EP0504695A1 (de) | Neue Carbonsäureamide, ihre Herstellung und pharmazeutische Präparate, die diese Verbindungen enthalten | |
| EP0547517B1 (de) | Neue Pyridylderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE69604713T2 (de) | Retinoide | |
| DE10046029A1 (de) | Indazole | |
| DE69511544T2 (de) | Amidderivate und ihre therapeutische verwendung | |
| DE10024939A1 (de) | Neue Diphenylmethanderivate für Arzneimittel | |
| DE68920063T2 (de) | Derivate von Benzoesäure und Verfahren zu deren Herstellung. | |
| EP0410358B1 (de) | Aromatische Carbonsäureamide, ihre Herstellung und Verwendung für Heilmittel | |
| EP0697405B1 (de) | Substituierte-Chinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0298919A2 (de) | 4-Amino-substituierte 1,2-Dihydroxynaphthalin-Derivate | |
| EP0862554B1 (de) | Aromatische carbonsäureester, ihre herstellung und verwendung als heilmittel | |
| EP0496274B1 (de) | Tricyclisches Pyridonderivat | |
| EP0009776B1 (de) | N-Monohydroxypropylamide, N-Dihydroxypropylamide und deren Acetonoide der all-E- und 13-Z-Retinsäure, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| EP0491263A1 (de) | Phenylalkylaminoalkyl-Verbindungen sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3347657A1 (de) | Neue 1,4-naphthochinonderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| EP0643045B1 (de) | Chinolin-Verbindungen als Leukotriene Antagonisten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |