DE69312176T2 - Verfahren zur Herstellung von mit Alpha-Anomeren angereichterten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl Sulfonaten - Google Patents
Verfahren zur Herstellung von mit Alpha-Anomeren angereichterten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl SulfonatenInfo
- Publication number
- DE69312176T2 DE69312176T2 DE69312176T DE69312176T DE69312176T2 DE 69312176 T2 DE69312176 T2 DE 69312176T2 DE 69312176 T DE69312176 T DE 69312176T DE 69312176 T DE69312176 T DE 69312176T DE 69312176 T2 DE69312176 T2 DE 69312176T2
- Authority
- DE
- Germany
- Prior art keywords
- anomer
- sulfonate
- acid
- deoxy
- alpha
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 26
- 238000002360 preparation method Methods 0.000 title description 3
- KBDKOYYFINOWDM-HERZVMAMSA-N (4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonic acid Chemical class OC[C@H]1OC(S(O)(=O)=O)C(F)(F)[C@@H]1O KBDKOYYFINOWDM-HERZVMAMSA-N 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims abstract description 35
- -1 ribofuranosyl sulfonate Chemical compound 0.000 claims abstract description 29
- 150000001450 anions Chemical class 0.000 claims abstract description 13
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 12
- 239000012442 inert solvent Substances 0.000 claims abstract description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 21
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 7
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- DSEPTYOCUKEWRG-UHFFFAOYSA-N n,n-dimethyl-1-phenylmethanamine;methanesulfonic acid Chemical class CS([O-])(=O)=O.C[NH+](C)CC1=CC=CC=C1 DSEPTYOCUKEWRG-UHFFFAOYSA-N 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 claims description 4
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 4
- KQYREKISXCBRQB-UHFFFAOYSA-N n,n-diethylethanamine;methanesulfonic acid Chemical class CS(O)(=O)=O.CCN(CC)CC KQYREKISXCBRQB-UHFFFAOYSA-N 0.000 claims description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical class CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 claims description 4
- LDHXMQXUOUZOLF-HERZVMAMSA-N (4r,5r)-3,3-difluoro-5-(hydroxymethyl)oxolane-2,4-diol Chemical compound OC[C@H]1OC(O)C(F)(F)[C@@H]1O LDHXMQXUOUZOLF-HERZVMAMSA-N 0.000 claims description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 3
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 claims description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical class C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 2
- 150000003983 crown ethers Chemical class 0.000 claims description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical class CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- GWVLAXGYZUVAGV-UHFFFAOYSA-N n,n-dimethylmethanamine;methanesulfonic acid Chemical class C[NH+](C)C.CS([O-])(=O)=O GWVLAXGYZUVAGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000003444 phase transfer catalyst Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000003849 aromatic solvent Substances 0.000 claims 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical class CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims 1
- RUCCIRTVEYMEQG-UHFFFAOYSA-N 2-nitrobenzenesulfonate;pyridin-1-ium Chemical compound C1=CC=[NH+]C=C1.[O-][N+](=O)C1=CC=CC=C1S([O-])(=O)=O RUCCIRTVEYMEQG-UHFFFAOYSA-N 0.000 claims 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 claims 1
- 150000001447 alkali salts Chemical class 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- ZAEQTGTVGUJEFV-UHFFFAOYSA-N phenylmethanesulfonate;pyridin-1-ium Chemical compound C1=CC=[NH+]C=C1.[O-]S(=O)(=O)CC1=CC=CC=C1 ZAEQTGTVGUJEFV-UHFFFAOYSA-N 0.000 claims 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical class CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 claims 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 9
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 6
- 238000004007 reversed phase HPLC Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 239000002777 nucleoside Substances 0.000 description 5
- QKFFSWPNFCXGIQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetraethylazanium Chemical compound CC[N+](CC)(CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 QKFFSWPNFCXGIQ-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000006206 glycosylation reaction Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 2
- XGLVDUUYFKXKPL-UHFFFAOYSA-N 2-(2-methoxyethoxy)-n,n-bis[2-(2-methoxyethoxy)ethyl]ethanamine Chemical compound COCCOCCN(CCOCCOC)CCOCCOC XGLVDUUYFKXKPL-UHFFFAOYSA-N 0.000 description 2
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 description 2
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 230000013595 glycosylation Effects 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- KFCWJXULHYUQKL-UHFFFAOYSA-N (4-bromophenyl)sulfonyl 4-bromobenzenesulfonate Chemical compound C1=CC(Br)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(Br)C=C1 KFCWJXULHYUQKL-UHFFFAOYSA-N 0.000 description 1
- AZGPBMFJVDJEQQ-PYHARJCCSA-N (4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonic acid Chemical class OC[C@H]1OC(S(O)(=O)=O)C[C@@H]1O AZGPBMFJVDJEQQ-PYHARJCCSA-N 0.000 description 1
- CFQPVBJOKYSPKG-UHFFFAOYSA-N 1,3-dimethylimidazol-2-one Chemical compound CN1C=CN(C)C1=O CFQPVBJOKYSPKG-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XQQZRZQVBFHBHL-UHFFFAOYSA-N 12-crown-4 Chemical compound C1COCCOCCOCCO1 XQQZRZQVBFHBHL-UHFFFAOYSA-N 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- WZZFZXZRKPNZOC-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;pyridine Chemical compound C1=CC=[NH+]C=C1.[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 WZZFZXZRKPNZOC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical class CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- USAAQJXEFRHWFZ-ZZKAVYKESA-N [(4r,5r)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate Chemical compound CS(=O)(=O)OC1O[C@H](CO)[C@@H](O)C1(F)F USAAQJXEFRHWFZ-ZZKAVYKESA-N 0.000 description 1
- XXFXTBNFFMQVKJ-UHFFFAOYSA-N [diphenyl(trityloxy)methyl]benzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XXFXTBNFFMQVKJ-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- MLWPJXZKQOPTKZ-UHFFFAOYSA-N benzenesulfonyl benzenesulfonate Chemical compound C=1C=CC=CC=1S(=O)(=O)OS(=O)(=O)C1=CC=CC=C1 MLWPJXZKQOPTKZ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- FMWLUWPQPKEARP-UHFFFAOYSA-N bromodichloromethane Chemical compound ClC(Cl)Br FMWLUWPQPKEARP-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000002243 furanoses Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- BLTAPEIEHGWKKN-UHFFFAOYSA-N methanesulfonate;pyridin-1-ium Chemical compound CS(O)(=O)=O.C1=CC=NC=C1 BLTAPEIEHGWKKN-UHFFFAOYSA-N 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 125000000548 ribosyl group Chemical group C1([C@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H13/00—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids
- C07H13/02—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids by carboxylic acids
- C07H13/08—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids by carboxylic acids having the esterifying carboxyl radicals directly attached to carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H11/00—Compounds containing saccharide radicals esterified by inorganic acids; Metal salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/902,305 US5256798A (en) | 1992-06-22 | 1992-06-22 | Process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69312176D1 DE69312176D1 (de) | 1997-08-21 |
| DE69312176T2 true DE69312176T2 (de) | 1997-12-11 |
Family
ID=25415655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69312176T Expired - Lifetime DE69312176T2 (de) | 1992-06-22 | 1993-06-21 | Verfahren zur Herstellung von mit Alpha-Anomeren angereichterten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl Sulfonaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5256798A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0577302B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JP3379993B2 (cg-RX-API-DMAC10.html) |
| AT (1) | ATE155476T1 (cg-RX-API-DMAC10.html) |
| BR (1) | BR9302429A (cg-RX-API-DMAC10.html) |
| CA (1) | CA2098882C (cg-RX-API-DMAC10.html) |
| DE (1) | DE69312176T2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK0577302T3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES2105114T3 (cg-RX-API-DMAC10.html) |
| GR (1) | GR3024975T3 (cg-RX-API-DMAC10.html) |
| HU (1) | HU216832B (cg-RX-API-DMAC10.html) |
| IL (1) | IL106077A (cg-RX-API-DMAC10.html) |
| MX (1) | MX9303712A (cg-RX-API-DMAC10.html) |
| TW (1) | TW224101B (cg-RX-API-DMAC10.html) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2131880C1 (ru) * | 1992-06-22 | 1999-06-20 | Эли Лилли Энд Компани | Способ получения обогащенных бета-аномером нуклеозидов |
| IL106075A (en) * | 1992-06-22 | 2000-12-06 | Lilly Co Eli | Process for preparing alpha-anomer enriched 1-halo-2-deoxy-2,2-difluoro-alpha-D-erythropentofuranose derivatives |
| UA41261C2 (uk) * | 1992-06-22 | 2001-09-17 | Елі Ліллі Енд Компані | Спосіб одержання збагачених бета-аномером нуклеозидів |
| US5424416A (en) * | 1993-08-25 | 1995-06-13 | Eli Lilly And Company | Process for preparation of 2-deoxy-2,2-difluoro-D-ribofuranosyl-3,5-hydroxy protected-1-alkyl and aryl sulfonates and their use in preparation of 2',2'-difluoro-2'-deoxy nucleosides |
| US7214791B2 (en) * | 2004-07-01 | 2007-05-08 | Shenzhen Hande Technology Co., Ltd. | Method for preparation of 2′-deoxy-2′, 2′-difluoro-β-cytidine or pharmaceutically acceptable salts thereof by using 1,6-anhydro-β-d-glucose as raw material |
| CN101023094B (zh) | 2004-07-21 | 2011-05-18 | 法莫赛特股份有限公司 | 烷基取代的2-脱氧-2-氟代-d-呋喃核糖基嘧啶和嘌呤及其衍生物的制备 |
| BRPI0515279A (pt) * | 2004-09-14 | 2008-07-15 | Pharmasset Inc | preparação de ribofuranosil pirimidinas e purinas 2'fluoro-2'-alquil- substituìdas ou outras opcionalmente substituìdas e seus derivados |
| MX2007010316A (es) * | 2005-03-04 | 2008-02-19 | Dabur Pharma Ltd | Intermediario de 21-desoxi, 21,21-difluoro-d-ribofuranosil nucleosidos enriquecidos en (-anomero y proceso para prepararlo. |
| AU2011202539B2 (en) * | 2005-06-03 | 2012-07-05 | Scinopharm Taiwan, Ltd. | Process of making an alpha-anomer enriched 2-deoxy-2,2-difluoro-d-ribofuranosyl sulfonate and use thereof for making a beta nucleoside |
| BRPI0610950A2 (pt) * | 2005-06-03 | 2010-08-03 | Scinopharm Taiwan Ltd | processo para produção de um sulfonato de 2-deoxi-2, 2-difluoro-d-ribofuranosil enriquecido de alfa anÈmero, e uso do mesmo para produção de um beta nocleosìdeo |
| AT502221A1 (de) * | 2005-07-20 | 2007-02-15 | Pharmacon Forschung & Beratung Gmbh | Homogemcitabine, verfahren zu ihrer herstellung sowie deren verwendung |
| KR20080099263A (ko) * | 2006-02-07 | 2008-11-12 | 케마지스 리미티드 | 젬시타빈 및 관련된 중간체의 제조 방법 |
| US20070249823A1 (en) * | 2006-04-20 | 2007-10-25 | Chemagis Ltd. | Process for preparing gemcitabine and associated intermediates |
| US7964580B2 (en) | 2007-03-30 | 2011-06-21 | Pharmasset, Inc. | Nucleoside phosphoramidate prodrugs |
| CN101024667B (zh) * | 2007-03-30 | 2011-01-26 | 湖北益泰药业有限公司 | 盐酸吉西他宾的合成方法 |
| US20080262215A1 (en) * | 2007-04-23 | 2008-10-23 | Chemagis Ltd. | Gemcitabine production process |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| WO2010075554A1 (en) | 2008-12-23 | 2010-07-01 | Pharmasset, Inc. | Synthesis of purine nucleosides |
| US8618076B2 (en) | 2009-05-20 | 2013-12-31 | Gilead Pharmasset Llc | Nucleoside phosphoramidates |
| TWI583692B (zh) * | 2009-05-20 | 2017-05-21 | 基利法瑪席特有限責任公司 | 核苷磷醯胺 |
| RS54368B1 (sr) | 2010-03-31 | 2016-04-28 | Gilead Pharmasset Llc | Kristalni (s)-izopropil 2-(((s)-(((2r,3r,4r,5r)-5-(2,4-diokso-3,4-dihidropirimidin-1-(2h)-il)-4-fluoro-3-hidroksi-4-metiltetrahidrofuran-2-il)metoksi)(fenoksi)fosforil)amino)propanoat |
| PL3290428T3 (pl) | 2010-03-31 | 2022-02-07 | Gilead Pharmasset Llc | Tabletka zawierająca krystaliczny (S)-2-(((S)-(((2R,3R,4R,5R)-5-(2,4-diokso-3,4-dihydropirymidyn-1(2H)-ylo)-4-fluoro-3-hydroksy-4-metylotetrahydrofuran-2-ylo)metoksy)(fenoksy)fosforylo)amino)propanian izopropylu |
| CA2818853A1 (en) | 2010-11-30 | 2012-06-07 | Gilead Pharmasset Llc | 2'-spirocyclo-nucleosides for use in therapy of hcv or dengue virus |
| US8889159B2 (en) | 2011-11-29 | 2014-11-18 | Gilead Pharmasset Llc | Compositions and methods for treating hepatitis C virus |
| CN102603838B (zh) * | 2012-02-14 | 2015-02-18 | 江苏八巨药业有限公司 | 一种制备吉西他滨盐酸盐的方法 |
| SG11201600919UA (en) | 2013-08-27 | 2016-03-30 | Gilead Pharmasset Llc | Combination formulation of two antiviral compounds |
| CN103692332B (zh) * | 2013-12-31 | 2015-12-09 | 景宁畲族自治县通用机械配件厂(普通合伙) | 全自动抛光除油机 |
| CN107793334A (zh) * | 2017-09-27 | 2018-03-13 | 九江善水科技股份有限公司 | 芳基磺酸铵盐化合物、其制备方法及应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4526988A (en) * | 1983-03-10 | 1985-07-02 | Eli Lilly And Company | Difluoro antivirals and intermediate therefor |
| US4965374A (en) * | 1987-08-28 | 1990-10-23 | Eli Lilly And Company | Process for and intermediates of 2',2'-difluoronucleosides |
| EP0306190B1 (en) * | 1987-08-28 | 1998-04-08 | Eli Lilly And Company | Process for preparing intermediates useful in the preparation of 2',2'-difluoronucleosides |
-
1992
- 1992-06-22 US US07/902,305 patent/US5256798A/en not_active Expired - Lifetime
-
1993
- 1993-06-21 HU HU9301825A patent/HU216832B/hu not_active IP Right Cessation
- 1993-06-21 DK DK93304814.2T patent/DK0577302T3/da active
- 1993-06-21 IL IL10607793A patent/IL106077A/en not_active IP Right Cessation
- 1993-06-21 AT AT93304814T patent/ATE155476T1/de not_active IP Right Cessation
- 1993-06-21 BR BR9302429A patent/BR9302429A/pt not_active Application Discontinuation
- 1993-06-21 JP JP14916193A patent/JP3379993B2/ja not_active Expired - Fee Related
- 1993-06-21 CA CA002098882A patent/CA2098882C/en not_active Expired - Lifetime
- 1993-06-21 ES ES93304814T patent/ES2105114T3/es not_active Expired - Lifetime
- 1993-06-21 DE DE69312176T patent/DE69312176T2/de not_active Expired - Lifetime
- 1993-06-21 EP EP93304814A patent/EP0577302B1/en not_active Expired - Lifetime
- 1993-06-21 MX MX9303712A patent/MX9303712A/es not_active IP Right Cessation
- 1993-06-22 TW TW082104989A patent/TW224101B/zh active
-
1997
- 1997-10-09 GR GR970402617T patent/GR3024975T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0656865A (ja) | 1994-03-01 |
| GR3024975T3 (en) | 1998-01-30 |
| EP0577302B1 (en) | 1997-07-16 |
| HUT65207A (en) | 1994-05-02 |
| IL106077A0 (en) | 1993-10-20 |
| BR9302429A (pt) | 1994-01-11 |
| HU216832B (hu) | 1999-09-28 |
| EP0577302A1 (en) | 1994-01-05 |
| CA2098882A1 (en) | 1993-12-23 |
| HU9301825D0 (en) | 1993-09-28 |
| DK0577302T3 (da) | 1997-10-06 |
| TW224101B (cg-RX-API-DMAC10.html) | 1994-05-21 |
| MX9303712A (es) | 1994-05-31 |
| CA2098882C (en) | 2004-05-04 |
| JP3379993B2 (ja) | 2003-02-24 |
| DE69312176D1 (de) | 1997-08-21 |
| ES2105114T3 (es) | 1997-10-16 |
| IL106077A (en) | 1998-07-15 |
| ATE155476T1 (de) | 1997-08-15 |
| US5256798A (en) | 1993-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69312176T2 (de) | Verfahren zur Herstellung von mit Alpha-Anomeren angereichterten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl Sulfonaten | |
| DE69314239T2 (de) | Verfahren zur Stereoselektivglycosylierung | |
| DE69315752T2 (de) | Tieftemperatur-Verfahren zur Herstellung von mit Alpha-Anomeren angereicherten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl-Sulfonaten | |
| DE69311000T2 (de) | Verfahren zur Herstellung von mit Alpha-Anomeren angereicherten 1-Halogen-2-Deoxy-2,2-Difluor-D-Ribofuranosyl-Derivaten | |
| DE69621180T2 (de) | 2,2-Difluor-3-Carbamoylribosesulfonat-Verbindungen und Verfahren zur Herstellung von Beta-Nukleosiden | |
| DE69308400T2 (de) | Verfahren zur Stereoselektivanionglycosylierung | |
| DE69108014T2 (de) | Verfahren zur herstellung von nucleosiden und ihre analogen. | |
| DE3856330T2 (de) | Verfahren zur selektiven Isolierung von beta-2'-desoxy-2'2'-difluorocytidin oder seiner Salze | |
| DE2555479A1 (de) | Verfahren zur herstellung von 3', 4'-alpha-epoxyneamin und verwandten aminoglykosidischen antibiotika sowie die so hergestellten verbindungen | |
| CH500203A (de) | Verfahren zur Herstellung von Nucleosiden | |
| DE69602834T2 (de) | Verfahren zur herstellung von anthracyclin antibiotica | |
| DE69222643T2 (de) | Verfahren zur herstellung von demethylepypodophyllotoxin | |
| DE69206893T2 (de) | Nucleosidderivate und deren Herstellung | |
| DE69401045T2 (de) | Stereoselektives Verfahren zur Herstellung von Beta-Anomer angereicherten 2-deoxy-2,2-difluoro-D-ribofuranosyl-3,5-hydroxy-geschützten 1-alkyl und aryl-sulfonat-Zwischenprodukten | |
| DE68920648T2 (de) | Verfahren zur Herstellung von O2,2'-anhydro-1-(beta-D-arabinofuranosyl)Thymin. | |
| DE69019052T2 (de) | Verfahren zur Herstellung von 2'Deoxy-5-trifluoromethyl-ss-uridin. | |
| DE68915067T2 (de) | Verfahren zur Herstellung von 2'-Deoxy-beta-adenosin. | |
| DE69323352T2 (de) | Verfahren zur Herstellung von mit Beta-Anomeren angereicherten 2-Deoxy-2,2-Difluor-D-Ribofuranosyl-Aryl-Sulfonaten | |
| DE69404953T2 (de) | Verfahren zur Herstellung von AZT und Derivaten davon | |
| Yamasaki et al. | Syntheses of 2-Amino-2, 3-dideoxy-l-and-d-Ribohexose by Utilizing an O→ N Acetyl Migration | |
| DE69719673T2 (de) | D-pentofuranose-derivate und verfahren zu ihrer herstellung | |
| DE69808457T2 (de) | Verfahren zur herstellung von deoxyuridinderivate | |
| DE69602983T2 (de) | Darstellung von D4T aus 5-Methyluridin | |
| DE69421665T2 (de) | Anomere Fluorribosylamine | |
| AT400953B (de) | Pentofuranosid-derivate, deren herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Representative=s name: KROHER, STROBEL RECHTS- UND PATENTANWAELTE, 80336 |
|
| 8328 | Change in the person/name/address of the agent |
Representative=s name: DR. SCHOEN & PARTNER, 80336 MUENCHEN |