DE69230163T2 - Thiazolylbenzofuranderivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthalten - Google Patents
Thiazolylbenzofuranderivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthaltenInfo
- Publication number
- DE69230163T2 DE69230163T2 DE69230163T DE69230163T DE69230163T2 DE 69230163 T2 DE69230163 T2 DE 69230163T2 DE 69230163 T DE69230163 T DE 69230163T DE 69230163 T DE69230163 T DE 69230163T DE 69230163 T2 DE69230163 T2 DE 69230163T2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- compound
- salt
- formula
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000000034 method Methods 0.000 title claims abstract description 109
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 5
- 238000002360 preparation method Methods 0.000 title abstract description 24
- IQDNFLQNJPENQU-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-1,3-thiazole Chemical class C1=CSC(C=2OC3=CC=CC=C3C=2)=N1 IQDNFLQNJPENQU-UHFFFAOYSA-N 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 320
- 150000003839 salts Chemical class 0.000 claims abstract description 239
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 122
- -1 cyano, hydroxy Chemical group 0.000 claims abstract description 112
- 125000003118 aryl group Chemical group 0.000 claims abstract description 90
- 125000002252 acyl group Chemical group 0.000 claims abstract description 84
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 64
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 45
- 150000002367 halogens Chemical group 0.000 claims abstract description 45
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 40
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 25
- 239000001257 hydrogen Substances 0.000 claims abstract description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 20
- 125000005843 halogen group Chemical group 0.000 claims abstract description 18
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims abstract description 15
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 14
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 14
- 125000004429 atom Chemical group 0.000 claims abstract description 10
- 125000001424 substituent group Chemical group 0.000 claims abstract description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000000203 mixture Substances 0.000 claims description 116
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 105
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 69
- 239000002253 acid Substances 0.000 claims description 43
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 38
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 17
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 8
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- 238000010531 catalytic reduction reaction Methods 0.000 claims description 7
- 239000003638 chemical reducing agent Substances 0.000 claims description 7
- 230000002265 prevention Effects 0.000 claims description 6
- SCEIUGQQBYRBPP-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-azepine Chemical compound C1CCC=CNC1 SCEIUGQQBYRBPP-UHFFFAOYSA-N 0.000 claims description 5
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 5
- 125000003435 aroyl group Chemical group 0.000 claims description 5
- 206010020751 Hypersensitivity Diseases 0.000 claims description 4
- 206010061218 Inflammation Diseases 0.000 claims description 4
- 150000001356 alkyl thiols Chemical class 0.000 claims description 4
- 230000007815 allergy Effects 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 239000012024 dehydrating agents Substances 0.000 claims description 4
- 230000004054 inflammatory process Effects 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000005425 toluyl group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- QALVWRPQKALRFR-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 QALVWRPQKALRFR-UHFFFAOYSA-N 0.000 claims description 3
- 241001465754 Metazoa Species 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- PSILZZNMGXTOOP-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC(O)=O)C=C3C=2)=N1 PSILZZNMGXTOOP-UHFFFAOYSA-N 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 238000006900 dealkylation reaction Methods 0.000 claims description 2
- 238000007257 deesterification reaction Methods 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 125000004970 halomethyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 15
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 claims 6
- 125000005947 C1-C6 alkylsulfonyloxy group Chemical group 0.000 claims 6
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 4
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 4
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 4
- 125000006590 (C2-C6) alkenylene group Chemical group 0.000 claims 4
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 3
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 3
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims 2
- 150000001335 aliphatic alkanes Chemical group 0.000 claims 1
- 150000004684 trihydrates Chemical class 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 25
- 125000003545 alkoxy group Chemical group 0.000 abstract description 7
- 125000003282 alkyl amino group Chemical group 0.000 abstract description 6
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract description 6
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 abstract description 5
- 125000004450 alkenylene group Chemical group 0.000 abstract description 5
- 125000002947 alkylene group Chemical group 0.000 abstract description 5
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 229910052727 yttrium Inorganic materials 0.000 abstract 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 198
- 238000006243 chemical reaction Methods 0.000 description 176
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- 238000002844 melting Methods 0.000 description 84
- 230000008018 melting Effects 0.000 description 84
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- 239000002585 base Substances 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 62
- 239000002904 solvent Substances 0.000 description 56
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 238000001816 cooling Methods 0.000 description 40
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 238000001914 filtration Methods 0.000 description 25
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 230000002411 adverse Effects 0.000 description 24
- 239000012267 brine Substances 0.000 description 23
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 23
- 235000019341 magnesium sulphate Nutrition 0.000 description 23
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 23
- 239000006188 syrup Substances 0.000 description 23
- 235000020357 syrup Nutrition 0.000 description 23
- 238000010792 warming Methods 0.000 description 21
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 229910052783 alkali metal Inorganic materials 0.000 description 18
- 238000004440 column chromatography Methods 0.000 description 18
- 239000012044 organic layer Substances 0.000 description 18
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 18
- 239000000741 silica gel Substances 0.000 description 18
- 229910002027 silica gel Inorganic materials 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000005457 ice water Substances 0.000 description 15
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 229910052751 metal Inorganic materials 0.000 description 14
- 239000002184 metal Substances 0.000 description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 13
- 239000003921 oil Substances 0.000 description 12
- 239000003960 organic solvent Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 150000001342 alkaline earth metals Chemical class 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 229910052697 platinum Inorganic materials 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000001340 alkali metals Chemical class 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- 201000004624 Dermatitis Diseases 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 235000011054 acetic acid Nutrition 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 229910017052 cobalt Inorganic materials 0.000 description 6
- 239000010941 cobalt Substances 0.000 description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- YXRUWYWSPZHKLD-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=O)C=C3C=2)=N1 YXRUWYWSPZHKLD-UHFFFAOYSA-N 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 5
- 150000008065 acid anhydrides Chemical class 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 125000001589 carboacyl group Chemical group 0.000 description 5
- 238000006757 chemical reactions by type Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- BNALANGFESRXOP-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 BNALANGFESRXOP-UHFFFAOYSA-N 0.000 description 4
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 4
- PNZYQVLBRDFJLB-UHFFFAOYSA-N 4-tert-butyl-2-[5-(chloromethyl)-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCl)C=C3C=2)=N1 PNZYQVLBRDFJLB-UHFFFAOYSA-N 0.000 description 4
- FZHSPPYCNDYIKD-UHFFFAOYSA-N 5-methoxysalicylaldehyde Chemical compound COC1=CC=C(O)C(C=O)=C1 FZHSPPYCNDYIKD-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 4
- 150000008046 alkali metal hydrides Chemical class 0.000 description 4
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 4
- 208000003455 anaphylaxis Diseases 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 229910052759 nickel Inorganic materials 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 3
- FWSXVUZYZVPTIF-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 FWSXVUZYZVPTIF-UHFFFAOYSA-N 0.000 description 3
- YCMLQMDWSXFTIF-UHFFFAOYSA-N 2-methylbenzenesulfonimidic acid Chemical compound CC1=CC=CC=C1S(N)(=O)=O YCMLQMDWSXFTIF-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- ZRCORLXUHDZQNV-UHFFFAOYSA-N 4-tert-butyl-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 ZRCORLXUHDZQNV-UHFFFAOYSA-N 0.000 description 3
- XBJDWSFHEMVWIV-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 XBJDWSFHEMVWIV-UHFFFAOYSA-N 0.000 description 3
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 3
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 3
- 206010002199 Anaphylactic shock Diseases 0.000 description 3
- 206010003210 Arteriosclerosis Diseases 0.000 description 3
- 206010048962 Brain oedema Diseases 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 208000018152 Cerebral disease Diseases 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 3
- 206010010741 Conjunctivitis Diseases 0.000 description 3
- 208000011231 Crohn disease Diseases 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 208000007882 Gastritis Diseases 0.000 description 3
- 201000005569 Gout Diseases 0.000 description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 206010033645 Pancreatitis Diseases 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- 206010040070 Septic Shock Diseases 0.000 description 3
- 208000007107 Stomach Ulcer Diseases 0.000 description 3
- 208000025865 Ulcer Diseases 0.000 description 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 208000011775 arteriosclerosis disease Diseases 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 208000010668 atopic eczema Diseases 0.000 description 3
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 208000006752 brain edema Diseases 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 206010006451 bronchitis Diseases 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 201000005917 gastric ulcer Diseases 0.000 description 3
- 230000002440 hepatic effect Effects 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 231100000283 hepatitis Toxicity 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 208000001286 intracranial vasospasm Diseases 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 230000000302 ischemic effect Effects 0.000 description 3
- 150000002617 leukotrienes Chemical class 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 3
- 208000010125 myocardial infarction Diseases 0.000 description 3
- 201000008383 nephritis Diseases 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 230000002685 pulmonary effect Effects 0.000 description 3
- 208000002815 pulmonary hypertension Diseases 0.000 description 3
- 206010039083 rhinitis Diseases 0.000 description 3
- 230000036303 septic shock Effects 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 3
- 125000005270 trialkylamine group Chemical group 0.000 description 3
- 231100000397 ulcer Toxicity 0.000 description 3
- IISOIQHTJLMMLZ-UHFFFAOYSA-M (2-ethoxycarbonylphenyl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].CCOC(=O)C1=CC=CC=C1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 IISOIQHTJLMMLZ-UHFFFAOYSA-M 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- DZOXPAYEAYNYMA-UHFFFAOYSA-N 1-(5-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2OC(C(C)=O)=CC2=C1 DZOXPAYEAYNYMA-UHFFFAOYSA-N 0.000 description 2
- VEGPSYLREWWGAU-UHFFFAOYSA-N 1-[2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CC1=NN=NN1 VEGPSYLREWWGAU-UHFFFAOYSA-N 0.000 description 2
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 2
- ALXDZWOFWIALGS-UHFFFAOYSA-N 2-(2-formyl-4-methoxyphenoxy)acetonitrile Chemical compound COC1=CC=C(OCC#N)C(C=O)=C1 ALXDZWOFWIALGS-UHFFFAOYSA-N 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- TVKWECKQHNTPMG-UHFFFAOYSA-N 2-(bromomethyl)-4-tert-butyl-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(CBr)=N1 TVKWECKQHNTPMG-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- ZRHOACSSGGJLRP-UHFFFAOYSA-N 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C1=NC(CCl)=CS1 ZRHOACSSGGJLRP-UHFFFAOYSA-N 0.000 description 2
- MXVGTYBWKONZRD-UHFFFAOYSA-N 2-[4-[(tert-butylamino)methyl]-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound CC(C)(C)NCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 MXVGTYBWKONZRD-UHFFFAOYSA-N 0.000 description 2
- FBFBAXVUXDBYAR-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-hexyl-1,3-thiazole Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 FBFBAXVUXDBYAR-UHFFFAOYSA-N 0.000 description 2
- FUJZAGIXVDMRPZ-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 FUJZAGIXVDMRPZ-UHFFFAOYSA-N 0.000 description 2
- HYEMCPMRYDUHSN-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)C=O)C=C3C=2)=N1 HYEMCPMRYDUHSN-UHFFFAOYSA-N 0.000 description 2
- UKFXZVDPWRYNQM-UHFFFAOYSA-N 2-[[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]methyl]propanedioic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC(C(O)=O)C(O)=O)C=C3C=2)=N1 UKFXZVDPWRYNQM-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- WYKHSBAVLOPISI-UHFFFAOYSA-N 2-phenyl-1,3-thiazole Chemical compound C1=CSC(C=2C=CC=CC=2)=N1 WYKHSBAVLOPISI-UHFFFAOYSA-N 0.000 description 2
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 2
- SITBSXWUFLOGAS-UHFFFAOYSA-N 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-2,2-dimethylpropanoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC(C)(C)C(O)=O)C=C3C=2)=N1 SITBSXWUFLOGAS-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- NAASIWUJCOIUMX-UHFFFAOYSA-N 4-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzene-1,3-dicarbaldehyde Chemical compound CC(C)(C)C1=CSC(COC=2C(=CC(C=O)=CC=2)C=O)=N1 NAASIWUJCOIUMX-UHFFFAOYSA-N 0.000 description 2
- FEUATHOQKVGPEK-UHFFFAOYSA-N 4-hydroxybenzene-1,3-dicarbaldehyde Chemical compound OC1=CC=C(C=O)C=C1C=O FEUATHOQKVGPEK-UHFFFAOYSA-N 0.000 description 2
- QVFBRRBYYIDZOG-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2-methylsulfanyl-2-methylsulfinylethenyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CSC(S(C)=O)=CC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 QVFBRRBYYIDZOG-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- UJKGHPHSZMHGPH-UHFFFAOYSA-N 5-hydroxy-1-benzofuran-2-carbothioamide Chemical compound OC1=CC=C2OC(C(=S)N)=CC2=C1 UJKGHPHSZMHGPH-UHFFFAOYSA-N 0.000 description 2
- FBZOVBYQQNIYBV-UHFFFAOYSA-N 5-methoxy-1-benzofuran-2-carbothioamide Chemical compound COC1=CC=C2OC(C(N)=S)=CC2=C1 FBZOVBYQQNIYBV-UHFFFAOYSA-N 0.000 description 2
- AOCUYPLJQNFUBI-UHFFFAOYSA-N 5-methoxy-n-(2-oxoazepan-3-yl)-1-benzofuran-2-carboxamide Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(=O)NC1CCCCNC1=O AOCUYPLJQNFUBI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- BJJGPJNFIWHDQT-UHFFFAOYSA-N [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methanol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CO)C=C3C=2)=N1 BJJGPJNFIWHDQT-UHFFFAOYSA-N 0.000 description 2
- STYBRPVXARSAAK-UHFFFAOYSA-N [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]phenyl]methanol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CO)C=C3C=2)=N1 STYBRPVXARSAAK-UHFFFAOYSA-N 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000001925 cycloalkenes Chemical group 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- KGTWUQFETIEFKI-UHFFFAOYSA-N diethyl 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]propanedioate Chemical compound C=1C2=CC(CC(C(=O)OCC)C(=O)OCC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 KGTWUQFETIEFKI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- JZRYZNCFHHWXLT-UHFFFAOYSA-N ethyl 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethenyl]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1C=CC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 JZRYZNCFHHWXLT-UHFFFAOYSA-N 0.000 description 2
- GUWLSZDZWACRBS-UHFFFAOYSA-N ethyl 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethyl]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CCC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 GUWLSZDZWACRBS-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- RIFFHFIDKGXZAS-UHFFFAOYSA-N methyl 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 RIFFHFIDKGXZAS-UHFFFAOYSA-N 0.000 description 2
- NHGZEJHJHUHZDI-UHFFFAOYSA-N methyl 2-sulfanylbutanoate Chemical compound CCC(S)C(=O)OC NHGZEJHJHUHZDI-UHFFFAOYSA-N 0.000 description 2
- JIXPEHBNFXLJEI-UHFFFAOYSA-N methyl 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-2,2-dimethylpropanoate Chemical compound C=1C2=CC(CC(C)(C)C(=O)OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 JIXPEHBNFXLJEI-UHFFFAOYSA-N 0.000 description 2
- KFBDRZJNGWQOMM-UHFFFAOYSA-N methyl 4-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylbutanoate Chemical compound C=1C2=CC(C(SCCC(=O)N(C)C)SCCCC(=O)OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 KFBDRZJNGWQOMM-UHFFFAOYSA-N 0.000 description 2
- BHIWKHZACMWKOJ-UHFFFAOYSA-N methyl isobutyrate Chemical compound COC(=O)C(C)C BHIWKHZACMWKOJ-UHFFFAOYSA-N 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 2
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910003445 palladium oxide Inorganic materials 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 2
- 229940103494 thiosalicylic acid Drugs 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- FMGGHNGKHRCJLL-UHFFFAOYSA-N 1,2-bis(chloromethyl)benzene Chemical group ClCC1=CC=CC=C1CCl FMGGHNGKHRCJLL-UHFFFAOYSA-N 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 1
- QFBZMBRHUZAPTL-UHFFFAOYSA-N 1-[2-(5-hydroxy-1-benzofuran-2-yl)-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound CC(=O)C1CCCNC2=C1N=C(C=1OC3=CC=C(O)C=C3C=1)S2 QFBZMBRHUZAPTL-UHFFFAOYSA-N 0.000 description 1
- WETPCDNVPGRKGT-UHFFFAOYSA-N 1-[2-(5-methoxy-1-benzofuran-2-yl)-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound CC(=O)C1CCCNC(S2)=C1N=C2C1=CC2=CC(OC)=CC=C2O1 WETPCDNVPGRKGT-UHFFFAOYSA-N 0.000 description 1
- XDIMOQRDIWMRMA-UHFFFAOYSA-N 1-[2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CCl XDIMOQRDIWMRMA-UHFFFAOYSA-N 0.000 description 1
- SAIRZMWXVJEBMO-UHFFFAOYSA-N 1-bromo-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CBr SAIRZMWXVJEBMO-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- OALRKTRDVLNQAZ-UHFFFAOYSA-N 1-methylsulfinyl-1-(1-methylsulfinylethylsulfanyl)ethane Chemical compound CS(=O)C(C)SC(C)S(C)=O OALRKTRDVLNQAZ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JUWKMCGQHYTQFD-UHFFFAOYSA-N 2-(2-tert-butyl-1,3-thiazol-4-yl)-1-benzofuran-5-ol;hydrobromide Chemical compound Br.S1C(C(C)(C)C)=NC(C=2OC3=CC=C(O)C=C3C=2)=C1 JUWKMCGQHYTQFD-UHFFFAOYSA-N 0.000 description 1
- MPTPXOLRFZGVTJ-UHFFFAOYSA-N 2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1-benzofuran-5-ol Chemical compound C1CCCC(S2)=C1N=C2C1=CC2=CC(O)=CC=C2O1 MPTPXOLRFZGVTJ-UHFFFAOYSA-N 0.000 description 1
- LEOOZBXZXBAGPV-UHFFFAOYSA-N 2-(4-cyclobutyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1CCC1 LEOOZBXZXBAGPV-UHFFFAOYSA-N 0.000 description 1
- ULLAJCTYXSYOJE-UHFFFAOYSA-N 2-(4-cyclopropyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1CC1 ULLAJCTYXSYOJE-UHFFFAOYSA-N 0.000 description 1
- SURHWKHAMWEMFC-UHFFFAOYSA-N 2-(4-hexyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 SURHWKHAMWEMFC-UHFFFAOYSA-N 0.000 description 1
- NYCMSJGLAGXYMI-UHFFFAOYSA-N 2-(4-methyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 NYCMSJGLAGXYMI-UHFFFAOYSA-N 0.000 description 1
- CYHZWHGCYXJNBY-UHFFFAOYSA-N 2-(4-pentyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 CYHZWHGCYXJNBY-UHFFFAOYSA-N 0.000 description 1
- PNMZNPODRHJKAM-UHFFFAOYSA-N 2-(4-phenyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=C1 PNMZNPODRHJKAM-UHFFFAOYSA-N 0.000 description 1
- DKUMTQAFQWGIOS-UHFFFAOYSA-N 2-(4-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 DKUMTQAFQWGIOS-UHFFFAOYSA-N 0.000 description 1
- MHUONAQKQYQPRK-UHFFFAOYSA-N 2-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=N1 MHUONAQKQYQPRK-UHFFFAOYSA-N 0.000 description 1
- JWFAFFDCJOYKOB-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C#N)=N1 JWFAFFDCJOYKOB-UHFFFAOYSA-N 0.000 description 1
- KNIQSVWAUDKCRS-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzothiophen-5-ol Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(O)C=C3C=2)=N1 KNIQSVWAUDKCRS-UHFFFAOYSA-N 0.000 description 1
- YIEGKCBHMGMNOJ-UHFFFAOYSA-N 2-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CS1 YIEGKCBHMGMNOJ-UHFFFAOYSA-N 0.000 description 1
- DLRJHYZDVVCTJO-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound C1CCCC(S2)=C1N=C2C1=CC2=CC(OC)=CC=C2O1 DLRJHYZDVVCTJO-UHFFFAOYSA-N 0.000 description 1
- APSMNLZTBGAVBJ-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-(trifluoromethyl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C(F)(F)F)=CS1 APSMNLZTBGAVBJ-UHFFFAOYSA-N 0.000 description 1
- BUTGBZVYCCYLJH-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-methyl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C)=CS1 BUTGBZVYCCYLJH-UHFFFAOYSA-N 0.000 description 1
- XHGVFWKEBVRDJW-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-phenyl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=C1 XHGVFWKEBVRDJW-UHFFFAOYSA-N 0.000 description 1
- JNOZIOSZZAJZHB-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-pyridin-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=N1 JNOZIOSZZAJZHB-UHFFFAOYSA-N 0.000 description 1
- LBNYDHGKJUFPFJ-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-thiophen-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CS1 LBNYDHGKJUFPFJ-UHFFFAOYSA-N 0.000 description 1
- YYYKDMKXQUNELW-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-5-propan-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC=C(C(C)C)S1 YYYKDMKXQUNELW-UHFFFAOYSA-N 0.000 description 1
- LFPWYVUYVPRGBQ-UHFFFAOYSA-N 2-(5-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(O)=CC=C2O1 LFPWYVUYVPRGBQ-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LPDVAZUHYLUBSO-UHFFFAOYSA-N 2-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-methoxybenzaldehyde Chemical compound O=CC1=CC(OC)=CC=C1OCC1=NC(C(C)(C)C)=CS1 LPDVAZUHYLUBSO-UHFFFAOYSA-N 0.000 description 1
- ZDQQEAKXIZQVAW-UHFFFAOYSA-N 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC#N)C=C3C=2)=N1 ZDQQEAKXIZQVAW-UHFFFAOYSA-N 0.000 description 1
- XXHQURQANNZXDO-UHFFFAOYSA-N 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 XXHQURQANNZXDO-UHFFFAOYSA-N 0.000 description 1
- DULKGUCALJFHAZ-UHFFFAOYSA-N 2-[2-[[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=4CCCCC=4N=3)C2=C1 DULKGUCALJFHAZ-UHFFFAOYSA-N 0.000 description 1
- MTZBSMGTNXWYJX-UHFFFAOYSA-N 2-[2-[[2-(4-cyclobutyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CCC3)C2=C1 MTZBSMGTNXWYJX-UHFFFAOYSA-N 0.000 description 1
- LEEVCCMHYCGJFV-UHFFFAOYSA-N 2-[2-[[2-(4-cyclopropyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CC3)C2=C1 LEEVCCMHYCGJFV-UHFFFAOYSA-N 0.000 description 1
- NFNQYXPFZIPDRZ-UHFFFAOYSA-N 2-[2-[[2-(4-hexyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 NFNQYXPFZIPDRZ-UHFFFAOYSA-N 0.000 description 1
- QAHKMMKEIZUPHD-UHFFFAOYSA-N 2-[2-[[2-(4-methyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 QAHKMMKEIZUPHD-UHFFFAOYSA-N 0.000 description 1
- ZSDIPSKDSOEGME-UHFFFAOYSA-N 2-[2-[[2-(4-pentyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 ZSDIPSKDSOEGME-UHFFFAOYSA-N 0.000 description 1
- XITNFTYFRHDTLZ-UHFFFAOYSA-N 2-[2-[[2-(4-phenyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3C=CC=CC=3)C2=C1 XITNFTYFRHDTLZ-UHFFFAOYSA-N 0.000 description 1
- HVPOEHISSYCOEH-UHFFFAOYSA-N 2-[2-[[2-(4-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 HVPOEHISSYCOEH-UHFFFAOYSA-N 0.000 description 1
- UTHUKQQIZOXCFR-UHFFFAOYSA-N 2-[2-[[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3N=CC=CC=3)C2=C1 UTHUKQQIZOXCFR-UHFFFAOYSA-N 0.000 description 1
- YTDHBKDNLJZAMY-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 YTDHBKDNLJZAMY-UHFFFAOYSA-N 0.000 description 1
- WYXJIHDNODKHJB-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 WYXJIHDNODKHJB-UHFFFAOYSA-N 0.000 description 1
- DNICZTISZUSBAD-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]-n-(2-methylphenyl)sulfonylacetamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)CC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 DNICZTISZUSBAD-UHFFFAOYSA-N 0.000 description 1
- AGKCMFIHQFHQPK-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzothiophen-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 AGKCMFIHQFHQPK-UHFFFAOYSA-N 0.000 description 1
- BDIOZPCAVUHWHS-UHFFFAOYSA-N 2-[2-[[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3SC=CC=3)C2=C1 BDIOZPCAVUHWHS-UHFFFAOYSA-N 0.000 description 1
- XOENEGMPYVTFJX-UHFFFAOYSA-N 2-[2-[[2-(5-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CC#N)=CC=C2O1 XOENEGMPYVTFJX-UHFFFAOYSA-N 0.000 description 1
- NEWJHVFYVNWCQD-UHFFFAOYSA-N 2-[2-[[2-(8-acetyl-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CC#N NEWJHVFYVNWCQD-UHFFFAOYSA-N 0.000 description 1
- ROZUZHKAGVUYBL-UHFFFAOYSA-N 2-[2-[[2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C34CC5CC(CC(C5)C3)C4)C2=C1 ROZUZHKAGVUYBL-UHFFFAOYSA-N 0.000 description 1
- OYNLUUAGGAATLV-UHFFFAOYSA-N 2-[2-[[2-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 OYNLUUAGGAATLV-UHFFFAOYSA-N 0.000 description 1
- PHKMPHODSDUBSZ-UHFFFAOYSA-N 2-[2-[[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 PHKMPHODSDUBSZ-UHFFFAOYSA-N 0.000 description 1
- SFRLBXJPVQADEU-UHFFFAOYSA-N 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C1C(C2)CC(C3)CC2CC13C1=CSC(C=2OC3=CC=C(C=C3C=2)O)=N1 SFRLBXJPVQADEU-UHFFFAOYSA-N 0.000 description 1
- MUSNGRVILXZYGS-UHFFFAOYSA-N 2-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 MUSNGRVILXZYGS-UHFFFAOYSA-N 0.000 description 1
- AUYLWBDILMAZNW-UHFFFAOYSA-N 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C1=NC(C(F)(F)F)=CS1 AUYLWBDILMAZNW-UHFFFAOYSA-N 0.000 description 1
- MFENBUASWIXCPU-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound C=1C=C2OC(C=3SC=4CCCCC=4N=3)=CC2=CC=1OCC1=CC=CC=C1CC=1N=NNN=1 MFENBUASWIXCPU-UHFFFAOYSA-N 0.000 description 1
- XMJBFDFESYAMIZ-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(trifluoromethyl)-1,3-thiazole Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 XMJBFDFESYAMIZ-UHFFFAOYSA-N 0.000 description 1
- RPPNUMDRYCDHRE-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-thiophen-2-yl-1,3-thiazole Chemical compound C=1C=CC=C(CC2=NNN=N2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1=CC=CS1 RPPNUMDRYCDHRE-UHFFFAOYSA-N 0.000 description 1
- MKZCWLRQWBHPQK-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepine Chemical compound C=1C=C2OC(C=3SC=4NCCCCC=4N=3)=CC2=CC=1OCC1=CC=CC=C1CC1=NN=NN1 MKZCWLRQWBHPQK-UHFFFAOYSA-N 0.000 description 1
- VLOIKVRFEHXODW-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=4CCCCC=4N=3)C2=C1 VLOIKVRFEHXODW-UHFFFAOYSA-N 0.000 description 1
- YLEBKDUVODBXHW-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(2,2-dimethylpropyl)-1,3-thiazole Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 YLEBKDUVODBXHW-UHFFFAOYSA-N 0.000 description 1
- ZJEKELSVWBZQRE-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(trifluoromethyl)-1,3-thiazole Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 ZJEKELSVWBZQRE-UHFFFAOYSA-N 0.000 description 1
- FMWHEZKQDMGMJY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-cyclobutyl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CCC3)C2=C1 FMWHEZKQDMGMJY-UHFFFAOYSA-N 0.000 description 1
- ALRKMCTWXSDYFA-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-cyclopropyl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CC3)C2=C1 ALRKMCTWXSDYFA-UHFFFAOYSA-N 0.000 description 1
- FDRMJBMVWFYVFY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-methyl-1,3-thiazole Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 FDRMJBMVWFYVFY-UHFFFAOYSA-N 0.000 description 1
- VAGYUNPKHPHURY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pentyl-1,3-thiazole Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 VAGYUNPKHPHURY-UHFFFAOYSA-N 0.000 description 1
- IUIWHLWMTFSOIL-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-phenyl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3C=CC=CC=3)C2=C1 IUIWHLWMTFSOIL-UHFFFAOYSA-N 0.000 description 1
- LLLTXEQOJOSUOU-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-propan-2-yl-1,3-thiazole Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 LLLTXEQOJOSUOU-UHFFFAOYSA-N 0.000 description 1
- PHJAOOYXXZDHRX-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3N=CC=CC=3)C2=C1 PHJAOOYXXZDHRX-UHFFFAOYSA-N 0.000 description 1
- VGWTXHSYHFEFMY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-thiophen-2-yl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3SC=CC=3)C2=C1 VGWTXHSYHFEFMY-UHFFFAOYSA-N 0.000 description 1
- CFAUDFRGAMRUCE-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3-thiazole Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CCl)=CC=C2O1 CFAUDFRGAMRUCE-UHFFFAOYSA-N 0.000 description 1
- DIQUWLCXEKOMIN-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]benzaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)C=O)C=C3C=2)=N1 DIQUWLCXEKOMIN-UHFFFAOYSA-N 0.000 description 1
- WSGCMWDSIBXWCB-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]propanedioic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC(C(O)=O)C(O)=O)C=C3C=2)=N1 WSGCMWDSIBXWCB-UHFFFAOYSA-N 0.000 description 1
- ISPSNKHMITUDOI-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]-n-(2-methylphenyl)sulfonylbenzamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1SCC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 ISPSNKHMITUDOI-UHFFFAOYSA-N 0.000 description 1
- FXZQOBWUDTXSRK-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-n-(2-methylphenyl)sulfonylbenzamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 FXZQOBWUDTXSRK-UHFFFAOYSA-N 0.000 description 1
- CDNSWXWETQLGKR-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 CDNSWXWETQLGKR-UHFFFAOYSA-N 0.000 description 1
- BOWUOGIPSRVRSJ-UHFFFAOYSA-N 2-aminohexano-6-lactam Chemical compound NC1CCCCNC1=O BOWUOGIPSRVRSJ-UHFFFAOYSA-N 0.000 description 1
- JSCFKVXPOWVVGS-UHFFFAOYSA-N 2-bromo-1-(5-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2OC(C(=O)CBr)=CC2=C1 JSCFKVXPOWVVGS-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- NMBWXBWFDHVLGS-UHFFFAOYSA-N 2-ethylbenzenesulfonamide Chemical compound CCC1=CC=CC=C1S(N)(=O)=O NMBWXBWFDHVLGS-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- GYXHHICIFZSKKZ-UHFFFAOYSA-N 2-sulfanylacetamide Chemical compound NC(=O)CS GYXHHICIFZSKKZ-UHFFFAOYSA-N 0.000 description 1
- CFPHMAVQAJGVPV-UHFFFAOYSA-N 2-sulfanylbutanoic acid Chemical compound CCC(S)C(O)=O CFPHMAVQAJGVPV-UHFFFAOYSA-N 0.000 description 1
- IMGGANUNCHXAQF-UHFFFAOYSA-N 2-sulfanylpentanoic acid Chemical compound CCCC(S)C(O)=O IMGGANUNCHXAQF-UHFFFAOYSA-N 0.000 description 1
- YDBVCFUMMUNSRW-UHFFFAOYSA-N 2-sulfanylpropanamide Chemical compound CC(S)C(N)=O YDBVCFUMMUNSRW-UHFFFAOYSA-N 0.000 description 1
- DQQJQXPICVLDKK-UHFFFAOYSA-N 2-tert-butyl-4-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=CSC(C(C)(C)C)=N1 DQQJQXPICVLDKK-UHFFFAOYSA-N 0.000 description 1
- QMVDZJSRSCLXSZ-UHFFFAOYSA-N 2-tert-butyl-4-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound S1C(C(C)(C)C)=NC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=C1 QMVDZJSRSCLXSZ-UHFFFAOYSA-N 0.000 description 1
- GOQLAWRYFURNHJ-UHFFFAOYSA-N 2-tert-butyl-4-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound S1C(C(C)(C)C)=NC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=C1 GOQLAWRYFURNHJ-UHFFFAOYSA-N 0.000 description 1
- CVKOOKPNCVYHNY-UHFFFAOYSA-N 3-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC(C#N)=C1 CVKOOKPNCVYHNY-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- GAQFEBOLCZZIFK-UHFFFAOYSA-N 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]propanoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCC(O)=O)C=C3C=2)=N1 GAQFEBOLCZZIFK-UHFFFAOYSA-N 0.000 description 1
- KINYANRSNLTINQ-UHFFFAOYSA-N 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-n-(2-methylphenyl)sulfonylbenzamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)C1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1 KINYANRSNLTINQ-UHFFFAOYSA-N 0.000 description 1
- QEMAXXDNCFWUMS-UHFFFAOYSA-N 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C=C(C=CC=4)C(O)=O)C=C3C=2)=N1 QEMAXXDNCFWUMS-UHFFFAOYSA-N 0.000 description 1
- NPVFUQSGOYOOHP-UHFFFAOYSA-N 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C=C(C=CC=4)C#N)C=C3C=2)=N1 NPVFUQSGOYOOHP-UHFFFAOYSA-N 0.000 description 1
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 1
- JNJXNTYEINIXPS-UHFFFAOYSA-N 4-(1-adamantyl)-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C1C(C2)CC(C3)CC2CC13C1=CSC(C=2OC3=CC=C(C=C3C=2)OC)=N1 JNJXNTYEINIXPS-UHFFFAOYSA-N 0.000 description 1
- USAGAUXLVIAUFA-UHFFFAOYSA-N 4-(1-adamantyl)-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole;hydrochloride Chemical compound Cl.C=1C=C2OC(C=3SC=C(N=3)C34CC5CC(CC(C5)C3)C4)=CC2=CC=1OCC1=CC=CC=C1CC=1N=NNN=1 USAGAUXLVIAUFA-UHFFFAOYSA-N 0.000 description 1
- KNFVGADUTWXZLL-UHFFFAOYSA-N 4-(1-adamantyl)-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C34CC5CC(CC(C5)C3)C4)C2=C1 KNFVGADUTWXZLL-UHFFFAOYSA-N 0.000 description 1
- NNKPGIWIUSVXIT-UHFFFAOYSA-N 4-(2,2-dimethylpropyl)-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 NNKPGIWIUSVXIT-UHFFFAOYSA-N 0.000 description 1
- JHKIUPOLQADFGQ-UHFFFAOYSA-N 4-cyclobutyl-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1CCC1 JHKIUPOLQADFGQ-UHFFFAOYSA-N 0.000 description 1
- FVVUOJUWJCSVED-UHFFFAOYSA-N 4-cyclobutyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C=1C=CC=C(CC=2NN=NN=2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1CCC1 FVVUOJUWJCSVED-UHFFFAOYSA-N 0.000 description 1
- XWFZIAPOIZCUOR-UHFFFAOYSA-N 4-cyclopropyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C=1C=CC=C(CC=2NN=NN=2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1CC1 XWFZIAPOIZCUOR-UHFFFAOYSA-N 0.000 description 1
- SANAIMQSTRMYGD-UHFFFAOYSA-N 4-hexyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 SANAIMQSTRMYGD-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- HSYSADQZVDOHMN-UHFFFAOYSA-N 4-methyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 HSYSADQZVDOHMN-UHFFFAOYSA-N 0.000 description 1
- DDODANZBNHLARU-UHFFFAOYSA-N 4-pentyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 DDODANZBNHLARU-UHFFFAOYSA-N 0.000 description 1
- KURJDTNKVWCTII-UHFFFAOYSA-N 4-phenyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C=1C=CC=C(CC2=NNN=N2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1=CC=CC=C1 KURJDTNKVWCTII-UHFFFAOYSA-N 0.000 description 1
- XBZYDWCIBOPVHJ-UHFFFAOYSA-N 4-propan-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 XBZYDWCIBOPVHJ-UHFFFAOYSA-N 0.000 description 1
- DNFXYJIENXCYEU-UHFFFAOYSA-N 4-pyridin-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole;hydrochloride Chemical compound Cl.C=1C=CC=C(CC=2NN=NN=2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1=CC=CC=N1 DNFXYJIENXCYEU-UHFFFAOYSA-N 0.000 description 1
- ZJIQUYZWMIXTRM-UHFFFAOYSA-N 4-tert-butyl-2-(5-methoxy-1-benzothiophen-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2SC=1C1=NC(C(C)(C)C)=CS1 ZJIQUYZWMIXTRM-UHFFFAOYSA-N 0.000 description 1
- RDKNZTPFGVOMAI-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenoxy]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 RDKNZTPFGVOMAI-UHFFFAOYSA-N 0.000 description 1
- YZIWSKJQONADSN-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzothiophen-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 YZIWSKJQONADSN-UHFFFAOYSA-N 0.000 description 1
- UXEPBOSUTKINCT-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]sulfanylmethyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 UXEPBOSUTKINCT-UHFFFAOYSA-N 0.000 description 1
- SZUFOPUHQJEOMC-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenoxy]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical class CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 SZUFOPUHQJEOMC-UHFFFAOYSA-N 0.000 description 1
- JPBYSHRCPHZBBS-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzothiophen-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 JPBYSHRCPHZBBS-UHFFFAOYSA-N 0.000 description 1
- XVLHZWGKLQAOCX-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]sulfanylmethyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 XVLHZWGKLQAOCX-UHFFFAOYSA-N 0.000 description 1
- QGJRBLUNOCMWJT-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[3-(2h-tetrazol-5-yl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C=C(C=CC=4)C4=NNN=N4)C=C3C=2)=N1 QGJRBLUNOCMWJT-UHFFFAOYSA-N 0.000 description 1
- VAPRPGOSGWMTJK-UHFFFAOYSA-N 5-methoxy-1-benzofuran-2-carbonyl chloride Chemical compound COC1=CC=C2OC(C(Cl)=O)=CC2=C1 VAPRPGOSGWMTJK-UHFFFAOYSA-N 0.000 description 1
- GKOBIPBVHLFDES-UHFFFAOYSA-N 5-methoxy-2-[(4-phenyl-1,3-thiazol-2-yl)methoxy]benzaldehyde Chemical compound O=CC1=CC(OC)=CC=C1OCC1=NC(C=2C=CC=CC=2)=CS1 GKOBIPBVHLFDES-UHFFFAOYSA-N 0.000 description 1
- ZMKJSTWSUYKRHU-UHFFFAOYSA-N 5-propan-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CC=3NN=NN=3)=CC=C2O1 ZMKJSTWSUYKRHU-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- YDPLDMLRERBXAV-UHFFFAOYSA-N aluminum;triazide Chemical compound [Al+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-] YDPLDMLRERBXAV-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229950003476 aminothiazole Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000005569 butenylene group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- BXCVCLILGBBCBR-UHFFFAOYSA-N diethyl 2-[[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]methyl]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 BXCVCLILGBBCBR-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RDEWTAHSEKSPPT-UHFFFAOYSA-N ethyl 2-(bromomethyl)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CBr RDEWTAHSEKSPPT-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- SNWKNPMDQONHKK-UHFFFAOYSA-N methyl 2-sulfanylpropanoate Chemical compound COC(=O)C(C)S SNWKNPMDQONHKK-UHFFFAOYSA-N 0.000 description 1
- OESMCLIZLYTGJJ-UHFFFAOYSA-N methyl 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoate Chemical compound COC(=O)C1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1 OESMCLIZLYTGJJ-UHFFFAOYSA-N 0.000 description 1
- VMIHLSLVBTVFHN-UHFFFAOYSA-N methyl 4-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-(4-methoxy-4-oxobutyl)sulfanylmethyl]sulfanylbutanoate Chemical compound C=1C2=CC(C(SCCCC(=O)OC)SCCCC(=O)OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 VMIHLSLVBTVFHN-UHFFFAOYSA-N 0.000 description 1
- YRIAPEVGKLRGHX-UHFFFAOYSA-N methyl 4-sulfanylbutanoate Chemical compound COC(=O)CCCS YRIAPEVGKLRGHX-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- UXBJXJHRVOEYPA-UHFFFAOYSA-N n,n-dimethyl-3-sulfanylpropanamide Chemical compound CN(C)C(=O)CCS UXBJXJHRVOEYPA-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 description 1
- QLVFXBSHXBMJMU-UHFFFAOYSA-N n-tert-butyl-n-[[2-(5-hydroxy-1-benzofuran-2-yl)-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 QLVFXBSHXBMJMU-UHFFFAOYSA-N 0.000 description 1
- WYLAJBGOOAKMAP-UHFFFAOYSA-N n-tert-butyl-n-[[2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 WYLAJBGOOAKMAP-UHFFFAOYSA-N 0.000 description 1
- YWORNCVWQMGRQA-UHFFFAOYSA-N n-tert-butyl-n-[[2-[5-[[2-(cyanomethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 YWORNCVWQMGRQA-UHFFFAOYSA-N 0.000 description 1
- ZFIFHAKCBWOSRN-UHFFFAOYSA-N naphthalene-1-sulfonamide Chemical compound C1=CC=C2C(S(=O)(=O)N)=CC=CC2=C1 ZFIFHAKCBWOSRN-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940100684 pentylamine Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Pulmonology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919117733A GB9117733D0 (en) | 1991-08-16 | 1991-08-16 | New thiazolylbenzofuran derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same |
| GB929201057A GB9201057D0 (en) | 1992-01-17 | 1992-01-17 | New thiazolylbenzofuran derivatives,processes for the preparation thereof and pharmaceutical composition comprising the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69230163D1 DE69230163D1 (de) | 1999-11-25 |
| DE69230163T2 true DE69230163T2 (de) | 2000-03-23 |
Family
ID=26299417
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69230163T Expired - Fee Related DE69230163T2 (de) | 1991-08-16 | 1992-08-12 | Thiazolylbenzofuranderivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthalten |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5296495A (enExample) |
| EP (1) | EP0528337B1 (enExample) |
| JP (1) | JP2600644B2 (enExample) |
| KR (1) | KR930004304A (enExample) |
| CN (1) | CN1033088C (enExample) |
| AT (1) | ATE185807T1 (enExample) |
| AU (1) | AU665007B2 (enExample) |
| CA (1) | CA2076192A1 (enExample) |
| DE (1) | DE69230163T2 (enExample) |
| DK (1) | DK0528337T3 (enExample) |
| ES (1) | ES2137169T3 (enExample) |
| GR (1) | GR3032425T3 (enExample) |
| HU (2) | HUT64336A (enExample) |
| MX (1) | MX9204746A (enExample) |
| SG (1) | SG45259A1 (enExample) |
| TW (1) | TW224464B (enExample) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0741125A1 (en) * | 1992-11-02 | 1996-11-06 | Shionogi Seiyaku Kabushiki Kaisha | Benzyl compounds and process for producing same |
| CA2102078A1 (en) * | 1992-11-02 | 1994-05-03 | Akira Takase | A process for producing (e)-alkoxyimino or hydroxyiminoacetamide compounds and intermediates therefor |
| DE4425609A1 (de) * | 1994-07-20 | 1996-01-25 | Bayer Ag | Benzofuranyl- und Benzothienyloxazolidinone |
| ATE216384T1 (de) * | 1996-01-22 | 2002-05-15 | Fujisawa Pharmaceutical Co | Thiazolylbenzofuranderivate und pharmazeutische zusammensetzungen die sie enthalten |
| CA2302417A1 (en) * | 1997-10-27 | 1999-05-06 | Takeda Chemical Industries, Ltd. | Adenosine a3 receptor antagonists |
| US6262066B1 (en) | 1998-07-27 | 2001-07-17 | Schering Corporation | High affinity ligands for nociceptin receptor ORL-1 |
| CA2469228A1 (en) | 2001-12-03 | 2003-06-12 | Japan Tobacco Inc. | Azole compound and medicinal use thereof |
| EP1424101A3 (en) * | 2002-11-29 | 2004-08-18 | NOZAKI, Masako | Use of a leukotriene C4 and D4 receptor antagonist for the preparation of a medicament for treating or preventing brain inflammation and sepsis |
| US7148248B2 (en) | 2002-11-29 | 2006-12-12 | Masako Nozaki | Method of treating or inhibiting the development of brain inflammation and sepsis |
| KR20050119201A (ko) * | 2003-04-09 | 2005-12-20 | 니뽄 다바코 산교 가부시키가이샤 | 5원 헤테로방향족 고리 화합물 및 이의 의약적 용도 |
| WO2004106317A1 (ja) | 2003-05-29 | 2004-12-09 | The New Industry Research Organization | ベンゾフラン化合物、およびそれを含有してなる医薬組成物 |
| JP2005008631A (ja) * | 2003-05-29 | 2005-01-13 | New Industry Research Organization | ベンゾフラン化合物、およびそれを含有してなる医薬組成物 |
| ITTO20040125A1 (it) * | 2004-03-01 | 2004-06-01 | Rotta Research Lab | Nuove amidine eterocicliche inibitrici la produzione di ossido d'azoto (no) ad attivita' antinfiammatoria ed analgesica |
| EP1765333A4 (en) | 2004-07-14 | 2008-06-18 | Inflammation Res Ct Company Lt | PROCESS FOR INHIBITING TUMOR METASTASES |
| CA2575932A1 (en) * | 2004-08-04 | 2006-02-16 | Schering Corporation | Pharmaceutical formulations comprising pleconaril for the treatment of airway diseases |
| US20060110449A1 (en) | 2004-10-25 | 2006-05-25 | Lorber Richard R | Pharmaceutical composition |
| WO2006046683A1 (en) * | 2004-10-25 | 2006-05-04 | Astellas Pharma Inc. | Thiazolylbenzofuran derivatives as leukotriene and prostaglandin d2 receptor antagonists |
| WO2006054793A1 (ja) * | 2004-11-19 | 2006-05-26 | The New Industry Research Organization | ベンゾフラン化合物、およびそれを含有してなる医薬組成物 |
| RU2009104346A (ru) * | 2006-07-11 | 2010-08-20 | Шеринг Корпорейшн (US) | Ксинафоатная соль замещенного 5-оксазол-2-ил-хинолинового соединения |
| AU2007319151B2 (en) * | 2006-11-16 | 2013-05-23 | Allergan, Inc. | Sulfoximines as kinase inhibitors |
| CA2764830A1 (en) | 2009-06-16 | 2010-12-23 | Schering Corporation | Novel [3,2-c] heteroaryl steroids as glucocorticoid receptor agonists, compositions and uses thereof |
| JP2014527511A (ja) | 2011-06-24 | 2014-10-16 | アムジエン・インコーポレーテツド | Trpm8拮抗剤及び治療におけるそれらの使用 |
| EP2723718A1 (en) | 2011-06-24 | 2014-04-30 | Amgen Inc. | Trpm8 antagonists and their use in treatments |
| WO2013102145A1 (en) | 2011-12-28 | 2013-07-04 | Global Blood Therapeutics, Inc. | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation |
| JP6242810B2 (ja) | 2011-12-28 | 2017-12-06 | グローバル・ブラッド・セラピューティクス・インコーポレイテッドGlobal Blood Therapeutics,Inc. | 置換ベンズアルデヒド化合物および組織酸素化の増加におけるそれらの使用方法 |
| US8952009B2 (en) | 2012-08-06 | 2015-02-10 | Amgen Inc. | Chroman derivatives as TRPM8 inhibitors |
| US9458139B2 (en) | 2013-03-15 | 2016-10-04 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US10100043B2 (en) | 2013-03-15 | 2018-10-16 | Global Blood Therapeutics, Inc. | Substituted aldehyde compounds and methods for their use in increasing tissue oxygenation |
| US8952171B2 (en) | 2013-03-15 | 2015-02-10 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US10266551B2 (en) | 2013-03-15 | 2019-04-23 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US20140274961A1 (en) | 2013-03-15 | 2014-09-18 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| ES2993155T3 (en) | 2013-03-15 | 2024-12-23 | Global Blood Therapeutics Inc | Compounds and uses thereof for the modulation of hemoglobin |
| SG11201507320QA (en) | 2013-03-15 | 2015-10-29 | Global Blood Therapeutics Inc | Compounds and uses thereof for the modulation of hemoglobin |
| US9422279B2 (en) | 2013-03-15 | 2016-08-23 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| SG11201507453VA (en) | 2013-03-15 | 2015-10-29 | Global Blood Therapeutics Inc | Compounds and uses thereof for the modulation of hemoglobin |
| US9802900B2 (en) | 2013-03-15 | 2017-10-31 | Global Blood Therapeutics, Inc. | Bicyclic heteroaryl compounds and uses thereof for the modulation of hemoglobin |
| US9604999B2 (en) | 2013-03-15 | 2017-03-28 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| EA201992707A1 (ru) | 2013-11-18 | 2020-06-30 | Глобал Блад Терапьютикс, Инк. | Соединения и их применения для модуляции гемоглобина |
| PL3102208T5 (pl) | 2014-02-07 | 2024-10-14 | Global Blood Therapeutics, Inc. | Krystaliczny polimorf wolnej zasady 2-hydroksy-6-((2-(1-izopropylo-1h-pirazol-5-ilo)pirydyn-3-ylo)metoksy)benzaldehydu |
| EA035646B1 (ru) | 2014-08-29 | 2020-07-21 | Сиэйчдиай Фаундэйшн, Инк. | Зонды для визуализации белка хантингтина |
| MA41841A (fr) | 2015-03-30 | 2018-02-06 | Global Blood Therapeutics Inc | Composés aldéhyde pour le traitement de la fibrose pulmonaire, de l'hypoxie, et de maladies auto-immunes et des tissus conjonctifs |
| ES3039236T3 (en) | 2015-12-04 | 2025-10-20 | Global Blood Therapeutics Inc | Dosing regimens for 2-hydroxy-6-((2-(1-isopropyl-1h-pyrazol-5-yl)pyridin-3-yl)methoxy)benzaldehyde |
| TWI752307B (zh) | 2016-05-12 | 2022-01-11 | 美商全球血液治療公司 | 新穎化合物及製造化合物之方法 |
| TW202332423A (zh) | 2016-10-12 | 2023-08-16 | 美商全球血液治療公司 | 包含2-羥基-6-((2-(1-異丙基-1h-吡唑-5-基)吡啶-3-基)甲氧基)-苯甲醛之片劑 |
| WO2018115984A1 (en) | 2016-12-19 | 2018-06-28 | Cellix Bio Private Limited | Compositions and methods for the treatment of inflammation |
| US11014884B2 (en) | 2018-10-01 | 2021-05-25 | Global Blood Therapeutics, Inc. | Modulators of hemoglobin |
| TW202500134A (zh) * | 2023-05-18 | 2025-01-01 | 美商恩維達醫療公司 | G-蛋白偶聯受體之拮抗劑 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62142168A (ja) * | 1985-10-16 | 1987-06-25 | Mitsubishi Chem Ind Ltd | チアゾ−ル誘導体及びそれを有効成分とするロイコトリエンきつ抗剤 |
| US4742057A (en) * | 1985-12-05 | 1988-05-03 | Fujisawa Pharmaceutical Co., Ltd. | Antiallergic thiazole compounds |
| US4908357A (en) * | 1986-04-30 | 1990-03-13 | Fmc Corporation | Photoactive azole pesticides |
| US5001140A (en) * | 1989-04-17 | 1991-03-19 | Hoffmann-La Roche Inc. | Cycloalkylthiazoles |
| JPH02169584A (ja) * | 1988-12-22 | 1990-06-29 | Mitsubishi Kasei Corp | ビニルチアゾール誘導体およびそれを有効成分とする薬剤 |
| US5032588A (en) * | 1989-12-08 | 1991-07-16 | Abbott Laboratories | Thiazole lipoxygenase-inhibiting compounds derived from non-steroidal antiinflammatory carboxylic acids |
| DE3941438A1 (de) * | 1989-12-15 | 1991-06-20 | Hoechst Ag | Neue 2-substituierte 4-(3-alkyl-5-tert.-butyl-4-hydroxy-phenyl)-thiazole, verfahren zu ihrer herstellung, die sie enthaltenden arzneimittel und ihre verwendung |
-
1992
- 1992-08-06 JP JP4210308A patent/JP2600644B2/ja not_active Expired - Fee Related
- 1992-08-12 US US07/929,751 patent/US5296495A/en not_active Expired - Fee Related
- 1992-08-12 AT AT92113705T patent/ATE185807T1/de not_active IP Right Cessation
- 1992-08-12 EP EP92113705A patent/EP0528337B1/en not_active Expired - Lifetime
- 1992-08-12 SG SG1996002173A patent/SG45259A1/en unknown
- 1992-08-12 DK DK92113705T patent/DK0528337T3/da active
- 1992-08-12 ES ES92113705T patent/ES2137169T3/es not_active Expired - Lifetime
- 1992-08-12 DE DE69230163T patent/DE69230163T2/de not_active Expired - Fee Related
- 1992-08-13 AU AU21029/92A patent/AU665007B2/en not_active Ceased
- 1992-08-14 TW TW081106455A patent/TW224464B/zh active
- 1992-08-14 KR KR1019920014712A patent/KR930004304A/ko not_active Ceased
- 1992-08-14 CA CA002076192A patent/CA2076192A1/en not_active Abandoned
- 1992-08-14 HU HU9202656A patent/HUT64336A/hu unknown
- 1992-08-15 CN CN92110877A patent/CN1033088C/zh not_active Expired - Fee Related
- 1992-08-17 MX MX9204746A patent/MX9204746A/es not_active IP Right Cessation
-
1995
- 1995-06-22 HU HU95P/P00346P patent/HU211630A9/hu unknown
-
2000
- 2000-01-19 GR GR20000400122T patent/GR3032425T3/el not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU2102992A (en) | 1993-02-18 |
| TW224464B (enExample) | 1994-06-01 |
| DK0528337T3 (da) | 2000-03-27 |
| EP0528337B1 (en) | 1999-10-20 |
| JP2600644B2 (ja) | 1997-04-16 |
| KR930004304A (ko) | 1993-03-22 |
| HU211630A9 (en) | 1995-12-28 |
| GR3032425T3 (en) | 2000-05-31 |
| CA2076192A1 (en) | 1993-02-17 |
| ATE185807T1 (de) | 1999-11-15 |
| SG45259A1 (en) | 1998-01-16 |
| HUT64336A (en) | 1993-12-28 |
| CN1070910A (zh) | 1993-04-14 |
| JPH05202040A (ja) | 1993-08-10 |
| HU9202656D0 (en) | 1992-10-28 |
| DE69230163D1 (de) | 1999-11-25 |
| EP0528337A1 (en) | 1993-02-24 |
| CN1033088C (zh) | 1996-10-23 |
| MX9204746A (es) | 1994-04-29 |
| AU665007B2 (en) | 1995-12-14 |
| US5296495A (en) | 1994-03-22 |
| ES2137169T3 (es) | 1999-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69230163T2 (de) | Thiazolylbenzofuranderivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthalten | |
| DE69310501T2 (de) | Chinolylbenzofuran derivate als leukotrien-antagonisten | |
| DE69712042T2 (de) | Thiazolylbenzofuranderivate und pharmazeutische zusammensetzungen die sie enthalten | |
| DE69322605T2 (de) | Imidazo (1,2-a)pyridine als Bradykinin-Antagonisten | |
| US5102667A (en) | Isoindolone derivatives, their preparation and the pharmaceutical compositions containing them | |
| DE69529614T2 (de) | Heterobizyklische derivate | |
| DE69426205T2 (de) | Gastrin-und cck-rezeptorligande | |
| AU768726B2 (en) | Indole derivatives and their use for the treatment of osteoporosis amongst other applications | |
| JP2021011494A (ja) | Pde4抑制活性を有する化合物の製造方法 | |
| WO1999000372A1 (fr) | Sulfamides et leur utilisation medicale | |
| EP0001113A1 (de) | Thienothiazinderivate, deren Herstellung, sowie diese enthaltende Präparate | |
| CA2101521A1 (en) | 5-heteroyl indole derivatives | |
| DE69224115T2 (de) | Heteroaryl substituierte Hydroxylaminderivate als Lipoxygenase-Inhibitoren | |
| DE69125308T2 (de) | Indolderivate | |
| CN110498770B (zh) | 一种制备恶拉戈利中间体的方法 | |
| CA2356838A1 (en) | Imidazole compounds and medicinal use thereof | |
| DE69419917T2 (de) | Indazolderivate | |
| JPH04211652A (ja) | ヘキサヒドロベンズ[cd]インドール | |
| DE60223227T2 (de) | BenzoÄbÄthiophenderivate und Verfahren zu deren Herstellung | |
| KR100242675B1 (ko) | 4-아미노테트라히드로벤즈 이소옥사졸 또는 -이소티아졸 화합물 | |
| JPH0673012A (ja) | 4−イミノキノリン、その製法およびその使用 | |
| HUT65252A (en) | Process for producing of quinolin-2-yl-methoxybenzylhydroxyureas and pharmaceutical compositions comprising them | |
| JPS61176563A (ja) | 4,4‐ジアルキル‐2‐アゼチジノン類の製造法 | |
| JPH08325265A (ja) | チアゾリルベンゾフラン誘導体の製造方法、および該製造方法に用いられる化合物 | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |