DE69021129T2 - Bleichaktivierung und Bleichmittel-Zusammensetzungen. - Google Patents
Bleichaktivierung und Bleichmittel-Zusammensetzungen.Info
- Publication number
- DE69021129T2 DE69021129T2 DE69021129T DE69021129T DE69021129T2 DE 69021129 T2 DE69021129 T2 DE 69021129T2 DE 69021129 T DE69021129 T DE 69021129T DE 69021129 T DE69021129 T DE 69021129T DE 69021129 T2 DE69021129 T2 DE 69021129T2
- Authority
- DE
- Germany
- Prior art keywords
- peroxyacid
- bleaching agent
- hydrophobic
- bleach
- cationic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 120
- 239000000203 mixture Substances 0.000 title claims description 50
- 230000004913 activation Effects 0.000 title description 2
- 150000004965 peroxy acids Chemical class 0.000 claims description 83
- 239000002243 precursor Substances 0.000 claims description 78
- -1 cationic peroxyacid Chemical class 0.000 claims description 46
- 230000002209 hydrophobic effect Effects 0.000 claims description 46
- 238000004061 bleaching Methods 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 28
- 239000003599 detergent Substances 0.000 claims description 28
- 239000012190 activator Substances 0.000 claims description 27
- 125000002091 cationic group Chemical group 0.000 claims description 23
- 229910052708 sodium Inorganic materials 0.000 claims description 22
- 239000011734 sodium Substances 0.000 claims description 22
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- 229910006067 SO3−M Inorganic materials 0.000 claims description 5
- 150000002978 peroxides Chemical class 0.000 claims description 5
- 229910052700 potassium Chemical group 0.000 claims description 5
- 239000011591 potassium Chemical group 0.000 claims description 5
- 230000003381 solubilizing effect Effects 0.000 claims description 5
- 238000004090 dissolution Methods 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- NTZRDKVFLPLTPU-UHFFFAOYSA-N CC[Na] Chemical compound CC[Na] NTZRDKVFLPLTPU-UHFFFAOYSA-N 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 159000000001 potassium salts Chemical class 0.000 claims description 2
- YIMYUGFRPUNGOM-UHFFFAOYSA-N 4-(3,5,5-trimethylhexanoyloxy)benzenesulfonic acid Chemical compound CC(C)(C)CC(C)CC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 YIMYUGFRPUNGOM-UHFFFAOYSA-N 0.000 claims 1
- RPVXVXVYQAUIQJ-UHFFFAOYSA-N 4-nonanoyloxybenzoic acid Chemical compound CCCCCCCCC(=O)OC1=CC=C(C(O)=O)C=C1 RPVXVXVYQAUIQJ-UHFFFAOYSA-N 0.000 claims 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 25
- 239000002689 soil Substances 0.000 description 18
- 239000000243 solution Substances 0.000 description 15
- 239000000463 material Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 12
- 239000007788 liquid Substances 0.000 description 10
- 239000000654 additive Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 235000014113 dietary fatty acids Nutrition 0.000 description 8
- 239000000194 fatty acid Substances 0.000 description 8
- 229930195729 fatty acid Natural products 0.000 description 8
- 239000000344 soap Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- 230000000996 additive effect Effects 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000004753 textile Substances 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- UPYKUZBSLRQECL-UKMVMLAPSA-N Lycopene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1C(=C)CCCC1(C)C)C=CC=C(/C)C=CC2C(=C)CCCC2(C)C UPYKUZBSLRQECL-UKMVMLAPSA-N 0.000 description 3
- JEVVKJMRZMXFBT-XWDZUXABSA-N Lycophyll Natural products OC/C(=C/CC/C(=C\C=C\C(=C/C=C/C(=C\C=C\C=C(/C=C/C=C(\C=C\C=C(/CC/C=C(/CO)\C)\C)/C)\C)/C)\C)/C)/C JEVVKJMRZMXFBT-XWDZUXABSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000003945 anionic surfactant Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 239000012933 diacyl peroxide Substances 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- OAIJSZIZWZSQBC-GYZMGTAESA-N lycopene Chemical compound CC(C)=CCC\C(C)=C\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)CCC=C(C)C OAIJSZIZWZSQBC-GYZMGTAESA-N 0.000 description 3
- 235000012661 lycopene Nutrition 0.000 description 3
- 229960004999 lycopene Drugs 0.000 description 3
- 239000001751 lycopene Substances 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- ZCIHMQAPACOQHT-ZGMPDRQDSA-N trans-isorenieratene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/c1c(C)ccc(C)c1C)C=CC=C(/C)C=Cc2c(C)ccc(C)c2C ZCIHMQAPACOQHT-ZGMPDRQDSA-N 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 244000269722 Thea sinensis Species 0.000 description 2
- GHDBLWVVUWTQCG-UHFFFAOYSA-N acetonitrile;n,n-dimethylmethanamine Chemical group CC#N.CN(C)C GHDBLWVVUWTQCG-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 235000015203 fruit juice Nutrition 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical class OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 125000005342 perphosphate group Chemical group 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 235000015067 sauces Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 235000013616 tea Nutrition 0.000 description 2
- 150000004685 tetrahydrates Chemical class 0.000 description 2
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- CGSCWNJIKKWYGC-UHFFFAOYSA-N 2-(2-methylphenoxy)benzenesulfonate;trimethylazanium Chemical compound C[NH+](C)C.CC1=CC=CC=C1OC1=CC=CC=C1S([O-])(=O)=O CGSCWNJIKKWYGC-UHFFFAOYSA-N 0.000 description 1
- KFHPLKOGIYRWMD-UHFFFAOYSA-N 2-[2-(2,5-dioxopyrrolidin-1-yl)pyridin-1-ium-1-yl]isoindole-1,3-dione Chemical group C1(CCC(N1C1=[N+](C=CC=C1)N1C(C=2C(C1=O)=CC=CC2)=O)=O)=O KFHPLKOGIYRWMD-UHFFFAOYSA-N 0.000 description 1
- NAKRZZMFASRRNT-UHFFFAOYSA-N 4-carboxyoxybenzenesulfonic acid hydrochloride Chemical compound Cl.OC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 NAKRZZMFASRRNT-UHFFFAOYSA-N 0.000 description 1
- JVZRCNQLWOELDU-UHFFFAOYSA-O 4-phenylpyridin-1-ium Chemical compound C1=CC=CC=C1C1=CC=[NH+]C=C1 JVZRCNQLWOELDU-UHFFFAOYSA-O 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 229920013820 alkyl cellulose Polymers 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001746 carotenes Chemical class 0.000 description 1
- 235000005473 carotenes Nutrition 0.000 description 1
- 239000012682 cationic precursor Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical group [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 description 1
- CICFLWYXGGPEOO-UHFFFAOYSA-M dimethyl-octyl-(11-oxo-11-phenoxyundecyl)azanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(C)CCCCCCCCCCC(=O)OC1=CC=CC=C1 CICFLWYXGGPEOO-UHFFFAOYSA-M 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- BRDYCNFHFWUBCZ-UHFFFAOYSA-N dodecaneperoxoic acid Chemical compound CCCCCCCCCCCC(=O)OO BRDYCNFHFWUBCZ-UHFFFAOYSA-N 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 235000019990 fruit wine Nutrition 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 235000008960 ketchup Nutrition 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N methyl undecanoic acid Natural products CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000001053 orange pigment Substances 0.000 description 1
- 150000004028 organic sulfates Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical class OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229940044652 phenolsulfonate Drugs 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Chemical group 0.000 description 1
- 239000011574 phosphorus Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- YKLPVHZUIDKCOW-UHFFFAOYSA-M potassium;2-(3,5,5-trimethylhexanoyloxy)benzenesulfonate Chemical compound [K+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1S([O-])(=O)=O YKLPVHZUIDKCOW-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 210000002374 sebum Anatomy 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- QSKQNALVHFTOQX-UHFFFAOYSA-M sodium nonanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O QSKQNALVHFTOQX-UHFFFAOYSA-M 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 229940087596 sodium phenolsulfonate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- BLXAGSNYHSQSRC-UHFFFAOYSA-M sodium;2-hydroxybenzenesulfonate Chemical compound [Na+].OC1=CC=CC=C1S([O-])(=O)=O BLXAGSNYHSQSRC-UHFFFAOYSA-M 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000013042 solid detergent Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/395—Bleaching agents
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898910725A GB8910725D0 (en) | 1989-05-10 | 1989-05-10 | Bleach activation and bleaching compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69021129D1 DE69021129D1 (de) | 1995-08-31 |
| DE69021129T2 true DE69021129T2 (de) | 1995-12-21 |
Family
ID=10656499
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69021129T Expired - Lifetime DE69021129T2 (de) | 1989-05-10 | 1990-05-02 | Bleichaktivierung und Bleichmittel-Zusammensetzungen. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5106528A (enExample) |
| EP (1) | EP0399584B1 (enExample) |
| JP (1) | JPH0678556B2 (enExample) |
| KR (1) | KR920010476B1 (enExample) |
| AU (1) | AU616356B2 (enExample) |
| BR (1) | BR9002190A (enExample) |
| CA (1) | CA2016030C (enExample) |
| DE (1) | DE69021129T2 (enExample) |
| ES (1) | ES2076292T3 (enExample) |
| GB (1) | GB8910725D0 (enExample) |
| IN (1) | IN171563B (enExample) |
| NO (1) | NO176613C (enExample) |
| TR (1) | TR24642A (enExample) |
| ZA (1) | ZA903575B (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0447553B1 (en) * | 1989-09-11 | 1996-06-12 | Kao Corporation | Bleaching composition |
| US5688757A (en) * | 1990-01-22 | 1997-11-18 | Novo Nordisk A/S The Procter & Gamble Co. | Sugar derivatives containing both long and short chain acyl groups as bleach activators |
| GB9018749D0 (en) * | 1990-08-28 | 1990-10-10 | Unilever Plc | Bleaching and detergent compositions |
| GB9105959D0 (en) * | 1991-03-21 | 1991-05-08 | Unilever Plc | Cationic peroxyacids and bleach compositions comprising said peroxyacids |
| GB9123220D0 (en) * | 1991-11-01 | 1991-12-18 | Unilever Plc | Liquid cleaning compositions |
| CA2098353A1 (en) * | 1992-06-15 | 1993-12-16 | Yueting Chou | Sulfonamide peroxycarboxylic acids |
| US5419847A (en) * | 1993-05-13 | 1995-05-30 | The Procter & Gamble Company | Translucent, isotropic aqueous liquid bleach composition |
| US5998350A (en) * | 1993-05-20 | 1999-12-07 | The Procter & Gamble Company | Bleaching compounds comprising N-acyl caprolactam and/or peroxy acid activators |
| CA2162362C (en) * | 1993-05-20 | 1999-07-27 | Alan David Willey | Bleaching compounds comprising n-acyl caprolactam and alkanoyloxybenzene sulfonate bleach activators |
| EP0651052B1 (en) * | 1993-11-03 | 1998-08-26 | The Procter & Gamble Company | Machine dishwashing detergent compositions |
| US5747438A (en) * | 1993-11-03 | 1998-05-05 | The Procter & Gamble Company | Machine dishwashing detergent containing coated percarbonate and an acidification agent to provide delayed lowered pH |
| DE4338922A1 (de) * | 1993-11-15 | 1995-05-18 | Degussa | Aktivatoren für anorganische Persauerstoffverbindungen |
| US5578136A (en) * | 1994-08-31 | 1996-11-26 | The Procter & Gamble Company | Automatic dishwashing compositions comprising quaternary substituted bleach activators |
| US5584888A (en) * | 1994-08-31 | 1996-12-17 | Miracle; Gregory S. | Perhydrolysis-selective bleach activators |
| US5460747A (en) * | 1994-08-31 | 1995-10-24 | The Procter & Gamble Co. | Multiple-substituted bleach activators |
| US5686015A (en) * | 1994-08-31 | 1997-11-11 | The Procter & Gamble Company | Quaternary substituted bleach activators |
| US5520835A (en) * | 1994-08-31 | 1996-05-28 | The Procter & Gamble Company | Automatic dishwashing compositions comprising multiquaternary bleach activators |
| DE4443177A1 (de) * | 1994-12-05 | 1996-06-13 | Henkel Kgaa | Aktivatormischungen für anorganische Perverbindungen |
| US5599781A (en) * | 1995-07-27 | 1997-02-04 | Haeggberg; Donna J. | Automatic dishwashing detergent having bleach system comprising monopersulfate, cationic bleach activator and perborate or percarbonate |
| US5534180A (en) * | 1995-02-03 | 1996-07-09 | Miracle; Gregory S. | Automatic dishwashing compositions comprising multiperacid-forming bleach activators |
| US5534179A (en) * | 1995-02-03 | 1996-07-09 | Procter & Gamble | Detergent compositions comprising multiperacid-forming bleach activators |
| GB9505518D0 (en) * | 1995-03-18 | 1995-05-03 | Procter & Gamble | Perfumed bleaching compositions |
| DE19549358A1 (de) * | 1995-03-24 | 1996-09-26 | Degussa | Aktivatorzusammensetzungen für Peroxoverbindungen und sie enthaltende Mittel |
| US5888419A (en) * | 1995-06-07 | 1999-03-30 | The Clorox Company | Granular N-alkyl ammonium acetontrile compositions |
| US6764613B2 (en) | 1995-06-07 | 2004-07-20 | Mid-America Commercialization Corporation | N-alkyl ammonium acetonitrile salts, methods therefor and compositions therewith |
| US5739327A (en) * | 1995-06-07 | 1998-04-14 | The Clorox Company | N-alkyl ammonium acetonitrile bleach activators |
| US5792218A (en) * | 1995-06-07 | 1998-08-11 | The Clorox Company | N-alkyl ammonium acetonitrile activators in dense gas cleaning and method |
| US6235218B1 (en) | 1995-06-07 | 2001-05-22 | The Clorox Company | Process for preparing N-alkyl ammonium acetonitrile compounds |
| US6183665B1 (en) | 1995-06-07 | 2001-02-06 | The Clorox Company | Granular N-alkyl ammonium acetonitrile compositions |
| US5814242A (en) * | 1995-06-07 | 1998-09-29 | The Clorox Company | Mixed peroxygen activator compositions |
| US6010994A (en) * | 1995-06-07 | 2000-01-04 | The Clorox Company | Liquid compositions containing N-alkyl ammonium acetonitrile salts |
| WO1997016515A1 (en) * | 1995-10-30 | 1997-05-09 | Unilever N.V. | Peroxyacids |
| EP0778342A1 (en) | 1995-12-06 | 1997-06-11 | The Procter & Gamble Company | Detergent compositions |
| BR9710914A (pt) * | 1996-07-29 | 1999-08-17 | Procter & Gamble | Ativadoares dealejante de imida ac¡clica assim-trica e composi-{es empregando os mesmos |
| JP2001502334A (ja) * | 1996-10-15 | 2001-02-20 | ザ、プロクター、エンド、ギャンブル、カンパニー | 不斉カチオン性ブリーチアクチベーターおよびそれを用いた組成物 |
| EP1032631B1 (en) | 1997-11-10 | 2002-10-23 | The Procter & Gamble Company | O-substituted n,n-diacylhydroxylamine bleach activators and compositions employing the same |
| US6649805B1 (en) | 1999-03-05 | 2003-11-18 | The Procter & Gamble Company | Articles with odor control |
| EP1034802A1 (en) * | 1999-03-05 | 2000-09-13 | The Procter & Gamble Company | Articles with odour control |
| US6830591B1 (en) * | 2000-02-15 | 2004-12-14 | The Procter & Gamble Company | Method for the use of hydrophobic bleaching systems in textile preparation |
| WO2001085890A1 (en) * | 2000-05-11 | 2001-11-15 | Unilever Plc | Machine dishwashing compositions containing bleaching agents and polymers |
| US6602836B2 (en) | 2000-05-11 | 2003-08-05 | Unilever Home & Personal Care Usa, A Division Of Conopco, Inc. | Machine dishwashing compositions containing cationic bleaching agents and water-soluble polymers incorporating cationic groups |
| CA2483393A1 (en) * | 2002-05-02 | 2003-11-13 | The Procter & Gamble Company | Detergent compositions and components thereof |
| GB2417250A (en) * | 2004-08-20 | 2006-02-22 | Reckitt Benckiser Nv | Multi-chamber bottle containg a liquid detergent composition |
| WO2016040629A1 (en) | 2014-09-10 | 2016-03-17 | Basf Se | Encapsulated cleaning composition |
| WO2017156141A1 (en) | 2016-03-09 | 2017-09-14 | Basf Se | Encapsulated laundry cleaning composition |
| GB202014070D0 (en) | 2020-09-08 | 2020-10-21 | Alborz Chemicals Ltd | Polymorph |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3950059A (en) * | 1975-06-27 | 1976-04-13 | International Telephone & Telegraph Corporation | Zero force electrical connector |
| DE2804478C2 (de) * | 1978-01-31 | 1982-11-25 | Krone Gmbh, 1000 Berlin | Elektrischer Klemmverbinder zur löt-, schraub- und abisolierfreien Herstellung eines Kontaktes an einem feststehenden Anschlußelement, insbesondere für die Fernmeldelinientechnik |
| DE3063010D1 (en) * | 1979-02-12 | 1983-06-16 | Bohdan Ulrich | Zero insertion force connector for making a disconnectible electrical connexion |
| EP0068547B1 (en) * | 1981-06-22 | 1985-09-18 | THE PROCTER & GAMBLE COMPANY | Mixed peroxyacid bleaches having improved bleaching power |
| US4412934A (en) * | 1982-06-30 | 1983-11-01 | The Procter & Gamble Company | Bleaching compositions |
| JPS5922999A (ja) * | 1982-06-30 | 1984-02-06 | ザ・プロクタ−・エンド・ギヤンブル・カンパニ− | 漂白組成物 |
| DE3377361D1 (en) * | 1982-09-30 | 1988-08-18 | Procter & Gamble | Bleaching compositions |
| ATE23877T1 (de) * | 1982-09-30 | 1986-12-15 | Procter & Gamble | Bleichmittelzusammensetzungen. |
| GB8304990D0 (en) * | 1983-02-23 | 1983-03-30 | Procter & Gamble | Detergent ingredients |
| US4525292A (en) * | 1983-03-07 | 1985-06-25 | Cushman Mark E | Bleaching detergent compositions comprising sulfosuccinate bleach promoters |
| GB8415909D0 (en) * | 1984-06-21 | 1984-07-25 | Procter & Gamble Ltd | Peracid compounds |
| GB8620635D0 (en) * | 1986-08-26 | 1986-10-01 | Unilever Plc | Detergent bleach composition |
| US4751015A (en) * | 1987-03-17 | 1988-06-14 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| US4818426A (en) * | 1987-03-17 | 1989-04-04 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| JPS63315666A (ja) * | 1987-03-23 | 1988-12-23 | 花王株式会社 | 漂白剤組成物 |
| US4933103A (en) * | 1987-03-23 | 1990-06-12 | Kao Corporation | Bleaching composition |
| IT1215739B (it) * | 1988-01-20 | 1990-02-22 | Ausimont Spa | Perossiacidi immido aromatici come agenti sbiancanti. |
| ES2058466T3 (es) * | 1988-03-01 | 1994-11-01 | Unilever Nv | Compuestos de amonio cuaternario para utilizacion en sistemas de blanqueo. |
| US4927559A (en) * | 1988-04-14 | 1990-05-22 | Lever Brothers Company | Low perborate to precursor ratio bleach systems |
-
1989
- 1989-05-10 GB GB898910725A patent/GB8910725D0/en active Pending
-
1990
- 1990-05-02 ES ES90201099T patent/ES2076292T3/es not_active Expired - Lifetime
- 1990-05-02 EP EP90201099A patent/EP0399584B1/en not_active Expired - Lifetime
- 1990-05-02 DE DE69021129T patent/DE69021129T2/de not_active Expired - Lifetime
- 1990-05-03 CA CA002016030A patent/CA2016030C/en not_active Expired - Fee Related
- 1990-05-08 IN IN105/BOM/90A patent/IN171563B/en unknown
- 1990-05-08 AU AU54839/90A patent/AU616356B2/en not_active Ceased
- 1990-05-08 NO NO902032A patent/NO176613C/no unknown
- 1990-05-10 BR BR909002190A patent/BR9002190A/pt not_active IP Right Cessation
- 1990-05-10 ZA ZA903575A patent/ZA903575B/xx unknown
- 1990-05-10 US US07/521,810 patent/US5106528A/en not_active Expired - Fee Related
- 1990-05-10 JP JP2121065A patent/JPH0678556B2/ja not_active Expired - Lifetime
- 1990-05-10 KR KR1019900006572A patent/KR920010476B1/ko not_active Expired
- 1990-06-04 TR TR90/0462A patent/TR24642A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO176613B (no) | 1995-01-23 |
| ES2076292T3 (es) | 1995-11-01 |
| EP0399584A2 (en) | 1990-11-28 |
| NO902032D0 (no) | 1990-05-08 |
| CA2016030A1 (en) | 1990-11-10 |
| JPH0678556B2 (ja) | 1994-10-05 |
| NO902032L (no) | 1990-11-12 |
| EP0399584B1 (en) | 1995-07-26 |
| EP0399584A3 (en) | 1991-09-25 |
| KR920010476B1 (ko) | 1992-11-28 |
| US5106528A (en) | 1992-04-21 |
| AU5483990A (en) | 1990-11-15 |
| BR9002190A (pt) | 1991-08-13 |
| AU616356B2 (en) | 1991-10-24 |
| JPH0317197A (ja) | 1991-01-25 |
| TR24642A (tr) | 1992-01-01 |
| NO176613C (no) | 1995-05-03 |
| KR900018353A (ko) | 1990-12-21 |
| ZA903575B (en) | 1992-01-29 |
| GB8910725D0 (en) | 1989-06-28 |
| IN171563B (enExample) | 1992-11-21 |
| CA2016030C (en) | 1994-12-06 |
| DE69021129D1 (de) | 1995-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69021129T2 (de) | Bleichaktivierung und Bleichmittel-Zusammensetzungen. | |
| DE69222620T2 (de) | Bleichaktivierung unter Verwendung einer Mangan- verbindung und einem organischen Ligand | |
| DE69014384T2 (de) | Bleichaktivierung. | |
| DE68908439T2 (de) | Quatenäre-Ammonium-Verbindungen zur Verwendung in Bleich-Systemen. | |
| DE69216786T2 (de) | Mangan enthaltender Bleichkatalysator und seine Verwendung | |
| DE69125310T2 (de) | Bleichmittelaktivierung | |
| DE3886969T2 (de) | Quartäre Ammonium- oder Phosphonium-Peroxycarbonsäure-Prekursoren und ihre Verwendung in Detergensbleichmittelzusammensetzungen. | |
| DE69229957T2 (de) | Acylierte citratester als ausgangsstoffe für persäuren | |
| DE69705041T2 (de) | Reinigungsverfahren | |
| DE69019781T2 (de) | Bleichmittelzusammensetzung. | |
| DE69324261T2 (de) | Granulare waschmittel mit protease | |
| DE2060762A1 (de) | Mittel zur Herstellung von Kaltbleichflotten,insbesondere von kaltbleichwirksamen Waschlaugen | |
| EP0869171A2 (de) | Bleichaktive Metall-Komplexe | |
| DE69325539T2 (de) | Flüssige Bleichmittelzusammensetzungen | |
| DE3337719A1 (de) | Stabilisierte teilchenfoermige bleich- und waschmittelzusammensetzung | |
| EP0825251A2 (de) | Sulphonylimin-Derivate als Bleichkatalysatoren | |
| EP0909810B1 (de) | Verwendung von Aminonitril-N-oxiden als Bleichaktivatoren | |
| DE2938731C2 (enExample) | ||
| CH655945A5 (de) | Silikatfreie, bleichende waschmittelzusammensetzung. | |
| DE3337750C2 (enExample) | ||
| CH655946A5 (de) | Silikatfreie, bleichende waschmittelzusammensetzung. | |
| DE2756583A1 (de) | Zur textilbehandlung geeignetes, perverbindungen und optische aufheller enthaltendes bleichmittel | |
| EP0930358B1 (de) | Verwendung von Formamidinium-Salzen als Bleichaktivatoren | |
| AT394575B (de) | Bleich- und waschmittel | |
| DE19629159A1 (de) | Nitril-Betaine als Bleichaktivatoren und deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |