DE556775A - - Google Patents
Info
- Publication number
- DE556775A DE556775A DE556775A DE 556775 A DE556775 A DE 556775A DE 556775 A DE556775 A DE 556775A
- Authority
- DE
- Germany
- Prior art keywords
- acetic acid
- reaction
- mercury
- ethylidene diacetate
- acetylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 64
- 229960000583 Acetic Acid Drugs 0.000 claims description 30
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 26
- ACKALUBLCWJVNB-UHFFFAOYSA-N Ethylidene diacetate Chemical compound CC(=O)OC(C)OC(C)=O ACKALUBLCWJVNB-UHFFFAOYSA-N 0.000 claims description 15
- 239000012362 glacial acetic acid Substances 0.000 claims description 13
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 12
- 239000007800 oxidant agent Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052753 mercury Inorganic materials 0.000 claims description 6
- KMUONIBRACKNSN-UHFFFAOYSA-N Potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 claims description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N Ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 229940069002 Potassium Dichromate Drugs 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000007788 liquid Substances 0.000 description 12
- DOBUSJIVSSJEDA-UHFFFAOYSA-L 1,3-dioxa-2$l^{6}-thia-4-mercuracyclobutane 2,2-dioxide Chemical compound [Hg+2].[O-]S([O-])(=O)=O DOBUSJIVSSJEDA-UHFFFAOYSA-L 0.000 description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- KRVSOGSZCMJSLX-UHFFFAOYSA-L Chromic acid Chemical compound O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 4
- GNTDGMZSJNCJKK-UHFFFAOYSA-N Vanadium(V) oxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N acetylene Chemical compound C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000003197 catalytic Effects 0.000 description 3
- 239000012295 chemical reaction liquid Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000004160 Ammonium persulphate Substances 0.000 description 2
- RUTXIHLAWFEWGM-UHFFFAOYSA-H Iron(III) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 description 2
- KIEOKOFEPABQKJ-UHFFFAOYSA-N Sodium dichromate Chemical compound [Na+].[Na+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KIEOKOFEPABQKJ-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 235000019395 ammonium persulphate Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000000875 corresponding Effects 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229940032950 ferric sulfate Drugs 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 229910000360 iron(III) sulfate Inorganic materials 0.000 description 2
- 150000002730 mercury Chemical class 0.000 description 2
- 229910000370 mercury sulfate Inorganic materials 0.000 description 2
- 230000001590 oxidative Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- JYCWUEIZRFNPGA-UHFFFAOYSA-N acetic acid;1-acetyloxyethyl acetate Chemical compound CC(O)=O.CC(=O)OC(C)OC(C)=O JYCWUEIZRFNPGA-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive Effects 0.000 description 1
- YTIJUXVIZLYQTB-UHFFFAOYSA-N bethanidine sulfate Chemical group [O-]S([O-])(=O)=O.CN\C(=[NH+]/C)NCC1=CC=CC=C1.CN\C(=[NH+]/C)NCC1=CC=CC=C1 YTIJUXVIZLYQTB-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910000460 iron oxide Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000717 retained Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 230000002747 voluntary Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2217452B2 (de) | Verfahren zur herstellung von 1,4- diacyloxybuten-(2) | |
| DE3025475A1 (de) | Verfahren zur herstellung von aromatischen dialdehyden | |
| DE2027995A1 (nl) | ||
| DE556775A (nl) | ||
| DE2365131A1 (de) | Verfahren zur herstellung von p-nitrobenzoesaeure | |
| DE3734469C2 (de) | Verfahren zur Herstellung von Pyromellitsäure | |
| DE2521324C2 (de) | Verfahren zur Herstellung eines Hydroperoxids | |
| DE69800265T2 (de) | Verfahren zur Hydroxylierung von aromatischen Kohlenwasserstoffen | |
| DE2836327A1 (de) | Verfahren zur herstellung von arylglyoxylsaeuren | |
| DE2321003C2 (de) | Verfahren zur Herstellung von 5- Nitro-naphthochinon-(1,4) | |
| DE3028757C2 (de) | Verfahren zur Herstellung von p-tert.-Butylbenzaldehyd | |
| DE175295C (nl) | ||
| DE3003656A1 (de) | Verfahren zur herstellung von 1,4-diamo-2,3-dicyano-anthrachinon | |
| DE2112938B2 (de) | Verfahren zur Herstellung ungesättigter Fettsäuren aus den entsprechenden ungesättigten aliphatischen Aldehyden | |
| DE2502332A1 (de) | Verfahren zur herstellung von trimethylbenzochinon | |
| DE2834557A1 (de) | Verfahren zur herstellung eines cyclopentendions | |
| DE2160649A1 (de) | Verfahren zur herstellung von allylacetat | |
| EP0073464A1 (de) | Verfahren zur Herstellung von Naphthalintetracarbonsäure-1,4,5,8 | |
| DE60104384T2 (de) | Verfahren zur Herstellung von Sauerstoff-enthaltenden aromatischen Verbindungen | |
| RU2614153C1 (ru) | Способ получения 2-метил-1,4-нафтохинона | |
| DE2702088A1 (de) | Verfahren zur autoxidation eines cycloalkanons zu dem entsprechenden cycloalkan-1,2-dion | |
| DE207702C (nl) | ||
| DE923249C (de) | Verfahren zur Herstellung von p-Xylylendichlorid | |
| DE305997A (nl) | ||
| DE2534944B2 (de) | Verfahren zur Herstellung von Äthylenoxid |