DE4316622A1 - 3-(Carboxymethoxyphenyl)benzofuran-2-one als Stabilisatoren - Google Patents
3-(Carboxymethoxyphenyl)benzofuran-2-one als StabilisatorenInfo
- Publication number
- DE4316622A1 DE4316622A1 DE4316622A DE4316622A DE4316622A1 DE 4316622 A1 DE4316622 A1 DE 4316622A1 DE 4316622 A DE4316622 A DE 4316622A DE 4316622 A DE4316622 A DE 4316622A DE 4316622 A1 DE4316622 A1 DE 4316622A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogen
- alkoxy
- independently
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000003381 stabilizer Substances 0.000 title description 9
- BUPAPANYJUHHIE-UHFFFAOYSA-N 2-[2-(2-oxo-3h-1-benzofuran-3-yl)phenoxy]acetic acid Chemical class OC(=O)COC1=CC=CC=C1C1C2=CC=CC=C2OC1=O BUPAPANYJUHHIE-UHFFFAOYSA-N 0.000 title description 5
- -1 cyclohexylidene ring Chemical group 0.000 claims description 129
- 239000001257 hydrogen Substances 0.000 claims description 118
- 229910052739 hydrogen Inorganic materials 0.000 claims description 118
- 150000001875 compounds Chemical class 0.000 claims description 72
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 64
- 150000002431 hydrogen Chemical class 0.000 claims description 54
- 239000000203 mixture Substances 0.000 claims description 47
- 125000003545 alkoxy group Chemical group 0.000 claims description 35
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 35
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 35
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 32
- 229910052760 oxygen Inorganic materials 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 28
- 239000001301 oxygen Substances 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 229910052717 sulfur Inorganic materials 0.000 claims description 20
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 19
- 239000011593 sulfur Substances 0.000 claims description 19
- 125000000951 phenoxy group Chemical class [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 17
- 125000004423 acyloxy group Chemical group 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 13
- 239000011368 organic material Substances 0.000 claims description 13
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 11
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 9
- 230000015556 catabolic process Effects 0.000 claims description 8
- 238000006731 degradation reaction Methods 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 230000001590 oxidative effect Effects 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 6
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical compound [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 claims description 6
- 150000001768 cations Chemical class 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- GJVFBWCTGUSGDD-UHFFFAOYSA-L pentamethonium bromide Chemical compound [Br-].[Br-].C[N+](C)(C)CCCCC[N+](C)(C)C GJVFBWCTGUSGDD-UHFFFAOYSA-L 0.000 claims description 4
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical compound OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 claims description 4
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- 125000004642 (C1-C12) alkoxy group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229920001059 synthetic polymer Polymers 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 description 32
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 31
- 150000003254 radicals Chemical class 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 229920000642 polymer Polymers 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000004743 Polypropylene Substances 0.000 description 12
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 239000004952 Polyamide Substances 0.000 description 11
- 229920002647 polyamide Polymers 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 10
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229920002857 polybutadiene Polymers 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000005062 Polybutadiene Substances 0.000 description 8
- 239000004698 Polyethylene Substances 0.000 description 8
- 229920001684 low density polyethylene Polymers 0.000 description 8
- 239000004702 low-density polyethylene Substances 0.000 description 8
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 8
- 229920000573 polyethylene Polymers 0.000 description 8
- 229920001155 polypropylene Polymers 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 7
- 229920000098 polyolefin Polymers 0.000 description 7
- ISWSIWMERMANOR-UHFFFAOYSA-N 2-[4-(carboxymethoxy)phenyl]-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CC=C(OCC(O)=O)C=C1 ISWSIWMERMANOR-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000004417 polycarbonate Substances 0.000 description 6
- 239000004800 polyvinyl chloride Substances 0.000 description 6
- 229920000915 polyvinyl chloride Polymers 0.000 description 6
- ICKWICRCANNIBI-UHFFFAOYSA-N 2,4-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(C(C)(C)C)=C1 ICKWICRCANNIBI-UHFFFAOYSA-N 0.000 description 5
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 5
- 229920002943 EPDM rubber Polymers 0.000 description 5
- 239000004721 Polyphenylene oxide Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 150000001993 dienes Chemical class 0.000 description 5
- 229920001903 high density polyethylene Polymers 0.000 description 5
- 239000004700 high-density polyethylene Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229920006324 polyoxymethylene Polymers 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 4
- KXPXKNBDCUOENF-UHFFFAOYSA-N 2-(Octylthio)ethanol Chemical compound CCCCCCCCSCCO KXPXKNBDCUOENF-UHFFFAOYSA-N 0.000 description 4
- IEUQSYIPXJRBDP-UHFFFAOYSA-N 2-[4-(5-methyl-2-oxo-3h-1-benzofuran-3-yl)phenoxy]acetic acid Chemical compound C12=CC(C)=CC=C2OC(=O)C1C1=CC=C(OCC(O)=O)C=C1 IEUQSYIPXJRBDP-UHFFFAOYSA-N 0.000 description 4
- ZPIRWAHWDCHWLM-UHFFFAOYSA-N 2-dodecylsulfanylethanol Chemical compound CCCCCCCCCCCCSCCO ZPIRWAHWDCHWLM-UHFFFAOYSA-N 0.000 description 4
- ACZGCWSMSTYWDQ-UHFFFAOYSA-N 3h-1-benzofuran-2-one Chemical class C1=CC=C2OC(=O)CC2=C1 ACZGCWSMSTYWDQ-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 229920000877 Melamine resin Polymers 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 4
- RKMFOPZDMRUMNG-UHFFFAOYSA-N ethyl 2-[4-(5,7-ditert-butyl-2-oxo-3h-1-benzofuran-3-yl)phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCC)=CC=C1C1C(C=C(C=C2C(C)(C)C)C(C)(C)C)=C2OC1=O RKMFOPZDMRUMNG-UHFFFAOYSA-N 0.000 description 4
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 4
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 4
- 150000002815 nickel Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 229920000570 polyether Polymers 0.000 description 4
- 229920006380 polyphenylene oxide Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- 235000013772 propylene glycol Nutrition 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- 229920001169 thermoplastic Polymers 0.000 description 4
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 4
- 229940113165 trimethylolpropane Drugs 0.000 description 4
- ALVZNPYWJMLXKV-UHFFFAOYSA-N 1,9-Nonanediol Chemical compound OCCCCCCCCCO ALVZNPYWJMLXKV-UHFFFAOYSA-N 0.000 description 3
- YEWBOZCFGXOUQW-UHFFFAOYSA-N 2,6,7-trioxa-1-phosphabicyclo[2.2.2]octan-4-ylmethanol Chemical compound C1OP2OCC1(CO)CO2 YEWBOZCFGXOUQW-UHFFFAOYSA-N 0.000 description 3
- RBQYTVXHDIGUCS-UHFFFAOYSA-N 2-hydroxy-2-(4-hydroxy-3-methylphenyl)acetic acid Chemical compound CC1=CC(C(O)C(O)=O)=CC=C1O RBQYTVXHDIGUCS-UHFFFAOYSA-N 0.000 description 3
- CKPKHTKLLYPGFM-UHFFFAOYSA-N 6,6-dimethylheptane-1,1-diol Chemical compound CC(CCCCC(O)O)(C)C CKPKHTKLLYPGFM-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- 229920002396 Polyurea Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- FQUNFJULCYSSOP-UHFFFAOYSA-N bisoctrizole Chemical compound N1=C2C=CC=CC2=NN1C1=CC(C(C)(C)CC(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)CC(C)(C)C)N2N=C3C=CC=CC3=N2)O)=C1O FQUNFJULCYSSOP-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 150000005673 monoalkenes Chemical class 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- FPQJEXTVQZHURJ-UHFFFAOYSA-N n,n'-bis(2-hydroxyethyl)oxamide Chemical compound OCCNC(=O)C(=O)NCCO FPQJEXTVQZHURJ-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 2
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 2
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 2
- SLUKQUGVTITNSY-UHFFFAOYSA-N 2,6-di-tert-butyl-4-methoxyphenol Chemical compound COC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SLUKQUGVTITNSY-UHFFFAOYSA-N 0.000 description 2
- ZCFQQYZWZNXBBC-UHFFFAOYSA-N 2-[4-(carboxymethoxy)-3-methylphenyl]-2-hydroxyacetic acid Chemical compound CC1=CC(C(O)C(O)=O)=CC=C1OCC(O)=O ZCFQQYZWZNXBBC-UHFFFAOYSA-N 0.000 description 2
- RXFCIXRFAJRBSG-UHFFFAOYSA-N 3,2,3-tetramine Chemical compound NCCCNCCNCCCN RXFCIXRFAJRBSG-UHFFFAOYSA-N 0.000 description 2
- WPMYUUITDBHVQZ-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O WPMYUUITDBHVQZ-UHFFFAOYSA-N 0.000 description 2
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 229920010126 Linear Low Density Polyethylene (LLDPE) Polymers 0.000 description 2
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- JKIJEFPNVSHHEI-UHFFFAOYSA-N Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP(OC=1C(=CC(=CC=1)C(C)(C)C)C(C)(C)C)OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C JKIJEFPNVSHHEI-UHFFFAOYSA-N 0.000 description 2
- 229920002367 Polyisobutene Polymers 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- CDJJKTLOZJAGIZ-UHFFFAOYSA-N Tolylacetate Chemical compound CC(=O)OC1=CC=C(C)C=C1 CDJJKTLOZJAGIZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000012964 benzotriazole Substances 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical class OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229920000554 ionomer Polymers 0.000 description 2
- 238000004898 kneading Methods 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 229920000092 linear low density polyethylene Polymers 0.000 description 2
- 239000004707 linear low-density polyethylene Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- UJRDRFZCRQNLJM-UHFFFAOYSA-N methyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OC)=CC(N2N=C3C=CC=CC3=N2)=C1O UJRDRFZCRQNLJM-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical compound C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 2
- 229920003052 natural elastomer Polymers 0.000 description 2
- 229920001194 natural rubber Polymers 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- VRCGRXGGTFUMIF-UHFFFAOYSA-N octadecan-4-yl 2-[3-methyl-5-(7-methyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]acetate Chemical compound CC=1C=C(C=C(C=1)C1C(OC2=C1C=CC=C2C)=O)OCC(=O)OC(CCC)CCCCCCCCCCCCCC VRCGRXGGTFUMIF-UHFFFAOYSA-N 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N perisophthalic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- ZQBAKBUEJOMQEX-UHFFFAOYSA-N phenyl salicylate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=CC=C1 ZQBAKBUEJOMQEX-UHFFFAOYSA-N 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 229920001281 polyalkylene Polymers 0.000 description 2
- 229920001707 polybutylene terephthalate Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 229920001228 polyisocyanate Polymers 0.000 description 2
- 239000005056 polyisocyanate Substances 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920000638 styrene acrylonitrile Polymers 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 description 2
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 description 1
- OUBISKKOUYNDML-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) 2-[bis[2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]amino]acetate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CN(CC(=O)OC1CC(C)(C)NC(C)(C)C1)CC(=O)OC1CC(C)(C)NC(C)(C)C1 OUBISKKOUYNDML-UHFFFAOYSA-N 0.000 description 1
- BJGZXKKYBXZLAM-UHFFFAOYSA-N (2,4-ditert-butyl-6-methylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CC1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1OC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 BJGZXKKYBXZLAM-UHFFFAOYSA-N 0.000 description 1
- KJYSXRBJOSZLEL-UHFFFAOYSA-N (2,4-ditert-butylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 KJYSXRBJOSZLEL-UHFFFAOYSA-N 0.000 description 1
- HQEPZWYPQQKFLU-UHFFFAOYSA-N (2,6-dihydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC(O)=C1C(=O)C1=CC=CC=C1 HQEPZWYPQQKFLU-UHFFFAOYSA-N 0.000 description 1
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- ATLWFAZCZPSXII-UHFFFAOYSA-N (2-octylphenyl) 2-hydroxybenzoate Chemical compound CCCCCCCCC1=CC=CC=C1OC(=O)C1=CC=CC=C1O ATLWFAZCZPSXII-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- WBSRIXCTCFFHEF-UHFFFAOYSA-N (3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid Chemical compound CCOP(O)(=O)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 WBSRIXCTCFFHEF-UHFFFAOYSA-N 0.000 description 1
- GOZHNJTXLALKRL-UHFFFAOYSA-N (5-benzoyl-2,4-dihydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(O)=C(C(=O)C=2C=CC=CC=2)C=C1C(=O)C1=CC=CC=C1 GOZHNJTXLALKRL-UHFFFAOYSA-N 0.000 description 1
- IFKPLJWIEQBPGG-QGZVFWFLSA-N (5s)-6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one Chemical compound C=1C=CC=CC=1C([C@H](C)CN(C)C)(C(=O)CC)C1=CC=CC=C1 IFKPLJWIEQBPGG-QGZVFWFLSA-N 0.000 description 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- VCMZIKKVYXGKCI-UHFFFAOYSA-N 1,1-bis(2,4-ditert-butyl-6-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O.C(C)(C)(C)C1=C(C(=CC(=C1)C(C)(C)C)C)C(O)(C(CO)(CO)CO)C1=C(C=C(C=C1C)C(C)(C)C)C(C)(C)C VCMZIKKVYXGKCI-UHFFFAOYSA-N 0.000 description 1
- RMCLVYNUTRHDDI-UHFFFAOYSA-N 1,1-dichloroethene;ethenyl acetate Chemical compound ClC(Cl)=C.CC(=O)OC=C RMCLVYNUTRHDDI-UHFFFAOYSA-N 0.000 description 1
- BPXVHIRIPLPOPT-UHFFFAOYSA-N 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound OCCN1C(=O)N(CCO)C(=O)N(CCO)C1=O BPXVHIRIPLPOPT-UHFFFAOYSA-N 0.000 description 1
- VNQNXQYZMPJLQX-UHFFFAOYSA-N 1,3,5-tris[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CN2C(N(CC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C(=O)N(CC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C2=O)=O)=C1 VNQNXQYZMPJLQX-UHFFFAOYSA-N 0.000 description 1
- MYMKXVFDVQUQLG-UHFFFAOYSA-N 1,3,7,9-tetratert-butyl-11-fluoro-5-methyl-5h-benzo[d][1,3,2]benzodioxaphosphocine Chemical compound CC1C2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2OP(F)OC2=C1C=C(C(C)(C)C)C=C2C(C)(C)C MYMKXVFDVQUQLG-UHFFFAOYSA-N 0.000 description 1
- JDLQSLMTBGPZLW-UHFFFAOYSA-N 1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC(O)N1C(C)(C)CC(O)CC1(C)C JDLQSLMTBGPZLW-UHFFFAOYSA-N 0.000 description 1
- MQQKTNDBASEZSD-UHFFFAOYSA-N 1-(octadecyldisulfanyl)octadecane Chemical compound CCCCCCCCCCCCCCCCCCSSCCCCCCCCCCCCCCCCCC MQQKTNDBASEZSD-UHFFFAOYSA-N 0.000 description 1
- KEXRSLVRFLEMHJ-UHFFFAOYSA-N 1-o,4-o-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl] benzene-1,4-dicarbothioate Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C)=C1COC(=S)C1=CC=C(C(=S)OCC=2C(=C(O)C(=CC=2C)C(C)(C)C)C)C=C1 KEXRSLVRFLEMHJ-UHFFFAOYSA-N 0.000 description 1
- WGCOJSGVXOMWKK-UHFFFAOYSA-N 10-(2,2-diphenylhydrazinyl)-10-oxodecanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCCCC(=O)O)=O)C1=CC=CC=C1 WGCOJSGVXOMWKK-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- TUYBEVLJKZQJPO-UHFFFAOYSA-N 19-(3,5-ditert-butyl-4-hydroxyphenyl)heptatriacontan-19-ylphosphonic acid Chemical compound CCCCCCCCCCCCCCCCCCC(CCCCCCCCCCCCCCCCCC)(P(O)(O)=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 TUYBEVLJKZQJPO-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 description 1
- UUAIOYWXCDLHKT-UHFFFAOYSA-N 2,4,6-tricyclohexylphenol Chemical compound OC1=C(C2CCCCC2)C=C(C2CCCCC2)C=C1C1CCCCC1 UUAIOYWXCDLHKT-UHFFFAOYSA-N 0.000 description 1
- OSPBEQGPLJSTKW-UHFFFAOYSA-N 2,4,6-tris[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CC=2C=C(CC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C(O)=C(CC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C=2)=C1 OSPBEQGPLJSTKW-UHFFFAOYSA-N 0.000 description 1
- LXWZXEJDKYWBOW-UHFFFAOYSA-N 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)C)C(C)(C)C)O)=C1O LXWZXEJDKYWBOW-UHFFFAOYSA-N 0.000 description 1
- CZNRFEXEPBITDS-UHFFFAOYSA-N 2,5-bis(2-methylbutan-2-yl)benzene-1,4-diol Chemical compound CCC(C)(C)C1=CC(O)=C(C(C)(C)CC)C=C1O CZNRFEXEPBITDS-UHFFFAOYSA-N 0.000 description 1
- JZODKRWQWUWGCD-UHFFFAOYSA-N 2,5-di-tert-butylbenzene-1,4-diol Chemical compound CC(C)(C)C1=CC(O)=C(C(C)(C)C)C=C1O JZODKRWQWUWGCD-UHFFFAOYSA-N 0.000 description 1
- HZSSKAQAXMTSHT-UHFFFAOYSA-N 2,5-ditert-butyl-4-(dimethoxyphosphorylmethyl)phenol Chemical compound COP(=O)(OC)CC1=CC(C(C)(C)C)=C(O)C=C1C(C)(C)C HZSSKAQAXMTSHT-UHFFFAOYSA-N 0.000 description 1
- FLLRQABPKFCXSO-UHFFFAOYSA-N 2,5-ditert-butyl-4-methoxyphenol Chemical compound COC1=CC(C(C)(C)C)=C(O)C=C1C(C)(C)C FLLRQABPKFCXSO-UHFFFAOYSA-N 0.000 description 1
- JFGVTUJBHHZRAB-UHFFFAOYSA-N 2,6-Di-tert-butyl-1,4-benzenediol Chemical compound CC(C)(C)C1=CC(O)=CC(C(C)(C)C)=C1O JFGVTUJBHHZRAB-UHFFFAOYSA-N 0.000 description 1
- LKALLEFLBKHPTQ-UHFFFAOYSA-N 2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound OC=1C(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=CC(C)=CC=1CC1=CC(C)=CC(C(C)(C)C)=C1O LKALLEFLBKHPTQ-UHFFFAOYSA-N 0.000 description 1
- FRAQIHUDFAFXHT-UHFFFAOYSA-N 2,6-dicyclopentyl-4-methylphenol Chemical compound OC=1C(C2CCCC2)=CC(C)=CC=1C1CCCC1 FRAQIHUDFAFXHT-UHFFFAOYSA-N 0.000 description 1
- JBYWTKPHBLYYFJ-UHFFFAOYSA-N 2,6-ditert-butyl-4-(2-methylpropyl)phenol Chemical compound CC(C)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 JBYWTKPHBLYYFJ-UHFFFAOYSA-N 0.000 description 1
- GJDRKHHGPHLVNI-UHFFFAOYSA-N 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol Chemical compound CCOP(=O)(OCC)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 GJDRKHHGPHLVNI-UHFFFAOYSA-N 0.000 description 1
- SCXYLTWTWUGEAA-UHFFFAOYSA-N 2,6-ditert-butyl-4-(methoxymethyl)phenol Chemical compound COCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SCXYLTWTWUGEAA-UHFFFAOYSA-N 0.000 description 1
- UDFARPRXWMDFQU-UHFFFAOYSA-N 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanylmethyl]phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CSCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 UDFARPRXWMDFQU-UHFFFAOYSA-N 0.000 description 1
- QHPKIUDQDCWRKO-UHFFFAOYSA-N 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C(C)(C)C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 QHPKIUDQDCWRKO-UHFFFAOYSA-N 0.000 description 1
- FURXDDVXYNEWJD-UHFFFAOYSA-N 2,6-ditert-butyl-4-[[4-(3,5-ditert-butyl-4-hydroxyanilino)-6-octylsulfanyl-1,3,5-triazin-2-yl]amino]phenol Chemical compound N=1C(NC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=NC(SCCCCCCCC)=NC=1NC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FURXDDVXYNEWJD-UHFFFAOYSA-N 0.000 description 1
- HWRLEEPNFJNTOP-UHFFFAOYSA-N 2-(1,3,5-triazin-2-yl)phenol Chemical class OC1=CC=CC=C1C1=NC=NC=N1 HWRLEEPNFJNTOP-UHFFFAOYSA-N 0.000 description 1
- IFPIHVZNAFBOTF-UHFFFAOYSA-N 2-(2-benzylidenehydrazinyl)-2-oxoacetic acid Chemical compound C(C1=CC=CC=C1)=NNC(C(=O)O)=O IFPIHVZNAFBOTF-UHFFFAOYSA-N 0.000 description 1
- LBOGPIWNHXHYHN-UHFFFAOYSA-N 2-(2-hydroxy-5-octylphenyl)sulfanyl-4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C(SC=2C(=CC=C(CCCCCCCC)C=2)O)=C1 LBOGPIWNHXHYHN-UHFFFAOYSA-N 0.000 description 1
- QLMGIWHWWWXXME-UHFFFAOYSA-N 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid Chemical compound CC(C)(C)C1=CC(CC(O)=O)=CC(C(C)(C)C)=C1O QLMGIWHWWWXXME-UHFFFAOYSA-N 0.000 description 1
- ZXJZIWIQBGXJFL-UHFFFAOYSA-N 2-(3,5-ditert-butyl-4-hydroxyphenyl)octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 ZXJZIWIQBGXJFL-UHFFFAOYSA-N 0.000 description 1
- ZMWRRFHBXARRRT-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol Chemical compound CCC(C)(C)C1=CC(C(C)(C)CC)=CC(N2N=C3C=CC=CC3=N2)=C1O ZMWRRFHBXARRRT-UHFFFAOYSA-N 0.000 description 1
- OLFNXLXEGXRUOI-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4,6-bis(2-phenylpropan-2-yl)phenol Chemical compound C=1C(N2N=C3C=CC=CC3=N2)=C(O)C(C(C)(C)C=2C=CC=CC=2)=CC=1C(C)(C)C1=CC=CC=C1 OLFNXLXEGXRUOI-UHFFFAOYSA-N 0.000 description 1
- LHPPDQUVECZQSW-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=CC=CC3=N2)=C1O LHPPDQUVECZQSW-UHFFFAOYSA-N 0.000 description 1
- IYAZLDLPUNDVAG-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 IYAZLDLPUNDVAG-UHFFFAOYSA-N 0.000 description 1
- WXHVQMGINBSVAY-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 WXHVQMGINBSVAY-UHFFFAOYSA-N 0.000 description 1
- RTNVDKBRTXEWQE-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-6-butan-2-yl-4-tert-butylphenol Chemical compound CCC(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=CC=CC3=N2)=C1O RTNVDKBRTXEWQE-UHFFFAOYSA-N 0.000 description 1
- FJGQBLRYBUAASW-UHFFFAOYSA-N 2-(benzotriazol-2-yl)phenol Chemical class OC1=CC=CC=C1N1N=C2C=CC=CC2=N1 FJGQBLRYBUAASW-UHFFFAOYSA-N 0.000 description 1
- XQESJWNDTICJHW-UHFFFAOYSA-N 2-[(2-hydroxy-5-methyl-3-nonylphenyl)methyl]-4-methyl-6-nonylphenol Chemical compound CCCCCCCCCC1=CC(C)=CC(CC=2C(=C(CCCCCCCCC)C=C(C)C=2)O)=C1O XQESJWNDTICJHW-UHFFFAOYSA-N 0.000 description 1
- YQQAAUCBTNZUQQ-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)butyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(CCC)C1=CC(C)=CC(C)=C1O YQQAAUCBTNZUQQ-UHFFFAOYSA-N 0.000 description 1
- WQYFETFRIRDUPJ-UHFFFAOYSA-N 2-[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfanyl-4-(2,4,4-trimethylpentan-2-yl)phenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(SC=2C(=CC=C(C=2)C(C)(C)CC(C)(C)C)O)=C1 WQYFETFRIRDUPJ-UHFFFAOYSA-N 0.000 description 1
- FESJNIGBEZWAIB-UHFFFAOYSA-N 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(2-hydroxy-3-octoxypropoxy)phenol Chemical compound OC1=CC(OCC(O)COCCCCCCCC)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(C)=CC=2)C)=N1 FESJNIGBEZWAIB-UHFFFAOYSA-N 0.000 description 1
- BZQCIHBFVOTXRU-UHFFFAOYSA-N 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(3-butoxy-2-hydroxypropoxy)phenol Chemical compound OC1=CC(OCC(O)COCCCC)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(C)=CC=2)C)=N1 BZQCIHBFVOTXRU-UHFFFAOYSA-N 0.000 description 1
- ZSSVCEUEVMALRD-UHFFFAOYSA-N 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(octyloxy)phenol Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(C)=CC=2)C)=N1 ZSSVCEUEVMALRD-UHFFFAOYSA-N 0.000 description 1
- DBYBHKQEHCYBQV-UHFFFAOYSA-N 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-dodecoxyphenol Chemical compound OC1=CC(OCCCCCCCCCCCC)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(C)=CC=2)C)=N1 DBYBHKQEHCYBQV-UHFFFAOYSA-N 0.000 description 1
- WPMUMRCRKFBYIH-UHFFFAOYSA-N 2-[4,6-bis(2-hydroxy-4-octoxyphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C1=NC(C=2C(=CC(OCCCCCCCC)=CC=2)O)=NC(C=2C(=CC(OCCCCCCCC)=CC=2)O)=N1 WPMUMRCRKFBYIH-UHFFFAOYSA-N 0.000 description 1
- NPUPWUDXQCOMBF-UHFFFAOYSA-N 2-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C1=NC(C=2C=CC(C)=CC=2)=NC(C=2C=CC(C)=CC=2)=N1 NPUPWUDXQCOMBF-UHFFFAOYSA-N 0.000 description 1
- HHIVRACNDKRDTF-UHFFFAOYSA-N 2-[4-(2,4-dimethylphenyl)-6-(2-hydroxy-4-propoxyphenyl)-1,3,5-triazin-2-yl]-5-propoxyphenol Chemical compound OC1=CC(OCCC)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(OCCC)=CC=2)O)=N1 HHIVRACNDKRDTF-UHFFFAOYSA-N 0.000 description 1
- NMPOCXMHBVMRLO-UHFFFAOYSA-N 2-[4-(5,7-ditert-butyl-2-oxo-3h-1-benzofuran-3-yl)phenoxy]acetic acid Chemical compound O=C1OC=2C(C(C)(C)C)=CC(C(C)(C)C)=CC=2C1C1=CC=C(OCC(O)=O)C=C1 NMPOCXMHBVMRLO-UHFFFAOYSA-N 0.000 description 1
- LUPNPYPXTUHIEW-UHFFFAOYSA-N 2-[4-(carboxymethoxy)-3,5-dimethylphenyl]-2-hydroxyacetic acid Chemical compound CC1=CC(C(O)C(O)=O)=CC(C)=C1OCC(O)=O LUPNPYPXTUHIEW-UHFFFAOYSA-N 0.000 description 1
- XUQNLOIVFHUMTR-UHFFFAOYSA-N 2-[[2-hydroxy-5-nonyl-3-(1-phenylethyl)phenyl]methyl]-4-nonyl-6-(1-phenylethyl)phenol Chemical compound OC=1C(C(C)C=2C=CC=CC=2)=CC(CCCCCCCCC)=CC=1CC(C=1O)=CC(CCCCCCCCC)=CC=1C(C)C1=CC=CC=C1 XUQNLOIVFHUMTR-UHFFFAOYSA-N 0.000 description 1
- HHPDFYDITNAMAM-UHFFFAOYSA-N 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol Chemical compound OCCN(CCO)C1CCCCC1 HHPDFYDITNAMAM-UHFFFAOYSA-N 0.000 description 1
- UIXRDRQSWYSVNK-UHFFFAOYSA-N 2-butyl-4,6-dimethylphenol Chemical compound CCCCC1=CC(C)=CC(C)=C1O UIXRDRQSWYSVNK-UHFFFAOYSA-N 0.000 description 1
- AKNMPWVTPUHKCG-UHFFFAOYSA-N 2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound OC=1C(C2CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1CCCCC1 AKNMPWVTPUHKCG-UHFFFAOYSA-N 0.000 description 1
- NCWTZPKMFNRUAK-UHFFFAOYSA-N 2-ethyl-4,6-bis(octylsulfanylmethyl)phenol Chemical compound CCCCCCCCSCC1=CC(CC)=C(O)C(CSCCCCCCCC)=C1 NCWTZPKMFNRUAK-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- LHHLLQVLJAUUDT-UHFFFAOYSA-N 2-ethylhexyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OCC(CC)CCCC)=CC(N2N=C3C=CC=CC3=N2)=C1O LHHLLQVLJAUUDT-UHFFFAOYSA-N 0.000 description 1
- AWEVLIFGIMIQHY-UHFFFAOYSA-N 2-ethylhexyl 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OCC(CC)CCCC)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O AWEVLIFGIMIQHY-UHFFFAOYSA-N 0.000 description 1
- RZEFQGHPKYOLKG-UHFFFAOYSA-N 2-hydroxy-2-(4-hydroxy-3,5-dimethylphenyl)acetic acid Chemical compound CC1=CC(C(O)C(O)=O)=CC(C)=C1O RZEFQGHPKYOLKG-UHFFFAOYSA-N 0.000 description 1
- OMCYEZUIYGPHDJ-UHFFFAOYSA-N 2-hydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide Chemical compound OC1=CC=CC=C1C=NNC(=O)C1=CC=CC=C1O OMCYEZUIYGPHDJ-UHFFFAOYSA-N 0.000 description 1
- UORSDGBOJHYJLV-UHFFFAOYSA-N 2-hydroxy-n'-(2-hydroxybenzoyl)benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)C1=CC=CC=C1O UORSDGBOJHYJLV-UHFFFAOYSA-N 0.000 description 1
- MZZYGYNZAOVRTG-UHFFFAOYSA-N 2-hydroxy-n-(1h-1,2,4-triazol-5-yl)benzamide Chemical compound OC1=CC=CC=C1C(=O)NC1=NC=NN1 MZZYGYNZAOVRTG-UHFFFAOYSA-N 0.000 description 1
- GAODDBNJCKQQDY-UHFFFAOYSA-N 2-methyl-4,6-bis(octylsulfanylmethyl)phenol Chemical compound CCCCCCCCSCC1=CC(C)=C(O)C(CSCCCCCCCC)=C1 GAODDBNJCKQQDY-UHFFFAOYSA-N 0.000 description 1
- VSKJLJHPAFKHBX-UHFFFAOYSA-N 2-methylbuta-1,3-diene;styrene Chemical compound CC(=C)C=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 VSKJLJHPAFKHBX-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZMNKLZZCQGIIOV-UHFFFAOYSA-N 2-n,2-n'-bis(2-hydroxybenzoyl)ethanedihydrazide Chemical compound C=1C=CC=C(O)C=1C(=O)N(C(=O)C(=O)NN)NC(=O)C1=CC=CC=C1O ZMNKLZZCQGIIOV-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- ZYJXQDCMXTWHIV-UHFFFAOYSA-N 2-tert-butyl-4,6-bis(octylsulfanylmethyl)phenol Chemical compound CCCCCCCCSCC1=CC(CSCCCCCCCC)=C(O)C(C(C)(C)C)=C1 ZYJXQDCMXTWHIV-UHFFFAOYSA-N 0.000 description 1
- YFHKLSPMRRWLKI-UHFFFAOYSA-N 2-tert-butyl-4-(3-tert-butyl-4-hydroxy-5-methylphenyl)sulfanyl-6-methylphenol Chemical compound CC(C)(C)C1=C(O)C(C)=CC(SC=2C=C(C(O)=C(C)C=2)C(C)(C)C)=C1 YFHKLSPMRRWLKI-UHFFFAOYSA-N 0.000 description 1
- HXIQYSLFEXIOAV-UHFFFAOYSA-N 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1SC1=CC(C(C)(C)C)=C(O)C=C1C HXIQYSLFEXIOAV-UHFFFAOYSA-N 0.000 description 1
- BCHSGIGAOYQMPC-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)-3-dodecylsulfanylbutyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CC(C)SCCCCCCCCCCCC)C1=CC(C(C)(C)C)=C(O)C=C1C BCHSGIGAOYQMPC-UHFFFAOYSA-N 0.000 description 1
- PFANXOISJYKQRP-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CCC)C1=CC(C(C)(C)C)=C(O)C=C1C PFANXOISJYKQRP-UHFFFAOYSA-N 0.000 description 1
- JJBOJSJSDIRUGY-UHFFFAOYSA-N 2-tert-butyl-4-[2-(5-tert-butyl-4-hydroxy-2-methylphenyl)-4-dodecylsulfanylbutan-2-yl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)(CCSCCCCCCCCCCCC)C1=CC(C(C)(C)C)=C(O)C=C1C JJBOJSJSDIRUGY-UHFFFAOYSA-N 0.000 description 1
- XMUNJUUYEJAAHG-UHFFFAOYSA-N 2-tert-butyl-5-methyl-4-[1,5,5-tris(5-tert-butyl-4-hydroxy-2-methylphenyl)pentyl]phenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1C(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)CCCC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C XMUNJUUYEJAAHG-UHFFFAOYSA-N 0.000 description 1
- MQWCQFCZUNBTCM-UHFFFAOYSA-N 2-tert-butyl-6-(3-tert-butyl-2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol Chemical compound CC(C)(C)C1=CC(C)=CC(SC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O MQWCQFCZUNBTCM-UHFFFAOYSA-N 0.000 description 1
- GPNYZBKIGXGYNU-UHFFFAOYSA-N 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)methyl]-4-ethylphenol Chemical compound CC(C)(C)C1=CC(CC)=CC(CC=2C(=C(C=C(CC)C=2)C(C)(C)C)O)=C1O GPNYZBKIGXGYNU-UHFFFAOYSA-N 0.000 description 1
- UHLYPUYAVHSKBN-UHFFFAOYSA-N 2-tert-butyl-6-[1-[3-tert-butyl-2-hydroxy-5-(2-methylpropyl)phenyl]ethyl]-4-(2-methylpropyl)phenol Chemical compound CC(C)(C)C1=CC(CC(C)C)=CC(C(C)C=2C(=C(C=C(CC(C)C)C=2)C(C)(C)C)O)=C1O UHLYPUYAVHSKBN-UHFFFAOYSA-N 0.000 description 1
- BKZXZGWHTRCFPX-UHFFFAOYSA-N 2-tert-butyl-6-methylphenol Chemical compound CC1=CC=CC(C(C)(C)C)=C1O BKZXZGWHTRCFPX-UHFFFAOYSA-N 0.000 description 1
- GUCMKIKYKIHUTM-UHFFFAOYSA-N 3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one Chemical compound O=C1C(C)(C)NC(C)(C)CN1CCN1C(=O)C(C)(C)NC(C)(C)C1 GUCMKIKYKIHUTM-UHFFFAOYSA-N 0.000 description 1
- SHDUFLICMXOBPA-UHFFFAOYSA-N 3,9-bis(2,4,6-tritert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1OP1OCC2(COP(OC=3C(=CC(=CC=3C(C)(C)C)C(C)(C)C)C(C)(C)C)OC2)CO1 SHDUFLICMXOBPA-UHFFFAOYSA-N 0.000 description 1
- AIBRSVLEQRWAEG-UHFFFAOYSA-N 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP1OCC2(COP(OC=3C(=CC(=CC=3)C(C)(C)C)C(C)(C)C)OC2)CO1 AIBRSVLEQRWAEG-UHFFFAOYSA-N 0.000 description 1
- SSADPHQCUURWSW-UHFFFAOYSA-N 3,9-bis(2,6-ditert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C)=CC(C(C)(C)C)=C1OP1OCC2(COP(OC=3C(=CC(C)=CC=3C(C)(C)C)C(C)(C)C)OC2)CO1 SSADPHQCUURWSW-UHFFFAOYSA-N 0.000 description 1
- YLUZWKKWWSCRSR-UHFFFAOYSA-N 3,9-bis(8-methylnonoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound C1OP(OCCCCCCCC(C)C)OCC21COP(OCCCCCCCC(C)C)OC2 YLUZWKKWWSCRSR-UHFFFAOYSA-N 0.000 description 1
- PZRWFKGUFWPFID-UHFFFAOYSA-N 3,9-dioctadecoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound C1OP(OCCCCCCCCCCCCCCCCCC)OCC21COP(OCCCCCCCCCCCCCCCCCC)OC2 PZRWFKGUFWPFID-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- DBHUTHZPCWZNRW-UHFFFAOYSA-N 3-(3,5-dicyclohexyl-4-hydroxyphenyl)propanoic acid Chemical compound OC=1C(C2CCCCC2)=CC(CCC(=O)O)=CC=1C1CCCCC1 DBHUTHZPCWZNRW-UHFFFAOYSA-N 0.000 description 1
- HCILJBJJZALOAL-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)-n'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)NNC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 HCILJBJJZALOAL-UHFFFAOYSA-N 0.000 description 1
- FLZYQMOKBVFXJS-UHFFFAOYSA-N 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoic acid Chemical compound CC1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O FLZYQMOKBVFXJS-UHFFFAOYSA-N 0.000 description 1
- YCGKJPVUGMBDDS-UHFFFAOYSA-N 3-(6-azabicyclo[3.1.1]hepta-1(7),2,4-triene-6-carbonyl)benzamide Chemical compound NC(=O)C1=CC=CC(C(=O)N2C=3C=C2C=CC=3)=C1 YCGKJPVUGMBDDS-UHFFFAOYSA-N 0.000 description 1
- FXNJOBMZUXWUBU-UHFFFAOYSA-N 3-[(3,5-ditert-butyl-2-hydroxyphenyl)methoxy]-3-oxopropanoic acid Chemical compound CC(C)(C)C1=CC(COC(=O)CC(O)=O)=C(O)C(C(C)(C)C)=C1 FXNJOBMZUXWUBU-UHFFFAOYSA-N 0.000 description 1
- QSZMLDPPGQRTQY-UHFFFAOYSA-N 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]-3-oxopropanoic acid Chemical compound CC(C)(C)C1=CC(COC(=O)CC(O)=O)=CC(C(C)(C)C)=C1O QSZMLDPPGQRTQY-UHFFFAOYSA-N 0.000 description 1
- NANGQJICIOUURV-UHFFFAOYSA-N 3-phenyl-3h-1-benzofuran-2-one Chemical compound O=C1OC2=CC=CC=C2C1C1=CC=CC=C1 NANGQJICIOUURV-UHFFFAOYSA-N 0.000 description 1
- MDWVSAYEQPLWMX-UHFFFAOYSA-N 4,4'-Methylenebis(2,6-di-tert-butylphenol) Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 MDWVSAYEQPLWMX-UHFFFAOYSA-N 0.000 description 1
- QRLSTWVLSWCGBT-UHFFFAOYSA-N 4-((4,6-bis(octylthio)-1,3,5-triazin-2-yl)amino)-2,6-di-tert-butylphenol Chemical compound CCCCCCCCSC1=NC(SCCCCCCCC)=NC(NC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=N1 QRLSTWVLSWCGBT-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UQAMDAUJTXFNAD-UHFFFAOYSA-N 4-(4,6-dichloro-1,3,5-triazin-2-yl)morpholine Chemical compound ClC1=NC(Cl)=NC(N2CCOCC2)=N1 UQAMDAUJTXFNAD-UHFFFAOYSA-N 0.000 description 1
- BCZQMWDTKGBZFG-UHFFFAOYSA-N 4-[(4-hydroxy-2,6-dimethylphenyl)disulfanyl]-3,5-dimethylphenol Chemical compound CC1=CC(O)=CC(C)=C1SSC1=C(C)C=C(O)C=C1C BCZQMWDTKGBZFG-UHFFFAOYSA-N 0.000 description 1
- VGEJJASMUCILJT-UHFFFAOYSA-N 4-[2-[4,6-bis[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-1,3,5-triazin-2-yl]ethyl]-2,6-ditert-butylphenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC=2N=C(CCC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)N=C(CCC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)N=2)=C1 VGEJJASMUCILJT-UHFFFAOYSA-N 0.000 description 1
- PRWJPWSKLXYEPD-UHFFFAOYSA-N 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)CC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C PRWJPWSKLXYEPD-UHFFFAOYSA-N 0.000 description 1
- FROCQMFXPIROOK-UHFFFAOYSA-N 4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol Chemical compound CC1=CC(C)=CC=C1C1=NC(C=2C(=CC(C)=CC=2)C)=NC(C=2C(=CC(O)=CC=2)O)=N1 FROCQMFXPIROOK-UHFFFAOYSA-N 0.000 description 1
- QVXGXGJJEDTQSU-UHFFFAOYSA-N 4-[4-hydroxy-2,5-di(pentan-2-yl)phenyl]sulfanyl-2,5-di(pentan-2-yl)phenol Chemical compound C1=C(O)C(C(C)CCC)=CC(SC=2C(=CC(O)=C(C(C)CCC)C=2)C(C)CCC)=C1C(C)CCC QVXGXGJJEDTQSU-UHFFFAOYSA-N 0.000 description 1
- IYUSCCOBICHICG-UHFFFAOYSA-N 4-[[2,4-bis(3,5-ditert-butyl-4-hydroxyphenoxy)-1h-triazin-6-yl]oxy]-2,6-ditert-butylphenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(ON2N=C(OC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C=C(OC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)N2)=C1 IYUSCCOBICHICG-UHFFFAOYSA-N 0.000 description 1
- VSAWBBYYMBQKIK-UHFFFAOYSA-N 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol Chemical compound CC1=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C1CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VSAWBBYYMBQKIK-UHFFFAOYSA-N 0.000 description 1
- WTWGHNZAQVTLSQ-UHFFFAOYSA-N 4-butyl-2,6-ditert-butylphenol Chemical compound CCCCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 WTWGHNZAQVTLSQ-UHFFFAOYSA-N 0.000 description 1
- OVARTXYXUGDZHU-UHFFFAOYSA-N 4-hydroxy-n-phenyldodecanamide Chemical compound CCCCCCCCC(O)CCC(=O)NC1=CC=CC=C1 OVARTXYXUGDZHU-UHFFFAOYSA-N 0.000 description 1
- RDZBAYGNTNYHAH-UHFFFAOYSA-N 4-hydroxy-n-phenyloctadecanamide Chemical compound CCCCCCCCCCCCCCC(O)CCC(=O)NC1=CC=CC=C1 RDZBAYGNTNYHAH-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- UXMKUNDWNZNECH-UHFFFAOYSA-N 4-methyl-2,6-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC(C)=CC(CCCCCCCCC)=C1O UXMKUNDWNZNECH-UHFFFAOYSA-N 0.000 description 1
- LZAIWKMQABZIDI-UHFFFAOYSA-N 4-methyl-2,6-dioctadecylphenol Chemical compound CCCCCCCCCCCCCCCCCCC1=CC(C)=CC(CCCCCCCCCCCCCCCCCC)=C1O LZAIWKMQABZIDI-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- JJHKARPEMHIIQC-UHFFFAOYSA-N 4-octadecoxy-2,6-diphenylphenol Chemical compound C=1C(OCCCCCCCCCCCCCCCCCC)=CC(C=2C=CC=CC=2)=C(O)C=1C1=CC=CC=C1 JJHKARPEMHIIQC-UHFFFAOYSA-N 0.000 description 1
- KDVYCTOWXSLNNI-UHFFFAOYSA-N 4-t-Butylbenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1 KDVYCTOWXSLNNI-UHFFFAOYSA-N 0.000 description 1
- DBOSBRHMHBENLP-UHFFFAOYSA-N 4-tert-Butylphenyl Salicylate Chemical compound C1=CC(C(C)(C)C)=CC=C1OC(=O)C1=CC=CC=C1O DBOSBRHMHBENLP-UHFFFAOYSA-N 0.000 description 1
- SXIUYTXSDRIIIQ-UHFFFAOYSA-N 6-methylheptyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-sulfanylpropanoate Chemical compound CC(C)CCCCCOC(=O)C(S)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SXIUYTXSDRIIIQ-UHFFFAOYSA-N 0.000 description 1
- FDSWXSIYVKPLBE-UHFFFAOYSA-N 6-n,6-n'-diacetylhexanedihydrazide Chemical compound CC(=O)NN(C(C)=O)C(=O)CCCCC(=O)NN FDSWXSIYVKPLBE-UHFFFAOYSA-N 0.000 description 1
- VPOKLVDHXARWQB-UHFFFAOYSA-N 7,7,9,9-tetramethyl-3-octyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCCCCCCC)C(=O)NC11CC(C)(C)NC(C)(C)C1 VPOKLVDHXARWQB-UHFFFAOYSA-N 0.000 description 1
- RAZWNFJQEZAVOT-UHFFFAOYSA-N 8-acetyl-3-dodecyl-7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCCCCCCCCCCC)C(=O)NC11CC(C)(C)N(C(C)=O)C(C)(C)C1 RAZWNFJQEZAVOT-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- OGBVRMYSNSKIEF-UHFFFAOYSA-N Benzylphosphonic acid Chemical class OP(O)(=O)CC1=CC=CC=C1 OGBVRMYSNSKIEF-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- VULPTUNSCKSQAL-UHFFFAOYSA-N C(C=C)(=O)OC(=C(C)C)OC(C(C=C)OC(C=CC)=O)=O Chemical compound C(C=C)(=O)OC(=C(C)C)OC(C(C=C)OC(C=CC)=O)=O VULPTUNSCKSQAL-UHFFFAOYSA-N 0.000 description 1
- DJRCMVCFUPOPKC-UHFFFAOYSA-N CCCCCCCCCCCC(=NO)C1=CC=C(C)C=C1O Chemical compound CCCCCCCCCCCC(=NO)C1=CC=C(C)C=C1O DJRCMVCFUPOPKC-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 244000292411 Excoecaria agallocha Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 239000013032 Hydrocarbon resin Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OKOBUGCCXMIKDM-UHFFFAOYSA-N Irganox 1098 Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)NCCCCCCNC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 OKOBUGCCXMIKDM-UHFFFAOYSA-N 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical class [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229920000571 Nylon 11 Polymers 0.000 description 1
- 229920000299 Nylon 12 Polymers 0.000 description 1
- 229920001007 Nylon 4 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- IWGBGUINMSOOKP-UHFFFAOYSA-N OC1=C(C(=O)CCCCCCCCCCC)C=NN1C1=CC=CC=C1 Chemical compound OC1=C(C(=O)CCCCCCCCCCC)C=NN1C1=CC=CC=C1 IWGBGUINMSOOKP-UHFFFAOYSA-N 0.000 description 1
- HFXDDXVWOZZBCG-UHFFFAOYSA-N OP(O)OP(O)O.C(CCCCCCC(C)C)OC(O)(C(CO)(CO)CO)OCCCCCCCC(C)C Chemical compound OP(O)OP(O)O.C(CCCCCCC(C)C)OC(O)(C(CO)(CO)CO)OCCCCCCCC(C)C HFXDDXVWOZZBCG-UHFFFAOYSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- QSBINWBNXWAVAK-PSXMRANNSA-N PE-NMe(16:0/16:0) Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OCCNC)OC(=O)CCCCCCCCCCCCCCC QSBINWBNXWAVAK-PSXMRANNSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004962 Polyamide-imide Substances 0.000 description 1
- 229920003006 Polybutadiene acrylonitrile Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 239000004734 Polyphenylene sulfide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000546339 Trioxys Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 239000004708 Very-low-density polyethylene Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- HHFMFWAFQGUGOB-UHFFFAOYSA-N [5-(4-tert-butylbenzoyl)-2,4-dihydroxyphenyl]-(4-tert-butylphenyl)methanone Chemical compound C1=CC(C(C)(C)C)=CC=C1C(=O)C1=CC(C(=O)C=2C=CC(=CC=2)C(C)(C)C)=C(O)C=C1O HHFMFWAFQGUGOB-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 229920000800 acrylic rubber Polymers 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- KVLCHQHEQROXGN-UHFFFAOYSA-N aluminium(1+) Chemical compound [Al+] KVLCHQHEQROXGN-UHFFFAOYSA-N 0.000 description 1
- 229940007076 aluminum cation Drugs 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940116224 behenate Drugs 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- SMISHRXKWQZCCQ-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-3-yl) decanedioate Chemical compound CC1(C)N(C)C(C)(C)CCC1OC(=O)CCCCCCCCC(=O)OC1C(C)(C)N(C)C(C)(C)CC1 SMISHRXKWQZCCQ-UHFFFAOYSA-N 0.000 description 1
- XVOKYUTWUYETLQ-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-1-yl) butanedioate Chemical compound CC1(C)CCCC(C)(C)N1OC(=O)CCC(=O)ON1C(C)(C)CCCC1(C)C XVOKYUTWUYETLQ-UHFFFAOYSA-N 0.000 description 1
- YWDBZVIHZORXHG-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-1-yl) decanedioate Chemical compound CC1(C)CCCC(C)(C)N1OC(=O)CCCCCCCCC(=O)ON1C(C)(C)CCCC1(C)C YWDBZVIHZORXHG-UHFFFAOYSA-N 0.000 description 1
- YTKWTCYBDMELQK-UHFFFAOYSA-N bis(2,4-ditert-butyl-6-methylphenyl)methyl dihydrogen phosphite Chemical compound CC1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1C(OP(O)O)C1=C(C)C=C(C(C)(C)C)C=C1C(C)(C)C YTKWTCYBDMELQK-UHFFFAOYSA-N 0.000 description 1
- OCWYEMOEOGEQAN-UHFFFAOYSA-N bumetrizole Chemical compound CC(C)(C)C1=CC(C)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O OCWYEMOEOGEQAN-UHFFFAOYSA-N 0.000 description 1
- FACXGONDLDSNOE-UHFFFAOYSA-N buta-1,3-diene;styrene Chemical compound C=CC=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 FACXGONDLDSNOE-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- YWDYRRUFQXZJBG-UHFFFAOYSA-N butyl prop-2-enoate;2-methylprop-2-enoic acid Chemical group CC(=C)C(O)=O.CCCCOC(=O)C=C YWDYRRUFQXZJBG-UHFFFAOYSA-N 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-L catecholate(2-) Chemical compound [O-]C1=CC=CC=C1[O-] YCIMNLLNPGFGHC-UHFFFAOYSA-L 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- DHZSIQDUYCWNSB-UHFFFAOYSA-N chloroethene;1,1-dichloroethene Chemical compound ClC=C.ClC(Cl)=C DHZSIQDUYCWNSB-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- 125000005201 cycloalkylcarbonyloxy group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- JMFYZMAVUHNCPW-UHFFFAOYSA-N dimethyl 2-[(4-methoxyphenyl)methylidene]propanedioate Chemical compound COC(=O)C(C(=O)OC)=CC1=CC=C(OC)C=C1 JMFYZMAVUHNCPW-UHFFFAOYSA-N 0.000 description 1
- HPLVTKYRGZZXJF-UHFFFAOYSA-N dimethyl 2-benzylidenepropanedioate Chemical compound COC(=O)C(C(=O)OC)=CC1=CC=CC=C1 HPLVTKYRGZZXJF-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical group [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- MCPKSFINULVDNX-UHFFFAOYSA-N drometrizole Chemical compound CC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 MCPKSFINULVDNX-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- BXOUVIIITJXIKB-UHFFFAOYSA-N ethene;styrene Chemical group C=C.C=CC1=CC=CC=C1 BXOUVIIITJXIKB-UHFFFAOYSA-N 0.000 description 1
- UHESRSKEBRADOO-UHFFFAOYSA-N ethyl carbamate;prop-2-enoic acid Chemical class OC(=O)C=C.CCOC(N)=O UHESRSKEBRADOO-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 210000004013 groin Anatomy 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- LSSQTAFYHNYODP-UHFFFAOYSA-N heptane-2,2-diol Chemical compound CCCCCC(C)(O)O LSSQTAFYHNYODP-UHFFFAOYSA-N 0.000 description 1
- AHAREKHAZNPPMI-UHFFFAOYSA-N hexa-1,3-diene Chemical compound CCC=CC=C AHAREKHAZNPPMI-UHFFFAOYSA-N 0.000 description 1
- NZYMWGXNIUZYRC-UHFFFAOYSA-N hexadecyl 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CCCCCCCCCCCCCCCCOC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NZYMWGXNIUZYRC-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229920006270 hydrocarbon resin Polymers 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 229920002681 hypalon Polymers 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 239000006078 metal deactivator Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- WGGBUPQMVJZVIO-XFXZXTDPSA-N methyl (z)-2-cyano-3-(4-methoxyphenyl)but-2-enoate Chemical compound COC(=O)C(\C#N)=C(\C)C1=CC=C(OC)C=C1 WGGBUPQMVJZVIO-XFXZXTDPSA-N 0.000 description 1
- VRBLLGLKTUGCSG-UHFFFAOYSA-N methyl 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OC)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O VRBLLGLKTUGCSG-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- NYBDEQVBEYXMHK-UHFFFAOYSA-N methyl prop-2-enoate;5-phenylpenta-2,4-dienenitrile Chemical compound COC(=O)C=C.N#CC=CC=CC1=CC=CC=C1 NYBDEQVBEYXMHK-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229940102838 methylmethacrylate Drugs 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- GXFQBBOZTNQHMW-UHFFFAOYSA-N n'-(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine Chemical compound CC1(C)CC(NCCCCCCN)CC(C)(C)N1 GXFQBBOZTNQHMW-UHFFFAOYSA-N 0.000 description 1
- YIMHRDBSVCPJOV-UHFFFAOYSA-N n'-(2-ethoxyphenyl)-n-(2-ethylphenyl)oxamide Chemical compound CCOC1=CC=CC=C1NC(=O)C(=O)NC1=CC=CC=C1CC YIMHRDBSVCPJOV-UHFFFAOYSA-N 0.000 description 1
- UKJARPDLRWBRAX-UHFFFAOYSA-N n,n'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine Chemical compound C1C(C)(C)NC(C)(C)CC1NCCCCCCNC1CC(C)(C)NC(C)(C)C1 UKJARPDLRWBRAX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- MPISXKORNCMEBA-UHFFFAOYSA-N octadecan-4-yl 2-[3-methyl-5-(2-oxo-3H-1-benzofuran-3-yl)phenoxy]acetate Chemical compound CC=1C=C(C=C(C=1)C1C(OC2=C1C=CC=C2)=O)OCC(=O)OC(CCC)CCCCCCCCCCCCCC MPISXKORNCMEBA-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- IXVLEAZXSJJKFR-UHFFFAOYSA-N octadecyl 2-[(4-hydroxy-3,5-dimethylphenyl)methylsulfanyl]acetate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CSCC1=CC(C)=C(O)C(C)=C1 IXVLEAZXSJJKFR-UHFFFAOYSA-N 0.000 description 1
- RNVAPPWJCZTWQL-UHFFFAOYSA-N octadecyl 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 RNVAPPWJCZTWQL-UHFFFAOYSA-N 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- XQAABEDPVQWFPN-UHFFFAOYSA-N octyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OCCCCCCCC)=CC(N2N=C3C=CC=CC3=N2)=C1O XQAABEDPVQWFPN-UHFFFAOYSA-N 0.000 description 1
- DMFXLIFZVRXRRR-UHFFFAOYSA-N octyl 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate Chemical compound CC(C)(C)C1=CC(CCC(=O)OCCCCCCCC)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O DMFXLIFZVRXRRR-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229960000969 phenyl salicylate Drugs 0.000 description 1
- ZPNJBTBYIHBSIG-UHFFFAOYSA-N phenyl-(2,2,6,6-tetramethylpiperidin-4-yl)methanone Chemical compound C1C(C)(C)NC(C)(C)CC1C(=O)C1=CC=CC=C1 ZPNJBTBYIHBSIG-UHFFFAOYSA-N 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000012994 photoredox catalyst Substances 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001627 poly(4-methyl styrene) Polymers 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001643 poly(ether ketone) Polymers 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920003251 poly(α-methylstyrene) Polymers 0.000 description 1
- 229920002401 polyacrylamide Chemical group 0.000 description 1
- 229920002239 polyacrylonitrile Chemical group 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920002312 polyamide-imide Polymers 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920006393 polyether sulfone Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940068886 polyethylene glycol 300 Drugs 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920000069 polyphenylene sulfide Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical compound CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 229940066675 ricinoleate Drugs 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920000468 styrene butadiene styrene block copolymer Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 230000000475 sunscreen effect Effects 0.000 description 1
- 239000000516 sunscreening agent Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- MHSKRLJMQQNJNC-UHFFFAOYSA-N terephthalamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1 MHSKRLJMQQNJNC-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- 125000005591 trimellitate group Chemical group 0.000 description 1
- CNUJLMSKURPSHE-UHFFFAOYSA-N trioctadecyl phosphite Chemical compound CCCCCCCCCCCCCCCCCCOP(OCCCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC CNUJLMSKURPSHE-UHFFFAOYSA-N 0.000 description 1
- WGKLOLBTFWFKOD-UHFFFAOYSA-N tris(2-nonylphenyl) phosphite Chemical compound CCCCCCCCCC1=CC=CC=C1OP(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC WGKLOLBTFWFKOD-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229920001866 very low density polyethylene Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/83—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/655—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms
- C07F9/65515—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms the oxygen atom being part of a five-membered ring
- C07F9/65517—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms the oxygen atom being part of a five-membered ring condensed with carbocyclic rings or carbocyclic ring systems
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/15—Heterocyclic compounds having oxygen in the ring
- C08K5/151—Heterocyclic compounds having oxygen in the ring having one oxygen atom in the ring
- C08K5/1535—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/20—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
- C08K5/5333—Esters of phosphonic acids
- C08K5/5373—Esters of phosphonic acids containing heterocyclic rings not representing cyclic esters of phosphonic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Furan Compounds (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Cosmetics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH165392 | 1992-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4316622A1 true DE4316622A1 (de) | 1993-11-25 |
Family
ID=4215496
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4316622A Ceased DE4316622A1 (de) | 1992-05-22 | 1993-05-18 | 3-(Carboxymethoxyphenyl)benzofuran-2-one als Stabilisatoren |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5356966A (enExample) |
| JP (1) | JP3250056B2 (enExample) |
| KR (1) | KR100286116B1 (enExample) |
| BE (1) | BE1006568A3 (enExample) |
| CA (1) | CA2096485A1 (enExample) |
| CZ (1) | CZ290103B6 (enExample) |
| DE (1) | DE4316622A1 (enExample) |
| FR (1) | FR2691469B1 (enExample) |
| GB (1) | GB2267490B (enExample) |
| IT (1) | IT1264451B1 (enExample) |
| NL (1) | NL9300865A (enExample) |
| SK (1) | SK280041B6 (enExample) |
| TW (1) | TW254956B (enExample) |
Cited By (155)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0665233A2 (en) | 1994-01-24 | 1995-08-02 | Ciba-Geigy Ag | 1-Hydrocarbyloxy-piperidine compounds containing silane groups for use as stabilizers for organic materials |
| EP0704437A2 (en) | 1994-07-27 | 1996-04-03 | Ciba-Geigy Ag | Red-shifted tris-aryl-s-triazines and compositions stabilized therewith |
| EP0711804A2 (de) | 1994-11-14 | 1996-05-15 | Ciba-Geigy Ag | Kryptolichtschutzmittel |
| EP0716076A2 (de) | 1994-12-05 | 1996-06-12 | Ciba-Geigy Ag | Bisphenolesterderivate |
| EP0750011A1 (de) | 1995-06-23 | 1996-12-27 | Ciba SC Holding AG | Polysiloxane als Lichtschutzmittel |
| EP0771814A1 (en) | 1995-11-02 | 1997-05-07 | Ciba SC Holding AG | Amorphous and crystalline modifications of 1,1',1"-nitrilo triethyl-tris[2,2'-methylene-bis(4,6-di-tert-butyl-phenyl)]phosphite |
| US5654430A (en) * | 1994-04-13 | 1997-08-05 | Ciba-Geigy Corporation | Oligomeric aliphatic HALS phosphites and HALS phosphonites as stabilizers |
| US5665273A (en) * | 1994-04-13 | 1997-09-09 | Ciba-Geigy Corporation | Hals phosphonites as stabilizers |
| US5925758A (en) * | 1994-04-13 | 1999-07-20 | Ciba Specialty Chemicals Corporation | HALS phosphites and HALS phosphoramides as stabilizers |
| US5932642A (en) * | 1996-12-24 | 1999-08-03 | Ciba Specialty Chemicals Corporation | Cyclic phosphinic acid derivatives as stabilizers |
| US6046261A (en) * | 1997-08-11 | 2000-04-04 | Sumitomo Chemical Company, Limited | Piperidine compound |
| US6096886A (en) * | 1997-12-08 | 2000-08-01 | Cytec Technology Corp. | Morpholino end-capped, hindered amine substituted aminotriazine |
| US6239276B1 (en) | 1998-06-22 | 2001-05-29 | Cytec Technology Corporation | Non-yellowing para-tertiary-alkyl phenyl substituted triazine and pyrimidine ultraviolet light absorbers |
| US6297377B1 (en) | 1998-06-22 | 2001-10-02 | Cytec Technology Corporation | Benzocycle-substituted triazine and pyrimidine ultraviolet light absorbers |
| US6306939B1 (en) | 1998-06-22 | 2001-10-23 | Ciba Specialty Chemicals Corporation | Poly-trisaryl-1,3,5-Triazine carbamate ultraviolet light absorbers |
| US6414155B1 (en) | 2000-11-03 | 2002-07-02 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| WO2002055411A1 (en) | 2001-01-15 | 2002-07-18 | Ciba Specialty Chemicals Holding Inc. | Antistatic flexible intermediate bulk container |
| US6492521B2 (en) | 2000-11-03 | 2002-12-10 | Cytec Technology Corp. | Hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6545156B1 (en) | 2000-11-03 | 2003-04-08 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6646035B2 (en) | 2000-02-25 | 2003-11-11 | Clariant Finance (Bvi) Limited | Synergistic combinations of phenolic antioxidants |
| US6727300B2 (en) | 2000-11-03 | 2004-04-27 | Cytec Technology Corp. | Polymeric articles containing hindered amine light stabilizers based on multi-functional carbonyl compounds |
| US6787591B2 (en) | 2000-02-25 | 2004-09-07 | Clariant Finance (Bvi) Limited | Synergistic stabilizer compositions for themoplastic polymers in prolonged contact with water |
| WO2004076419A1 (en) | 2003-02-26 | 2004-09-10 | Ciba Specialty Chemicals Holding Inc. | Water compatible sterically hindered alkoxyamines and hydroxy substituted alkoxyamines |
| US6867250B1 (en) | 2000-10-30 | 2005-03-15 | Cytec Technology Corp. | Non-yellowing ortho-dialkyl aryl substituted triazine ultraviolet light absorbers |
| US6995200B2 (en) | 2001-02-22 | 2006-02-07 | Clariant Finance (Bvi) Limited | Color improving stabilizing compositions comprising leucine |
| EP1655303A2 (en) | 2000-05-19 | 2006-05-10 | Ciba SC Holding AG | Hydroxylamine esters as polimerization initiators |
| EP1676887A1 (en) | 2004-12-29 | 2006-07-05 | Ciba Specialty Chemicals Holding Inc. | Composition and process for improving heat and weathering stability of segmented polyurethane polymers |
| US7297734B2 (en) | 2002-02-06 | 2007-11-20 | Clariant Produkte (Deutschland) Gmbh | Process for preparing synergistic stabilizer mixtures |
| EP2009041A1 (en) | 2003-12-19 | 2008-12-31 | Ciba Holding Inc. | Fluorocarbon terminated oligo- and poly-carbonates as surface modifiers |
| EP2028228A2 (en) | 2004-10-25 | 2009-02-25 | Ciba Holding Inc. | Functionalized nanoparticles |
| DE102007040925A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Thermoplastische Zusammensetzungen mit geringer Trübung |
| WO2009034016A1 (en) | 2007-09-13 | 2009-03-19 | Basf Se | Silane coupling agents for filled rubbers |
| EP2112141A1 (en) | 2008-04-23 | 2009-10-28 | 3V SIGMA S.p.A | Oligomeric sterically hindered amines and their use as polymer stabilizers |
| EP2112198A1 (en) | 2008-04-24 | 2009-10-28 | 3V SIGMA S.p.A | Mixtures of sterically hindered amines for the stabilisation of polymers |
| EP2138534A1 (en) | 2008-06-26 | 2009-12-30 | Sumitomo Chemical Company, Limited | Polyester compositions |
| WO2010023155A2 (en) | 2008-08-27 | 2010-03-04 | Basf Se | Flame retardant compositions with polymeric dispersing agents |
| EP2160945A1 (en) | 2008-09-09 | 2010-03-10 | Polymers CRC Limited | Antimicrobial Article |
| EP2186845A1 (en) | 2008-11-18 | 2010-05-19 | Basf Se | Ammonium Functionalized Polymers as Antistatic Additives |
| US7728057B2 (en) | 2002-11-21 | 2010-06-01 | Basf Aktiengesellschaft | Use of polymer powder containing UV absorber for the stabilisation of polymers against the effects of UV radiation |
| US7744970B2 (en) | 2005-05-26 | 2010-06-29 | E. I. Du Pont De Nemours And Company | Multilayer laminates comprising twisted nematic liquid crystals |
| WO2010072768A1 (de) | 2008-12-23 | 2010-07-01 | Basf Se | Uv-absorber agglomerate |
| WO2010076278A1 (en) | 2009-01-05 | 2010-07-08 | Basf Se | Phosphorus based dispersants for inorganic particles in polymer matrices |
| EP2216364A1 (en) | 2009-02-09 | 2010-08-11 | 3V SIGMA S.p.A | Sterically hindered amines and use thereof as polymer stabilizers |
| WO2010108837A1 (en) | 2009-03-24 | 2010-09-30 | Basf Se | Preparation of shaped metal particles and their uses |
| WO2010112395A1 (en) | 2009-04-02 | 2010-10-07 | Basf Se | S-perfluoroalkyl substituted hydroxybenzylthioethers and derivatives as surface modifiers |
| WO2011009876A1 (en) | 2009-07-24 | 2011-01-27 | Basf Se | Derivatives of diphosphines as flame retardants in aromatic and/or heteroaromatic epoxy resins |
| WO2011020762A1 (en) | 2009-08-18 | 2011-02-24 | Basf Se | An uv-stabilized photovoltaic module |
| WO2011020760A1 (en) | 2009-08-18 | 2011-02-24 | Basf Se | Photovoltaic module with stabilized polymeric encapsulant |
| WO2011023584A2 (en) | 2009-08-27 | 2011-03-03 | Polymers Crc Ltd. | Nano silver-zinc oxide composition |
| WO2011029744A1 (en) | 2009-09-10 | 2011-03-17 | Basf Se | Sterically hindered amine stabilizer |
| EP2319832A1 (en) | 2009-10-20 | 2011-05-11 | Basf Se | Sterically hindered amines |
| WO2011064192A1 (en) | 2009-11-27 | 2011-06-03 | Basf Se | Photovoltaic module with uv-stabilized encapsulant |
| US7988881B2 (en) | 2008-09-30 | 2011-08-02 | E. I. Du Pont De Nemours And Company | Multilayer laminates comprising chiral nematic liquid crystals |
| WO2011107513A1 (en) | 2010-03-05 | 2011-09-09 | Basf Se | Sterically hindered amines |
| WO2011107515A2 (en) | 2010-03-05 | 2011-09-09 | Basf Se | Sterically hindered amines |
| WO2011110550A1 (en) | 2010-03-09 | 2011-09-15 | Polymers Crc Ltd | Process for the preparation of an antimicrobial article |
| EP2366732A2 (en) | 2010-03-15 | 2011-09-21 | 3V SIGMA S.p.A | Mixtures of sterically hindered amines for polymer stabilisation |
| WO2011161105A2 (en) | 2010-06-24 | 2011-12-29 | Basf Se | Herbicidal compositions |
| EP2402390A1 (en) | 2010-06-30 | 2012-01-04 | Basf Se | Particles with a hindered amine light stabilizer and a microporous organic polymer |
| WO2012000992A1 (en) | 2010-06-29 | 2012-01-05 | Basf Se | Process for improving the flow properties of polymer melts |
| WO2012052377A1 (en) | 2010-10-20 | 2012-04-26 | Basf Se | Sterically hindered amine light stabilizers with mixed functionalization |
| WO2012052376A1 (en) | 2010-10-20 | 2012-04-26 | Basf Se | Oligomeric light stabilizers with a specific functionalization |
| WO2012055965A1 (en) | 2010-10-28 | 2012-05-03 | 3V Sigma S.P.A. | New sterically hindered polymeric amines and their use as polymer stabilizers |
| EP2450400A2 (de) | 2008-08-28 | 2012-05-09 | Basf Se | Stabilisatoren für unbelebte organische materialien |
| EP2450401A1 (de) | 2008-09-05 | 2012-05-09 | THOR GmbH | Flammschutzzusammensetzung enthaltend ein Phosphonsäurederivat |
| WO2012065919A1 (en) | 2010-11-16 | 2012-05-24 | Basf Se | Stabilizer composition for polymers |
| WO2012082578A2 (en) | 2010-12-13 | 2012-06-21 | Cytec Technology Corp. | Processing additives and uses of same in rotational molding |
| WO2012153260A1 (en) | 2011-05-10 | 2012-11-15 | 3V Sigma S.P.A. | Mixture of sterically hindered amines for polymer stabilization |
| US8334033B2 (en) | 2008-12-31 | 2012-12-18 | E I Du Pont De Nemours And Company | Ionomer compositions with low haze and high moisture resistance and articles comprising the same |
| US8399082B2 (en) | 2008-12-30 | 2013-03-19 | E I Du Pont De Nemours And Company | High-clarity blended ionomer compositions and articles comprising the same |
| US8399096B2 (en) | 2008-10-31 | 2013-03-19 | E I Du Pont De Nemours And Company | High-clarity ionomer compositions and articles comprising the same |
| WO2013041592A1 (en) | 2011-09-23 | 2013-03-28 | Borealis Ag | Stabilizing of organic material with amino-triazine based mannich-compounds |
| US8519035B2 (en) | 2007-09-04 | 2013-08-27 | Basf Se | Cyclic phosphines as flame retardants |
| WO2013139799A1 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Isoindolo[2,1-a]quinazoline derivatives for stabilization of organic materials |
| WO2013139802A1 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Polyamide compositions with improved optical properties |
| WO2013139800A2 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Urea compounds for improving the solid state properties of polyamide resins |
| WO2013188490A1 (en) | 2012-06-13 | 2013-12-19 | Cytec Technology Corp. | Stabilizer compositions containing substituted chroman compounds and methods of use |
| WO2014009361A1 (en) | 2012-07-13 | 2014-01-16 | Basf Se | Polyglycol bis-[3-(7-tert-butyl-2-oxo-3-phenyl-3h-benzofuran-5-yl-)propanoyl] derivatives as stabilizers of organic material |
| US8680183B2 (en) | 2007-11-28 | 2014-03-25 | Basf Se | Liquid stabilizer mixture |
| US8822575B2 (en) | 2007-08-28 | 2014-09-02 | Basf Se | Stabilizer mixture |
| US8853314B2 (en) | 2008-10-23 | 2014-10-07 | Datalase Ltd. | Heat absorbing additives |
| EP2876126A1 (en) | 2013-11-25 | 2015-05-27 | Basf Se | A stabilizer mixture |
| WO2015077635A2 (en) | 2013-11-22 | 2015-05-28 | Polnox Corporation | Macromolecular antioxidants based on dual type moiety per molecule: structures methods of making and using the same |
| US9267042B2 (en) | 2008-10-27 | 2016-02-23 | Datalase Ltd. | Coating composition for marking substrates |
| EP2993168A1 (en) | 2004-11-02 | 2016-03-09 | Basf Se | Process for the synthesis of n-alkoxyamines |
| US9309379B2 (en) | 2008-05-15 | 2016-04-12 | Basf Se | Basic stabilisation systems for emulsion polymerised rubber |
| US9328219B2 (en) | 2012-03-20 | 2016-05-03 | Basf Se | Polyamide compositions with improved optical properties |
| US9333786B2 (en) | 2007-07-18 | 2016-05-10 | Datalase, Ltd. | Laser-sensitive coating formulations |
| EP3050919A1 (de) | 2015-01-29 | 2016-08-03 | Basf Se | Lignocellulosehaltige materialen enthaltend mischungen mit salzen von n-substituierten carbamidsäuren |
| WO2016131791A1 (en) | 2015-02-20 | 2016-08-25 | Basf Se | Light stabilized polyolefin films, tapes and monofilaments |
| WO2017025431A1 (en) | 2015-08-10 | 2017-02-16 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US9732254B2 (en) | 2014-04-29 | 2017-08-15 | Basf Se | Multi-layered film and the use thereof |
| WO2018046301A1 (en) | 2016-09-12 | 2018-03-15 | Basf Se | Additive mixture |
| US9951207B2 (en) | 2014-02-17 | 2018-04-24 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US9969864B2 (en) | 2013-07-08 | 2018-05-15 | Basf Se | Light stabilizers |
| WO2018145283A1 (en) | 2017-02-09 | 2018-08-16 | Dow Global Technologies Llc | Polyurethane foams having low levels of aldehyde emissions |
| WO2018148959A1 (en) | 2017-02-20 | 2018-08-23 | Dow Global Technologies Llc | Polyurethanes having reduced aldehyde emissions |
| US10072136B2 (en) | 2014-08-05 | 2018-09-11 | Basf Se | 3-phenyl-benzofuran-2-one diphosphite derivatives as stabilizers |
| WO2018177846A1 (en) | 2017-03-28 | 2018-10-04 | Basf Se | Light stabilizer mixture |
| US10119039B2 (en) | 2013-10-29 | 2018-11-06 | Basf Se | Use of 2-(2-hydroxyphenyl)benzotriazole compounds as an UV absorbing agent in coatings |
| WO2018202707A1 (en) | 2017-05-03 | 2018-11-08 | Basf Se | Nucleating agents, methods for their production, and associated polymer compositions |
| EP3424977A1 (en) | 2017-06-30 | 2019-01-09 | 3V SIGMA S.p.A | Hindered polymeric amines |
| WO2019007935A1 (en) | 2017-07-06 | 2019-01-10 | Basf Se | POLYETHYLENE PIPE |
| WO2019008002A1 (en) | 2017-07-03 | 2019-01-10 | Basf Se | PHENOLIC METAL SALTS AND THEIR PHENOLIC ACIDS AS STABILIZERS OF POLYMERS |
| EP3428156A1 (en) | 2017-07-11 | 2019-01-16 | 3V SIGMA S.p.A | Hindered amines |
| WO2019053187A1 (en) | 2017-09-18 | 2019-03-21 | Basf Se | MIXTURE OF ADDITIVES |
| US10253164B2 (en) | 2014-05-15 | 2019-04-09 | Basf Se | Highly effective stabilizer |
| DE10316198B4 (de) | 2002-04-12 | 2019-09-05 | Ciba Holding Inc. | Stabilisatorgemisch, enthaltend drei spezielle sterisch gehinderte Aminverbindungen, das Stabilisatorgemisch enthaltende Zusammensetzung und Verfahren zur Stabilisierung von organischem Material gegen durch Licht, Wärme oder Oxidation hervorgerufene Zersetzung |
| WO2019192982A1 (en) | 2018-04-04 | 2019-10-10 | Basf Se | Use of an ultraviolet radiation absorbing polymer composition (uvrap) as an uv absorbing agent in a coating for non-living and non-keratinous materials |
| WO2019192943A1 (en) | 2018-04-04 | 2019-10-10 | Basf Se | Use of an ultraviolet radiation absorbing composition as a light stabilizer for a shaped artificial polymer article |
| WO2019243267A1 (en) | 2018-06-21 | 2019-12-26 | Basf Se | 3-phenyl-benzofuran-2-one diphosphate derivatives as stabilizers |
| WO2020024231A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024235A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024236A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024233A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020114810A1 (en) | 2018-12-04 | 2020-06-11 | Basf Se | Polyethylene or polypropylene articles |
| US10683409B2 (en) | 2016-01-21 | 2020-06-16 | Basf Se | Additive mixture for stabilization of polyol and polyurethane |
| DE10150793B4 (de) | 2000-10-17 | 2020-06-18 | Basf Se | Stabilisiertes Metallocenpolypropylen und Verfahren zum Stabilisieren von Metallocenpolypropylen |
| WO2020126752A1 (en) | 2018-12-21 | 2020-06-25 | Basf Se | A polypropylene composition |
| WO2020182587A1 (en) | 2019-03-08 | 2020-09-17 | Basf Se | Sterically hindered amine stabilizer mixtures |
| WO2020182709A1 (en) | 2019-03-12 | 2020-09-17 | Basf Se | Shaped artificial polymer articles |
| WO2021035662A1 (en) | 2019-08-30 | 2021-03-04 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyether polyols and polyurethane foams |
| WO2021160524A1 (en) | 2020-02-10 | 2021-08-19 | Basf Se | Light stabilizer mixture |
| WO2021170615A1 (en) | 2020-02-26 | 2021-09-02 | Basf Se | Additive mixtures for rheology modification of polymers |
| WO2021170599A1 (en) | 2020-02-27 | 2021-09-02 | Basf Se | Polyolefin compositions |
| US11180476B2 (en) | 2013-10-17 | 2021-11-23 | Basf Se | Hindered amine light stabilizers |
| WO2022096356A1 (en) | 2020-11-03 | 2022-05-12 | Basf Se | Method for stabilizing an organic material using a stabilizer mixture |
| WO2022122868A1 (en) | 2020-12-09 | 2022-06-16 | Basf Se | An organic material based shaped article |
| WO2022122818A1 (en) | 2020-12-09 | 2022-06-16 | Basf Se | Additive mixtures |
| WO2022210295A1 (ja) | 2021-03-30 | 2022-10-06 | 住友化学株式会社 | 亜リン酸エステル化合物、その製造方法及びその用途 |
| WO2022207787A1 (en) | 2021-04-01 | 2022-10-06 | Basf Se | Stabilizer mixture |
| WO2022243306A1 (en) | 2021-05-21 | 2022-11-24 | Rhodia Operations | Stabilized polymer resin systems having heteropolyoxometalates for antimicrobial properties and uses thereof |
| WO2022255116A1 (ja) | 2021-05-31 | 2022-12-08 | 住友化学株式会社 | 亜リン酸エステル組成物 |
| WO2023286616A1 (ja) | 2021-07-15 | 2023-01-19 | 住友化学株式会社 | フェノール化合物、有機材料用安定剤、樹脂組成物、及び有機材料の安定化方法 |
| WO2023001717A1 (en) | 2021-07-17 | 2023-01-26 | Basf Se | An additive mixture for stabilization of organic material |
| WO2023030859A1 (en) | 2021-09-02 | 2023-03-09 | Basf Se | Stabilizer combination for preventing degradation of synthetic polymers |
| WO2023041690A1 (en) | 2021-09-16 | 2023-03-23 | Basf Se | Stabilizer formulation |
| WO2023117980A1 (en) | 2021-12-21 | 2023-06-29 | Basf Se | Environmental attributes for plastic additives |
| WO2023129464A1 (en) | 2022-01-01 | 2023-07-06 | Cytec Industries Inc. | Polymer compositions having densification accelerators and rotational molding processes for making hollow articles therefrom |
| WO2023141089A1 (en) | 2022-01-18 | 2023-07-27 | Basf Se | Shaped artificial polymer articles with hybrid metal oxide particles |
| WO2023141091A1 (en) | 2022-01-18 | 2023-07-27 | Basf Se | Shaped artificial polymer articles with closed-cell metal oxide particles |
| WO2023166978A1 (ja) | 2022-03-03 | 2023-09-07 | 住友化学株式会社 | 加工安定剤、有機材料組成物、及び有機材料の安定化方法 |
| WO2023227472A1 (en) | 2022-05-24 | 2023-11-30 | Basf Se | Polycarbonate composition containing combination of hydroxyphenyl triazines and uv absorbers |
| WO2024037851A1 (en) | 2022-08-19 | 2024-02-22 | Basf Se | Use of additives for improving the processing of polyethylenes |
| WO2024052176A1 (en) | 2022-09-07 | 2024-03-14 | Basf Se | Rheology modifying of polymers with a radical initiator and thiourethane |
| WO2024068415A1 (en) | 2022-09-29 | 2024-04-04 | Basf Se | Co-stabilizers for hydroxyphenyl triazine stabilized polymers |
| WO2024075651A1 (ja) | 2022-10-03 | 2024-04-11 | 住友化学株式会社 | 安定剤、有機材料組成物、及び有機材料の安定化方法 |
| US12006417B2 (en) | 2015-07-27 | 2024-06-11 | Basf Se | Additive mixture containing a particular sterically hindered amine compound and a heat reflecting interference pigment |
| WO2024133667A1 (en) | 2022-12-21 | 2024-06-27 | Basf Se | A method for improving the processing of polyethylene |
| WO2024150714A1 (ja) | 2023-01-13 | 2024-07-18 | 住友化学株式会社 | 加工安定剤、樹脂組成物、および有機材料の安定化方法 |
| WO2024153547A1 (en) | 2023-01-16 | 2024-07-25 | Basf Se | Hydroxyphenyltriazine co-stabilizers for stabilized polyesters |
| WO2024153546A1 (en) | 2023-01-16 | 2024-07-25 | Basf Se | Phenyl triazine co-stabilizers for stabilized polyurethanes |
| WO2025087886A1 (en) | 2023-10-26 | 2025-05-01 | Basf Se | Polyolefin pipe comprising a hydrotalcite mineral and a hydrazide |
| WO2025223984A1 (en) | 2024-04-22 | 2025-10-30 | Basf Se | Flame retardant articles comprising polylactic acid |
| WO2026046898A1 (en) | 2024-08-30 | 2026-03-05 | Basf Se | An interlayer film for laminated glass comprising a resorcinol triazine uv absorber |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH686306A5 (de) * | 1993-09-17 | 1996-02-29 | Ciba Geigy Ag | 3-Aryl-benzofuranone als Stabilisatoren. |
| TW270133B (enExample) * | 1993-09-17 | 1996-02-11 | Ciba Geigy | |
| US6493838B1 (en) * | 1995-09-29 | 2002-12-10 | Kabushiki Kaisha Toshiba | Coding apparatus and decoding apparatus for transmission/storage of information |
| US6521681B1 (en) | 1996-07-05 | 2003-02-18 | Ciba Specialty Chemicals Corporation | Phenol-free stabilization of polyolefin fibres |
| EP0839623B1 (de) | 1996-10-30 | 2001-01-31 | Ciba SC Holding AG | Stabilisatorkombination für das Rotomolding-Verfahren |
| DE59810298D1 (de) * | 1997-02-05 | 2004-01-15 | Ciba Sc Holding Ag | Stabilisatoren für Pulverlacke |
| ES2149678B1 (es) | 1997-03-06 | 2001-05-16 | Ciba Sc Holding Ag | Estabilizacion de policarbonatos, poliesteres y policetonas. |
| DE19820157B4 (de) | 1997-05-13 | 2010-04-08 | Clariant Produkte (Deutschland) Gmbh | Neue Verbindungen auf Basis von Polyalkyl-1-oxa-diazaspirodecan-Verbindungen |
| GB2333296B (en) * | 1998-01-15 | 2000-09-27 | Ciba Sc Holding Ag | Stabilisers and anti-ozonants for elastomers |
| AU2310999A (en) * | 1998-02-17 | 1999-08-30 | Dow Chemical Company, The | Hydrogenated aromatic polymer compositions containing stabilizers |
| IL140446A0 (en) | 1998-06-22 | 2002-02-10 | Cytec Tech Corp | Red-shifted trisaryl-1,3,5-triazine ultraviolet light absorbers |
| GB2343007B (en) | 1998-10-19 | 2001-11-07 | Ciba Sc Holding Ag | Colour photographic material |
| CN100366678C (zh) | 1999-09-01 | 2008-02-06 | 陶氏环球技术公司 | 含有氰基丙烯酸酯稳定剂化合物的聚碳酸酯树脂组合物 |
| GB0019465D0 (en) * | 2000-08-09 | 2000-09-27 | Clariant Int Ltd | Synergistic stabilizer for color stable pigmented thermoplastic polyners in prolonged contact with water |
| ES2247332T3 (es) * | 2001-03-20 | 2006-03-01 | Ciba Specialty Chemicals Holding Inc. | Composiciones ignifugantes. |
| GB0119137D0 (en) * | 2001-08-06 | 2001-09-26 | Clariant Int Ltd | Property enhancement of polyamides by co-condensation with lightstabilizers |
| KR100485170B1 (ko) * | 2002-12-05 | 2005-04-22 | 동부아남반도체 주식회사 | 반도체 소자 및 이의 제조 방법 |
| US7390912B2 (en) * | 2004-12-17 | 2008-06-24 | Milliken & Company | Lactone stabilizing compositions |
| EP1904301A2 (en) * | 2005-05-26 | 2008-04-02 | E.I. Dupont De Nemours And Company | High strength multilayer laminates comprising twisted nematic liquid crystals |
| JP2009522399A (ja) * | 2005-12-29 | 2009-06-11 | イー・アイ・デュポン・ドウ・ヌムール・アンド・カンパニー | 赤外線の透過を低減するための組成物 |
| EP2167570A1 (en) | 2007-06-29 | 2010-03-31 | Basell Poliolefine Italia S.R.L. | An irradiated polyolefin composition comprising a non - phenolic stabilizer |
| KR101782173B1 (ko) | 2009-07-07 | 2017-10-23 | 바스프 에스이 | 칼륨 세슘 텅스텐 브론즈 입자 |
| US8286405B1 (en) * | 2009-08-11 | 2012-10-16 | Agp Plastics, Inc. | Fire and impact resistant window and building structures |
| US11267951B2 (en) | 2010-12-13 | 2022-03-08 | Cytec Technology Corp. | Stabilizer compositions containing substituted chroman compounds and methods of use |
| JP6241702B2 (ja) * | 2012-09-14 | 2017-12-06 | 国立大学法人九州大学 | メカノクロミック材料 |
| KR102294024B1 (ko) | 2013-09-27 | 2021-08-27 | 바스프 에스이 | 건축 재료를 위한 폴리올레핀 조성물 |
| TWI685524B (zh) | 2013-12-17 | 2020-02-21 | 美商畢克美國股份有限公司 | 預先脫層之層狀材料 |
| US9481775B2 (en) | 2014-04-28 | 2016-11-01 | Vanderbilt Chemicals, Llc | Polyurethane scorch inhibitor |
| WO2017013028A1 (en) | 2015-07-20 | 2017-01-26 | Basf Se | Flame retardant polyolefin articles |
| PL3841166T5 (pl) | 2018-08-22 | 2025-08-18 | Basf Se | Stabilizowana poliolefina wytwarzana w procesie formowania rotacyjnego |
| US20220282064A1 (en) | 2019-07-30 | 2022-09-08 | Basf Se | Stabilizer composition |
| CN120897951A (zh) | 2023-04-04 | 2025-11-04 | 巴斯夫欧洲公司 | 含有稳定剂混合物的热塑性聚合物组合物 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2440350A1 (fr) * | 1978-11-03 | 1980-05-30 | Hoechst France | Procede de fabrication de l'acide parahydroxymandelique racemique |
| GB2042562B (en) * | 1979-02-05 | 1983-05-11 | Sandoz Ltd | Stabilising polymers |
| DE3480926D1 (de) * | 1983-12-16 | 1990-02-08 | Ici Plc | Hetero-polycyclische, aromatische verbindung. |
| GB8712784D0 (en) * | 1987-06-01 | 1987-07-08 | Ici Plc | Hetero-polycyclic aromatic compounds |
| DE59007379D1 (de) * | 1989-08-31 | 1994-11-10 | Ciba Geigy Ag | 3-Phenylbenzofuran-2-one. |
| GB2252325A (en) * | 1991-01-31 | 1992-08-05 | Ciba Geigy Ag | Stabilised polyolefin |
| EP0543778A1 (de) * | 1991-11-19 | 1993-05-26 | Ciba-Geigy Ag | Gegen Oxidation bzw. Kernverbräunung geschützte Polyetherpolyol- und Polyurethanzusammensetzungen |
-
1993
- 1993-05-11 GB GB9309641A patent/GB2267490B/en not_active Expired - Fee Related
- 1993-05-14 IT IT93MI000989A patent/IT1264451B1/it active IP Right Grant
- 1993-05-14 KR KR1019930008245A patent/KR100286116B1/ko not_active Expired - Fee Related
- 1993-05-17 CZ CZ1993918A patent/CZ290103B6/cs not_active IP Right Cessation
- 1993-05-17 US US08/115,119 patent/US5356966A/en not_active Expired - Fee Related
- 1993-05-17 SK SK494-93A patent/SK280041B6/sk unknown
- 1993-05-18 CA CA002096485A patent/CA2096485A1/en not_active Abandoned
- 1993-05-18 BE BE9300512A patent/BE1006568A3/fr not_active IP Right Cessation
- 1993-05-18 FR FR9305959A patent/FR2691469B1/fr not_active Expired - Fee Related
- 1993-05-18 DE DE4316622A patent/DE4316622A1/de not_active Ceased
- 1993-05-18 NL NL9300865A patent/NL9300865A/nl not_active Application Discontinuation
- 1993-05-19 JP JP14021993A patent/JP3250056B2/ja not_active Expired - Fee Related
- 1993-05-27 TW TW082103583A patent/TW254956B/zh active
Cited By (184)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0665233A2 (en) | 1994-01-24 | 1995-08-02 | Ciba-Geigy Ag | 1-Hydrocarbyloxy-piperidine compounds containing silane groups for use as stabilizers for organic materials |
| US5654430A (en) * | 1994-04-13 | 1997-08-05 | Ciba-Geigy Corporation | Oligomeric aliphatic HALS phosphites and HALS phosphonites as stabilizers |
| US5665273A (en) * | 1994-04-13 | 1997-09-09 | Ciba-Geigy Corporation | Hals phosphonites as stabilizers |
| US5925758A (en) * | 1994-04-13 | 1999-07-20 | Ciba Specialty Chemicals Corporation | HALS phosphites and HALS phosphoramides as stabilizers |
| EP0704437A2 (en) | 1994-07-27 | 1996-04-03 | Ciba-Geigy Ag | Red-shifted tris-aryl-s-triazines and compositions stabilized therewith |
| EP0711804A2 (de) | 1994-11-14 | 1996-05-15 | Ciba-Geigy Ag | Kryptolichtschutzmittel |
| EP0716076A2 (de) | 1994-12-05 | 1996-06-12 | Ciba-Geigy Ag | Bisphenolesterderivate |
| EP0750011A1 (de) | 1995-06-23 | 1996-12-27 | Ciba SC Holding AG | Polysiloxane als Lichtschutzmittel |
| EP0771814A1 (en) | 1995-11-02 | 1997-05-07 | Ciba SC Holding AG | Amorphous and crystalline modifications of 1,1',1"-nitrilo triethyl-tris[2,2'-methylene-bis(4,6-di-tert-butyl-phenyl)]phosphite |
| US5932642A (en) * | 1996-12-24 | 1999-08-03 | Ciba Specialty Chemicals Corporation | Cyclic phosphinic acid derivatives as stabilizers |
| US6046261A (en) * | 1997-08-11 | 2000-04-04 | Sumitomo Chemical Company, Limited | Piperidine compound |
| US6096886A (en) * | 1997-12-08 | 2000-08-01 | Cytec Technology Corp. | Morpholino end-capped, hindered amine substituted aminotriazine |
| US6306939B1 (en) | 1998-06-22 | 2001-10-23 | Ciba Specialty Chemicals Corporation | Poly-trisaryl-1,3,5-Triazine carbamate ultraviolet light absorbers |
| US6239276B1 (en) | 1998-06-22 | 2001-05-29 | Cytec Technology Corporation | Non-yellowing para-tertiary-alkyl phenyl substituted triazine and pyrimidine ultraviolet light absorbers |
| US6384113B1 (en) | 1998-06-22 | 2002-05-07 | Cytec Technology Corp. | Benzocycle-substituted triazine and pyrimidine ultraviolet light absorbers |
| US6297377B1 (en) | 1998-06-22 | 2001-10-02 | Cytec Technology Corporation | Benzocycle-substituted triazine and pyrimidine ultraviolet light absorbers |
| US6509399B2 (en) | 1998-06-22 | 2003-01-21 | Cytec Technology Corp | Non-yellowing part-tertiary-alkyl phenyl substituted triazine and pyrimidine ultraviolet light absorbers |
| US6646035B2 (en) | 2000-02-25 | 2003-11-11 | Clariant Finance (Bvi) Limited | Synergistic combinations of phenolic antioxidants |
| US6787591B2 (en) | 2000-02-25 | 2004-09-07 | Clariant Finance (Bvi) Limited | Synergistic stabilizer compositions for themoplastic polymers in prolonged contact with water |
| EP1655303A2 (en) | 2000-05-19 | 2006-05-10 | Ciba SC Holding AG | Hydroxylamine esters as polimerization initiators |
| DE10150793B4 (de) | 2000-10-17 | 2020-06-18 | Basf Se | Stabilisiertes Metallocenpolypropylen und Verfahren zum Stabilisieren von Metallocenpolypropylen |
| US6867250B1 (en) | 2000-10-30 | 2005-03-15 | Cytec Technology Corp. | Non-yellowing ortho-dialkyl aryl substituted triazine ultraviolet light absorbers |
| US6545156B1 (en) | 2000-11-03 | 2003-04-08 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6696570B2 (en) | 2000-11-03 | 2004-02-24 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6727300B2 (en) | 2000-11-03 | 2004-04-27 | Cytec Technology Corp. | Polymeric articles containing hindered amine light stabilizers based on multi-functional carbonyl compounds |
| US6492521B2 (en) | 2000-11-03 | 2002-12-10 | Cytec Technology Corp. | Hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6414155B1 (en) | 2000-11-03 | 2002-07-02 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| WO2002055411A1 (en) | 2001-01-15 | 2002-07-18 | Ciba Specialty Chemicals Holding Inc. | Antistatic flexible intermediate bulk container |
| US6995200B2 (en) | 2001-02-22 | 2006-02-07 | Clariant Finance (Bvi) Limited | Color improving stabilizing compositions comprising leucine |
| US7297734B2 (en) | 2002-02-06 | 2007-11-20 | Clariant Produkte (Deutschland) Gmbh | Process for preparing synergistic stabilizer mixtures |
| DE10316198B4 (de) | 2002-04-12 | 2019-09-05 | Ciba Holding Inc. | Stabilisatorgemisch, enthaltend drei spezielle sterisch gehinderte Aminverbindungen, das Stabilisatorgemisch enthaltende Zusammensetzung und Verfahren zur Stabilisierung von organischem Material gegen durch Licht, Wärme oder Oxidation hervorgerufene Zersetzung |
| US7728057B2 (en) | 2002-11-21 | 2010-06-01 | Basf Aktiengesellschaft | Use of polymer powder containing UV absorber for the stabilisation of polymers against the effects of UV radiation |
| US8461235B2 (en) | 2002-11-21 | 2013-06-11 | Basf Se | Use of polymer powder containing UV absorber for the stabilisation of polymers against the effects of UV radiation |
| WO2004076419A1 (en) | 2003-02-26 | 2004-09-10 | Ciba Specialty Chemicals Holding Inc. | Water compatible sterically hindered alkoxyamines and hydroxy substituted alkoxyamines |
| EP2009041A1 (en) | 2003-12-19 | 2008-12-31 | Ciba Holding Inc. | Fluorocarbon terminated oligo- and poly-carbonates as surface modifiers |
| EP2028228A2 (en) | 2004-10-25 | 2009-02-25 | Ciba Holding Inc. | Functionalized nanoparticles |
| EP2993168A1 (en) | 2004-11-02 | 2016-03-09 | Basf Se | Process for the synthesis of n-alkoxyamines |
| EP1676887A1 (en) | 2004-12-29 | 2006-07-05 | Ciba Specialty Chemicals Holding Inc. | Composition and process for improving heat and weathering stability of segmented polyurethane polymers |
| US7744970B2 (en) | 2005-05-26 | 2010-06-29 | E. I. Du Pont De Nemours And Company | Multilayer laminates comprising twisted nematic liquid crystals |
| US9333786B2 (en) | 2007-07-18 | 2016-05-10 | Datalase, Ltd. | Laser-sensitive coating formulations |
| US8822575B2 (en) | 2007-08-28 | 2014-09-02 | Basf Se | Stabilizer mixture |
| DE102007040925A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Thermoplastische Zusammensetzungen mit geringer Trübung |
| US8519035B2 (en) | 2007-09-04 | 2013-08-27 | Basf Se | Cyclic phosphines as flame retardants |
| WO2009034016A1 (en) | 2007-09-13 | 2009-03-19 | Basf Se | Silane coupling agents for filled rubbers |
| US8252862B2 (en) | 2007-09-13 | 2012-08-28 | Basf Se | Silane coupling agents for filled rubbers |
| US8680183B2 (en) | 2007-11-28 | 2014-03-25 | Basf Se | Liquid stabilizer mixture |
| US8003718B2 (en) | 2008-04-23 | 2011-08-23 | 3V Sigma S.P.A. | Oligomeric sterically hindered amines and their use as polymer stabilisers |
| EP2112141A1 (en) | 2008-04-23 | 2009-10-28 | 3V SIGMA S.p.A | Oligomeric sterically hindered amines and their use as polymer stabilizers |
| US7713444B2 (en) | 2008-04-24 | 2010-05-11 | 3V Sigma S.P.A. | Mixtures of sterically hindered amines for the stabilisation of polymers |
| EP2112198A1 (en) | 2008-04-24 | 2009-10-28 | 3V SIGMA S.p.A | Mixtures of sterically hindered amines for the stabilisation of polymers |
| US9562148B2 (en) | 2008-05-15 | 2017-02-07 | Basf Se | Basic stabilisation systems for emulsion polymerised rubber |
| US9309379B2 (en) | 2008-05-15 | 2016-04-12 | Basf Se | Basic stabilisation systems for emulsion polymerised rubber |
| EP2138534A1 (en) | 2008-06-26 | 2009-12-30 | Sumitomo Chemical Company, Limited | Polyester compositions |
| WO2010023155A2 (en) | 2008-08-27 | 2010-03-04 | Basf Se | Flame retardant compositions with polymeric dispersing agents |
| EP2450400A2 (de) | 2008-08-28 | 2012-05-09 | Basf Se | Stabilisatoren für unbelebte organische materialien |
| US8377192B2 (en) | 2008-08-28 | 2013-02-19 | Basf Se | Stabilisers for inanimate organic materials |
| EP2450401A1 (de) | 2008-09-05 | 2012-05-09 | THOR GmbH | Flammschutzzusammensetzung enthaltend ein Phosphonsäurederivat |
| EP2160945A1 (en) | 2008-09-09 | 2010-03-10 | Polymers CRC Limited | Antimicrobial Article |
| US7988881B2 (en) | 2008-09-30 | 2011-08-02 | E. I. Du Pont De Nemours And Company | Multilayer laminates comprising chiral nematic liquid crystals |
| US8853314B2 (en) | 2008-10-23 | 2014-10-07 | Datalase Ltd. | Heat absorbing additives |
| US9267042B2 (en) | 2008-10-27 | 2016-02-23 | Datalase Ltd. | Coating composition for marking substrates |
| US8399096B2 (en) | 2008-10-31 | 2013-03-19 | E I Du Pont De Nemours And Company | High-clarity ionomer compositions and articles comprising the same |
| EP2186845A1 (en) | 2008-11-18 | 2010-05-19 | Basf Se | Ammonium Functionalized Polymers as Antistatic Additives |
| WO2010072768A1 (de) | 2008-12-23 | 2010-07-01 | Basf Se | Uv-absorber agglomerate |
| US8399082B2 (en) | 2008-12-30 | 2013-03-19 | E I Du Pont De Nemours And Company | High-clarity blended ionomer compositions and articles comprising the same |
| US8334033B2 (en) | 2008-12-31 | 2012-12-18 | E I Du Pont De Nemours And Company | Ionomer compositions with low haze and high moisture resistance and articles comprising the same |
| WO2010076278A1 (en) | 2009-01-05 | 2010-07-08 | Basf Se | Phosphorus based dispersants for inorganic particles in polymer matrices |
| EP2216364A1 (en) | 2009-02-09 | 2010-08-11 | 3V SIGMA S.p.A | Sterically hindered amines and use thereof as polymer stabilizers |
| US8802151B2 (en) | 2009-03-24 | 2014-08-12 | Basf Se | Preparation of shaped metal particles and their uses |
| WO2010108837A1 (en) | 2009-03-24 | 2010-09-30 | Basf Se | Preparation of shaped metal particles and their uses |
| WO2010112395A1 (en) | 2009-04-02 | 2010-10-07 | Basf Se | S-perfluoroalkyl substituted hydroxybenzylthioethers and derivatives as surface modifiers |
| WO2011009876A1 (en) | 2009-07-24 | 2011-01-27 | Basf Se | Derivatives of diphosphines as flame retardants in aromatic and/or heteroaromatic epoxy resins |
| WO2011020762A1 (en) | 2009-08-18 | 2011-02-24 | Basf Se | An uv-stabilized photovoltaic module |
| WO2011020760A1 (en) | 2009-08-18 | 2011-02-24 | Basf Se | Photovoltaic module with stabilized polymeric encapsulant |
| WO2011023584A2 (en) | 2009-08-27 | 2011-03-03 | Polymers Crc Ltd. | Nano silver-zinc oxide composition |
| WO2011029744A1 (en) | 2009-09-10 | 2011-03-17 | Basf Se | Sterically hindered amine stabilizer |
| EP2319832A1 (en) | 2009-10-20 | 2011-05-11 | Basf Se | Sterically hindered amines |
| WO2011064192A1 (en) | 2009-11-27 | 2011-06-03 | Basf Se | Photovoltaic module with uv-stabilized encapsulant |
| WO2011107513A1 (en) | 2010-03-05 | 2011-09-09 | Basf Se | Sterically hindered amines |
| WO2011107515A2 (en) | 2010-03-05 | 2011-09-09 | Basf Se | Sterically hindered amines |
| WO2011110550A1 (en) | 2010-03-09 | 2011-09-15 | Polymers Crc Ltd | Process for the preparation of an antimicrobial article |
| EP2366732A2 (en) | 2010-03-15 | 2011-09-21 | 3V SIGMA S.p.A | Mixtures of sterically hindered amines for polymer stabilisation |
| WO2011161105A2 (en) | 2010-06-24 | 2011-12-29 | Basf Se | Herbicidal compositions |
| WO2012000992A1 (en) | 2010-06-29 | 2012-01-05 | Basf Se | Process for improving the flow properties of polymer melts |
| EP2402390A1 (en) | 2010-06-30 | 2012-01-04 | Basf Se | Particles with a hindered amine light stabilizer and a microporous organic polymer |
| WO2012052376A1 (en) | 2010-10-20 | 2012-04-26 | Basf Se | Oligomeric light stabilizers with a specific functionalization |
| WO2012052377A1 (en) | 2010-10-20 | 2012-04-26 | Basf Se | Sterically hindered amine light stabilizers with mixed functionalization |
| WO2012055965A1 (en) | 2010-10-28 | 2012-05-03 | 3V Sigma S.P.A. | New sterically hindered polymeric amines and their use as polymer stabilizers |
| WO2012065919A1 (en) | 2010-11-16 | 2012-05-24 | Basf Se | Stabilizer composition for polymers |
| EP3786216A1 (en) | 2010-12-13 | 2021-03-03 | Cytec Technology Corp. | Processing additives and uses of same in rotational molding |
| WO2012082578A2 (en) | 2010-12-13 | 2012-06-21 | Cytec Technology Corp. | Processing additives and uses of same in rotational molding |
| WO2012153260A1 (en) | 2011-05-10 | 2012-11-15 | 3V Sigma S.P.A. | Mixture of sterically hindered amines for polymer stabilization |
| US9546261B2 (en) | 2011-09-23 | 2017-01-17 | Borealis Ag | Stabilizing of organic material with amino-triazine based mannich-compounds |
| WO2013041592A1 (en) | 2011-09-23 | 2013-03-28 | Borealis Ag | Stabilizing of organic material with amino-triazine based mannich-compounds |
| US9328219B2 (en) | 2012-03-20 | 2016-05-03 | Basf Se | Polyamide compositions with improved optical properties |
| WO2013139799A1 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Isoindolo[2,1-a]quinazoline derivatives for stabilization of organic materials |
| WO2013139802A1 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Polyamide compositions with improved optical properties |
| WO2013139800A2 (en) | 2012-03-20 | 2013-09-26 | Basf Se | Urea compounds for improving the solid state properties of polyamide resins |
| WO2013188490A1 (en) | 2012-06-13 | 2013-12-19 | Cytec Technology Corp. | Stabilizer compositions containing substituted chroman compounds and methods of use |
| WO2014009361A1 (en) | 2012-07-13 | 2014-01-16 | Basf Se | Polyglycol bis-[3-(7-tert-butyl-2-oxo-3-phenyl-3h-benzofuran-5-yl-)propanoyl] derivatives as stabilizers of organic material |
| US9969864B2 (en) | 2013-07-08 | 2018-05-15 | Basf Se | Light stabilizers |
| US11180476B2 (en) | 2013-10-17 | 2021-11-23 | Basf Se | Hindered amine light stabilizers |
| US10119039B2 (en) | 2013-10-29 | 2018-11-06 | Basf Se | Use of 2-(2-hydroxyphenyl)benzotriazole compounds as an UV absorbing agent in coatings |
| WO2015077635A2 (en) | 2013-11-22 | 2015-05-28 | Polnox Corporation | Macromolecular antioxidants based on dual type moiety per molecule: structures methods of making and using the same |
| EP2876126A1 (en) | 2013-11-25 | 2015-05-27 | Basf Se | A stabilizer mixture |
| US9951207B2 (en) | 2014-02-17 | 2018-04-24 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| EP3428228A1 (en) | 2014-02-17 | 2019-01-16 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US10259931B2 (en) | 2014-02-17 | 2019-04-16 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US9732254B2 (en) | 2014-04-29 | 2017-08-15 | Basf Se | Multi-layered film and the use thereof |
| US10253164B2 (en) | 2014-05-15 | 2019-04-09 | Basf Se | Highly effective stabilizer |
| US10717847B2 (en) | 2014-05-15 | 2020-07-21 | Basf Se | Highly effective stabilizer |
| US10072136B2 (en) | 2014-08-05 | 2018-09-11 | Basf Se | 3-phenyl-benzofuran-2-one diphosphite derivatives as stabilizers |
| EP3050919A1 (de) | 2015-01-29 | 2016-08-03 | Basf Se | Lignocellulosehaltige materialen enthaltend mischungen mit salzen von n-substituierten carbamidsäuren |
| US10689495B2 (en) | 2015-02-20 | 2020-06-23 | Basf Se | Light stabilized polyolefin films, tapes and monofilaments |
| US11021585B2 (en) | 2015-02-20 | 2021-06-01 | Basf Se | Light stabilized polyolefin films, tapes and monofilaments |
| WO2016131791A1 (en) | 2015-02-20 | 2016-08-25 | Basf Se | Light stabilized polyolefin films, tapes and monofilaments |
| EP3473670A1 (en) | 2015-02-20 | 2019-04-24 | Basf Se | Light stabilized polyolefin films, tapes and monofilaments |
| US12006417B2 (en) | 2015-07-27 | 2024-06-11 | Basf Se | Additive mixture containing a particular sterically hindered amine compound and a heat reflecting interference pigment |
| WO2017025431A1 (en) | 2015-08-10 | 2017-02-16 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US10590263B2 (en) | 2015-08-10 | 2020-03-17 | Basf Se | 3-phenyl-benzofuran-2-one derivatives containing phosphorus as stabilizers |
| US10683409B2 (en) | 2016-01-21 | 2020-06-16 | Basf Se | Additive mixture for stabilization of polyol and polyurethane |
| US10927236B2 (en) | 2016-09-12 | 2021-02-23 | Basf Se | Additive mixture |
| WO2018046301A1 (en) | 2016-09-12 | 2018-03-15 | Basf Se | Additive mixture |
| WO2018145283A1 (en) | 2017-02-09 | 2018-08-16 | Dow Global Technologies Llc | Polyurethane foams having low levels of aldehyde emissions |
| WO2018148959A1 (en) | 2017-02-20 | 2018-08-23 | Dow Global Technologies Llc | Polyurethanes having reduced aldehyde emissions |
| US11136444B2 (en) | 2017-02-20 | 2021-10-05 | Dow Global Technologies Llc | Polyurethanes having reduced aldehyde emissions |
| US11542386B2 (en) | 2017-03-28 | 2023-01-03 | Basf Se | Light stabilizer mixture |
| WO2018177846A1 (en) | 2017-03-28 | 2018-10-04 | Basf Se | Light stabilizer mixture |
| WO2018202707A1 (en) | 2017-05-03 | 2018-11-08 | Basf Se | Nucleating agents, methods for their production, and associated polymer compositions |
| US11414531B2 (en) | 2017-05-03 | 2022-08-16 | Basf Se | Nucleating agents, methods for their production, and associated polymer compositions |
| EP3424977A1 (en) | 2017-06-30 | 2019-01-09 | 3V SIGMA S.p.A | Hindered polymeric amines |
| WO2019008002A1 (en) | 2017-07-03 | 2019-01-10 | Basf Se | PHENOLIC METAL SALTS AND THEIR PHENOLIC ACIDS AS STABILIZERS OF POLYMERS |
| US12421379B2 (en) | 2017-07-06 | 2025-09-23 | Basf Se | Polyethylene pipe |
| WO2019007935A1 (en) | 2017-07-06 | 2019-01-10 | Basf Se | POLYETHYLENE PIPE |
| EP3428156A1 (en) | 2017-07-11 | 2019-01-16 | 3V SIGMA S.p.A | Hindered amines |
| WO2019053187A1 (en) | 2017-09-18 | 2019-03-21 | Basf Se | MIXTURE OF ADDITIVES |
| WO2019192982A1 (en) | 2018-04-04 | 2019-10-10 | Basf Se | Use of an ultraviolet radiation absorbing polymer composition (uvrap) as an uv absorbing agent in a coating for non-living and non-keratinous materials |
| US11773277B2 (en) | 2018-04-04 | 2023-10-03 | Basf Se | Use of an ultraviolet radiation absorbing polymer composition (UVRAP) as an UV absorbing agent in a coating for non-living and non-keratinous materials |
| US11981793B2 (en) | 2018-04-04 | 2024-05-14 | Basf Se | Use of an ultraviolet radiation absorbing composition as a light stabilizer for a shaped artificial polymer article |
| WO2019192943A1 (en) | 2018-04-04 | 2019-10-10 | Basf Se | Use of an ultraviolet radiation absorbing composition as a light stabilizer for a shaped artificial polymer article |
| WO2019243267A1 (en) | 2018-06-21 | 2019-12-26 | Basf Se | 3-phenyl-benzofuran-2-one diphosphate derivatives as stabilizers |
| WO2020024235A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024233A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024236A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020024231A1 (en) | 2018-08-02 | 2020-02-06 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyurethane foams |
| WO2020114810A1 (en) | 2018-12-04 | 2020-06-11 | Basf Se | Polyethylene or polypropylene articles |
| US12269938B2 (en) | 2018-12-04 | 2025-04-08 | Basf Se | Polyethylene or polypropylene articles |
| US12209174B2 (en) | 2018-12-21 | 2025-01-28 | Basf Se | Polypropylene composition |
| WO2020126752A1 (en) | 2018-12-21 | 2020-06-25 | Basf Se | A polypropylene composition |
| WO2020182587A1 (en) | 2019-03-08 | 2020-09-17 | Basf Se | Sterically hindered amine stabilizer mixtures |
| WO2020182709A1 (en) | 2019-03-12 | 2020-09-17 | Basf Se | Shaped artificial polymer articles |
| WO2021035662A1 (en) | 2019-08-30 | 2021-03-04 | Dow Global Technologies Llc | Methods for reducing aldehyde emissions in polyether polyols and polyurethane foams |
| WO2021160524A1 (en) | 2020-02-10 | 2021-08-19 | Basf Se | Light stabilizer mixture |
| WO2021170615A1 (en) | 2020-02-26 | 2021-09-02 | Basf Se | Additive mixtures for rheology modification of polymers |
| WO2021170599A1 (en) | 2020-02-27 | 2021-09-02 | Basf Se | Polyolefin compositions |
| WO2022096356A1 (en) | 2020-11-03 | 2022-05-12 | Basf Se | Method for stabilizing an organic material using a stabilizer mixture |
| WO2022122818A1 (en) | 2020-12-09 | 2022-06-16 | Basf Se | Additive mixtures |
| WO2022122868A1 (en) | 2020-12-09 | 2022-06-16 | Basf Se | An organic material based shaped article |
| WO2022210295A1 (ja) | 2021-03-30 | 2022-10-06 | 住友化学株式会社 | 亜リン酸エステル化合物、その製造方法及びその用途 |
| WO2022207787A1 (en) | 2021-04-01 | 2022-10-06 | Basf Se | Stabilizer mixture |
| WO2022243306A1 (en) | 2021-05-21 | 2022-11-24 | Rhodia Operations | Stabilized polymer resin systems having heteropolyoxometalates for antimicrobial properties and uses thereof |
| WO2022255116A1 (ja) | 2021-05-31 | 2022-12-08 | 住友化学株式会社 | 亜リン酸エステル組成物 |
| WO2023286616A1 (ja) | 2021-07-15 | 2023-01-19 | 住友化学株式会社 | フェノール化合物、有機材料用安定剤、樹脂組成物、及び有機材料の安定化方法 |
| WO2023001717A1 (en) | 2021-07-17 | 2023-01-26 | Basf Se | An additive mixture for stabilization of organic material |
| WO2023030859A1 (en) | 2021-09-02 | 2023-03-09 | Basf Se | Stabilizer combination for preventing degradation of synthetic polymers |
| WO2023041690A1 (en) | 2021-09-16 | 2023-03-23 | Basf Se | Stabilizer formulation |
| WO2023117980A1 (en) | 2021-12-21 | 2023-06-29 | Basf Se | Environmental attributes for plastic additives |
| WO2023129464A1 (en) | 2022-01-01 | 2023-07-06 | Cytec Industries Inc. | Polymer compositions having densification accelerators and rotational molding processes for making hollow articles therefrom |
| WO2023141091A1 (en) | 2022-01-18 | 2023-07-27 | Basf Se | Shaped artificial polymer articles with closed-cell metal oxide particles |
| WO2023141089A1 (en) | 2022-01-18 | 2023-07-27 | Basf Se | Shaped artificial polymer articles with hybrid metal oxide particles |
| WO2023166978A1 (ja) | 2022-03-03 | 2023-09-07 | 住友化学株式会社 | 加工安定剤、有機材料組成物、及び有機材料の安定化方法 |
| WO2023227472A1 (en) | 2022-05-24 | 2023-11-30 | Basf Se | Polycarbonate composition containing combination of hydroxyphenyl triazines and uv absorbers |
| WO2024037851A1 (en) | 2022-08-19 | 2024-02-22 | Basf Se | Use of additives for improving the processing of polyethylenes |
| WO2024052176A1 (en) | 2022-09-07 | 2024-03-14 | Basf Se | Rheology modifying of polymers with a radical initiator and thiourethane |
| WO2024068415A1 (en) | 2022-09-29 | 2024-04-04 | Basf Se | Co-stabilizers for hydroxyphenyl triazine stabilized polymers |
| WO2024075651A1 (ja) | 2022-10-03 | 2024-04-11 | 住友化学株式会社 | 安定剤、有機材料組成物、及び有機材料の安定化方法 |
| WO2024133667A1 (en) | 2022-12-21 | 2024-06-27 | Basf Se | A method for improving the processing of polyethylene |
| WO2024150714A1 (ja) | 2023-01-13 | 2024-07-18 | 住友化学株式会社 | 加工安定剤、樹脂組成物、および有機材料の安定化方法 |
| EP4650401A1 (en) | 2023-01-13 | 2025-11-19 | Sumitomo Chemical Company, Limited | Processing stabilizer, resin composition, and organic material stabilizing method |
| WO2024153546A1 (en) | 2023-01-16 | 2024-07-25 | Basf Se | Phenyl triazine co-stabilizers for stabilized polyurethanes |
| WO2024153547A1 (en) | 2023-01-16 | 2024-07-25 | Basf Se | Hydroxyphenyltriazine co-stabilizers for stabilized polyesters |
| WO2025087886A1 (en) | 2023-10-26 | 2025-05-01 | Basf Se | Polyolefin pipe comprising a hydrotalcite mineral and a hydrazide |
| WO2025223984A1 (en) | 2024-04-22 | 2025-10-30 | Basf Se | Flame retardant articles comprising polylactic acid |
| WO2026046898A1 (en) | 2024-08-30 | 2026-03-05 | Basf Se | An interlayer film for laminated glass comprising a resorcinol triazine uv absorber |
Also Published As
| Publication number | Publication date |
|---|---|
| TW254956B (enExample) | 1995-08-21 |
| KR100286116B1 (ko) | 2001-04-16 |
| FR2691469B1 (fr) | 1995-02-24 |
| GB9309641D0 (en) | 1993-06-23 |
| BE1006568A3 (fr) | 1994-10-18 |
| JPH0641110A (ja) | 1994-02-15 |
| ITMI930989A1 (it) | 1994-11-14 |
| JP3250056B2 (ja) | 2002-01-28 |
| SK49493A3 (en) | 1994-05-11 |
| CZ91893A3 (en) | 1993-12-15 |
| KR940005734A (ko) | 1994-03-22 |
| CA2096485A1 (en) | 1993-11-23 |
| ITMI930989A0 (it) | 1993-05-14 |
| NL9300865A (nl) | 1993-12-16 |
| GB2267490A (en) | 1993-12-08 |
| IT1264451B1 (it) | 1996-09-23 |
| FR2691469A1 (fr) | 1993-11-26 |
| GB2267490B (en) | 1995-08-09 |
| CZ290103B6 (cs) | 2002-05-15 |
| US5356966A (en) | 1994-10-18 |
| SK280041B6 (sk) | 1999-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4316622A1 (de) | 3-(Carboxymethoxyphenyl)benzofuran-2-one als Stabilisatoren | |
| EP0589839B1 (de) | 3-(Dihydrobenzofuran-5-yl)benzofuran-2-one als Stabilisatoren | |
| EP0591102B1 (de) | 3-(2-Acyloxyethoxyphenyl)benzofuran-2-one als Stabilisatoren | |
| US5216052A (en) | Bisbenzofuran-2-ones | |
| EP0644190B1 (de) | Benzofuran-2-one als Stabilisatoren | |
| DE4220992A1 (de) | Thiomethylierte benzofuran-2-one | |
| DE4316876A1 (de) | 3-(Alkoxyphenyl)benzofuran-2-one als Stabilisatoren | |
| DE4316611A1 (de) | 3-(Acyloxyphenyl)benzofuran-2-one als Stabilisatoren | |
| DE69522124T2 (de) | Silangruppen enthaltende 1-Hydrocarbyloxy-Piperidin-Verbindungen als Stabilisatoren für organisches Material | |
| DE69308319T2 (de) | Alpha kristalline modifikation des 2, 2', 2''-nitrilotriethyl-tris-(3, 3', 5 , 5'-tetra-tert-butyl-1, 1-biphenyl-2,2-diyl)phosphite | |
| EP0601973B1 (de) | Oligomere HALS-Phosphite und HALS-Phosphonite als Stabilisatoren | |
| EP0594539B1 (de) | Phenylphosphite als Stabilisatoren für organische Materialien | |
| DE4337372A1 (de) | alpha,w-Alkandiphenole | |
| EP0677529A1 (de) | Oligomere Aliphatische HALS-Phosphite und HALS-Phosphonite als Stabilisatoren | |
| EP0685519A1 (de) | Oligomere HALS-Phosphite und HALS-Phosphonite als Stabilisatoren | |
| EP0579576B1 (de) | 2,4-Dialkyl-6-sec-alkylphenole | |
| EP0707035B1 (de) | HALS-Phosphorinane als Stabilisatoren | |
| EP0608198A1 (de) | Cyclische Diphenylacetonitrile als Stabilisatoren | |
| DE19513585A1 (de) | HALS-Phosphite und HALS-Phophoramide als Stabilisatoren | |
| EP0553059B1 (de) | Neue Cycloalkyliden-bisphenol-phosphite | |
| DE4305422A1 (enExample) | ||
| EP0545861B1 (de) | Diphenylessigsäurederivate als Stabilisatoren für organisches Material | |
| DE19513543A1 (de) | HALS-Phosphite als Stabilisatoren | |
| EP0850946A1 (de) | Cyclische Phosphinsäurederivate als Stabilisatoren | |
| DE19513541A1 (de) | Monomere und Oligomere Bisphenyl-HALS-Phosphite als Stabilisatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: CIBA SPECIALTY CHEMICALS HOLDING INC., BASEL, CH |
|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |