DE4021016A1 - Baukoerper zur anordnung von armaturen fuer eine klimaanlage - Google Patents
Baukoerper zur anordnung von armaturen fuer eine klimaanlageInfo
- Publication number
- DE4021016A1 DE4021016A1 DE19904021016 DE4021016A DE4021016A1 DE 4021016 A1 DE4021016 A1 DE 4021016A1 DE 19904021016 DE19904021016 DE 19904021016 DE 4021016 A DE4021016 A DE 4021016A DE 4021016 A1 DE4021016 A1 DE 4021016A1
- Authority
- DE
- Germany
- Prior art keywords
- channel
- section
- lines
- structure according
- electrical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004378 air conditioning Methods 0.000 title claims description 3
- 238000010438 heat treatment Methods 0.000 claims abstract description 14
- 238000010276 construction Methods 0.000 claims description 4
- 239000004035 construction material Substances 0.000 claims description 3
- 241001123248 Arma Species 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 2
- 239000011449 brick Substances 0.000 description 2
- 238000004891 communication Methods 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000010616 electrical installation Methods 0.000 description 1
- 238000009429 electrical wiring Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000012549 training Methods 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04C—STRUCTURAL ELEMENTS; BUILDING MATERIALS
- E04C2/00—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels
- E04C2/44—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the purpose
- E04C2/52—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the purpose with special adaptations for auxiliary purposes, e.g. serving for locating conduits
- E04C2/521—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the purpose with special adaptations for auxiliary purposes, e.g. serving for locating conduits serving for locating conduits; for ventilating, heating or cooling
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04F—FINISHING WORK ON BUILDINGS, e.g. STAIRS, FLOORS
- E04F17/00—Vertical ducts; Channels, e.g. for drainage
- E04F17/08—Vertical ducts; Channels, e.g. for drainage for receiving utility lines, e.g. cables, pipes
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04F—FINISHING WORK ON BUILDINGS, e.g. STAIRS, FLOORS
- E04F19/00—Other details of constructional parts for finishing work on buildings
- E04F19/08—Built-in cupboards; Masks of niches; Covers of holes enabling access to installations
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Floor Finish (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH89190A CH681033A5 (enExample) | 1990-03-19 | 1990-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4021016A1 true DE4021016A1 (de) | 1991-09-26 |
Family
ID=4197589
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19904021016 Withdrawn DE4021016A1 (de) | 1990-03-19 | 1990-07-02 | Baukoerper zur anordnung von armaturen fuer eine klimaanlage |
Country Status (2)
| Country | Link |
|---|---|
| CH (1) | CH681033A5 (enExample) |
| DE (1) | DE4021016A1 (enExample) |
Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2260178A (en) * | 1940-02-05 | 1941-10-21 | Jr Emile S Guignon | Removable panel |
| CH224158A (de) * | 1941-07-12 | 1942-11-15 | Irion G M B H | Mauerwerk. |
| US2419319A (en) * | 1945-04-09 | 1947-04-22 | Lankton Joel Fletcher | Portable utility building core unit |
| DE1883553U (de) * | 1963-09-17 | 1963-11-28 | Sanbloc G M B H | Vorgefertigte installationswand. |
| DE1891937U (de) * | 1963-12-17 | 1964-04-30 | Heinrich Becker Fa | Wandplatte. |
| DE7203228U (de) * | 1971-09-16 | 1973-03-22 | Meile E | Installationsblock |
| DE2403187A1 (de) * | 1973-11-15 | 1975-05-28 | Werner Dipl Ing Vogt | Installationseinrichtung zur versetzung in bauwerken |
| DE2835849A1 (de) * | 1977-09-13 | 1979-03-22 | Maroni Francesco & Co | Waerme- und schallisolierende verlorene schalung |
| DE7901232U1 (de) * | 1979-01-18 | 1980-06-26 | Heinrich Nickel Gmbh, 5240 Betzdorf | Einbaufertiges wandelement fuer eine sanitaerzelle u.dgl. |
| DE2852944A1 (de) * | 1978-12-07 | 1980-08-21 | Kurt Ing Grad Aberle | Mauerstein mit ausnehmung fuer installationsrohre |
| DE2916057A1 (de) * | 1979-04-20 | 1980-10-30 | Passavant Werke | Fuer den bodeneinbau bestimmter anschlusskasten fuer versorgungsleitungen |
| DE8206901U1 (de) * | 1982-03-12 | 1983-08-25 | Schlaf, Karl, 5010 Bergheim | Installationsgestell mit fertigteil-bauelementen fuer sanitaerobjekte u.dgl. |
| DE3338246A1 (de) * | 1983-10-21 | 1985-05-02 | Veit Dennert KG Baustoffbetriebe, 8602 Schlüsselfeld | Fertigbauelement aus stahlbeton |
| DE8603659U1 (de) * | 1986-02-12 | 1988-06-23 | Vahlbrauk, Karl Heinz, 37581 Bad Gandersheim | Installations-Wandelement |
| DE3901828A1 (de) * | 1989-01-23 | 1989-09-21 | Alfred Pistner | Staenderwand mit integrierten kabelkanaelen |
| DE8717828U1 (de) * | 1987-01-08 | 1990-06-21 | Vahlbrauk, Karl Heinz, 3353 Bad Gandersheim | Installationswandelement |
-
1990
- 1990-03-19 CH CH89190A patent/CH681033A5/de not_active IP Right Cessation
- 1990-07-02 DE DE19904021016 patent/DE4021016A1/de not_active Withdrawn
Patent Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2260178A (en) * | 1940-02-05 | 1941-10-21 | Jr Emile S Guignon | Removable panel |
| CH224158A (de) * | 1941-07-12 | 1942-11-15 | Irion G M B H | Mauerwerk. |
| US2419319A (en) * | 1945-04-09 | 1947-04-22 | Lankton Joel Fletcher | Portable utility building core unit |
| DE1883553U (de) * | 1963-09-17 | 1963-11-28 | Sanbloc G M B H | Vorgefertigte installationswand. |
| DE1891937U (de) * | 1963-12-17 | 1964-04-30 | Heinrich Becker Fa | Wandplatte. |
| DE7203228U (de) * | 1971-09-16 | 1973-03-22 | Meile E | Installationsblock |
| DE2403187A1 (de) * | 1973-11-15 | 1975-05-28 | Werner Dipl Ing Vogt | Installationseinrichtung zur versetzung in bauwerken |
| DE2835849A1 (de) * | 1977-09-13 | 1979-03-22 | Maroni Francesco & Co | Waerme- und schallisolierende verlorene schalung |
| DE2852944A1 (de) * | 1978-12-07 | 1980-08-21 | Kurt Ing Grad Aberle | Mauerstein mit ausnehmung fuer installationsrohre |
| DE7901232U1 (de) * | 1979-01-18 | 1980-06-26 | Heinrich Nickel Gmbh, 5240 Betzdorf | Einbaufertiges wandelement fuer eine sanitaerzelle u.dgl. |
| DE2916057A1 (de) * | 1979-04-20 | 1980-10-30 | Passavant Werke | Fuer den bodeneinbau bestimmter anschlusskasten fuer versorgungsleitungen |
| DE8206901U1 (de) * | 1982-03-12 | 1983-08-25 | Schlaf, Karl, 5010 Bergheim | Installationsgestell mit fertigteil-bauelementen fuer sanitaerobjekte u.dgl. |
| DE3338246A1 (de) * | 1983-10-21 | 1985-05-02 | Veit Dennert KG Baustoffbetriebe, 8602 Schlüsselfeld | Fertigbauelement aus stahlbeton |
| DE8603659U1 (de) * | 1986-02-12 | 1988-06-23 | Vahlbrauk, Karl Heinz, 37581 Bad Gandersheim | Installations-Wandelement |
| DE8717828U1 (de) * | 1987-01-08 | 1990-06-21 | Vahlbrauk, Karl Heinz, 3353 Bad Gandersheim | Installationswandelement |
| DE3901828A1 (de) * | 1989-01-23 | 1989-09-21 | Alfred Pistner | Staenderwand mit integrierten kabelkanaelen |
Also Published As
| Publication number | Publication date |
|---|---|
| CH681033A5 (enExample) | 1992-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2252006A1 (de) | Transportfaehige bausystemgruppe zum einbau in gebaeude | |
| EP3530825B1 (de) | Sanitärinstallation | |
| DE102020121629A1 (de) | Induktionskochfeld und Verfahren zu dessen Herstellung | |
| DE68914246T2 (de) | Vorgefertigte Elemente für Klimatisation durch Strahlung oder Strahlung/Ventilation und eine diese Elemente enthaltende Klimaanlage. | |
| DE202007016111U1 (de) | Vorwandsystem für die Gebäudesystemtechnik | |
| EP0670985B1 (de) | Wandelement mit integrierter heizung | |
| WO2009156059A1 (de) | T-förmiges abzweigstück, insbesondere für ein lüftungssystem | |
| DE3310138A1 (de) | Anschlussdose | |
| DE4021016A1 (de) | Baukoerper zur anordnung von armaturen fuer eine klimaanlage | |
| DE4025798C2 (de) | Vorwandinstallation einer sanitären Brauseanlage | |
| EP3055463B1 (de) | Vorrichtung zum anschluss von sanitärarmaturen | |
| EP1674648B1 (de) | Elementmodul zum Einbau in Fassaden und dergleichen | |
| DE2460960A1 (de) | Nasszelle | |
| DE9110913U1 (de) | Sanitärelement | |
| EP0035642A1 (de) | Heizungsverteiler | |
| DE3338130A1 (de) | Bauelement, insbesondere baustein | |
| EP0698770A1 (de) | Heizkörperanordnung | |
| EP4249795B1 (de) | Halterungssystem | |
| EP1612901B1 (de) | Versorgungseinrichtung zur Bereitstellung von Versorgungsmedien | |
| DE3319500C2 (de) | Luft-Fußbodenheizung | |
| DE19738172C1 (de) | Einrichtung zum Temperieren von Gebäuden | |
| DE7901232U1 (de) | Einbaufertiges wandelement fuer eine sanitaerzelle u.dgl. | |
| DE102006053723A1 (de) | Fertigteil- Anordnung mit Lüftungs-Einrichtung | |
| WO1997007302A1 (de) | Mehrwandiges bauteil | |
| DE2417442A1 (de) | Abgehaengte raumdecke sowie bauelementensatz und leuchten zu ihrer montage |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8110 | Request for examination paragraph 44 | ||
| 8139 | Disposal/non-payment of the annual fee |