DE3903407A1 - Dentales fuellungsmaterial - Google Patents
Dentales fuellungsmaterialInfo
- Publication number
- DE3903407A1 DE3903407A1 DE3903407A DE3903407A DE3903407A1 DE 3903407 A1 DE3903407 A1 DE 3903407A1 DE 3903407 A DE3903407 A DE 3903407A DE 3903407 A DE3903407 A DE 3903407A DE 3903407 A1 DE3903407 A1 DE 3903407A1
- Authority
- DE
- Germany
- Prior art keywords
- dental filling
- dental
- structural elements
- filling material
- structural
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000463 material Substances 0.000 title claims description 19
- 238000011049 filling Methods 0.000 claims description 20
- 239000000945 filler Substances 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 239000002131 composite material Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- -1 acrylic ester Chemical class 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical group [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052726 zirconium Chemical group 0.000 claims description 3
- 239000002244 precipitate Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- GHLKSLMMWAKNBM-UHFFFAOYSA-N dodecane-1,12-diol Chemical compound OCCCCCCCCCCCCO GHLKSLMMWAKNBM-UHFFFAOYSA-N 0.000 description 6
- 239000000178 monomer Substances 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- VNQXSTWCDUXYEZ-UHFFFAOYSA-N 1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione Chemical compound C1CC2(C)C(=O)C(=O)C1C2(C)C VNQXSTWCDUXYEZ-UHFFFAOYSA-N 0.000 description 3
- LMGYOBQJBQAZKC-UHFFFAOYSA-N 1-(2-ethylphenyl)-2-hydroxy-2-phenylethanone Chemical compound CCC1=CC=CC=C1C(=O)C(O)C1=CC=CC=C1 LMGYOBQJBQAZKC-UHFFFAOYSA-N 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229930006711 bornane-2,3-dione Natural products 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- RMKZLFMHXZAGTM-UHFFFAOYSA-N [dimethoxy(propyl)silyl]oxymethyl prop-2-enoate Chemical compound CCC[Si](OC)(OC)OCOC(=O)C=C RMKZLFMHXZAGTM-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- TZMFJUDUGYTVRY-UHFFFAOYSA-N pentane-2,3-dione Chemical compound CCC(=O)C(C)=O TZMFJUDUGYTVRY-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 239000003505 polymerization initiator Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- CIDZDYAPPNMBIY-UHFFFAOYSA-N (4-butylphenyl)methanol Chemical compound CCCCC1=CC=C(CO)C=C1 CIDZDYAPPNMBIY-UHFFFAOYSA-N 0.000 description 1
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 description 1
- LTHJXDSHSVNJKG-UHFFFAOYSA-N 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOCCOC(=O)C(C)=C LTHJXDSHSVNJKG-UHFFFAOYSA-N 0.000 description 1
- JUVSRZCUMWZBFK-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-methylanilino]ethanol Chemical compound CC1=CC=C(N(CCO)CCO)C=C1 JUVSRZCUMWZBFK-UHFFFAOYSA-N 0.000 description 1
- BQZJOQXSCSZQPS-UHFFFAOYSA-N 2-methoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC)C(=O)C1=CC=CC=C1 BQZJOQXSCSZQPS-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- XDLMVUHYZWKMMD-UHFFFAOYSA-N 3-trimethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C(C)=C XDLMVUHYZWKMMD-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 description 1
- XFOFBPRPOAWWPA-UHFFFAOYSA-N 6-hydroxyhexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCCCO XFOFBPRPOAWWPA-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical class CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- AMFGWXWBFGVCKG-UHFFFAOYSA-N Panavia opaque Chemical compound C1=CC(OCC(O)COC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OCC(O)COC(=O)C(C)=C)C=C1 AMFGWXWBFGVCKG-UHFFFAOYSA-N 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000005224 alkoxybenzenes Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 229910052916 barium silicate Inorganic materials 0.000 description 1
- HMOQPOVBDRFNIU-UHFFFAOYSA-N barium(2+);dioxido(oxo)silane Chemical compound [Ba+2].[O-][Si]([O-])=O HMOQPOVBDRFNIU-UHFFFAOYSA-N 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- ABIDBMKSPYZAQJ-UHFFFAOYSA-N bis(2,4-dimethyl-3-oxopent-4-enyl) benzene-1,2-dicarboxylate Chemical compound CC(=C)C(=O)C(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C(=O)C(C)=C ABIDBMKSPYZAQJ-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 239000002241 glass-ceramic Substances 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 1
- DIAIBWNEUYXDNL-UHFFFAOYSA-N n,n-dihexylhexan-1-amine Chemical compound CCCCCCN(CCCCCC)CCCCCC DIAIBWNEUYXDNL-UHFFFAOYSA-N 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- DXGLGDHPHMLXJC-UHFFFAOYSA-N oxybenzone Chemical group OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXGLGDHPHMLXJC-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 238000002444 silanisation Methods 0.000 description 1
- 125000005372 silanol group Chemical group 0.000 description 1
- 239000005368 silicate glass Substances 0.000 description 1
- 150000004979 silylperoxides Chemical class 0.000 description 1
- 238000003980 solgel method Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K6/00—Preparations for dentistry
- A61K6/80—Preparations for artificial teeth, for filling teeth or for capping teeth
- A61K6/884—Preparations for artificial teeth, for filling teeth or for capping teeth comprising natural or synthetic resins
- A61K6/887—Compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
Landscapes
- Health & Medical Sciences (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Plastic & Reconstructive Surgery (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Dental Preparations (AREA)
- Cosmetics (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3903407A DE3903407A1 (de) | 1989-02-06 | 1989-02-06 | Dentales fuellungsmaterial |
| DE69018289T DE69018289T2 (de) | 1989-02-06 | 1990-01-18 | Zahnfüllungsmaterial. |
| EP90100966A EP0381961B1 (en) | 1989-02-06 | 1990-01-18 | Dental filling material |
| ES90100966T ES2076977T3 (es) | 1989-02-06 | 1990-01-18 | Material de empaste dental. |
| DK90100966.2T DK0381961T3 (da) | 1989-02-06 | 1990-01-18 | Dentalt fyldningsmateriale |
| CA002008895A CA2008895C (en) | 1989-02-06 | 1990-01-30 | Dental filling material |
| US07/474,413 US5112884A (en) | 1989-02-06 | 1990-02-02 | Dental filling material |
| DD90337520A DD291695A5 (de) | 1989-02-06 | 1990-02-02 | Dental-fuellmaterial |
| SU904743118A RU2050846C1 (ru) | 1989-02-06 | 1990-02-05 | Пломбировочный материал |
| AU49075/90A AU641138B2 (en) | 1989-02-06 | 1990-02-05 | Dental filling material |
| KR1019900001325A KR0179984B1 (ko) | 1989-02-06 | 1990-02-05 | 치과용 충전재 |
| IE40890A IE72492B1 (en) | 1989-02-06 | 1990-02-05 | Dental filling material |
| JP2025916A JP3001218B2 (ja) | 1989-02-06 | 1990-02-05 | 歯科充填物質 |
| HU90687A HU209415B (en) | 1989-02-06 | 1990-02-06 | Dental filling material |
| GR940403819T GR3015698T3 (en) | 1989-02-06 | 1995-04-06 | Dental filling material. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3903407A DE3903407A1 (de) | 1989-02-06 | 1989-02-06 | Dentales fuellungsmaterial |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3903407A1 true DE3903407A1 (de) | 1990-08-09 |
| DE3903407C2 DE3903407C2 (OSRAM) | 1991-04-18 |
Family
ID=6373475
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3903407A Granted DE3903407A1 (de) | 1989-02-06 | 1989-02-06 | Dentales fuellungsmaterial |
| DE69018289T Expired - Fee Related DE69018289T2 (de) | 1989-02-06 | 1990-01-18 | Zahnfüllungsmaterial. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69018289T Expired - Fee Related DE69018289T2 (de) | 1989-02-06 | 1990-01-18 | Zahnfüllungsmaterial. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5112884A (OSRAM) |
| EP (1) | EP0381961B1 (OSRAM) |
| JP (1) | JP3001218B2 (OSRAM) |
| KR (1) | KR0179984B1 (OSRAM) |
| AU (1) | AU641138B2 (OSRAM) |
| CA (1) | CA2008895C (OSRAM) |
| DD (1) | DD291695A5 (OSRAM) |
| DE (2) | DE3903407A1 (OSRAM) |
| DK (1) | DK0381961T3 (OSRAM) |
| ES (1) | ES2076977T3 (OSRAM) |
| GR (1) | GR3015698T3 (OSRAM) |
| HU (1) | HU209415B (OSRAM) |
| IE (1) | IE72492B1 (OSRAM) |
| RU (1) | RU2050846C1 (OSRAM) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3913252A1 (de) * | 1989-04-22 | 1990-10-25 | Degussa | Dentalmaterial (i) |
| DE3913250A1 (de) * | 1989-04-22 | 1990-10-25 | Degussa | Dentalmaterial (ii) |
| DE4029230A1 (de) * | 1990-09-14 | 1992-03-19 | Ivoclar Ag | Polymerisierbarer dentalwerkstoff |
| DE4123946A1 (de) * | 1991-07-19 | 1993-01-28 | Degussa | Dentalmaterial mit alumoorganopolysiloxan-fuellstoff |
| DE4133494A1 (de) * | 1991-10-09 | 1993-04-15 | Fraunhofer Ges Forschung | Dentalharzmasse |
| US5248706A (en) * | 1989-04-22 | 1993-09-28 | Degussa Aktiengesellschaft | Process for preparing a pasty dental material which is an organopolysiloxane filler combined with a polymerizable bonding agent |
| DE19904816A1 (de) * | 1999-02-05 | 2000-09-14 | Espe Dental Ag | Dentalwerkstoff und Verwendung von monodispersen Organopolysiloxanpartikeln als Inhaltsstoff in einem Dentalwerkstoff |
| WO2001012679A1 (de) * | 1999-08-13 | 2001-02-22 | Deltamed Medizinprodukte Gmbh | Mit sichtbarem licht aushärtende zusammensetzung und deren verwendung |
| DE19524362C2 (de) * | 1994-07-04 | 2002-01-03 | Tokuyama Corp | Anorganische Zusammensetzung, insbesondere für dentale Zwecke |
| US6812266B2 (en) | 2001-08-10 | 2004-11-02 | Dentsply Detrey Gmbh | Hydrolysis stable one-part self-etching, self-priming dental adhesive |
| DE102006016474A1 (de) * | 2006-04-07 | 2007-10-11 | Ivoclar Vivadent Ag | Dentalmaterialien enthaltend hydrophobe, nanopartikuläre Kieselsäurecokondensate und deren Verwendung |
| US8364704B1 (en) | 1999-09-10 | 2013-01-29 | Nagravision S.A. | Method and system for transmitting messages for database |
| DE102014116402A1 (de) | 2014-11-11 | 2016-05-12 | Voco Gmbh | Verwendung radikalisch härtbarer Zusammensetzungen in generativen Fertigungsverfahren |
| US9839585B2 (en) | 2014-11-11 | 2017-12-12 | Voco Gmbh | Free radically curable dental compositions |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5219899A (en) * | 1989-04-22 | 1993-06-15 | Degussa Aktiengesellschaft | Pasty dental material which is an organopolysilane filler combined with a polymerizable bonding agent |
| DE9103321U1 (de) * | 1991-03-19 | 1992-08-27 | Thera Patent GmbH & Co KG Gesellschaft für industrielle Schutzrechte, 8031 Seefeld | Transparentversiegelter Dentalkunststoffkörper |
| GB9115154D0 (en) * | 1991-07-12 | 1991-08-28 | Patel Bipin C M | Sol-gel composition for producing glassy coatings |
| GB9115153D0 (en) * | 1991-07-12 | 1991-08-28 | Patel Bipin C M | Sol-gel composition for producing glassy coatings |
| FR2693664B1 (fr) * | 1992-07-20 | 1994-09-02 | Ceramiques Tech Soc D | Dispositif à membrane pour filtration, séparation ou réaction catalytique. |
| US6369164B1 (en) | 1993-05-26 | 2002-04-09 | Dentsply G.M.B.H. | Polymerizable compounds and compositions |
| US5998499A (en) | 1994-03-25 | 1999-12-07 | Dentsply G.M.B.H. | Liquid crystalline (meth)acrylate compounds, composition and method |
| US6353061B1 (en) | 1993-05-26 | 2002-03-05 | Dentsply Gmbh | α, ω-methacrylate terminated macromonomer compounds |
| US6177534B1 (en) | 1997-12-23 | 2001-01-23 | The United States Of America As Represented By The Secretary Of Commerce | Silylated resins and the synthesis thereof |
| US20020037258A1 (en) * | 1999-08-05 | 2002-03-28 | Gregory P. Dodd | Dental composition for the mineral occlusion of dentinal tubules in sensitive teeth |
| DE19860361A1 (de) | 1998-12-24 | 2000-06-29 | Espe Dental Ag | Vernetzbare Monomere auf Cyclosiloxanbasis, deren Herstellung und deren Verwendung in polymerisierbaren Massen |
| US6749945B2 (en) * | 2001-01-29 | 2004-06-15 | The Board Of Regents For Oklahoma State University | Advanced composite ormosil coatings |
| US6569942B2 (en) | 2001-03-14 | 2003-05-27 | The Goodyear Tire & Rubber Company | Rubber compositions containing silicon coupled oligomers |
| US6548599B2 (en) | 2001-03-14 | 2003-04-15 | The Goodyear Tire & Rubber Company | Rubber compositions containing silicon coupled oligomers |
| DE10137372C2 (de) | 2001-07-31 | 2003-07-10 | Ivoclar Vivadent Ag | Polymerisierbares Dentalmaterial auf der Basis chromophorer Xerogele |
| US20030199605A1 (en) * | 2002-04-23 | 2003-10-23 | Fischer Dan E. | Hydrophilic endodontic sealing compositions and methods for using such compositions |
| US7037965B2 (en) * | 2002-08-27 | 2006-05-02 | Acushnet Company | Golf balls comprising glass ionomers, ormocers, or other hybrid organic/inorganic compositions |
| US7238122B2 (en) * | 2002-08-27 | 2007-07-03 | Acushnet Company | Ormocer composites for golf ball components |
| US6793592B2 (en) * | 2002-08-27 | 2004-09-21 | Acushnet Company | Golf balls comprising glass ionomers, or other hybrid organic/inorganic compositions |
| EP1621179A1 (en) * | 2004-07-30 | 2006-02-01 | DENTSPLY DETREY GmbH | Laser curable polymerisable composition for the protection of hard tissue |
| US7828550B2 (en) | 2005-09-21 | 2010-11-09 | Ultradent Products, Inc. | Activating endodontic points and dental tools for initiating polymerization of dental compositions |
| JP2010519257A (ja) * | 2007-02-23 | 2010-06-03 | デンツプライ インターナショナル インコーポレーテッド | 二相光硬化材料を用いる歯科修復物の製造方法 |
| JP5269734B2 (ja) * | 2008-10-16 | 2013-08-21 | 株式会社デンソー | 重合硬化性組成物、その重合硬化方法、および重合硬化樹脂組成物 |
| US20180155846A1 (en) * | 2015-07-28 | 2018-06-07 | Hewlett-Packard Development Company, L.P. | Magnesium Alloy Substrate |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1617583B1 (de) * | 1967-08-19 | 1970-07-02 | Kulzer & Co Gmbh | Zahnfüll- und dentales Befestigungsmaterial |
| DE2224683A1 (de) * | 1971-05-24 | 1972-12-07 | Lee Phamaceuticals | Polyacrylsäureester-Harzverbindungen |
| US4188317A (en) * | 1978-07-28 | 1980-02-12 | Colgate-Palmolive Company | Dental restorative compositions containing titanium silicate |
| DE3135113A1 (de) * | 1981-09-04 | 1983-03-24 | Bayer Ag, 5090 Leverkusen | Photopolymerisierbare massen, deren verwendung fuer zahnaerztliche zwecke, sowie verfahren zur herstellung von zahnersatzteilen, zahnfuellungen und ueberzuegen |
| US4427799A (en) * | 1981-03-24 | 1984-01-24 | Blendax-Werke R. Schneider Gmbh & Co. | Dental restoring material and a filler therefor |
| US4764497A (en) * | 1981-12-23 | 1988-08-16 | Tokuyama Soda Kabushiki Kaisha | Amorphous, spherical inorganic compound and process for preparation thereof |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3801344A (en) * | 1971-06-30 | 1974-04-02 | Owens Illinois Inc | Tooth filling and facing compositions comprising a radiopaque glass and method of making the same |
| US3975203A (en) * | 1971-06-30 | 1976-08-17 | Owens-Illinois, Inc. | Composition for use as a filler in tooth filling and facing composition and method of making the same |
| DE2925969A1 (de) * | 1979-06-27 | 1981-01-29 | Fraunhofer Ges Forschung | Poroese membranen und adsorbentien, verfahren zu ihrer herstellung und ihre verwendung zur stofftrennung |
| JPS59203720A (ja) * | 1983-05-04 | 1984-11-17 | Tokuyama Soda Co Ltd | 結晶性金属酸化物及びその製造方法 |
| JPH0755882B2 (ja) * | 1987-02-13 | 1995-06-14 | 而至歯科工業株式会社 | 歯科用グラスアイオノマーセメント用ガラス粉末 |
| DE3854796T2 (de) * | 1987-04-02 | 1996-05-02 | Tohru Yamamoto | Verbundwerkstoff und Verfahren zu dessen Herstellung |
| DD293486A5 (de) * | 1989-02-06 | 1991-09-05 | Friedrich-Schiller-Universitaet Jena,De | Zahnrestaurationswerkstoffe |
| US5028638A (en) * | 1989-02-09 | 1991-07-02 | Bayer Aktiengesellschaft | Hybrid plastic filling material |
-
1989
- 1989-02-06 DE DE3903407A patent/DE3903407A1/de active Granted
-
1990
- 1990-01-18 DK DK90100966.2T patent/DK0381961T3/da active
- 1990-01-18 EP EP90100966A patent/EP0381961B1/en not_active Expired - Lifetime
- 1990-01-18 ES ES90100966T patent/ES2076977T3/es not_active Expired - Lifetime
- 1990-01-18 DE DE69018289T patent/DE69018289T2/de not_active Expired - Fee Related
- 1990-01-30 CA CA002008895A patent/CA2008895C/en not_active Expired - Lifetime
- 1990-02-02 DD DD90337520A patent/DD291695A5/de unknown
- 1990-02-02 US US07/474,413 patent/US5112884A/en not_active Expired - Lifetime
- 1990-02-05 AU AU49075/90A patent/AU641138B2/en not_active Expired
- 1990-02-05 KR KR1019900001325A patent/KR0179984B1/ko not_active Expired - Lifetime
- 1990-02-05 RU SU904743118A patent/RU2050846C1/ru active
- 1990-02-05 IE IE40890A patent/IE72492B1/en not_active IP Right Cessation
- 1990-02-05 JP JP2025916A patent/JP3001218B2/ja not_active Expired - Lifetime
- 1990-02-06 HU HU90687A patent/HU209415B/hu not_active IP Right Cessation
-
1995
- 1995-04-06 GR GR940403819T patent/GR3015698T3/el unknown
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1617583B1 (de) * | 1967-08-19 | 1970-07-02 | Kulzer & Co Gmbh | Zahnfüll- und dentales Befestigungsmaterial |
| DE2224683A1 (de) * | 1971-05-24 | 1972-12-07 | Lee Phamaceuticals | Polyacrylsäureester-Harzverbindungen |
| US4188317A (en) * | 1978-07-28 | 1980-02-12 | Colgate-Palmolive Company | Dental restorative compositions containing titanium silicate |
| US4427799A (en) * | 1981-03-24 | 1984-01-24 | Blendax-Werke R. Schneider Gmbh & Co. | Dental restoring material and a filler therefor |
| DE3135113A1 (de) * | 1981-09-04 | 1983-03-24 | Bayer Ag, 5090 Leverkusen | Photopolymerisierbare massen, deren verwendung fuer zahnaerztliche zwecke, sowie verfahren zur herstellung von zahnersatzteilen, zahnfuellungen und ueberzuegen |
| US4764497A (en) * | 1981-12-23 | 1988-08-16 | Tokuyama Soda Kabushiki Kaisha | Amorphous, spherical inorganic compound and process for preparation thereof |
Non-Patent Citations (3)
| Title |
|---|
| HAGER: Handbuch der Pharmazeutischen Praxis, 4. Ausgabe, Bd. VII 6, Berlin, 1977, S. 255- 258 * |
| MARXKORS/MEINERS: Taschenbuch der zahnärzt- lichen Werkstoffkunde, 3. Aufl., München, 1988, S. 225 * |
| RÖMPP: Chemie-Lexikon, 8. Aufl., Stuttgart, 1983, S. 2108-9 * |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3913250A1 (de) * | 1989-04-22 | 1990-10-25 | Degussa | Dentalmaterial (ii) |
| US5132337A (en) * | 1989-04-22 | 1992-07-21 | Degussa Aktiengesellschaft | Pasty dental material |
| US5248706A (en) * | 1989-04-22 | 1993-09-28 | Degussa Aktiengesellschaft | Process for preparing a pasty dental material which is an organopolysiloxane filler combined with a polymerizable bonding agent |
| DE3913252A1 (de) * | 1989-04-22 | 1990-10-25 | Degussa | Dentalmaterial (i) |
| DE4029230A1 (de) * | 1990-09-14 | 1992-03-19 | Ivoclar Ag | Polymerisierbarer dentalwerkstoff |
| DE4123946A1 (de) * | 1991-07-19 | 1993-01-28 | Degussa | Dentalmaterial mit alumoorganopolysiloxan-fuellstoff |
| DE4133494A1 (de) * | 1991-10-09 | 1993-04-15 | Fraunhofer Ges Forschung | Dentalharzmasse |
| DE19524362C2 (de) * | 1994-07-04 | 2002-01-03 | Tokuyama Corp | Anorganische Zusammensetzung, insbesondere für dentale Zwecke |
| DE19904816A1 (de) * | 1999-02-05 | 2000-09-14 | Espe Dental Ag | Dentalwerkstoff und Verwendung von monodispersen Organopolysiloxanpartikeln als Inhaltsstoff in einem Dentalwerkstoff |
| WO2001012679A1 (de) * | 1999-08-13 | 2001-02-22 | Deltamed Medizinprodukte Gmbh | Mit sichtbarem licht aushärtende zusammensetzung und deren verwendung |
| US8364704B1 (en) | 1999-09-10 | 2013-01-29 | Nagravision S.A. | Method and system for transmitting messages for database |
| US6812266B2 (en) | 2001-08-10 | 2004-11-02 | Dentsply Detrey Gmbh | Hydrolysis stable one-part self-etching, self-priming dental adhesive |
| DE102006016474A1 (de) * | 2006-04-07 | 2007-10-11 | Ivoclar Vivadent Ag | Dentalmaterialien enthaltend hydrophobe, nanopartikuläre Kieselsäurecokondensate und deren Verwendung |
| US8889758B2 (en) | 2006-04-07 | 2014-11-18 | Ivoclar Vivadent Ag | Dental materials containing hydrophobic nanoparticulate silicic acid co-condensates and use thereof |
| DE102014116402A1 (de) | 2014-11-11 | 2016-05-12 | Voco Gmbh | Verwendung radikalisch härtbarer Zusammensetzungen in generativen Fertigungsverfahren |
| EP3020361A1 (de) | 2014-11-11 | 2016-05-18 | VOCO GmbH | Verwendung radikalisch härtbarer zusammensetzungen in generativen fertigungsverfahren |
| US9795541B2 (en) | 2014-11-11 | 2017-10-24 | Voco Gmbh | Use of free radically curable compositions in additive manufacturing methods |
| US9839585B2 (en) | 2014-11-11 | 2017-12-12 | Voco Gmbh | Free radically curable dental compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0381961A2 (en) | 1990-08-16 |
| RU2050846C1 (ru) | 1995-12-27 |
| HU900687D0 (en) | 1990-04-28 |
| IE72492B1 (en) | 1997-04-23 |
| DE3903407C2 (OSRAM) | 1991-04-18 |
| DE69018289T2 (de) | 1995-11-23 |
| JPH02288816A (ja) | 1990-11-28 |
| HUT56486A (en) | 1991-09-30 |
| KR0179984B1 (ko) | 1999-03-20 |
| AU4907590A (en) | 1990-08-09 |
| AU641138B2 (en) | 1993-09-16 |
| GR3015698T3 (en) | 1995-07-31 |
| CA2008895A1 (en) | 1990-08-06 |
| HU209415B (en) | 1994-06-28 |
| DD291695A5 (de) | 1991-07-11 |
| ES2076977T3 (es) | 1995-11-16 |
| DE69018289D1 (de) | 1995-05-11 |
| IE900408L (en) | 1990-08-06 |
| US5112884A (en) | 1992-05-12 |
| KR900012592A (ko) | 1990-09-01 |
| JP3001218B2 (ja) | 2000-01-24 |
| EP0381961A3 (en) | 1991-07-17 |
| CA2008895C (en) | 1995-12-26 |
| EP0381961B1 (en) | 1995-04-05 |
| DK0381961T3 (da) | 1995-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3903407C2 (OSRAM) | ||
| EP0156105B1 (de) | Dentales Füllungsmaterial | |
| EP0060911B1 (de) | Dentales Füllungsmaterial | |
| EP0044352B1 (de) | Addukte aus Diisocyanaten und Methacryloylalkylethern, -alkoxybenzolen bzw. -alkoxycycloalkanen und deren Verwendung | |
| EP0091990B1 (de) | Dentales Restorationsmaterial | |
| EP2016931B1 (de) | Dentalkomposite mit niedriger Schrumpfspannung und hoher Biegefestigkeit | |
| EP0172513B1 (de) | Verwendung von porösen Füllstoffen in polymerisierbaren Dentalmassen, solche Massen und deren Verwendung zur Herstellung von Formkörpern | |
| EP0011735B1 (de) | Röntgenopake Dentalwerkstoffe auf Basis von organischen Kunststoffen in pastöser Form | |
| DE68908087T2 (de) | Dentales Restaurationsmaterial. | |
| DE3342601C1 (de) | Verwendung von bromierten aromatischen Diacrylsaeure- bzw. Dimethacrylsaeureestern in dentalen Fuellungsmaterialien | |
| EP0475239B1 (de) | Polymerisierbarer Dentalwerkstoff | |
| DE102005021332B4 (de) | Kompositmaterialien mit geringer Schrumpfkraft | |
| DE2403211C3 (de) | Werkstoff für Dentalzwecke | |
| EP0486775B1 (de) | Polymerisierbares Dentalmaterial | |
| DE3819777A1 (de) | Fuellstoffhaltige, polymerisierbare massen und deren verwendung | |
| DE3873953T2 (de) | Durch licht polymerisierbare zahnaerztliche zusammensetzung. | |
| EP0635478A1 (de) | Acrylate und Methacrylate auf Basis von Cyclohexyldiphenolen | |
| DE112013002309B4 (de) | Radikalisch polymerisierbares Dentalmaterial, gehärtetes Produkt und Verwendung | |
| EP1732499B1 (de) | Härtbare dentalmaterialien mit einer einstellbaren transluzenz | |
| EP0101807B1 (de) | Neue Tetra(meth)acrylsäureverbindungen und deren Verwendung | |
| CH617346A5 (en) | Curable cement composition | |
| DE2462271C3 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |