DE3782525T2 - Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung. - Google Patents
Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung.Info
- Publication number
- DE3782525T2 DE3782525T2 DE8787200296T DE3782525T DE3782525T2 DE 3782525 T2 DE3782525 T2 DE 3782525T2 DE 8787200296 T DE8787200296 T DE 8787200296T DE 3782525 T DE3782525 T DE 3782525T DE 3782525 T2 DE3782525 T2 DE 3782525T2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- group
- compound
- compounds
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- -1 (N-PIPERIDINYL) METHYL Chemical class 0.000 title abstract description 10
- 230000000561 anti-psychotic effect Effects 0.000 title abstract description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 68
- 238000000034 method Methods 0.000 claims abstract description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000000651 prodrug Substances 0.000 claims description 6
- 229940002612 prodrug Drugs 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 150000005357 2-phenylpyrroles Chemical class 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 239000012634 fragment Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000003511 tertiary amides Chemical class 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- PGNHBJGIQAEIHD-UHFFFAOYSA-N 1-(1-benzofuran-7-yl)-4-[[5-(4-fluorophenyl)-1h-pyrrol-2-yl]methyl]piperazine Chemical compound C1=CC(F)=CC=C1C(N1)=CC=C1CN1CCN(C=2C=3OC=CC=3C=CC=2)CC1 PGNHBJGIQAEIHD-UHFFFAOYSA-N 0.000 claims 1
- 230000004913 activation Effects 0.000 claims 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 8
- 230000000144 pharmacologic effect Effects 0.000 abstract description 3
- 230000015572 biosynthetic process Effects 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 230000002903 catalepsic effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000001143 conditioned effect Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZUPZKNPDQPDZHI-UHFFFAOYSA-N 4-(1-benzofuran-7-yl)-1-[5-(4-fluorophenyl)-1h-pyrrol-2-yl]-2-methylpiperazine Chemical compound CC1CN(C=2C=3OC=CC=3C=CC=2)CCN1C(N1)=CC=C1C1=CC=C(F)C=C1 ZUPZKNPDQPDZHI-UHFFFAOYSA-N 0.000 description 1
- IFRWCHDMMUMFBO-UHFFFAOYSA-N 4-(2-methoxyphenyl)-2-methyl-1-(1-phenylpyrazol-4-yl)piperazine Chemical compound COC1=CC=CC=C1N1CC(C)N(C2=CN(N=C2)C=2C=CC=CC=2)CC1 IFRWCHDMMUMFBO-UHFFFAOYSA-N 0.000 description 1
- PRKFRFBAKGZDEX-UHFFFAOYSA-N 4-(chloromethyl)-1-phenylpyrazole Chemical compound C1=C(CCl)C=NN1C1=CC=CC=C1 PRKFRFBAKGZDEX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 102000004980 Dopamine D2 Receptors Human genes 0.000 description 1
- 108090001111 Dopamine D2 Receptors Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 1
- 229960004046 apomorphine Drugs 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 238000009227 behaviour therapy Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 210000005013 brain tissue Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000009194 climbing Effects 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 210000004744 fore-foot Anatomy 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/335—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Biomedical Technology (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Psychiatry (AREA)
- Anesthesiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8600488 | 1986-02-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3782525D1 DE3782525D1 (de) | 1992-12-17 |
| DE3782525T2 true DE3782525T2 (de) | 1993-05-27 |
Family
ID=19847632
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8787200296T Expired - Fee Related DE3782525T2 (de) | 1986-02-27 | 1987-02-24 | Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung. |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US4772604A (enExample) |
| EP (1) | EP0241053B1 (enExample) |
| JP (1) | JPH0798800B2 (enExample) |
| AT (1) | ATE82281T1 (enExample) |
| AU (1) | AU585131B2 (enExample) |
| CA (1) | CA1279645C (enExample) |
| DE (1) | DE3782525T2 (enExample) |
| DK (1) | DK93087A (enExample) |
| ES (1) | ES2052545T3 (enExample) |
| GR (1) | GR3006689T3 (enExample) |
| IE (1) | IE61724B1 (enExample) |
| IL (1) | IL81669A (enExample) |
| NZ (1) | NZ219380A (enExample) |
| PH (1) | PH22783A (enExample) |
| ZA (1) | ZA871335B (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3782525T2 (de) * | 1986-02-27 | 1993-05-27 | Duphar Int Res | Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung. |
| US4992441A (en) * | 1987-10-14 | 1991-02-12 | Mcneilab, Inc. | 1-[[5-[[4-substituted-1-piperazinyl]methyl]-pyrrol-2-yl or furan-2-yl]methyl-2-piperidinones useful in treating schizophrenia |
| FR2672052B1 (fr) * | 1991-01-28 | 1995-05-24 | Esteve Labor Dr | Derives d'aryl (ou heteroaryl)-piperazinyl-alkyl-azoles, leur preparation et leur application en tant que medicaments. |
| GB9021453D0 (en) * | 1990-10-03 | 1990-11-14 | Wyeth John & Brother Ltd | Piperazine derivatives |
| US5159083A (en) * | 1990-12-28 | 1992-10-27 | Neurogen Corporation | Certain aminomethyl phenylimidazole derivatives; a class of dopamine receptor subtype specific ligands |
| FR2673628B1 (fr) * | 1991-03-07 | 1993-07-09 | Esteve Labor Dr | Procede de preparation de derives d'aryl (ou heteroaryl)-piperazinyl-butyl-azoles. |
| US5569659A (en) * | 1991-09-11 | 1996-10-29 | Mcneilab, Inc. | 4-arylpiperazines and 4-arylpiperidines |
| IE914218A1 (en) * | 1991-09-11 | 1993-03-24 | Mcneilab Inc | Novel 4-arylpiperazines and 4-arylpiperidines |
| JPH05255089A (ja) * | 1991-12-18 | 1993-10-05 | Sanwa Kagaku Kenkyusho Co Ltd | 抗ウイルス剤 |
| FR2692264B1 (fr) * | 1992-06-12 | 1994-08-05 | Adir | Nouvelles piperazines 1,4-disubstituees, leur procede de preparation et les compositions pharmaceutiques les contenant. |
| EP0654023B1 (en) * | 1992-08-06 | 1998-09-16 | Smithkline Beecham Plc | 5-(2-oxyphenyl)-pyrrole derivatives as dopamine d3 receptor antagonists |
| US5314885A (en) * | 1992-09-11 | 1994-05-24 | Mcneilab, Inc. | Cyclic benzylamino, benzylamido, and benzylimido antipsychotic agents |
| GB9305644D0 (en) * | 1993-03-18 | 1993-05-05 | Merck Sharp & Dohme | Therapeutic agents |
| GB9306578D0 (en) * | 1993-03-30 | 1993-05-26 | Merck Sharp & Dohme | Therapeutic agents |
| GB9307400D0 (en) * | 1993-04-08 | 1993-06-02 | Smithkline Beecham Plc | Compounds |
| JPH08511789A (ja) * | 1993-06-25 | 1996-12-10 | スミスクライン・ビーチャム・パブリック・リミテッド・カンパニー | フェニルピロール誘導体およびドーパミンd3拮抗薬としてのそれらの使用 |
| GB9315801D0 (en) * | 1993-07-30 | 1993-09-15 | Smithkline Beecham Plc | Compounds |
| GB9315800D0 (en) * | 1993-07-30 | 1993-09-15 | Smithkline Beecham Plc | Compounds |
| GB9320855D0 (en) * | 1993-10-09 | 1993-12-01 | Smithkline Beecham Plc | Compounds |
| GB9325827D0 (en) * | 1993-12-17 | 1994-02-23 | Smithkline Beecham Plc | Compounds |
| GB9402197D0 (en) * | 1994-02-04 | 1994-03-30 | Smithkline Beecham Plc | Compounds |
| GB9403199D0 (en) * | 1994-02-19 | 1994-04-13 | Smithkline Beecham Plc | Compounds |
| US5478934A (en) * | 1994-11-23 | 1995-12-26 | Yuan; Jun | Certain 1-substituted aminomethyl imidazole and pyrrole derivatives: novel dopamine receptor subtype specific ligands |
| WO1996016057A1 (en) * | 1994-11-23 | 1996-05-30 | Neurogen Corporation | Certain 1-substituted aminomethyl imidazole and pyrrole derivatives; novel dopamine receptor subtype specific ligands |
| GB9512129D0 (en) * | 1995-06-15 | 1995-08-16 | Smithkline Beecham Plc | Compounds |
| US6114334A (en) * | 1995-07-13 | 2000-09-05 | Knoll Aktiengesellschaft | Piperazine derivatives as therapeutic agents |
| JP3989554B2 (ja) | 1996-03-29 | 2007-10-10 | デユフアー・インターナシヨナル・リサーチ・ベー・ブイ | ピペラジンおよびピペリジン化合物 |
| AU730224B2 (en) | 1996-12-23 | 2001-03-01 | Du Pont Pharmaceuticals Company | Nitrogen containing heteroaromatics as factor Xa inhibitors |
| CA2278677A1 (en) * | 1997-01-27 | 1998-07-30 | Daiichi Pharmaceutical Co., Ltd. | Pyrazole derivatives |
| US6169086B1 (en) | 1997-01-27 | 2001-01-02 | Daiichi Pharmaceutical Co., Ltd. | Pyrazole derivatives |
| TW530054B (en) * | 1997-09-24 | 2003-05-01 | Duphar Int Res | New piperazine and piperidine compounds |
| CA2415210C (en) | 2000-07-04 | 2011-12-06 | Shohei Fukuda | Benzoxazole compound, process for producing the same and herbicides |
| ES2323451T7 (es) | 2001-07-20 | 2011-08-01 | Psychogenics Inc. | Tratamiento para el trastorno de hiperactividad con deficit de atencion. |
| US7842693B2 (en) * | 2002-06-12 | 2010-11-30 | Chemocentryx, Inc. | Substituted piperazines |
| US20050256130A1 (en) * | 2002-06-12 | 2005-11-17 | Chemocentryx, Inc. | Substituted piperazines |
| EP1531822B1 (en) * | 2002-06-12 | 2009-08-05 | ChemoCentryx Inc | 1-aryl-4-substituted piperazine derivatives for use as ccr1 antagonists for the treatment of inflammation and immune disorders |
| US7589199B2 (en) | 2002-06-12 | 2009-09-15 | Chemocentryx, Inc. | Substituted piperazines |
| US7435830B2 (en) * | 2004-03-03 | 2008-10-14 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| US7435831B2 (en) * | 2004-03-03 | 2008-10-14 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| BRPI0405418A (pt) * | 2004-09-02 | 2006-05-02 | Univ Rio De Janeiro | uso de derivados n-fenilperazìnicos e composições farmacêuticas contendo os mesmos |
| TW200800946A (en) * | 2005-08-15 | 2008-01-01 | Astrazeneca Ab | Substituted piperazines as metabotropic glutamate receptor antagonists |
| KR100654328B1 (ko) | 2005-08-26 | 2006-12-08 | 한국과학기술연구원 | 피페라지닐알킬피라졸계 t-타입 칼슘 채널 억제 화합물 및이의 제조방법 |
| US9066903B2 (en) | 2006-02-28 | 2015-06-30 | The United States Of America As Represented By The Department Of Veterans Affairs | Pharmacological treatment of Parkinson's disease |
| CN103570705B (zh) * | 2012-07-18 | 2017-01-25 | 中国医学科学院医药生物技术研究所 | 取代的n‑((1',3'‑杂唑‑4'‑基)‑甲基)‑4‑苯甲酰基六氢吡啶类化合物及其用途 |
| CN105829297B (zh) * | 2013-12-20 | 2019-08-09 | 埃斯蒂文制药股份有限公司 | 具有抗疼痛的多重模式活性的哌啶化合物 |
| MX2016008130A (es) * | 2013-12-20 | 2016-10-13 | Esteve Labor Dr | Derivados de piperidina con actividad multimodal contra el dolor. |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3407199A (en) * | 1966-01-18 | 1968-10-22 | Endo Lab | Tertiaryamino ethyl or propyl pyrrol-2-yl ketones |
| DE2261351A1 (de) * | 1972-12-15 | 1974-06-20 | Merck Patent Gmbh | Pyrazolderivate und verfahren zu ihrer herstellung |
| DE2526469A1 (de) * | 1975-06-13 | 1976-12-30 | Bayer Ag | 1-substituierte pyrazolderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4032526A (en) * | 1975-10-02 | 1977-06-28 | American Cyanamid Company | 1,2-dimethyl-3 or 5-piperazinyl-pyrazolium salts |
| US4123529A (en) * | 1976-04-23 | 1978-10-31 | Lilly Industries Limited | Phenylpiperazine derivatives |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| FR2537133A1 (fr) * | 1982-12-07 | 1984-06-08 | Rhone Poulenc Sante | Nouveaux derives de la (piperazinyl-1)-5 pyrrolidine, leur preparation et les medicaments qui les contiennent |
| AU577802B2 (en) * | 1983-10-17 | 1988-10-06 | Duphar International Research B.V. | Blood-pressure lowering piperazine derivatives |
| US4562189A (en) * | 1984-10-09 | 1985-12-31 | American Cyanamid Company | Pyrazolylpiperazines |
| DE3442860A1 (de) * | 1984-11-24 | 1986-05-28 | Kali-Chemie Pharma Gmbh, 3000 Hannover | 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3- on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3782525T2 (de) * | 1986-02-27 | 1993-05-27 | Duphar Int Res | Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung. |
-
1987
- 1987-02-24 DE DE8787200296T patent/DE3782525T2/de not_active Expired - Fee Related
- 1987-02-24 ES ES87200296T patent/ES2052545T3/es not_active Expired - Lifetime
- 1987-02-24 CA CA000530424A patent/CA1279645C/en not_active Expired - Lifetime
- 1987-02-24 US US07/018,164 patent/US4772604A/en not_active Expired - Lifetime
- 1987-02-24 DK DK093087A patent/DK93087A/da not_active Application Discontinuation
- 1987-02-24 PH PH34901A patent/PH22783A/en unknown
- 1987-02-24 ZA ZA871335A patent/ZA871335B/xx unknown
- 1987-02-24 AT AT87200296T patent/ATE82281T1/de not_active IP Right Cessation
- 1987-02-24 IE IE46687A patent/IE61724B1/en not_active IP Right Cessation
- 1987-02-24 EP EP87200296A patent/EP0241053B1/en not_active Expired - Lifetime
- 1987-02-24 NZ NZ219380A patent/NZ219380A/xx unknown
- 1987-02-24 IL IL81669A patent/IL81669A/xx not_active IP Right Cessation
- 1987-02-25 JP JP62040530A patent/JPH0798800B2/ja not_active Expired - Lifetime
- 1987-02-25 AU AU69247/87A patent/AU585131B2/en not_active Ceased
-
1988
- 1988-07-01 US US07/214,310 patent/US4874770A/en not_active Expired - Lifetime
-
1992
- 1992-12-28 GR GR920403153T patent/GR3006689T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR3006689T3 (enExample) | 1993-06-30 |
| ZA871335B (en) | 1987-09-30 |
| US4772604A (en) | 1988-09-20 |
| US4874770A (en) | 1989-10-17 |
| PH22783A (en) | 1988-12-12 |
| IL81669A (en) | 1990-11-29 |
| CA1279645C (en) | 1991-01-29 |
| IL81669A0 (en) | 1987-09-16 |
| IE870466L (en) | 1987-08-27 |
| DE3782525D1 (de) | 1992-12-17 |
| AU585131B2 (en) | 1989-06-08 |
| ES2052545T3 (es) | 1994-07-16 |
| AU6924787A (en) | 1987-09-03 |
| NZ219380A (en) | 1990-06-26 |
| EP0241053A1 (en) | 1987-10-14 |
| JPS62205058A (ja) | 1987-09-09 |
| IE61724B1 (en) | 1994-11-30 |
| EP0241053B1 (en) | 1992-11-11 |
| DK93087A (da) | 1987-08-28 |
| JPH0798800B2 (ja) | 1995-10-25 |
| ATE82281T1 (de) | 1992-11-15 |
| DK93087D0 (da) | 1987-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3782525T2 (de) | Aryl-substituierte(n-piperidinyl)methyl und (n-piperazinyl)methylazole mit antipsychotischer wirkung. | |
| DE3685608T2 (de) | 8-phenylxanthine. | |
| DE68927254T2 (de) | Arylpiperidin-Derivate | |
| CH643736A5 (de) | Pharmazeutische zubereitungen, enthaltend imidazolderivate oder deren salze. | |
| EP0005205A1 (de) | Substituierte 5,6-Dimethylpyrrolo(2,3-d)pyrimidine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE19744027A1 (de) | Substituierte Pyrazolo[3,4-b]pyridine, ihre Herstellung und Verwendung in Arzneimitteln | |
| DE60304599T2 (de) | Pyridopyrimidinon-derivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DE3105330C2 (enExample) | ||
| EP0287907A1 (de) | Pyrazolo[3,4-d]pyrimidine, Verfahren zu ihrer Herstellung und Verwendung als Arzneimittel | |
| EP0031080A1 (de) | 2-Acylaminomethyl-1,4-benzodiazepine und deren Salze sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69214925T2 (de) | Verfahren zur Herstellung von Pyrrolo (2,3-d)Pyrimidinen | |
| DE3850861T2 (de) | Imidazochinoxalinverbindungen und ihre Herstellung und Verwendung. | |
| DD289529A5 (de) | Verfahren zur herstellung heterozyklischer verbindungen | |
| WO1999054315A2 (de) | Triazolone mit neuroprotektiver wirkung | |
| DE2811031C2 (de) | Piperazino-3-indole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2424334A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE69228307T2 (de) | Imidazo(1,2-c)chinazolinderivate als antihypertensive und antidysurie | |
| DE69232980T2 (de) | Pyrroloazepinderivate | |
| DE69719563T2 (de) | Pharmazeutische wirksame trizyklische amine | |
| DD282457A5 (de) | Verfahren zur herstellung neuer heterocyclischer derivate | |
| DE69919575T2 (de) | Benzoxazolderivate und medikamente die diese als aktiven wirkstoff enthalten | |
| EP0346683A1 (de) | Pyrrolderivate, ihre Herstellung und ihre Verwendung | |
| DE2323301A1 (de) | Cyclohexenonderivate und verfahren zu ihrer herstellung | |
| DE68905363T2 (de) | Heterotetracyclische laktamderivate, verfahren zu ihrer herstellung und pharmazeutische zubereitungen, die sie enthalten. | |
| DE69121894T2 (de) | Heterocyclische verbindungen, herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |