DE3709851A1 - Nmr-diagnostische fluessigkeitszusammensetzungen - Google Patents
Nmr-diagnostische fluessigkeitszusammensetzungenInfo
- Publication number
- DE3709851A1 DE3709851A1 DE19873709851 DE3709851A DE3709851A1 DE 3709851 A1 DE3709851 A1 DE 3709851A1 DE 19873709851 DE19873709851 DE 19873709851 DE 3709851 A DE3709851 A DE 3709851A DE 3709851 A1 DE3709851 A1 DE 3709851A1
- Authority
- DE
- Germany
- Prior art keywords
- nmr
- acid
- substances
- magnetic
- diagnostic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 53
- 239000007788 liquid Substances 0.000 title claims description 66
- 230000005291 magnetic effect Effects 0.000 claims abstract description 83
- 239000000126 substance Substances 0.000 claims abstract description 74
- 239000003381 stabilizer Substances 0.000 claims abstract description 35
- 239000002245 particle Substances 0.000 claims abstract description 29
- 239000011553 magnetic fluid Substances 0.000 claims abstract description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000013543 active substance Substances 0.000 claims abstract description 12
- 239000006185 dispersion Substances 0.000 claims abstract description 7
- 238000001727 in vivo Methods 0.000 claims abstract description 5
- 238000000338 in vitro Methods 0.000 claims abstract description 4
- 238000002560 therapeutic procedure Methods 0.000 claims abstract 2
- 239000006249 magnetic particle Substances 0.000 claims description 45
- 238000005481 NMR spectroscopy Methods 0.000 claims description 32
- 229910019142 PO4 Inorganic materials 0.000 claims description 28
- -1 polyethylene Polymers 0.000 claims description 26
- 235000021317 phosphate Nutrition 0.000 claims description 25
- 239000010452 phosphate Substances 0.000 claims description 20
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 19
- 239000011737 fluorine Substances 0.000 claims description 19
- 229910052731 fluorine Inorganic materials 0.000 claims description 19
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- 229920001223 polyethylene glycol Polymers 0.000 claims description 17
- 239000002202 Polyethylene glycol Substances 0.000 claims description 16
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 16
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 15
- 230000000087 stabilizing effect Effects 0.000 claims description 15
- 229910052698 phosphorus Inorganic materials 0.000 claims description 14
- 239000011574 phosphorus Substances 0.000 claims description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 13
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 13
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 11
- 229920001451 polypropylene glycol Polymers 0.000 claims description 10
- 230000027455 binding Effects 0.000 claims description 9
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 claims description 8
- 230000003993 interaction Effects 0.000 claims description 8
- 230000009870 specific binding Effects 0.000 claims description 8
- 108020004414 DNA Proteins 0.000 claims description 7
- 150000001720 carbohydrates Chemical class 0.000 claims description 7
- 235000014633 carbohydrates Nutrition 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 125000000524 functional group Chemical group 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 229920002477 rna polymer Polymers 0.000 claims description 7
- 229940124530 sulfonamide Drugs 0.000 claims description 7
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical group SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 6
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 claims description 6
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 6
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 claims description 6
- 230000000144 pharmacologic effect Effects 0.000 claims description 6
- NGVDGCNFYWLIFO-UHFFFAOYSA-N pyridoxal 5'-phosphate Chemical compound CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O NGVDGCNFYWLIFO-UHFFFAOYSA-N 0.000 claims description 6
- 230000006641 stabilisation Effects 0.000 claims description 6
- 238000011105 stabilization Methods 0.000 claims description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 6
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 claims description 5
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 claims description 5
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 claims description 5
- 102000053602 DNA Human genes 0.000 claims description 5
- 239000005642 Oleic acid Substances 0.000 claims description 5
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 claims description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical group CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 5
- 239000002270 dispersing agent Substances 0.000 claims description 5
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 claims description 5
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 claims description 4
- RFLVMTUMFYRZCB-UHFFFAOYSA-N 1-methylguanine Chemical compound O=C1N(C)C(N)=NC2=C1N=CN2 RFLVMTUMFYRZCB-UHFFFAOYSA-N 0.000 claims description 4
- RYVNIFSIEDRLSJ-UHFFFAOYSA-N 5-(hydroxymethyl)cytosine Chemical compound NC=1NC(=O)N=CC=1CO RYVNIFSIEDRLSJ-UHFFFAOYSA-N 0.000 claims description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 claims description 4
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 claims description 4
- 229920001774 Perfluoroether Polymers 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 4
- MUPFEKGTMRGPLJ-UHFFFAOYSA-N UNPD196149 Natural products OC1C(O)C(CO)OC1(CO)OC1C(O)C(O)C(O)C(COC2C(C(O)C(O)C(CO)O2)O)O1 MUPFEKGTMRGPLJ-UHFFFAOYSA-N 0.000 claims description 4
- DRTQHJPVMGBUCF-XVFCMESISA-N Uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-XVFCMESISA-N 0.000 claims description 4
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 claims description 4
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 4
- 239000005556 hormone Substances 0.000 claims description 4
- 229940088597 hormone Drugs 0.000 claims description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 4
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 claims description 4
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 claims description 3
- ICGQLNMKJVHCIR-UHFFFAOYSA-N 1,3,2-dioxazetidin-4-one Chemical group O=C1ONO1 ICGQLNMKJVHCIR-UHFFFAOYSA-N 0.000 claims description 3
- 102000004190 Enzymes Human genes 0.000 claims description 3
- 108090000790 Enzymes Proteins 0.000 claims description 3
- 229920002230 Pectic acid Polymers 0.000 claims description 3
- 102000001938 Plasminogen Activators Human genes 0.000 claims description 3
- 108010001014 Plasminogen Activators Proteins 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 229940104302 cytosine Drugs 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 150000002482 oligosaccharides Chemical class 0.000 claims description 3
- 230000005298 paramagnetic effect Effects 0.000 claims description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 3
- 229940127126 plasminogen activator Drugs 0.000 claims description 3
- 239000010318 polygalacturonic acid Substances 0.000 claims description 3
- 229920001282 polysaccharide Polymers 0.000 claims description 3
- 239000005017 polysaccharide Substances 0.000 claims description 3
- 102000004169 proteins and genes Human genes 0.000 claims description 3
- 108090000623 proteins and genes Proteins 0.000 claims description 3
- 235000007682 pyridoxal 5'-phosphate Nutrition 0.000 claims description 3
- 239000011589 pyridoxal 5'-phosphate Substances 0.000 claims description 3
- 229960001327 pyridoxal phosphate Drugs 0.000 claims description 3
- ZMJGSOSNSPKHNH-UHFFFAOYSA-N pyridoxamine 5'-phosphate Chemical compound CC1=NC=C(COP(O)(O)=O)C(CN)=C1O ZMJGSOSNSPKHNH-UHFFFAOYSA-N 0.000 claims description 3
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical class OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 claims description 3
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 claims description 2
- UHDGCWIWMRVCDJ-UHFFFAOYSA-N 1-beta-D-Xylofuranosyl-NH-Cytosine Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 UHDGCWIWMRVCDJ-UHFFFAOYSA-N 0.000 claims description 2
- HWPZZUQOWRWFDB-UHFFFAOYSA-N 1-methylcytosine Chemical compound CN1C=CC(N)=NC1=O HWPZZUQOWRWFDB-UHFFFAOYSA-N 0.000 claims description 2
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 claims description 2
- ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical compound OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 claims description 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 claims description 2
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical compound ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 claims description 2
- CKTSBUTUHBMZGZ-ULQXZJNLSA-N 4-amino-1-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-tritiopyrimidin-2-one Chemical compound O=C1N=C(N)C([3H])=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 CKTSBUTUHBMZGZ-ULQXZJNLSA-N 0.000 claims description 2
- 229930024421 Adenine Natural products 0.000 claims description 2
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000002126 C01EB10 - Adenosine Substances 0.000 claims description 2
- MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 claims description 2
- 101000972324 Cynodon dactylon Leaf protein Proteins 0.000 claims description 2
- UHDGCWIWMRVCDJ-PSQAKQOGSA-N Cytidine Natural products O=C1N=C(N)C=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-PSQAKQOGSA-N 0.000 claims description 2
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 claims description 2
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 claims description 2
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 claims description 2
- 229920002307 Dextran Polymers 0.000 claims description 2
- 229920001353 Dextrin Polymers 0.000 claims description 2
- 239000004375 Dextrin Substances 0.000 claims description 2
- 229930091371 Fructose Natural products 0.000 claims description 2
- 239000005715 Fructose Substances 0.000 claims description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 claims description 2
- MUPFEKGTMRGPLJ-OBAJZVCXSA-N Gentianose Natural products O(C[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[C@@]2(CO)[C@H](O)[C@H](O)[C@@H](CO)O2)O1)[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 MUPFEKGTMRGPLJ-OBAJZVCXSA-N 0.000 claims description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 2
- 229920002527 Glycogen Polymers 0.000 claims description 2
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 claims description 2
- 229930010555 Inosine Natural products 0.000 claims description 2
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 claims description 2
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 claims description 2
- 229920001202 Inulin Polymers 0.000 claims description 2
- 229920002097 Lichenin Polymers 0.000 claims description 2
- 229920000057 Mannan Polymers 0.000 claims description 2
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 claims description 2
- BAQMYDQNMFBZNA-UHFFFAOYSA-N N-biotinyl-L-lysine Natural products N1C(=O)NC2C(CCCCC(=O)NCCCCC(N)C(O)=O)SCC21 BAQMYDQNMFBZNA-UHFFFAOYSA-N 0.000 claims description 2
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 claims description 2
- 229920002845 Poly(methacrylic acid) Polymers 0.000 claims description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 2
- MUPFEKGTMRGPLJ-RMMQSMQOSA-N Raffinose Natural products O(C[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[C@@]2(CO)[C@H](O)[C@@H](O)[C@@H](CO)O2)O1)[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 MUPFEKGTMRGPLJ-RMMQSMQOSA-N 0.000 claims description 2
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 claims description 2
- 229920002125 Sokalan® Polymers 0.000 claims description 2
- UQZIYBXSHAGNOE-USOSMYMVSA-N Stachyose Natural products O(C[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[C@@]2(CO)[C@H](O)[C@@H](O)[C@@H](CO)O2)O1)[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](CO[C@@H]2[C@@H](O)[C@@H](O)[C@@H](O)[C@H](CO)O2)O1 UQZIYBXSHAGNOE-USOSMYMVSA-N 0.000 claims description 2
- 229920002472 Starch Polymers 0.000 claims description 2
- 229920000147 Styrene maleic anhydride Polymers 0.000 claims description 2
- 229930006000 Sucrose Natural products 0.000 claims description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 2
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 claims description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 2
- FLUADVWHMHPUCG-OVEXVZGPSA-N Verbascose Natural products O(C[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](OC[C@@H]2[C@H](O)[C@H](O)[C@@H](O)[C@@H](O[C@@]3(CO)[C@H](O)[C@@H](O)[C@@H](CO)O3)O2)O1)[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](CO[C@@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@H](CO)O2)O1 FLUADVWHMHPUCG-OVEXVZGPSA-N 0.000 claims description 2
- 238000009825 accumulation Methods 0.000 claims description 2
- 230000004913 activation Effects 0.000 claims description 2
- 229960005305 adenosine Drugs 0.000 claims description 2
- 239000000783 alginic acid Substances 0.000 claims description 2
- 235000010443 alginic acid Nutrition 0.000 claims description 2
- 229920000615 alginic acid Polymers 0.000 claims description 2
- 229960001126 alginic acid Drugs 0.000 claims description 2
- 150000004781 alginic acids Chemical class 0.000 claims description 2
- 229930013930 alkaloid Natural products 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 claims description 2
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 claims description 2
- 235000020661 alpha-linolenic acid Nutrition 0.000 claims description 2
- 239000003242 anti bacterial agent Substances 0.000 claims description 2
- 230000000259 anti-tumor effect Effects 0.000 claims description 2
- 229940088710 antibiotic agent Drugs 0.000 claims description 2
- 239000000427 antigen Substances 0.000 claims description 2
- 102000036639 antigens Human genes 0.000 claims description 2
- 108091007433 antigens Proteins 0.000 claims description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 2
- DRTQHJPVMGBUCF-PSQAKQOGSA-N beta-L-uridine Natural products O[C@H]1[C@@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-PSQAKQOGSA-N 0.000 claims description 2
- BAQMYDQNMFBZNA-MNXVOIDGSA-N biocytin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)NCCCC[C@H](N)C(O)=O)SC[C@@H]21 BAQMYDQNMFBZNA-MNXVOIDGSA-N 0.000 claims description 2
- 229960002685 biotin Drugs 0.000 claims description 2
- 235000020958 biotin Nutrition 0.000 claims description 2
- 239000011616 biotin Substances 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 claims description 2
- 235000019425 dextrin Nutrition 0.000 claims description 2
- 239000012954 diazonium Substances 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 229960000304 folic acid Drugs 0.000 claims description 2
- 235000019152 folic acid Nutrition 0.000 claims description 2
- 239000011724 folic acid Substances 0.000 claims description 2
- MUPFEKGTMRGPLJ-WSCXOGSTSA-N gentianose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)O1 MUPFEKGTMRGPLJ-WSCXOGSTSA-N 0.000 claims description 2
- 239000008103 glucose Substances 0.000 claims description 2
- 229940096919 glycogen Drugs 0.000 claims description 2
- 229940029575 guanosine Drugs 0.000 claims description 2
- 229960003786 inosine Drugs 0.000 claims description 2
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 claims description 2
- 229960000367 inositol Drugs 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229960004488 linolenic acid Drugs 0.000 claims description 2
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 claims description 2
- LUEWUZLMQUOBSB-GFVSVBBRSA-N mannan Chemical class O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@H]3[C@H](O[C@@H](O)[C@@H](O)[C@H]3O)CO)[C@@H](O)[C@H]2O)CO)[C@H](O)[C@H]1O LUEWUZLMQUOBSB-GFVSVBBRSA-N 0.000 claims description 2
- 150000002772 monosaccharides Chemical class 0.000 claims description 2
- 229920001542 oligosaccharide Polymers 0.000 claims description 2
- 229920001277 pectin Polymers 0.000 claims description 2
- 239000001814 pectin Substances 0.000 claims description 2
- 235000010987 pectin Nutrition 0.000 claims description 2
- 229940068041 phytic acid Drugs 0.000 claims description 2
- 239000000467 phytic acid Substances 0.000 claims description 2
- 235000002949 phytic acid Nutrition 0.000 claims description 2
- 239000004584 polyacrylic acid Substances 0.000 claims description 2
- 150000004804 polysaccharides Chemical class 0.000 claims description 2
- MUPFEKGTMRGPLJ-ZQSKZDJDSA-N raffinose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)O)O1 MUPFEKGTMRGPLJ-ZQSKZDJDSA-N 0.000 claims description 2
- 235000019192 riboflavin Nutrition 0.000 claims description 2
- 239000002151 riboflavin Substances 0.000 claims description 2
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 claims description 2
- UQZIYBXSHAGNOE-XNSRJBNMSA-N stachyose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO[C@@H]3[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O3)O)O2)O)O1 UQZIYBXSHAGNOE-XNSRJBNMSA-N 0.000 claims description 2
- 235000019698 starch Nutrition 0.000 claims description 2
- 239000008107 starch Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 239000005720 sucrose Substances 0.000 claims description 2
- 125000000565 sulfonamide group Chemical group 0.000 claims description 2
- 229920001059 synthetic polymer Polymers 0.000 claims description 2
- 235000019157 thiamine Nutrition 0.000 claims description 2
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 claims description 2
- 229960003495 thiamine Drugs 0.000 claims description 2
- 239000011721 thiamine Substances 0.000 claims description 2
- 229940113082 thymine Drugs 0.000 claims description 2
- 229940048102 triphosphoric acid Drugs 0.000 claims description 2
- 102000003390 tumor necrosis factor Human genes 0.000 claims description 2
- 238000002604 ultrasonography Methods 0.000 claims description 2
- DRTQHJPVMGBUCF-UHFFFAOYSA-N uracil arabinoside Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UHFFFAOYSA-N 0.000 claims description 2
- 229940045145 uridine Drugs 0.000 claims description 2
- FLUADVWHMHPUCG-SWPIJASHSA-N verbascose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO[C@@H]3[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO[C@@H]4[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O4)O)O3)O)O2)O)O1 FLUADVWHMHPUCG-SWPIJASHSA-N 0.000 claims description 2
- 229920001221 xylan Polymers 0.000 claims description 2
- 150000004823 xylans Chemical class 0.000 claims description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims 3
- 239000004698 Polyethylene Substances 0.000 claims 3
- 229920000573 polyethylene Polymers 0.000 claims 3
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 claims 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 239000003054 catalyst Substances 0.000 claims 2
- 229940088598 enzyme Drugs 0.000 claims 2
- IZFHEQBZOYJLPK-SSDOTTSWSA-N (R)-dihydrolipoic acid Chemical compound OC(=O)CCCC[C@@H](S)CCS IZFHEQBZOYJLPK-SSDOTTSWSA-N 0.000 claims 1
- AGBQKNBQESQNJD-SSDOTTSWSA-N (R)-lipoic acid Chemical compound OC(=O)CCCC[C@@H]1CCSS1 AGBQKNBQESQNJD-SSDOTTSWSA-N 0.000 claims 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical group CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 claims 1
- 241000251468 Actinopterygii Species 0.000 claims 1
- OSSQVWUXYUDQKW-LDUAJXOISA-N C1=CC(C(=O)N[C@@H](CC(C)C(O)=O)C(O)=O)=CC=C1NCC1NC(C(=O)NC(N)=N2)=C2NC1 Chemical compound C1=CC(C(=O)N[C@@H](CC(C)C(O)=O)C(O)=O)=CC=C1NCC1NC(C(=O)NC(N)=N2)=C2NC1 OSSQVWUXYUDQKW-LDUAJXOISA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 claims 1
- 239000004743 Polypropylene Substances 0.000 claims 1
- 241000246358 Thymus Species 0.000 claims 1
- 235000007303 Thymus vulgaris Nutrition 0.000 claims 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims 1
- 238000007792 addition Methods 0.000 claims 1
- 229960000643 adenine Drugs 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- AGBQKNBQESQNJD-UHFFFAOYSA-N alpha-Lipoic acid Natural products OC(=O)CCCCC1CCSS1 AGBQKNBQESQNJD-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 1
- 125000002843 carboxylic acid group Chemical group 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims 1
- 239000004744 fabric Substances 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- 235000019136 lipoic acid Nutrition 0.000 claims 1
- 210000002540 macrophage Anatomy 0.000 claims 1
- 239000003921 oil Substances 0.000 claims 1
- 235000021313 oleic acid Nutrition 0.000 claims 1
- KYOBSHFOBAOFBF-XVFCMESISA-N orotidine 5'-phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C=C1C(O)=O KYOBSHFOBAOFBF-XVFCMESISA-N 0.000 claims 1
- 230000001575 pathological effect Effects 0.000 claims 1
- 229920001155 polypropylene Polymers 0.000 claims 1
- 229960002477 riboflavin Drugs 0.000 claims 1
- 159000000000 sodium salts Chemical class 0.000 claims 1
- 230000001225 therapeutic effect Effects 0.000 claims 1
- 229960002663 thioctic acid Drugs 0.000 claims 1
- 239000001585 thymus vulgaris Substances 0.000 claims 1
- 229940035893 uracil Drugs 0.000 claims 1
- 229960005356 urokinase Drugs 0.000 claims 1
- 239000003814 drug Substances 0.000 abstract 2
- 238000003745 diagnosis Methods 0.000 abstract 1
- 210000001519 tissue Anatomy 0.000 description 16
- 230000000694 effects Effects 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 6
- 230000004907 flux Effects 0.000 description 6
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 6
- 230000005294 ferromagnetic effect Effects 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000011859 microparticle Substances 0.000 description 4
- 239000013049 sediment Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 238000004220 aggregation Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 238000002595 magnetic resonance imaging Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical class CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 108091028043 Nucleic acid sequence Proteins 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 108010074605 gamma-Globulins Proteins 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 238000009396 hybridization Methods 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- 125000004437 phosphorous atom Chemical group 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 238000004062 sedimentation Methods 0.000 description 2
- 238000004904 shortening Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- BHQCQFFYRZLCQQ-UHFFFAOYSA-N (3alpha,5alpha,7alpha,12alpha)-3,7,12-trihydroxy-cholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 BHQCQFFYRZLCQQ-UHFFFAOYSA-N 0.000 description 1
- FSHNGIVBUUFZSQ-UHFFFAOYSA-N 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate Chemical compound OCCOCCOCCOCCOCCOP(O)(O)=O FSHNGIVBUUFZSQ-UHFFFAOYSA-N 0.000 description 1
- SMADWRYCYBUIKH-UHFFFAOYSA-N 2-methyl-7h-purin-6-amine Chemical compound CC1=NC(N)=C2NC=NC2=N1 SMADWRYCYBUIKH-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108020000946 Bacterial DNA Proteins 0.000 description 1
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
- 239000004380 Cholic acid Substances 0.000 description 1
- 108020003215 DNA Probes Proteins 0.000 description 1
- 239000003298 DNA probe Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 206010016352 Feeling of relaxation Diseases 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- 102000008072 Lymphokines Human genes 0.000 description 1
- 108010074338 Lymphokines Proteins 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 108020005202 Viral DNA Proteins 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- BHQCQFFYRZLCQQ-OELDTZBJSA-N cholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 BHQCQFFYRZLCQQ-OELDTZBJSA-N 0.000 description 1
- 235000019416 cholic acid Nutrition 0.000 description 1
- 229960002471 cholic acid Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229950001485 cocarboxylase Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000002872 contrast media Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- 239000000032 diagnostic agent Substances 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002052 molecular layer Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 229950001574 riboflavin phosphate Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- YXVCLPJQTZXJLH-UHFFFAOYSA-N thiamine(1+) diphosphate chloride Chemical compound [Cl-].CC1=C(CCOP(O)(=O)OP(O)(O)=O)SC=[N+]1CC1=CN=C(C)N=C1N YXVCLPJQTZXJLH-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229940104230 thymidine Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000003325 tomography Methods 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K33/00—Medicinal preparations containing inorganic active ingredients
- A61K33/24—Heavy metals; Compounds thereof
- A61K33/26—Iron; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/06—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations
- A61K49/18—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations characterised by a special physical form, e.g. emulsions, microcapsules, liposomes
- A61K49/1806—Suspensions, emulsions, colloids, dispersions
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5094—Microcapsules containing magnetic carrier material, e.g. ferrite for drug targeting
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/06—Antianaemics
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N2446/00—Magnetic particle immunoreagent carriers
- G01N2446/20—Magnetic particle immunoreagent carriers the magnetic material being present in the particle core
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N2446/00—Magnetic particle immunoreagent carriers
- G01N2446/80—Magnetic particle immunoreagent carriers characterised by the agent used to coat the magnetic particles, e.g. lipids
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N2446/00—Magnetic particle immunoreagent carriers
- G01N2446/80—Magnetic particle immunoreagent carriers characterised by the agent used to coat the magnetic particles, e.g. lipids
- G01N2446/90—Magnetic particle immunoreagent carriers characterised by the agent used to coat the magnetic particles, e.g. lipids characterised by small molecule linker used to couple immunoreagents to magnetic particles
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T436/00—Chemistry: analytical and immunological testing
- Y10T436/24—Nuclear magnetic resonance, electron spin resonance or other spin effects or mass spectrometry
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Chemical & Material Sciences (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Hematology (AREA)
- Radiology & Medical Imaging (AREA)
- Inorganic Chemistry (AREA)
- Diabetes (AREA)
- Dispersion Chemistry (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Virology (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Soft Magnetic Materials (AREA)
- Lubricants (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicinal Preparation (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873709851 DE3709851A1 (de) | 1987-03-24 | 1987-03-24 | Nmr-diagnostische fluessigkeitszusammensetzungen |
| EP88730073A EP0284549B1 (de) | 1987-03-24 | 1988-03-23 | Magnetische Flüssigkeitszusammensetzungen |
| AT88730073T ATE78175T1 (de) | 1987-03-24 | 1988-03-23 | Magnetische fluessigkeitszusammensetzungen. |
| DE8888730073T DE3872741D1 (de) | 1987-03-24 | 1988-03-23 | Magnetische fluessigkeitszusammensetzungen. |
| ES88730073T ES2052766T3 (es) | 1987-03-24 | 1988-03-23 | Composiciones magneticas en estado liquido. |
| JP63068349A JP2663976B2 (ja) | 1987-03-24 | 1988-03-24 | 生理学的に認容される超常磁性液体組成物,その製造方法並びにそれよりなる画像形成nmr,x線及び超音波診断剤 |
| US07/638,134 US5160725A (en) | 1987-03-24 | 1991-01-04 | Magnetic liquid compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873709851 DE3709851A1 (de) | 1987-03-24 | 1987-03-24 | Nmr-diagnostische fluessigkeitszusammensetzungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3709851A1 true DE3709851A1 (de) | 1988-10-06 |
Family
ID=6323973
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873709851 Withdrawn DE3709851A1 (de) | 1987-03-24 | 1987-03-24 | Nmr-diagnostische fluessigkeitszusammensetzungen |
| DE8888730073T Expired - Lifetime DE3872741D1 (de) | 1987-03-24 | 1988-03-23 | Magnetische fluessigkeitszusammensetzungen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8888730073T Expired - Lifetime DE3872741D1 (de) | 1987-03-24 | 1988-03-23 | Magnetische fluessigkeitszusammensetzungen. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5160725A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0284549B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JP2663976B2 (cg-RX-API-DMAC10.html) |
| AT (1) | ATE78175T1 (cg-RX-API-DMAC10.html) |
| DE (2) | DE3709851A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES2052766T3 (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5240626A (en) * | 1990-09-21 | 1993-08-31 | Minnesota Mining And Manufacturing Company | Aqueous ferrofluid |
| DE4309333A1 (de) * | 1993-03-17 | 1994-09-22 | Silica Gel Gmbh | Superparamagnetische Teilchen, Verfahren zu ihrer Herstellung und Verwendung derselben |
| DE19514515A1 (de) * | 1995-04-12 | 1996-11-21 | Dirk Dipl Chem Guenther | Magnetisierbare Dispersionen |
Families Citing this family (83)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5612019A (en) * | 1988-12-19 | 1997-03-18 | Gordon, Deceased; David | Diagnosis and treatment of HIV viral infection using magnetic metal transferrin particles |
| US5385707A (en) * | 1988-12-28 | 1995-01-31 | Stefan Miltenyi | Metal matrices for use in high gradient magnetic separation of biological materials and method for coating the same |
| US5114703A (en) * | 1989-05-30 | 1992-05-19 | Alliance Pharmaceutical Corp. | Percutaneous lymphography using particulate fluorocarbon emulsions |
| GB8916781D0 (en) * | 1989-07-21 | 1989-09-06 | Nycomed As | Compositions |
| GB8916780D0 (en) * | 1989-07-21 | 1989-09-06 | Nycomed As | Compositions |
| GB8916782D0 (en) * | 1989-07-21 | 1989-09-06 | Nycomed As | Compositions |
| US5547682A (en) * | 1989-12-22 | 1996-08-20 | Bioquest, Incorporated | Preparation and use of novel injectable RES avoiding inorganic particles for medical application |
| DE69126429T2 (de) * | 1990-04-10 | 1997-10-23 | Imarx Pharmaceutical Corp | Polymere und ihre verwendung als kontrastmittel bei der bilderzeugung mit magnetischer resonanz |
| US5368840A (en) * | 1990-04-10 | 1994-11-29 | Imarx Pharmaceutical Corp. | Natural polymers as contrast media for magnetic resonance imaging |
| US5358702A (en) * | 1990-04-10 | 1994-10-25 | Unger Evan C | Methoxylated gel particle contrast media for improved diagnostic imaging |
| US5370901A (en) * | 1991-02-15 | 1994-12-06 | Bracco International B.V. | Compositions for increasing the image contrast in diagnostic investigations of the digestive tract of patients |
| US5179955A (en) * | 1991-02-22 | 1993-01-19 | Molecular Biosystems, Inc. | Method of abdominal ultrasound imaging |
| DE4117782C2 (de) * | 1991-05-28 | 1997-07-17 | Diagnostikforschung Inst | Nanokristalline magnetische Eisenoxid-Partikel, Verfahren zu ihrer Herstellung sowie diagnostische und/oder therapeutische Mittel |
| US5342609A (en) * | 1991-10-22 | 1994-08-30 | Mallinckrodt Medical, Inc. | Microfluidization of calcium/oxyanion-containing particles |
| US5344640A (en) * | 1991-10-22 | 1994-09-06 | Mallinckrodt Medical, Inc. | Preparation of apatite particles for medical diagnostic imaging |
| US5407659A (en) * | 1991-10-22 | 1995-04-18 | Mallinckrodt Medical, Inc. | Treated calcium/oxyanion-containing particles for medical diagnostic imaging |
| WO1993010440A1 (en) * | 1991-11-19 | 1993-05-27 | Unger Evan C | Gel particle contrast media for improved diagnostic imaging |
| US5324503A (en) * | 1992-02-06 | 1994-06-28 | Mallinckrodt Medical, Inc. | Iodo-phenylated chelates for x-ray contrast |
| JPH05262673A (ja) * | 1992-03-19 | 1993-10-12 | Nippon Paint Co Ltd | 超音波診断用造影剤 |
| DE69207589T2 (de) * | 1992-06-01 | 1996-05-23 | Basf Ag | Anwendung von Dispersionen von magneto-ionischen Partikeln in MRI-Kontrast-Mitteln |
| US5464696A (en) * | 1992-08-13 | 1995-11-07 | Bracco International B.V. | Particles for NMR imaging |
| US5871710A (en) * | 1992-09-04 | 1999-02-16 | The General Hospital Corporation | Graft co-polymer adducts of platinum (II) compounds |
| JPH08501097A (ja) * | 1992-09-04 | 1996-02-06 | ザ ゼネラル ホスピタル コーポレーション | 臨床診断及び治療用部分を含む生体適合性ポリマー |
| JPH08501776A (ja) * | 1992-09-16 | 1996-02-27 | ニユコメド・イメージング・アクシエセルカペト | 造影剤における又はそれに関する改良 |
| US5336923A (en) * | 1992-12-31 | 1994-08-09 | Honeywell, Inc. | Varactor diode having a stepped capacitance-voltage profile |
| JPH08508721A (ja) * | 1993-03-17 | 1996-09-17 | シリカゲル ゲス.エム.ビー.エイチ | 超常磁性粒子、その製法及びその用途 |
| US5605672A (en) * | 1993-06-09 | 1997-02-25 | The General Hospital Corporation | Blood pool imaging composition and method of its use |
| US5411730A (en) * | 1993-07-20 | 1995-05-02 | Research Corporation Technologies, Inc. | Magnetic microparticles |
| ATE191086T1 (de) * | 1994-07-27 | 2000-04-15 | Pilgrimm Herbert | Superparamagnetische teilchen, verfahren zur herstellung und deren verwendung |
| DE4428851C2 (de) * | 1994-08-04 | 2000-05-04 | Diagnostikforschung Inst | Eisen enthaltende Nanopartikel, ihre Herstellung und Anwendung in der Diagnostik und Therapie |
| US5520904A (en) * | 1995-01-27 | 1996-05-28 | Mallinckrodt Medical, Inc. | Calcium/oxyanion-containing particles with a polymerical alkoxy coating for use in medical diagnostic imaging |
| WO1996040273A2 (en) * | 1995-06-07 | 1996-12-19 | Schering Aktiengesellschaft | Conjugates of ferrites and oligonucleotides, which bond specifically to certain target structures |
| IL125150A (en) | 1996-01-10 | 2001-03-19 | Nycomed Imaging As | Magnetic resonance contrast media |
| GB9600427D0 (en) * | 1996-01-10 | 1996-03-13 | Nycomed Imaging As | Contrast media |
| DE19602930A1 (de) * | 1996-01-18 | 1997-07-24 | Schering Ag | Poröse Matrices aus niedermolekularen Substanzen zur Genierung stabiler Gasblasensuspensionen, deren Verwendung als Ultraschallkontrastmittel sowie Verfahren zu deren Herstellung |
| DE19612001A1 (de) * | 1996-03-18 | 1997-09-25 | Silica Gel Gmbh Adsorptions Te | Superparamagnetische Teilchen mit vergrößerter R¶1¶-Relaxivität, Verfahren zur Herstellung und deren Verwendung |
| US5855868A (en) * | 1996-04-01 | 1999-01-05 | Nycomed Imaging As | Method of T1 -weighted resonance imaging of RES organs |
| US6306384B1 (en) * | 1996-10-01 | 2001-10-23 | E-L Management Corp. | Skin battery cosmetic composition |
| WO1999009998A1 (en) * | 1997-08-29 | 1999-03-04 | The University Of North Carolina At Chapel Hill | Use of uridine 5'-diphosphate and analogs thereof for the treatment of lung diseases |
| US6503761B1 (en) * | 1999-10-19 | 2003-01-07 | Kimberly-Clark Worldwide, Inc. | Selective removal of contaminants from a surface using articles having magnets |
| WO2001028511A2 (en) * | 1999-10-19 | 2001-04-26 | Kimberly-Clark Worldwide, Inc. | Selective removal of contaminants from a surface using magnets |
| US6841393B2 (en) | 1999-10-19 | 2005-01-11 | Kimberly-Clark Worldwide, Inc. | Selective removal of contaminants from a surface using colored particles and articles having magnets |
| WO2003049936A1 (en) * | 2001-04-13 | 2003-06-19 | Cornell Research Foundation, Inc. | Superparamagnetic nanostructured materials |
| US20030022203A1 (en) * | 2001-04-23 | 2003-01-30 | Rajan Kumar | Cellular Arrays |
| DE10154016B4 (de) * | 2001-10-26 | 2004-02-12 | Berlin Heart Ag | Magnetflüssigkeit und Verfahren zur ihrer Herstellung |
| BR0105499F1 (pt) * | 2001-11-05 | 2018-01-09 | Univ Minas Gerais | processo de obtenção de nanocompósitos ferrita/ciclodextrina e uso como dispositivos de descontaminação magneticamente dirigível |
| US20030185757A1 (en) * | 2002-03-27 | 2003-10-02 | Mayk Kresse | Iron-containing nanoparticles with double coating and their use in diagnosis and therapy |
| DE10222481A1 (de) * | 2002-05-22 | 2003-12-04 | Eucro Europe Contract Res Gmbh | Kontrastmittel für die Verwendung in bildgebenden Verfahren |
| AU2002347076A1 (en) * | 2002-10-09 | 2004-05-04 | Ferropharm Gmbh Forschungslabor | Stabilized superparamagnetic particles |
| US6887295B2 (en) * | 2002-10-25 | 2005-05-03 | Hoeganaes Corporation | Powder metallurgy lubricants, compositions, and methods for using the same |
| DE10331439B3 (de) * | 2003-07-10 | 2005-02-03 | Micromod Partikeltechnologie Gmbh | Magnetische Nanopartikel mit verbesserten Magneteigenschaften |
| US7723311B2 (en) * | 2003-06-18 | 2010-05-25 | Nanobiomagnetics, Inc. | Delivery of bioactive substances to target cells |
| US7344491B1 (en) | 2003-11-26 | 2008-03-18 | Nanobiomagnetics, Inc. | Method and apparatus for improving hearing |
| US8651113B2 (en) * | 2003-06-18 | 2014-02-18 | Swr&D Inc. | Magnetically responsive nanoparticle therapeutic constructs and methods of making and using |
| JPWO2006028129A1 (ja) * | 2004-09-10 | 2008-05-08 | 東レ株式会社 | 医薬品製剤 |
| EP1866155A2 (en) * | 2005-04-05 | 2007-12-19 | Bar-Ilan University | New core and core-shell nanoparticles containing iodine for x-ray imaging |
| US20070036026A1 (en) * | 2005-05-16 | 2007-02-15 | Laibinis Paul E | Magnetic Particle Systems and Methods |
| JP5321772B2 (ja) * | 2005-06-15 | 2013-10-23 | 戸田工業株式会社 | 磁性粒子含有医薬用原薬 |
| US20070098641A1 (en) * | 2005-11-02 | 2007-05-03 | General Electric Company | Nanoparticle-based imaging agents for X-ray/computed tomography |
| DE102005059751A1 (de) * | 2005-12-09 | 2007-06-14 | Ferropharm Gmbh Forschungslabor | Wässrige Dispersion von superparamagnetischen Eindomänenteilchen, deren Herstellung und Verwendung zur Diagnose und Therapie |
| KR100819377B1 (ko) * | 2006-02-24 | 2008-04-04 | (주)에이티젠 | 양친매성 화합물을 이용한 자성 나노복합체 및 이를포함하는 조영제 |
| US20070297988A1 (en) * | 2006-06-21 | 2007-12-27 | Bin Wu | Optical probes for in vivo imaging |
| ES2400696T3 (es) * | 2006-12-18 | 2013-04-11 | Colorobbia Italia S.P.A. | Nanopartículas magnéticas para su aplicación en la hipertermía, preparación de las mismas y uso en construcciones que tienen una aplicación farmacológica |
| FR2921837B1 (fr) * | 2007-10-05 | 2015-07-31 | Guerbet Sa | Nouveau procede de preparation de nanoparticules recouvertes d'une couche stabilisatrice organique couplee a des ligands de ciblage |
| WO2010101737A1 (en) | 2009-03-04 | 2010-09-10 | Lubrizol Advanced Materials, Inc. | Dispersant composition |
| GB2472446A (en) * | 2009-08-07 | 2011-02-09 | Ct Fuer Angewandte Nanotechnologie | Metal oxide particles coated with polyethylene glycol and their synthesis |
| JP2011057473A (ja) * | 2009-09-07 | 2011-03-24 | Univ Of Miyazaki | マグネタイト微粒子の製造方法 |
| US9205155B2 (en) * | 2009-10-30 | 2015-12-08 | General Electric Company | Treating water insoluble nanoparticles with hydrophilic alpha-hydroxyphosphonic acid conjugates, the so modified nanoparticles and their use as contrast agents |
| US20110217379A1 (en) * | 2010-03-08 | 2011-09-08 | Davis Llp | Magnetic nanomaterials and methods for chemoembolisation |
| CA2792399A1 (en) * | 2010-04-01 | 2011-10-06 | Hoeganaes Corporation | Magnetic powder metallurgy materials |
| JP5608851B2 (ja) * | 2010-04-08 | 2014-10-15 | サンノプコ株式会社 | 金属酸化物粒子分散体 |
| DE102010020784A1 (de) * | 2010-05-18 | 2011-11-24 | Siemens Aktiengesellschaft | Verfahren zum Erkennen von magnetisch gekennzeichneten Objekten sowie entsprechende Vorrichtung |
| KR101805873B1 (ko) * | 2011-08-03 | 2018-01-10 | 한화케미칼 주식회사 | 단당류 인산 또는 그 유도체로 표면이 개질된 친수성 나노입자, 그의 콜로이드 용액 및 그 용도 |
| RU2540472C2 (ru) | 2010-08-05 | 2015-02-10 | Ханвха Кемикал Корпорейшн | Получение крайне малых и однородных по размеру парамагнитных или псевдопарамагнитных наночастиц на основе оксида железа и, с их использованием, контрастных веществ для т1-режима мрт |
| US8889103B2 (en) | 2010-12-15 | 2014-11-18 | General Electric Company | Diagnostic agent composition and associated methods thereof |
| US8895068B2 (en) | 2010-12-15 | 2014-11-25 | General Electric Company | Nanoparticle composition and associated methods thereof |
| KR101303567B1 (ko) * | 2011-03-08 | 2013-09-23 | 주식회사 인트론바이오테크놀로지 | 카르복실기가 도입된 만난으로 코팅된 자기공명영상 조영제 및 그것의 제조 방법 |
| CN102924977A (zh) * | 2012-11-06 | 2013-02-13 | 广东工业大学 | 一种磁性Fe3O4 纳米粒子表面改性的方法 |
| US11033640B2 (en) * | 2013-03-15 | 2021-06-15 | The Regents Of The University Of California | Enteric CT contrast material based on low-z atoms |
| JP2016528259A (ja) | 2013-08-16 | 2016-09-15 | ザ リージェンツ オブ ザ ユニバーシティ オブ カリフォルニア | シリコーン系腸管ct造影材料 |
| CA2943375C (en) | 2014-04-01 | 2022-07-12 | Universite Claude Bernard Lyon 1 | Dendronized metallic oxide nanoparticles, a process for preparing the same and their uses |
| FR3031063B1 (fr) | 2014-12-30 | 2017-02-10 | Biomerieux Sa | Complexe multicouches, procede de fabrication et utilisation du complexe |
| CN107551271B (zh) * | 2017-08-28 | 2020-11-27 | 上海长海医院 | 一种磁性-ros双重智能靶向纳米粒及其制备方法 |
Citations (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1978000005A1 (en) * | 1977-06-02 | 1978-12-07 | K H Mosbach | Magnetic polymer particles |
| DE2828941A1 (de) * | 1978-06-30 | 1980-01-10 | Robert Thomas Gordon | Mittel zur behandlung von krebs |
| EP0071564A1 (de) * | 1981-07-24 | 1983-02-09 | Schering Aktiengesellschaft | Paramagnetische Komplexsalze, deren Herstellung und Verwendung bei der NMR-Diagnostik |
| DE3401052A1 (de) * | 1983-01-21 | 1984-07-26 | Schering AG, 1000 Berlin und 4709 Bergkamen | Diagnostische mittel |
| DE3316703A1 (de) * | 1983-05-04 | 1984-11-08 | Schering AG, 1000 Berlin und 4709 Bergkamen | Orales kontrastmittel fuer die kernspintomographie und dessen herstellung |
| EP0133603A1 (fr) * | 1983-08-12 | 1985-02-27 | Société anonyme: COMPAGNIE ORIS INDUSTRIE | Agents de relaxation spécifiques d'organes ou de pathologies, utilisables pour modifier les contrastes en imagerie médicale par résonance magnétique nucléaire |
| EP0136812A2 (en) * | 1983-08-25 | 1985-04-10 | Technicare Corporation | Reagents for enhancing the contrast in NMR images |
| WO1985002772A1 (en) * | 1983-12-21 | 1985-07-04 | Schroeder Ulf | Diagnostic and contrast agent |
| WO1985004330A1 (en) * | 1984-03-29 | 1985-10-10 | Nyegaard & Co A/S | Use of ferromagnetic particles in contrast agents for nmr imaging and contrast agents |
| EP0160552A2 (en) * | 1984-04-27 | 1985-11-06 | Vestar, Inc. | Contrast agents for NMR imaging |
| WO1985005554A1 (en) * | 1984-05-31 | 1985-12-19 | Amersham International Plc | Nmr contrast agents |
| EP0165728A1 (en) * | 1984-05-30 | 1985-12-27 | Nycomed As | NMR contrast agents |
| EP0173163A1 (en) * | 1984-08-13 | 1986-03-05 | Research Corporation | Metal organo phosphorous compounds for NMR analysis |
| DE3443252A1 (de) * | 1984-11-23 | 1986-05-28 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dextran-magnetit-komplexe fuer die nmr-diagnostik |
| DE3443251A1 (de) * | 1984-11-23 | 1986-05-28 | Schering AG, 1000 Berlin und 4709 Bergkamen | Eisenoxid-komplexe fuer die nmr-diagnostik |
| EP0184899A1 (en) * | 1984-11-01 | 1986-06-18 | Nycomed As | Paramagnetic contrast agents for use in "in vivo" diagnostic methods using NMR, and their preparation |
| EP0186616A1 (de) * | 1984-11-23 | 1986-07-02 | Schering Aktiengesellschaft | Magnetische Partikel für die Diagnostik |
| EP0186947A1 (en) * | 1984-11-01 | 1986-07-09 | Nycomed As | Paramagnetic contrast agents for use in "in vivo" diagnostic methods using NMR, and their preparation |
| DE3590398T1 (de) * | 1984-08-10 | 1986-08-28 | Fox Chase Cancer Center, Philadelphia, Pa. | Magnetische Mikroteilchen als Kontrastmittel für magnetische Kernresonanzabbildung |
| DE3508000A1 (de) * | 1985-03-04 | 1986-09-04 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Ferromagnetische partikel fuer die nmr-diagnostik |
| US4615879A (en) * | 1983-11-14 | 1986-10-07 | Vanderbilt University | Particulate NMR contrast agents for gastrointestinal application |
| DE3518267A1 (de) * | 1985-05-17 | 1986-11-20 | Martin Prof. Dr. 1000 Berlin Wenzel | Mittel zur kontrast-erhoehung bei der kernspin-tomographie |
| US4637929A (en) * | 1985-01-04 | 1987-01-20 | Salutar, Inc. | Ferrioxamine-paramagnetic contrast agents for MR imaging, composition, apparatus and use |
| US4639365A (en) * | 1984-10-18 | 1987-01-27 | The Board Of Regents, The University Of Texas System | Gadolinium chelates as NMR contrast agents |
| EP0210043A2 (en) * | 1985-07-19 | 1987-01-28 | Guerbet S.A. | Contrast agent for NMR scanning |
| US4647447A (en) * | 1981-07-24 | 1987-03-03 | Schering Aktiengesellschaft | Diagnostic media |
| WO1987001594A1 (en) * | 1985-09-11 | 1987-03-26 | Amersham International Plc | Contrast agent for nmr imaging |
| US4656026A (en) * | 1984-12-10 | 1987-04-07 | University Of Iowa Research Foundation | Magnetic resonance (MR) image enhancement compounds for specific areas of the brain |
| US4675173A (en) * | 1985-05-08 | 1987-06-23 | Molecular Biosystems, Inc. | Method of magnetic resonance imaging of the liver and spleen |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4267234A (en) * | 1978-03-17 | 1981-05-12 | California Institute Of Technology | Polyglutaraldehyde synthesis and protein bonding substrates |
| DE3141641A1 (de) * | 1981-10-16 | 1983-04-28 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Ultraschall-kontrastmittel und dessen herstellung |
| US4423158A (en) * | 1983-01-27 | 1983-12-27 | Gelinnovation Handelsaktiebolag | Ion adsorbent for metals having a coordination number greater than two |
| US4554088A (en) * | 1983-05-12 | 1985-11-19 | Advanced Magnetics Inc. | Magnetic particles for use in separations |
| EP0184849A1 (de) * | 1984-12-12 | 1986-06-18 | Rainer Bauer | Aufnahmeeinrichtung für elektronische Bauelemente |
| US4795698A (en) * | 1985-10-04 | 1989-01-03 | Immunicon Corporation | Magnetic-polymer particles |
-
1987
- 1987-03-24 DE DE19873709851 patent/DE3709851A1/de not_active Withdrawn
-
1988
- 1988-03-23 AT AT88730073T patent/ATE78175T1/de not_active IP Right Cessation
- 1988-03-23 EP EP88730073A patent/EP0284549B1/de not_active Expired - Lifetime
- 1988-03-23 DE DE8888730073T patent/DE3872741D1/de not_active Expired - Lifetime
- 1988-03-23 ES ES88730073T patent/ES2052766T3/es not_active Expired - Lifetime
- 1988-03-24 JP JP63068349A patent/JP2663976B2/ja not_active Expired - Fee Related
-
1991
- 1991-01-04 US US07/638,134 patent/US5160725A/en not_active Expired - Fee Related
Patent Citations (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1978000005A1 (en) * | 1977-06-02 | 1978-12-07 | K H Mosbach | Magnetic polymer particles |
| DE2828941A1 (de) * | 1978-06-30 | 1980-01-10 | Robert Thomas Gordon | Mittel zur behandlung von krebs |
| EP0169299A2 (de) * | 1981-07-24 | 1986-01-29 | Schering Aktiengesellschaft | Verwendung von paramagnetischen Komplexsalzen zur Herstellung von Mitteln für die NMR-Diagnostik |
| EP0071564A1 (de) * | 1981-07-24 | 1983-02-09 | Schering Aktiengesellschaft | Paramagnetische Komplexsalze, deren Herstellung und Verwendung bei der NMR-Diagnostik |
| DE3129906A1 (de) * | 1981-07-24 | 1983-02-10 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Paramagnetische komplexsalze, deren herstellung und verwendung bei der nmr-diagnostik |
| US4647447A (en) * | 1981-07-24 | 1987-03-03 | Schering Aktiengesellschaft | Diagnostic media |
| DE3401052A1 (de) * | 1983-01-21 | 1984-07-26 | Schering AG, 1000 Berlin und 4709 Bergkamen | Diagnostische mittel |
| DE3316703A1 (de) * | 1983-05-04 | 1984-11-08 | Schering AG, 1000 Berlin und 4709 Bergkamen | Orales kontrastmittel fuer die kernspintomographie und dessen herstellung |
| EP0133603A1 (fr) * | 1983-08-12 | 1985-02-27 | Société anonyme: COMPAGNIE ORIS INDUSTRIE | Agents de relaxation spécifiques d'organes ou de pathologies, utilisables pour modifier les contrastes en imagerie médicale par résonance magnétique nucléaire |
| EP0136812A2 (en) * | 1983-08-25 | 1985-04-10 | Technicare Corporation | Reagents for enhancing the contrast in NMR images |
| US4615879A (en) * | 1983-11-14 | 1986-10-07 | Vanderbilt University | Particulate NMR contrast agents for gastrointestinal application |
| WO1985002772A1 (en) * | 1983-12-21 | 1985-07-04 | Schroeder Ulf | Diagnostic and contrast agent |
| WO1985004330A1 (en) * | 1984-03-29 | 1985-10-10 | Nyegaard & Co A/S | Use of ferromagnetic particles in contrast agents for nmr imaging and contrast agents |
| EP0160552A2 (en) * | 1984-04-27 | 1985-11-06 | Vestar, Inc. | Contrast agents for NMR imaging |
| EP0165728A1 (en) * | 1984-05-30 | 1985-12-27 | Nycomed As | NMR contrast agents |
| WO1985005554A1 (en) * | 1984-05-31 | 1985-12-19 | Amersham International Plc | Nmr contrast agents |
| DE3590398T1 (de) * | 1984-08-10 | 1986-08-28 | Fox Chase Cancer Center, Philadelphia, Pa. | Magnetische Mikroteilchen als Kontrastmittel für magnetische Kernresonanzabbildung |
| EP0173163A1 (en) * | 1984-08-13 | 1986-03-05 | Research Corporation | Metal organo phosphorous compounds for NMR analysis |
| US4639365A (en) * | 1984-10-18 | 1987-01-27 | The Board Of Regents, The University Of Texas System | Gadolinium chelates as NMR contrast agents |
| EP0186947A1 (en) * | 1984-11-01 | 1986-07-09 | Nycomed As | Paramagnetic contrast agents for use in "in vivo" diagnostic methods using NMR, and their preparation |
| EP0184899A1 (en) * | 1984-11-01 | 1986-06-18 | Nycomed As | Paramagnetic contrast agents for use in "in vivo" diagnostic methods using NMR, and their preparation |
| DE3443251A1 (de) * | 1984-11-23 | 1986-05-28 | Schering AG, 1000 Berlin und 4709 Bergkamen | Eisenoxid-komplexe fuer die nmr-diagnostik |
| DE3443252A1 (de) * | 1984-11-23 | 1986-05-28 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dextran-magnetit-komplexe fuer die nmr-diagnostik |
| EP0186616A1 (de) * | 1984-11-23 | 1986-07-02 | Schering Aktiengesellschaft | Magnetische Partikel für die Diagnostik |
| US4656026A (en) * | 1984-12-10 | 1987-04-07 | University Of Iowa Research Foundation | Magnetic resonance (MR) image enhancement compounds for specific areas of the brain |
| US4637929A (en) * | 1985-01-04 | 1987-01-20 | Salutar, Inc. | Ferrioxamine-paramagnetic contrast agents for MR imaging, composition, apparatus and use |
| DE3508000A1 (de) * | 1985-03-04 | 1986-09-04 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Ferromagnetische partikel fuer die nmr-diagnostik |
| US4675173A (en) * | 1985-05-08 | 1987-06-23 | Molecular Biosystems, Inc. | Method of magnetic resonance imaging of the liver and spleen |
| DE3518267A1 (de) * | 1985-05-17 | 1986-11-20 | Martin Prof. Dr. 1000 Berlin Wenzel | Mittel zur kontrast-erhoehung bei der kernspin-tomographie |
| EP0210043A2 (en) * | 1985-07-19 | 1987-01-28 | Guerbet S.A. | Contrast agent for NMR scanning |
| WO1987001594A1 (en) * | 1985-09-11 | 1987-03-26 | Amersham International Plc | Contrast agent for nmr imaging |
Non-Patent Citations (1)
| Title |
|---|
| DE-Z: Fortschr.Röntgenstr., Bd.145, H.2, 1986, S.130-139 * |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5240626A (en) * | 1990-09-21 | 1993-08-31 | Minnesota Mining And Manufacturing Company | Aqueous ferrofluid |
| DE4309333A1 (de) * | 1993-03-17 | 1994-09-22 | Silica Gel Gmbh | Superparamagnetische Teilchen, Verfahren zu ihrer Herstellung und Verwendung derselben |
| DE19514515A1 (de) * | 1995-04-12 | 1996-11-21 | Dirk Dipl Chem Guenther | Magnetisierbare Dispersionen |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3872741D1 (de) | 1992-08-20 |
| ES2052766T3 (es) | 1994-07-16 |
| EP0284549A2 (de) | 1988-09-28 |
| US5160725A (en) | 1992-11-03 |
| JP2663976B2 (ja) | 1997-10-15 |
| EP0284549A3 (en) | 1989-09-13 |
| JPS63255237A (ja) | 1988-10-21 |
| DE3872741T (cg-RX-API-DMAC10.html) | 1992-08-20 |
| ATE78175T1 (de) | 1992-08-15 |
| EP0284549B1 (de) | 1992-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3709851A1 (de) | Nmr-diagnostische fluessigkeitszusammensetzungen | |
| EP0689430B1 (de) | Superparamagnetische teilchen, verfahren zu ihrer herstellung und verwendung derselben | |
| DE3751918T2 (de) | Biodegradierbares superparamagnetisches material zur verwendung in klinischen anwendungen | |
| EP0772776B1 (de) | Superparamagnetische teilchen, verfahren zur herstellung und deren verwendung | |
| DE69507482T2 (de) | Hochdispergierte magnetische metalloxidteilchen,produktionsverfahren und anwendung | |
| DE69324591T2 (de) | Verbundmaterial mit kleinem durchmesser, welches ein wasserlösliches carboxylpolysaccharid und magnetisches eisenoxid enthaltet | |
| DE68919715T2 (de) | Verfahren sowie materialien zur hochgraduierten magnetischen abspaltung biologischer materialien. | |
| DE4407338A1 (de) | Superparamagnetische Teilchen und deren Verwendung | |
| DE3382834T3 (de) | Sorbentmittel und dessen Herstellungsverfahren | |
| DE69909090T2 (de) | Keimbildung und wachstum von metalloxid-nanopartikeln und verwendung | |
| EP0516252B1 (de) | Nanokristalline magnetische Eisenoxid-Partikel zur Anwendung in Diagnostik und Therapie | |
| DE69203004T2 (de) | Zusammensetzung zur Erhöhung des Bildkontrastes bei Bilderzeugung vom Verdauungstrakt von Patienten. | |
| EP0888545B1 (de) | Superparamagnetische teilchen mit vergrösserter r 1-relaxivität, verfahren zur herstellung und deren verwendung | |
| US5219554A (en) | Hydrated biodegradable superparamagnetic metal oxides | |
| DE3709852A1 (de) | Stabile magnetische fluessigkeitszusammensetzungen und verfahren zu ihrer herstellung und ihre verwendung | |
| DE10020376A1 (de) | Dynamische Marker | |
| EP0773796A1 (de) | Eisen enthaltende nanopartikel mit doppeltem coating und anwendung in der diagnostik und therapie | |
| DE10154016B4 (de) | Magnetflüssigkeit und Verfahren zur ihrer Herstellung | |
| EP0403961B1 (de) | Magnetische Protein-Konjugate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP1554734A1 (de) | Stabilisierte superparamagnetische teilchen | |
| DE102004035803B4 (de) | Verfahren zur Herstellung von in Wasser dispergierten Eisenoxid-Nanoteilchen und deren Anwendung | |
| DE69002742T2 (de) | Trennungsmaterial für Blutgerinnungsfaktoren, seine Herstellung und Verwendung. | |
| EP0472772A1 (de) | Verfahren zur Herstellung vitaler Wirkstoff-beladener Humanerythrozyten | |
| Ma et al. | Using Gradient Magnetic Fields to Control the Size and Uniformity of Iron Oxide Nanoparticles for Magnetic Resonance Imaging | |
| DE19924643B4 (de) | Verfahren zur Herstellung von Protein-beladenen Mikropartikeln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8141 | Disposal/no request for examination |