DE3640737A1 - Elektromagnetisches relais - Google Patents
Elektromagnetisches relaisInfo
- Publication number
- DE3640737A1 DE3640737A1 DE19863640737 DE3640737A DE3640737A1 DE 3640737 A1 DE3640737 A1 DE 3640737A1 DE 19863640737 DE19863640737 DE 19863640737 DE 3640737 A DE3640737 A DE 3640737A DE 3640737 A1 DE3640737 A1 DE 3640737A1
- Authority
- DE
- Germany
- Prior art keywords
- magnetic yoke
- leaf spring
- hinged armature
- hinged
- attached
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004353 relayed correlation spectroscopy Methods 0.000 title 1
- 238000004804 winding Methods 0.000 claims description 6
- 239000011810 insulating material Substances 0.000 claims description 4
- 230000001154 acute effect Effects 0.000 claims description 3
- 238000003860 storage Methods 0.000 description 3
- 238000003825 pressing Methods 0.000 description 2
- 238000005452 bending Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000007688 edging Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- SQMCFUSVGSBKFK-UHFFFAOYSA-M sodium;5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione Chemical compound [Na+].O=C1N(C)C(=O)[N-]C(=O)C1(C)C1=CCCCC1 SQMCFUSVGSBKFK-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/16—Magnetic circuit arrangements
- H01H50/18—Movable parts of magnetic circuits, e.g. armature
- H01H50/24—Parts rotatable or rockable outside coil
- H01H50/28—Parts movable due to bending of a blade spring or reed
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863640737 DE3640737A1 (de) | 1986-11-28 | 1986-11-28 | Elektromagnetisches relais |
| PCT/DE1987/000377 WO1988004101A1 (fr) | 1986-11-28 | 1987-08-25 | Relais electromagnetique |
| US07/236,355 US4951017A (en) | 1986-11-28 | 1987-08-25 | Electromagnetic relay |
| AU78541/87A AU7854187A (en) | 1986-11-28 | 1987-08-25 | Electromagnetic relay |
| ES8703398A ES2008922A6 (es) | 1986-11-28 | 1987-11-27 | Rele electromagnetico. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863640737 DE3640737A1 (de) | 1986-11-28 | 1986-11-28 | Elektromagnetisches relais |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3640737A1 true DE3640737A1 (de) | 1988-06-09 |
| DE3640737C2 DE3640737C2 (enExample) | 1991-11-28 |
Family
ID=6315029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863640737 Granted DE3640737A1 (de) | 1986-11-28 | 1986-11-28 | Elektromagnetisches relais |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4951017A (enExample) |
| AU (1) | AU7854187A (enExample) |
| DE (1) | DE3640737A1 (enExample) |
| ES (1) | ES2008922A6 (enExample) |
| WO (1) | WO1988004101A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4035586A1 (de) * | 1989-11-30 | 1991-06-06 | Jidosha Denki Kogyo Kk | Elektromagnetisches relais |
| WO2000060625A1 (de) * | 1999-04-07 | 2000-10-12 | Tyco Electronics Logistics Ag | Elektromagnetisches relais |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE8808277U1 (de) * | 1988-06-28 | 1989-10-26 | Robert Bosch Gmbh, 7000 Stuttgart | Elektromagnetisches Relais |
| JPH02106662U (enExample) * | 1989-02-10 | 1990-08-24 | ||
| US5260677A (en) * | 1991-11-04 | 1993-11-09 | Gamble John G | Snap-acting normally closed AC relay |
| DE4320831C1 (de) * | 1993-06-23 | 1994-07-07 | Hella Kg Hueck & Co | Ankerlagerung für ein Klappankerrelais |
| DE4411879C2 (de) * | 1994-04-06 | 1997-04-10 | Siemens Ag | Blattfederanordnung in einem elektrischen Schaltgerät und Verfahren zur Befestigung und Justierung einer Blattfeder |
| JP3992496B2 (ja) | 1999-09-28 | 2007-10-17 | Idec株式会社 | リレー及びリレーの製造方法 |
| US20030197999A1 (en) * | 2002-04-23 | 2003-10-23 | Mainstream Engineering Corp. | Device to increase the closing force of AC powered contactors, relays and solenoids |
| JP2011108452A (ja) * | 2009-11-16 | 2011-06-02 | Fujitsu Component Ltd | 電磁継電器 |
| DE102014103247A1 (de) * | 2014-03-11 | 2015-09-17 | Tyco Electronics Austria Gmbh | Elektromagnetisches Relais |
| FR3098639B1 (fr) * | 2019-07-08 | 2021-12-03 | G Cartier Tech | Relais electromecanique a dispersion reduite de la force de travail, et procede pour sa realisation |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE735980C (de) * | 1939-09-22 | 1943-06-03 | Siemens Ag | Elektrisches Relais mit Winkelanker |
| GB872789A (en) * | 1957-09-06 | 1961-07-12 | Standard Telephones Cables Ltd | Pivotal means for electromagnetic armatures |
| DE1940185U (de) * | 1965-11-04 | 1966-06-08 | Siemens Ag | Relaisanker mit einstellbarem anschlag. |
| US3437962A (en) * | 1967-06-12 | 1969-04-08 | American Mach & Foundry | Clapper type relay with improved armature |
| DE1807319A1 (de) * | 1967-11-06 | 1969-07-17 | Hermetic Coil Co Inc | Relais |
| US4260973A (en) * | 1978-08-17 | 1981-04-07 | Robert Bosch Gmbh | Plug-in electromagnetic relay |
| DE8325986U1 (de) * | 1983-09-09 | 1983-12-29 | Siemens AG, 1000 Berlin und 8000 München | Elektromagnetisches Relais |
| DE3332487A1 (de) * | 1983-04-09 | 1984-10-18 | Original Electric Mfg. Co. Ltd., Tokio/Tokyo | Elektromagnetisches relais |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE539029A (enExample) * | 1954-06-18 | |||
| FR1534341A (fr) * | 1966-08-18 | 1968-07-26 | Siemens Ag | Relais non polarisé de construction miniaturisée |
| DE1639296A1 (de) * | 1968-01-13 | 1971-02-25 | Hartmann & Braun Ag | Hilfsrelais mit Winkelanker |
| DE7033403U (de) * | 1970-09-08 | 1970-12-17 | Kienzle Uhrenfabriken Gmbh | Rueckholfeder fuer klappanker. |
| US4460881A (en) * | 1982-09-30 | 1984-07-17 | Meister Jack B | Quiet relay |
| DE3339082A1 (de) * | 1983-10-28 | 1985-05-09 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Elektromagnetisches relais und verfahren zur herstellung |
-
1986
- 1986-11-28 DE DE19863640737 patent/DE3640737A1/de active Granted
-
1987
- 1987-08-25 AU AU78541/87A patent/AU7854187A/en not_active Abandoned
- 1987-08-25 US US07/236,355 patent/US4951017A/en not_active Expired - Lifetime
- 1987-08-25 WO PCT/DE1987/000377 patent/WO1988004101A1/de not_active Ceased
- 1987-11-27 ES ES8703398A patent/ES2008922A6/es not_active Expired
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE735980C (de) * | 1939-09-22 | 1943-06-03 | Siemens Ag | Elektrisches Relais mit Winkelanker |
| GB872789A (en) * | 1957-09-06 | 1961-07-12 | Standard Telephones Cables Ltd | Pivotal means for electromagnetic armatures |
| DE1940185U (de) * | 1965-11-04 | 1966-06-08 | Siemens Ag | Relaisanker mit einstellbarem anschlag. |
| US3437962A (en) * | 1967-06-12 | 1969-04-08 | American Mach & Foundry | Clapper type relay with improved armature |
| DE1807319A1 (de) * | 1967-11-06 | 1969-07-17 | Hermetic Coil Co Inc | Relais |
| US4260973A (en) * | 1978-08-17 | 1981-04-07 | Robert Bosch Gmbh | Plug-in electromagnetic relay |
| DE3332487A1 (de) * | 1983-04-09 | 1984-10-18 | Original Electric Mfg. Co. Ltd., Tokio/Tokyo | Elektromagnetisches relais |
| DE8325986U1 (de) * | 1983-09-09 | 1983-12-29 | Siemens AG, 1000 Berlin und 8000 München | Elektromagnetisches Relais |
Non-Patent Citations (1)
| Title |
|---|
| DE Patentanmeldung T 5719 VIIIc/21g * |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4035586A1 (de) * | 1989-11-30 | 1991-06-06 | Jidosha Denki Kogyo Kk | Elektromagnetisches relais |
| DE4035586C3 (de) * | 1989-11-30 | 1998-02-12 | Jidosha Denki Kogyo Kk | Elektromagnetisches Relais |
| WO2000060625A1 (de) * | 1999-04-07 | 2000-10-12 | Tyco Electronics Logistics Ag | Elektromagnetisches relais |
| US6531939B1 (en) | 1999-04-07 | 2003-03-11 | Tyco Electronics Logistics Ag | Electromagnetic relay |
Also Published As
| Publication number | Publication date |
|---|---|
| WO1988004101A1 (fr) | 1988-06-02 |
| ES2008922A6 (es) | 1989-08-16 |
| AU7854187A (en) | 1988-06-16 |
| DE3640737C2 (enExample) | 1991-11-28 |
| US4951017A (en) | 1990-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3808558C2 (enExample) | ||
| DE3640737A1 (de) | Elektromagnetisches relais | |
| DE68921449T2 (de) | Elektromagnetisches Relais. | |
| DE4327502C2 (de) | Schiebeschalter | |
| DE2835316C2 (enExample) | ||
| DE8418178U1 (de) | Bandkassette, insbesondere video-magnetbandkassette mit mindestens einer andruckfeder | |
| DE60306962T2 (de) | Elektromagnetisches kontaktglied | |
| DE3783834T2 (de) | Elektromagnetisches relais. | |
| WO1993023862A1 (de) | Vorrichtung zum ein- und ausschalten elektrischer verbraucher, insbesondere für anzeigeinstrumente im armaturenbrett von kraftfahrzeugen | |
| DE3836096A1 (de) | Elektromagnetisches relais | |
| DE2640439A1 (de) | Elektromagnetische betaetigungseinrichtung | |
| EP0091688B1 (de) | Elektromagnetisches Relais | |
| DE3423270C2 (de) | Elektromagnetisches Relais | |
| DE4115092A1 (de) | Elektromagnetisches schaltrelais fuer leiterplattenmontage | |
| DE60025454T2 (de) | Relais mit einem L-förmigen Joch und einem an die Kante eines Schenkels des Joches schwenkbaren Klappanker | |
| DE3046947C2 (enExample) | ||
| DE3219368A1 (de) | Elektrischer leistungsschalter mit elektromagnetisch wirkendem ausloesemechanismus | |
| DE3202579C2 (enExample) | ||
| EP0456984B1 (de) | Steckschalter | |
| DE4143063C2 (de) | Minielektromagnet und seine Verwendung als Relais | |
| DE19956080C1 (de) | Kontaktfederbaugruppe für ein Relais mit einem Wippanker | |
| DE3438274C2 (enExample) | ||
| EP0178666A2 (de) | Gepoltes elektromagnetisches Relais | |
| DE3328684C1 (de) | Ankerhaltefeder für DIL-Relais | |
| EP0337097A1 (de) | Elektromagnetisches Relais |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: H01H 50/18 |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |