DE3624491C3 - Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-Fassaden - Google Patents
Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-FassadenInfo
- Publication number
- DE3624491C3 DE3624491C3 DE3624491A DE3624491A DE3624491C3 DE 3624491 C3 DE3624491 C3 DE 3624491C3 DE 3624491 A DE3624491 A DE 3624491A DE 3624491 A DE3624491 A DE 3624491A DE 3624491 C3 DE3624491 C3 DE 3624491C3
- Authority
- DE
- Germany
- Prior art keywords
- pane
- edges
- panes
- profile
- support structure
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000011521 glass Substances 0.000 title claims description 13
- 239000005340 laminated glass Substances 0.000 claims description 9
- 239000010410 layer Substances 0.000 claims description 4
- 239000002356 single layer Substances 0.000 claims description 3
- 238000010276 construction Methods 0.000 description 5
- 125000006850 spacer group Chemical group 0.000 description 3
- 239000011324 bead Substances 0.000 description 2
- 238000007373 indentation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 241000022844 Praxis Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- RJMIEHBSYVWVIN-UHFFFAOYSA-N indoprofen Chemical compound C1=CC(C(C(O)=O)C)=CC=C1N1C(=O)C2=CC=CC=C2C1 RJMIEHBSYVWVIN-UHFFFAOYSA-N 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 210000000689 upper leg Anatomy 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B3/00—Window sashes, door leaves, or like elements for closing wall or like openings; Layout of fixed or moving closures, e.g. windows in wall or like openings; Features of rigidly-mounted outer frames relating to the mounting of wing frames
- E06B3/54—Fixing of glass panes or like plates
- E06B3/5427—Fixing of glass panes or like plates the panes mounted flush with the surrounding frame or with the surrounding panes
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B17/00—Layered products essentially comprising sheet glass, or glass, slag, or like fibres
- B32B17/06—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material
- B32B17/10—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin
- B32B17/10005—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing
- B32B17/10009—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing characterized by the number, the constitution or treatment of glass sheets
- B32B17/10036—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing characterized by the number, the constitution or treatment of glass sheets comprising two outer glass sheets
- B32B17/10045—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing characterized by the number, the constitution or treatment of glass sheets comprising two outer glass sheets with at least one intermediate layer consisting of a glass sheet
- B32B17/10055—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing characterized by the number, the constitution or treatment of glass sheets comprising two outer glass sheets with at least one intermediate layer consisting of a glass sheet with at least one intermediate air space
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B17/00—Layered products essentially comprising sheet glass, or glass, slag, or like fibres
- B32B17/06—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material
- B32B17/10—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin
- B32B17/10005—Layered products essentially comprising sheet glass, or glass, slag, or like fibres comprising glass as the main or only constituent of a layer, next to another layer of a specific material of synthetic resin laminated safety glass or glazing
- B32B17/10165—Functional features of the laminated safety glass or glazing
- B32B17/10293—Edge features, e.g. inserts or holes
Landscapes
- Engineering & Computer Science (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Load-Bearing And Curtain Walls (AREA)
- Securing Of Glass Panes Or The Like (AREA)
- Window Of Vehicle (AREA)
- Wing Frames And Configurations (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3624491A DE3624491C3 (de) | 1986-07-19 | 1986-07-19 | Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-Fassaden |
| GB8706186A GB2194278B (en) | 1986-07-19 | 1987-03-16 | Composite pane structure for all-glass facades |
| SE8702810A SE462291B (sv) | 1986-07-19 | 1987-07-08 | Skivinfaestningssystem foer upphaengning av glasenheter i en baerkonstruktion vid helglasfasader |
| CH2641/87A CH674875A5 (cg-RX-API-DMAC10.html) | 1986-07-19 | 1987-07-09 | |
| NO872871A NO166967C (no) | 1986-07-19 | 1987-07-10 | Anordning for opphengning av ruteenheter. |
| IT21290/87A IT1222035B (it) | 1986-07-19 | 1987-07-15 | Sostegno per lastre in facciate interamente di vetro |
| FR878710167A FR2601717B1 (fr) | 1986-07-19 | 1987-07-17 | Dispositif de fixation de vitrages dans une facade rideau entierement vitree |
| AT0181287A AT404274B (de) | 1986-07-19 | 1987-07-17 | Scheibenhalterung bei ganzglasfassaden |
| US07/258,042 US4905435A (en) | 1986-07-19 | 1988-10-13 | Pane holder in all-glass facades |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3624491A DE3624491C3 (de) | 1986-07-19 | 1986-07-19 | Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-Fassaden |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE3624491A1 DE3624491A1 (de) | 1988-01-21 |
| DE3624491C2 DE3624491C2 (cg-RX-API-DMAC10.html) | 1992-07-02 |
| DE3624491C3 true DE3624491C3 (de) | 1997-04-24 |
Family
ID=6305575
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3624491A Expired - Fee Related DE3624491C3 (de) | 1986-07-19 | 1986-07-19 | Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-Fassaden |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4905435A (cg-RX-API-DMAC10.html) |
| AT (1) | AT404274B (cg-RX-API-DMAC10.html) |
| CH (1) | CH674875A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3624491C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2601717B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2194278B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1222035B (cg-RX-API-DMAC10.html) |
| NO (1) | NO166967C (cg-RX-API-DMAC10.html) |
| SE (1) | SE462291B (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10216425C1 (de) * | 2002-04-12 | 2003-08-14 | Steindl Glas Gmbh Itter | Isolierverglasung mit Haltesystem |
| DE102010011315A1 (de) | 2010-03-13 | 2011-09-15 | Eduard Hueck Gmbh & Co Kg | Ganzglasfassade |
| DE102010017984A1 (de) * | 2010-04-21 | 2011-10-27 | Udo Vierck | Dichtungsrahmen für den Hausbau |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0280832B1 (de) * | 1987-03-05 | 1990-08-22 | Metallbau Koller AG | Plattenkonstruktion für eine Fassade oder ein Dach |
| DE3710478A1 (de) * | 1987-03-30 | 1988-10-13 | Noerdlingen Glashandel | Glasscheibe zur verwendung als fassadenelement fuer hochbauten, insbesondere zur herstellung von ganzglasfassaden |
| IT1221850B (it) * | 1987-08-07 | 1990-07-12 | Col Diego Da | Sistema di rivestimento a specchiature formantifacciata continua per edifici |
| DE3801186A1 (de) * | 1988-01-18 | 1989-07-27 | Schueco Int Gmbh & Co | Befestigung fuer isolierglasscheiben einer aussenwand- oder dachverglasung |
| EP0325098A1 (de) * | 1988-01-18 | 1989-07-26 | Josef Eckelt | Verglasung mit einer Verbundscheibe und Verfahren zum Herstellen einer solchen Verbundscheibe |
| DE3808513A1 (de) * | 1988-03-15 | 1989-10-05 | Hueck Eduard Kg | Scheibenhalterung zum aufhaengen von scheibenfeldern an einer traegerkonstruktion bei gebaeudefassaden u. dgl. |
| DE3808981A1 (de) * | 1988-03-17 | 1989-09-28 | Gartner & Co J | Rahmenlose verglasung |
| AT396497B (de) * | 1988-03-18 | 1993-09-27 | Glas Baumann Ges M B H & Co Kg | Gebäudeaussenverkleidung, insbesondere fassade, mit plattenförmigen bauelementen |
| FR2635801B1 (fr) * | 1988-08-30 | 1990-11-23 | Timo Ind | Cloisons fabriquees par assemblage de panneaux et de vitres |
| IT1225125B (it) * | 1988-10-07 | 1990-11-02 | Clima Srl | Profilato atto a formare un elemento di supporto di lastre di vetro e/o piastre di vario genere particolarmente applicabile per la formazione di facciate continue e simili |
| DE3905379A1 (de) * | 1989-02-22 | 1990-08-23 | Ahrens Chr Fa | Mehrfachglasscheibe |
| JPH0611283Y2 (ja) * | 1989-08-09 | 1994-03-23 | 日本建鐵株式会社 | 網入複層ガラスの取付構造 |
| CA2017669C (en) * | 1990-05-28 | 1992-07-21 | Albino D. Nonis | Curtain wall for a building |
| DE4126918A1 (de) * | 1990-08-20 | 1992-02-27 | Gartner & Co J | Anordnung von halterungsprofilen zum befestigen einer glasscheibe |
| BE1003942A4 (fr) * | 1990-10-01 | 1992-07-22 | Portal S A | Vitre, procede et outil pour sa fabrication. |
| CA2041364C (en) * | 1991-04-26 | 1993-09-21 | Glenn Robert Allen | Insulated glass/flush outer surface arrangement |
| DK168338B1 (da) * | 1992-01-31 | 1994-03-14 | Rasmussen Kann Ind As | Modulsystem for bygningsfacader |
| WO1993021400A1 (en) * | 1992-04-16 | 1993-10-28 | Farag F Aziz | A stopless butt-joint curtainwall system |
| DE4218351A1 (de) * | 1992-06-04 | 1993-12-16 | Mero Raumstruktur Gmbh & Co | Abdichtsystem für Ein- bzw. Abdeckungselemente von Gebäudedächern und-fassaden |
| US5355645A (en) * | 1992-08-26 | 1994-10-18 | Farag F Aziz | Stopless butt-joint multiple curtainwall system |
| US5579616A (en) * | 1992-08-26 | 1996-12-03 | Farag; F. Aziz | Panel-securing system |
| US5307597A (en) * | 1992-11-13 | 1994-05-03 | Ykk Corporation | Water deflector |
| DE9303883U1 (de) * | 1993-03-16 | 1993-05-19 | Thyssen Polymer GmbH, 8000 München | Sparren- und Pfostenprofil |
| DE4324656C2 (de) * | 1993-07-22 | 1998-03-19 | Gartner & Co J | Glasrandhalterung |
| DE9411552U1 (de) * | 1994-07-16 | 1994-11-10 | Raico Bautechnik GmbH, 86470 Thannhausen | Fassade |
| GB2318148B (en) * | 1996-10-10 | 2000-10-11 | Komfort Systems Ltd | Partitioning system |
| EP0957227B1 (de) * | 1998-05-13 | 2002-02-27 | Harald Dr.-Ing. Schulz | Fassadenkonstruktion |
| US6581354B1 (en) * | 1999-06-25 | 2003-06-24 | Larry S. Skarpness | Glass curtain wall system |
| DE10034889B4 (de) * | 2000-07-18 | 2004-01-29 | Ingenieurbüro Dr.-Ing. Harald Schulz | Spreizglashalter |
| SE0200141L (sv) * | 2002-01-21 | 2003-02-25 | Jerker Lundgren | Glasningssystem för byggnader |
| DE10319278B4 (de) | 2003-04-29 | 2007-03-29 | Wicona Bausysteme Gmbh | Fassadenelement zum Verkleiden einer Gebäudewand |
| JP3951975B2 (ja) * | 2003-07-22 | 2007-08-01 | 株式会社日立製作所 | 交流電動機の制御装置,交流電動機の制御方法及びモジュール |
| GB2449439B (en) * | 2007-05-21 | 2009-04-22 | Viridian Concepts Ltd | Glazing integrated solar water heating panels |
| JP5166467B2 (ja) * | 2010-03-16 | 2013-03-21 | 株式会社サンレール | 手摺りガラス取付装置 |
| CA2741229C (en) * | 2010-06-04 | 2013-11-19 | Alcoa Inc. | Sealant joint backer support |
| JP5197682B2 (ja) * | 2010-06-18 | 2013-05-15 | 株式会社サンレール | 手摺りのガラス板取付構造 |
| AT12441U1 (de) | 2010-12-23 | 2012-05-15 | Glas Gasperlmair Ges M B H | Isolierverglasung für glasfassaden |
| WO2012103102A1 (en) * | 2011-01-26 | 2012-08-02 | Dow Corning Corporation | Assemblies for a structure |
| US9068347B2 (en) | 2012-12-07 | 2015-06-30 | Illinois Tool Works Inc. | Curtain wall panel bracket leveling system |
| US8955285B2 (en) | 2012-12-07 | 2015-02-17 | Illinois Tool Works Inc. | Embedment attachment system |
| US9663961B2 (en) | 2012-12-07 | 2017-05-30 | Illinois Tool Works Inc. | Curtain wall panel installation system |
| EP3179025B1 (de) * | 2015-12-08 | 2020-10-28 | Heinz Eisenbach | Absturzsicherung und glasfassade |
| US10562274B1 (en) | 2016-02-22 | 2020-02-18 | Apple Inc. | Glass fastening and sealing systems |
| EP3279404B1 (de) * | 2016-08-04 | 2019-06-12 | Knapp GmbH | Vorrichtung zum befestigen einer glasscheibe |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB106003A (en) * | 1916-05-19 | 1917-05-10 | John Patrick O'donnell | Improvements in or relating to Motion-plate and like Pin-and-slot Mechanism applicable principally to Valve-gears. |
| US2034725A (en) * | 1934-10-26 | 1936-03-24 | Macgaffey Wyatt | Display window |
| US2576392A (en) * | 1945-05-15 | 1951-11-27 | Pittsburgh Plate Glass Co | Laminated glass unit |
| DE1284605B (de) * | 1963-09-13 | 1968-12-05 | Gartner & Co J | Vorhangwand fuer Gebaeude |
| GB1060031A (en) * | 1965-01-06 | 1967-02-22 | British Aircraft Corp Ltd | Improvements in mountings for aircraft windscreens |
| US3343317A (en) * | 1965-12-28 | 1967-09-26 | United Aircraft Corp | Window construction and mounting |
| GB1181517A (en) * | 1966-07-29 | 1970-02-18 | British Aircraft Corp Ltd Form | Improvements in Aircraft. |
| SE320586B (cg-RX-API-DMAC10.html) * | 1967-11-13 | 1970-02-09 | Bofors Ab | |
| GB1245748A (en) * | 1968-01-05 | 1971-09-08 | Astralite Windows Ltd | Improvements in or relating to panel constructions |
| DE6800936U (de) * | 1968-10-04 | 1969-03-06 | Bostik Gmbh | Doppelscheibe mit abstandhalter |
| US3672107A (en) * | 1970-05-11 | 1972-06-27 | Corning Glass Works | Gripping and sealing system for slab facing materials |
| FR2094397A6 (cg-RX-API-DMAC10.html) * | 1970-06-19 | 1972-02-04 | Cib Couverture Indle | |
| DE2430276C3 (de) * | 1974-06-24 | 1978-09-28 | Theodor 8857 Gottmannshofen Straub | Befestigungsvorrichtung für Fassadenelemente |
| GB1537473A (en) * | 1975-10-29 | 1978-12-29 | Btr Industries Ltd | Structural assemblies |
| US4041663A (en) * | 1976-07-30 | 1977-08-16 | Ppg Industries, Inc. | Reducing solar radiation transmittance of installed glazing |
| JPS5921383U (ja) * | 1982-08-02 | 1984-02-09 | ワイケイケイ株式会社 | 建築用形材 |
| US4552790A (en) * | 1983-06-30 | 1985-11-12 | Francis Geoffrey V | Structural spacer glazing with connecting spacer device |
| GB8324355D0 (en) * | 1983-09-12 | 1983-10-12 | Pilkington Brothers Plc | Glass assembly |
| DE3335783A1 (de) * | 1983-10-01 | 1985-05-02 | Schott Glaswerke, 6500 Mainz | Brandschutz-isolierglas |
| DE3439436A1 (de) * | 1984-10-27 | 1986-04-30 | SCHÜCO Heinz Schürmann GmbH & Co, 4800 Bielefeld | Aussenwand- und dachverglasung |
| IT1180493B (it) * | 1984-11-28 | 1987-09-23 | C C Di Costa E C S R L | Rivestimento per superfici esterne di edifici |
| GB8504275D0 (en) * | 1985-02-19 | 1985-03-20 | Pilkington Glass Ltd | Sealed double glazing unit |
| DE8508113U1 (de) * | 1985-03-19 | 1985-11-14 | Rüterbau GmbH, 3012 Langenhagen | Rahmen mit Ein- und Mehrfachglasscheiben, sowie mit Wand- und Fassadenelementen |
| GB8519276D0 (en) * | 1985-07-31 | 1985-10-02 | Pilkington Glass Ltd | Structural glass unit |
| IT1202093B (it) * | 1985-08-21 | 1989-02-02 | C C Di Costa & C Srl | Sistema di fissaggio di laster vetrocamera isolante a telai metallici di supporto |
| DE8704683U1 (de) * | 1987-03-30 | 1987-05-27 | GGN Glashandels-Gesellschaft Nördlingen mbH & Co KG, 8860 Nördlingen | Glasscheibe zur Verwendung als Fassadenelement für Hochbauten |
| DE3801186A1 (de) * | 1988-01-18 | 1989-07-27 | Schueco Int Gmbh & Co | Befestigung fuer isolierglasscheiben einer aussenwand- oder dachverglasung |
-
1986
- 1986-07-19 DE DE3624491A patent/DE3624491C3/de not_active Expired - Fee Related
-
1987
- 1987-03-16 GB GB8706186A patent/GB2194278B/en not_active Expired - Lifetime
- 1987-07-08 SE SE8702810A patent/SE462291B/sv not_active IP Right Cessation
- 1987-07-09 CH CH2641/87A patent/CH674875A5/de not_active IP Right Cessation
- 1987-07-10 NO NO872871A patent/NO166967C/no unknown
- 1987-07-15 IT IT21290/87A patent/IT1222035B/it active
- 1987-07-17 FR FR878710167A patent/FR2601717B1/fr not_active Expired - Lifetime
- 1987-07-17 AT AT0181287A patent/AT404274B/de not_active IP Right Cessation
-
1988
- 1988-10-13 US US07/258,042 patent/US4905435A/en not_active Expired - Fee Related
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10216425C1 (de) * | 2002-04-12 | 2003-08-14 | Steindl Glas Gmbh Itter | Isolierverglasung mit Haltesystem |
| DE10216425C5 (de) * | 2002-04-12 | 2009-10-08 | Steindl Glas Gmbh | Isolierverglasung mit Haltesystem |
| DE102010011315A1 (de) | 2010-03-13 | 2011-09-15 | Eduard Hueck Gmbh & Co Kg | Ganzglasfassade |
| DE102010017984A1 (de) * | 2010-04-21 | 2011-10-27 | Udo Vierck | Dichtungsrahmen für den Hausbau |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2601717B1 (fr) | 1992-02-28 |
| GB2194278B (en) | 1990-04-04 |
| FR2601717A1 (fr) | 1988-01-22 |
| DE3624491A1 (de) | 1988-01-21 |
| US4905435A (en) | 1990-03-06 |
| NO872871D0 (no) | 1987-07-10 |
| CH674875A5 (cg-RX-API-DMAC10.html) | 1990-07-31 |
| AT404274B (de) | 1998-10-27 |
| IT1222035B (it) | 1990-08-31 |
| GB8706186D0 (en) | 1987-04-23 |
| SE8702810D0 (sv) | 1987-07-08 |
| NO166967B (no) | 1991-06-10 |
| SE462291B (sv) | 1990-05-28 |
| NO166967C (no) | 1991-09-18 |
| IT8721290A0 (it) | 1987-07-15 |
| SE8702810L (sv) | 1988-01-20 |
| ATA181287A (de) | 1991-02-15 |
| DE3624491C2 (cg-RX-API-DMAC10.html) | 1992-07-02 |
| NO872871L (no) | 1988-01-20 |
| GB2194278A (en) | 1988-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3624491C3 (de) | Scheibenhalterung zum Aufhängen von Scheibenfeldern an einer Trägerkonstruktion bei Ganzglas-Fassaden | |
| DE1609784A1 (de) | Bausystem | |
| CH660116A5 (de) | Gestell aus mehreren profilstaeben. | |
| DE69203300T2 (de) | Gitterartiges Tunnelgewölbe. | |
| DE202014010902U1 (de) | Isolierelement für Fassaden- oder Lichtdachkonstruktionen | |
| AT395339B (de) | Scheibenhalterung zum aufhaengen von scheibenfeldern an einer traegerkonstruktion bei ganzglasfassaden und dgl. | |
| AT406073B (de) | Fenster oder tür | |
| EP0141368B1 (de) | Türblatt | |
| AT514271A1 (de) | Tür | |
| DE202016101078U1 (de) | Geländer | |
| EP0256563B1 (de) | Abstandhalterrahmen für Mehrscheibenisolierglas | |
| DE3510742A1 (de) | Haltevorrichtung fuer eine glaswand bildende verglasungen | |
| CH674541A5 (cg-RX-API-DMAC10.html) | ||
| DE202016105087U1 (de) | Halteschiene für einen französischen Balkon sowie Haltevorrichtung und Anordnung dafür | |
| EP0853182A1 (de) | Türblatt | |
| DE9013659U1 (de) | Schutzwand, insbesondere zum Schutz gegen Überfluten durch Hochwasser | |
| DE3403133A1 (de) | Sprossenfenster mit einem bevorzugt den ganzen fenster- oder fluegelrahmen ausfuellenden isolierglaseinsatz | |
| CH707540A2 (de) | Tragendes Glaswandelement für leichte Holzbauten. | |
| DE1683158A1 (de) | Gelaender,insbesondere aus Aluminium | |
| DE29504372U1 (de) | Verbindungssystem | |
| DE3311142A1 (de) | Dichtungsleiste zum abdichten spaltfoermiger zwischenraeume zwischen der aussenseite von fensterrahmen und angrenzendem mauerwerk | |
| DE29713191U1 (de) | Schiebeflügel mit einem aus Metallprofilen hergestellten Rahmen | |
| DE7729252U1 (de) | Elastisches dek-profil fuer zweifachverglasung an neufenster | |
| EP1258592B1 (de) | Zurückgesetzter Ladeneingang mit Brandschutzverglasung | |
| DE2642746B2 (de) | Aus Schaumstoff mit eingelagerten metallenen Hohlprofilen bestehender Rahmen für Fenster |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: EDUARD HUECK GMBH & CO KG, 5880 LUEDENSCHEID, DE |
|
| 8366 | Restricted maintained after opposition proceedings | ||
| 8381 | Inventor (new situation) |
Free format text: HORST, GUENTER, 58511 LUEDENSCHEID, DE |
|
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted | ||
| 8339 | Ceased/non-payment of the annual fee |