DE3602648A1 - Verfahren zur herstellung von n(pfeil hoch)5(pfeil hoch)-(3'-(3''-<(dimethylamino)-methyl>-phenoxy)-propyl)-1h-1,2,4-triazol-3,5-di-(aminen) sowie 3-(amino)-5-((3'-(halogen)-propyl) -amino)-1h-1,2,4-triazole - Google Patents
Verfahren zur herstellung von n(pfeil hoch)5(pfeil hoch)-(3'-(3''-<(dimethylamino)-methyl>-phenoxy)-propyl)-1h-1,2,4-triazol-3,5-di-(aminen) sowie 3-(amino)-5-((3'-(halogen)-propyl) -amino)-1h-1,2,4-triazoleInfo
- Publication number
- DE3602648A1 DE3602648A1 DE19863602648 DE3602648A DE3602648A1 DE 3602648 A1 DE3602648 A1 DE 3602648A1 DE 19863602648 DE19863602648 DE 19863602648 DE 3602648 A DE3602648 A DE 3602648A DE 3602648 A1 DE3602648 A1 DE 3602648A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- general formula
- propyl
- deep
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 AMINO Chemical class 0.000 title claims abstract description 102
- 150000001412 amines Chemical class 0.000 title claims abstract description 50
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical compound CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 title claims abstract description 37
- 229910052736 halogen Inorganic materials 0.000 title claims abstract description 32
- 150000002367 halogens Chemical class 0.000 title claims abstract description 32
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 238000000034 method Methods 0.000 claims abstract description 61
- 230000008569 process Effects 0.000 claims abstract description 38
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 36
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 28
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 16
- JNZYADHPGVZMQK-UHFFFAOYSA-N 3-(aminomethyl)phenol Chemical class NCC1=CC=CC(O)=C1 JNZYADHPGVZMQK-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000003513 alkali Substances 0.000 claims abstract description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 12
- 239000002253 acid Substances 0.000 claims abstract description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- 229910052799 carbon Inorganic materials 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical compound C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 159000000003 magnesium salts Chemical class 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 5
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 7
- PKWIYNIDEDLDCJ-UHFFFAOYSA-N guanazole Chemical compound NC1=NNC(N)=N1 PKWIYNIDEDLDCJ-UHFFFAOYSA-N 0.000 abstract description 5
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 2
- 150000001340 alkali metals Chemical class 0.000 abstract description 2
- 239000013067 intermediate product Substances 0.000 abstract description 2
- 150000001875 compounds Chemical class 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- DVYKNDNKQXODLX-UHFFFAOYSA-N Cl.ClCCCC1(N=C(NN1)N)N Chemical compound Cl.ClCCCC1(N=C(NN1)N)N DVYKNDNKQXODLX-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical group 0.000 description 6
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical class NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 5
- 150000002429 hydrazines Chemical class 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 150000004707 phenolate Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical class NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 150000002541 isothioureas Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- HXMWGMZZNGHVPQ-UHFFFAOYSA-N 3-[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC=CC(O)=C1 HXMWGMZZNGHVPQ-UHFFFAOYSA-N 0.000 description 2
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003852 triazoles Chemical group 0.000 description 2
- 231100000397 ulcer Toxicity 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- XRENTJLWZNGGPA-UHFFFAOYSA-N C(CC1(NNC(=N1)N)N)CO Chemical compound C(CC1(NNC(=N1)N)N)CO XRENTJLWZNGGPA-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- CKQOECSSEWMCOD-UHFFFAOYSA-N cyanoiminocarbamodithioic acid Chemical compound SC(=S)N=NC#N CKQOECSSEWMCOD-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 150000003349 semicarbazides Chemical class 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000003583 thiosemicarbazides Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU85315A HU193253B (en) | 1985-01-29 | 1985-01-29 | Process for preparing 3,5-diamino-1,2,4-triazole derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3602648A1 true DE3602648A1 (de) | 1986-09-11 |
| DE3602648C2 DE3602648C2 (enExample) | 1990-09-06 |
Family
ID=10949054
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863602648 Granted DE3602648A1 (de) | 1985-01-29 | 1986-01-29 | Verfahren zur herstellung von n(pfeil hoch)5(pfeil hoch)-(3'-(3''-<(dimethylamino)-methyl>-phenoxy)-propyl)-1h-1,2,4-triazol-3,5-di-(aminen) sowie 3-(amino)-5-((3'-(halogen)-propyl) -amino)-1h-1,2,4-triazole |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS61176576A (enExample) |
| CN (1) | CN1015456B (enExample) |
| AR (1) | AR240046A1 (enExample) |
| AT (1) | AT395149B (enExample) |
| CA (1) | CA1285568C (enExample) |
| CS (1) | CS253739B2 (enExample) |
| DD (1) | DD242807A5 (enExample) |
| DE (1) | DE3602648A1 (enExample) |
| DK (1) | DK42986A (enExample) |
| ES (1) | ES8704910A1 (enExample) |
| FI (1) | FI860432A7 (enExample) |
| GB (1) | GB2170805B (enExample) |
| HU (1) | HU193253B (enExample) |
| IT (1) | IT1190608B (enExample) |
| NO (1) | NO167091C (enExample) |
| PL (1) | PL146491B1 (enExample) |
| PT (1) | PT81935B (enExample) |
| SE (1) | SE8600385L (enExample) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE875846A (fr) * | 1978-04-26 | 1979-10-25 | Glaxo Group Ltd | Derives heterocycliques et leur preparation |
| EP0029303B1 (en) * | 1979-10-22 | 1985-01-30 | Glaxo Group Limited | 1,2,4-triazole derivatives, processes for their production and pharmaceutical compositions containing them |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK558181A (da) * | 1981-01-30 | 1982-07-31 | Smithkline Corp | Fremgangsmaade til fremstilling af 3,5-diamino-1,2,4-triazoler |
| DE3336410A1 (de) * | 1983-10-06 | 1985-04-18 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | Sulfenamidderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3341750A1 (de) * | 1983-11-18 | 1985-05-30 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 1,2,4-triazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
-
1985
- 1985-01-29 HU HU85315A patent/HU193253B/hu unknown
-
1986
- 1986-01-19 IT IT19218/86A patent/IT1190608B/it active
- 1986-01-27 CS CS86576A patent/CS253739B2/cs unknown
- 1986-01-29 AR AR302989A patent/AR240046A1/es active
- 1986-01-29 AT AT0021086A patent/AT395149B/de not_active IP Right Cessation
- 1986-01-29 ES ES551388A patent/ES8704910A1/es not_active Expired
- 1986-01-29 SE SE8600385A patent/SE8600385L/xx not_active Application Discontinuation
- 1986-01-29 DE DE19863602648 patent/DE3602648A1/de active Granted
- 1986-01-29 NO NO860324A patent/NO167091C/no unknown
- 1986-01-29 PL PL1986257689A patent/PL146491B1/pl unknown
- 1986-01-29 CN CN86100724A patent/CN1015456B/zh not_active Expired
- 1986-01-29 JP JP61017700A patent/JPS61176576A/ja active Granted
- 1986-01-29 DK DK42986A patent/DK42986A/da not_active Application Discontinuation
- 1986-01-29 GB GB08602136A patent/GB2170805B/en not_active Expired
- 1986-01-29 DD DD86286590A patent/DD242807A5/de not_active IP Right Cessation
- 1986-01-29 PT PT81935A patent/PT81935B/pt not_active IP Right Cessation
- 1986-01-29 CA CA000500565A patent/CA1285568C/en not_active Expired - Lifetime
- 1986-01-29 FI FI860432A patent/FI860432A7/fi not_active Application Discontinuation
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE875846A (fr) * | 1978-04-26 | 1979-10-25 | Glaxo Group Ltd | Derives heterocycliques et leur preparation |
| EP0029303B1 (en) * | 1979-10-22 | 1985-01-30 | Glaxo Group Limited | 1,2,4-triazole derivatives, processes for their production and pharmaceutical compositions containing them |
Non-Patent Citations (1)
| Title |
|---|
| Europäische Patentanmeldung 29 303 |
Also Published As
| Publication number | Publication date |
|---|---|
| FI860432A0 (fi) | 1986-01-29 |
| DK42986A (da) | 1986-07-30 |
| GB8602136D0 (en) | 1986-03-05 |
| NO167091C (no) | 1991-10-02 |
| DK42986D0 (da) | 1986-01-29 |
| ES551388A0 (es) | 1987-04-16 |
| IT1190608B (it) | 1988-02-16 |
| DE3602648C2 (enExample) | 1990-09-06 |
| HUT40632A (en) | 1987-01-28 |
| DD242807A5 (de) | 1987-02-11 |
| SE8600385L (sv) | 1986-07-30 |
| NO167091B (no) | 1991-06-24 |
| ATA21086A (de) | 1992-02-15 |
| JPH0524906B2 (enExample) | 1993-04-09 |
| SE8600385D0 (sv) | 1986-01-29 |
| IT8619218A0 (it) | 1986-01-19 |
| CA1285568C (en) | 1991-07-02 |
| ES8704910A1 (es) | 1987-04-16 |
| PL257689A1 (en) | 1987-02-09 |
| CN86100724A (zh) | 1986-08-13 |
| AR240046A1 (es) | 1990-01-31 |
| FI860432A7 (fi) | 1986-07-30 |
| GB2170805A (en) | 1986-08-13 |
| PT81935B (pt) | 1987-11-30 |
| CN1015456B (zh) | 1992-02-12 |
| AT395149B (de) | 1992-09-25 |
| NO860324L (no) | 1986-07-30 |
| CS253739B2 (en) | 1987-12-17 |
| PT81935A (en) | 1986-02-01 |
| GB2170805B (en) | 1988-04-27 |
| JPS61176576A (ja) | 1986-08-08 |
| HU193253B (en) | 1987-08-28 |
| PL146491B1 (en) | 1989-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2235544C3 (de) | 33-Disubstituierte l-Methyl-1,2,4triazolderivate und Verfahren zu deren Herstellung | |
| DE2321330A1 (de) | Azolyl-amidine, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| EP0199262A2 (de) | Fluorierte Benzyltriazolverbindungen | |
| DE2835157A1 (de) | Verfahren zur herstellung von n-substituierten alpha -halogenacetaniliden | |
| DE3602648A1 (de) | Verfahren zur herstellung von n(pfeil hoch)5(pfeil hoch)-(3'-(3''-<(dimethylamino)-methyl>-phenoxy)-propyl)-1h-1,2,4-triazol-3,5-di-(aminen) sowie 3-(amino)-5-((3'-(halogen)-propyl) -amino)-1h-1,2,4-triazole | |
| DE1620702A1 (de) | Benzimidazolonderivate | |
| DE2441820A1 (de) | Verfahren zur herstellung von chlorierten imidazol-derivaten | |
| DE2937595A1 (de) | Verfahren zur herstellung von 1-azolyl-1-phenoxy-alkan-2-onen | |
| DE2907972A1 (de) | Omega -halogen-acetophenon-oximether, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte zur herstellung von omega -azolyl-acetophenon-oximethern | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| EP0043024B1 (de) | Verfahren zur Herstellung von 5-Aminoisoxazolen | |
| WO2011020579A1 (de) | Verfahren zur herstellung von 1-phenyl-1,2,4-triazolen | |
| DE2401715B2 (de) | Verfahren zur Herstellung von 1-(lÄ4-Triazol-l-yl)-l-phenoxy-33dimethyl-butan-2-on-Derivaten | |
| EP0110116B1 (de) | Verfahren zur Herstellung von Keten-O,N-acetalen | |
| AT366375B (de) | Verfahren zur herstellung von 2-alkyl-5nitroimidazolderivaten | |
| DE1445794A1 (de) | Verfahren zur Herstellung von Iminothiopyrrolidonen | |
| DE3331591A1 (de) | 3-(alkylthio)- beziehungsweise 3-(phenylalkylthio)-5-(acylamino)-1,2,4-triazolderivate, verfahren zu ihrer herstellung und diese enthaltende arzneimittel sowie 3-(alkylthio)- beziehungsweise 3-(phenylalkylthio)-1-(acyl)-5-amino-1,2,4-triazolderivate und verfahren zur herstellung der letzteren | |
| AT206902B (de) | Verfahren zur Herstellung neuer Monocarbaminsäureester von disubstituierten Butandiolen | |
| AT251600B (de) | Verfahren zur Herstellung von neuen Oxazolylurethanen | |
| DE3433143A1 (de) | Verfahren zur herstellung von 3-(amino)-5-(5'-(aminomethyl)-cyclohexa-1',4'-dien-1'-(yloxypropylamino))-1h-1,2,4-triazolderivaten sowie 5-(aminomethyl)-cyclohexa-1,4-dien-1-(yloxypropylamine) und ((5-(aminomethyl)-cyclohexa-1,4-dien-1-(yloxypropylamino))-(n-(cyan)-imino)-methyl)-(methyl)-thioaether | |
| DE1921341C3 (de) | Verfahren zur Herstellung von 2- Carbamyl-A2 -imidazolinen | |
| EP0129170B1 (de) | Triazolyl-ketonoxime und -dioxime, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenwachstumsregulatoren | |
| AT376213B (de) | Verfahren zur herstellung von neuen 1,2,4-triazolderivaten | |
| AT356101B (de) | Verfahren zur herstellung von neuen arylimino- imidazolidinderivaten und ihren salzen | |
| DE19522715A1 (de) | Verfahren zur Herstellung von 1,2,4-Triazoliumsalzen und 1,2,4-Triazolinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |