DE3601469A1 - Elektrisches verbindungsstueck (adapter) - Google Patents
Elektrisches verbindungsstueck (adapter)Info
- Publication number
- DE3601469A1 DE3601469A1 DE19863601469 DE3601469A DE3601469A1 DE 3601469 A1 DE3601469 A1 DE 3601469A1 DE 19863601469 DE19863601469 DE 19863601469 DE 3601469 A DE3601469 A DE 3601469A DE 3601469 A1 DE3601469 A1 DE 3601469A1
- Authority
- DE
- Germany
- Prior art keywords
- plug
- connector
- rotating body
- contact
- systems
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000003780 insertion Methods 0.000 claims description 10
- 230000037431 insertion Effects 0.000 claims description 10
- 230000001681 protective effect Effects 0.000 claims description 4
- 230000006978 adaptation Effects 0.000 claims description 2
- 239000011810 insulating material Substances 0.000 claims description 2
- 230000002146 bilateral effect Effects 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 238000000465 moulding Methods 0.000 description 3
- 238000013459 approach Methods 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- RKTYLMNFRDHKIL-UHFFFAOYSA-N copper;5,10,15,20-tetraphenylporphyrin-22,24-diide Chemical compound [Cu+2].C1=CC(C(=C2C=CC([N-]2)=C(C=2C=CC=CC=2)C=2C=CC(N=2)=C(C=2C=CC=CC=2)C2=CC=C3[N-]2)C=2C=CC=CC=2)=NC1=C3C1=CC=CC=C1 RKTYLMNFRDHKIL-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- LKACJLUUJRMGFK-UHFFFAOYSA-N methylsulfonal Chemical compound CCS(=O)(=O)C(C)(CC)S(=O)(=O)CC LKACJLUUJRMGFK-UHFFFAOYSA-N 0.000 description 1
- 238000011022 operating instruction Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01R—ELECTRICALLY-CONDUCTIVE CONNECTIONS; STRUCTURAL ASSOCIATIONS OF A PLURALITY OF MUTUALLY-INSULATED ELECTRICAL CONNECTING ELEMENTS; COUPLING DEVICES; CURRENT COLLECTORS
- H01R31/00—Coupling parts supported only by co-operation with counterpart
- H01R31/06—Intermediate parts for linking two coupling parts, e.g. adapter
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01R—ELECTRICALLY-CONDUCTIVE CONNECTIONS; STRUCTURAL ASSOCIATIONS OF A PLURALITY OF MUTUALLY-INSULATED ELECTRICAL CONNECTING ELEMENTS; COUPLING DEVICES; CURRENT COLLECTORS
- H01R13/00—Details of coupling devices of the kinds covered by groups H01R12/70 or H01R24/00 - H01R33/00
- H01R13/66—Structural association with built-in electrical component
- H01R13/70—Structural association with built-in electrical component with built-in switch
Landscapes
- Connector Housings Or Holding Contact Members (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601469 DE3601469A1 (de) | 1986-01-20 | 1986-01-20 | Elektrisches verbindungsstueck (adapter) |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601469 DE3601469A1 (de) | 1986-01-20 | 1986-01-20 | Elektrisches verbindungsstueck (adapter) |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3601469A1 true DE3601469A1 (de) | 1987-07-23 |
| DE3601469C2 DE3601469C2 (enExample) | 1987-12-23 |
Family
ID=6292176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863601469 Granted DE3601469A1 (de) | 1986-01-20 | 1986-01-20 | Elektrisches verbindungsstueck (adapter) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3601469A1 (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4433144A1 (de) * | 1994-09-16 | 1996-03-21 | Kopp Heinrich Ag | Steckdose mit drehbarem Steckereinschubabschnitt |
| DE29705377U1 (de) | 1997-03-25 | 1997-08-14 | Frank, Hans-Peter, 74653 Künzelsau | Stecker-Adapter |
| DE19716083C1 (de) * | 1997-04-17 | 1998-10-22 | Lott Oswald | Elektrischer Steckadapter |
| WO1999048174A1 (de) * | 1998-03-17 | 1999-09-23 | Oswald Lott | Mehrfachstecker für unterschiedliche verbindungssysteme |
| DE19845962C1 (de) * | 1998-08-04 | 1999-10-07 | Oswald Lott | Elektrischer Steckadapter |
| DE19835161C1 (de) * | 1998-03-17 | 1999-10-28 | Oswald Lott | Mehrfachstecker für unterschiedliche Verbindungssysteme |
| EP1257018A1 (de) * | 2001-05-10 | 2002-11-13 | Heinrich Kopp AG | Elektrischer Steckadapter |
| WO2009014460A1 (en) * | 2007-07-25 | 2009-01-29 | Blijlevens, Antonius, Petrus, Henricus | Electrical plug/socket adaptor |
| DE202018002416U1 (de) | 2018-05-08 | 2018-06-14 | Sagross Designoffice Gmbh | Stecker |
| DE202019000733U1 (de) | 2019-02-07 | 2019-03-21 | Sagross Design Office Gmbh | Mehrfachanschluss für unterschiedliche Verbindungssysteme |
| CN114039253A (zh) * | 2021-11-12 | 2022-02-11 | 贵州电网有限责任公司 | 一种高适应性检修电源接线适配装置 |
| GB2610223A (en) * | 2021-08-27 | 2023-03-01 | Campisi Mauro | A plug head and a cable comprising a plug head |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19538785B4 (de) * | 1995-10-18 | 2008-07-24 | Reinhard Napierski | Elektrischer Zwischenstecker |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3034000A (en) * | 1960-07-19 | 1962-05-08 | Todd Electric Company Inc | Appliance adapter |
-
1986
- 1986-01-20 DE DE19863601469 patent/DE3601469A1/de active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3034000A (en) * | 1960-07-19 | 1962-05-08 | Todd Electric Company Inc | Appliance adapter |
Non-Patent Citations (2)
| Title |
|---|
| D-Zeitschrift "Test" 1/79, S. 45 * |
| Prospekt der Firma Traveller Weltreisestecker, Eingang 6/83 * |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4433144A1 (de) * | 1994-09-16 | 1996-03-21 | Kopp Heinrich Ag | Steckdose mit drehbarem Steckereinschubabschnitt |
| DE29705377U1 (de) | 1997-03-25 | 1997-08-14 | Frank, Hans-Peter, 74653 Künzelsau | Stecker-Adapter |
| DE19716083C1 (de) * | 1997-04-17 | 1998-10-22 | Lott Oswald | Elektrischer Steckadapter |
| WO1999048174A1 (de) * | 1998-03-17 | 1999-09-23 | Oswald Lott | Mehrfachstecker für unterschiedliche verbindungssysteme |
| DE19835161C1 (de) * | 1998-03-17 | 1999-10-28 | Oswald Lott | Mehrfachstecker für unterschiedliche Verbindungssysteme |
| DE19845962C1 (de) * | 1998-08-04 | 1999-10-07 | Oswald Lott | Elektrischer Steckadapter |
| EP1257018A1 (de) * | 2001-05-10 | 2002-11-13 | Heinrich Kopp AG | Elektrischer Steckadapter |
| DE10122620A1 (de) * | 2001-05-10 | 2002-11-14 | Kopp Heinrich Ag | Elektrischer Steckadapter |
| US6749451B2 (en) | 2001-05-10 | 2004-06-15 | Heinrich Kopp Ag | Electrical plug-in adapter for optional connection to different national plug-in systems |
| WO2009014460A1 (en) * | 2007-07-25 | 2009-01-29 | Blijlevens, Antonius, Petrus, Henricus | Electrical plug/socket adaptor |
| DE202018002416U1 (de) | 2018-05-08 | 2018-06-14 | Sagross Designoffice Gmbh | Stecker |
| DE202019000733U1 (de) | 2019-02-07 | 2019-03-21 | Sagross Design Office Gmbh | Mehrfachanschluss für unterschiedliche Verbindungssysteme |
| GB2610223A (en) * | 2021-08-27 | 2023-03-01 | Campisi Mauro | A plug head and a cable comprising a plug head |
| GB2610223B (en) * | 2021-08-27 | 2025-08-27 | Campisi Mauro | A plug head and a combination comprising a plug head |
| CN114039253A (zh) * | 2021-11-12 | 2022-02-11 | 贵州电网有限责任公司 | 一种高适应性检修电源接线适配装置 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3601469C2 (enExample) | 1987-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0255512B1 (de) | Elektrisches verbindungsstück (adapter) | |
| DE3327087C1 (de) | Zwischenstück zum Sichern von Netzsteckern gegen unbefugten Gerätegebrauch | |
| DE3601469A1 (de) | Elektrisches verbindungsstueck (adapter) | |
| DE2117315C3 (de) | Steckverbindung | |
| DE2507921C2 (de) | Adapter für Stromschienen | |
| DE2751724C2 (de) | Adapter für Stromentnahmeschiene | |
| DE1603326B2 (de) | Spielbaustein | |
| EP0621483A1 (de) | Prüfstecker für Reihenklemmen | |
| DE1590617B1 (de) | Mit Kontaktstiften zur Aufnahme eines Dosensteckers versehener elektrischer Schalter | |
| DE2251731B2 (de) | Verbindungsteil fuer stromschienen | |
| DE3918517C1 (en) | Telephone line connector - has plug body that allows cable connector to be fixed in different positions | |
| DE2757967B2 (de) | Elektrischer Steckverbinder | |
| EP0930673B1 (de) | Transformationseinrichtung und Steckeranordnung | |
| EP0824769B1 (de) | Steckdose für ein elektrogerät | |
| DE2646611C2 (de) | Sicherungsklemme mit auswechselbarer Glimmlampe | |
| DE2206753B2 (de) | Mehrpolige Steckverbindung für die Verdrahtung von Lichtbändern | |
| DE2651193A1 (de) | Elektrischer sicherheitsverbinder | |
| DE827512C (de) | Elektrischer Stecker | |
| DE1110698B (de) | Mit einer Spannungsumschaltvorrichtung kombinierte Steckvorrichtung fuer ein elektrisches Geraet | |
| EP0471817B1 (de) | Elektrische anschlusseinrichtung für steckfertige schaltuhren | |
| DE558169C (de) | Schaltvorrichtung fuer Elektromotoren, insbesondere fuer solche zum beliebigen Anschluss an ein Gleich- oder Wechselstromnetz | |
| DE1196274B (de) | Schiebeschalter in Steckbauweise | |
| DE1590617C (de) | Mit Kontaktstiften zur Aufnahme eines Dosensteckers versehener elektrischer Schal | |
| DE1137784B (de) | Kontaktanordnung fuer elektrische Steckverbindungen | |
| DE68912366T2 (de) | Kontaktelement. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HEINRICH KOPP AG, 63796 KAHL, DE |