DE3215967A1 - Elektrographische aufzeichnungsmaterialien mit speziellen ladungstraeger transportierenden verbindungen - Google Patents
Elektrographische aufzeichnungsmaterialien mit speziellen ladungstraeger transportierenden verbindungenInfo
- Publication number
- DE3215967A1 DE3215967A1 DE19823215967 DE3215967A DE3215967A1 DE 3215967 A1 DE3215967 A1 DE 3215967A1 DE 19823215967 DE19823215967 DE 19823215967 DE 3215967 A DE3215967 A DE 3215967A DE 3215967 A1 DE3215967 A1 DE 3215967A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- alkyl
- recording materials
- phenyl
- electrophotographic recording
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000463 material Substances 0.000 title claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 26
- 239000002800 charge carrier Substances 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 238000007639 printing Methods 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 239000000969 carrier Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 238000007645 offset printing Methods 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Chemical group 0.000 claims description 3
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 28
- 239000011230 binding agent Substances 0.000 description 11
- 239000000975 dye Substances 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- -1 alkyl radicals Chemical class 0.000 description 5
- 239000012876 carrier material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 150000003852 triazoles Chemical class 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 229940107698 malachite green Drugs 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical group OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical group C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- JFTBTTPUYRGXDG-UHFFFAOYSA-N methyl violet Chemical compound Cl.C1=CC(=NC)C=CC1=C(C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 JFTBTTPUYRGXDG-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000007978 oxazole derivatives Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- FVDOBFPYBSDRKH-UHFFFAOYSA-N perylene-3,4,9,10-tetracarboxylic acid Chemical class C=12C3=CC=C(C(O)=O)C2=C(C(O)=O)C=CC=1C1=CC=C(C(O)=O)C2=C1C3=CC=C2C(=O)O FVDOBFPYBSDRKH-UHFFFAOYSA-N 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229940043267 rhodamine b Drugs 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000001018 xanthene dye Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0624—Heterocyclic compounds containing one hetero ring
- G03G5/0627—Heterocyclic compounds containing one hetero ring being five-membered
- G03G5/0633—Heterocyclic compounds containing one hetero ring being five-membered containing three hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823215967 DE3215967A1 (de) | 1982-04-29 | 1982-04-29 | Elektrographische aufzeichnungsmaterialien mit speziellen ladungstraeger transportierenden verbindungen |
| EP83103860A EP0093329B1 (de) | 1982-04-29 | 1983-04-20 | Elektrographische Aufzeichnungsmaterialien mit speziellen Ladungsträger transportierenden Verbindungen |
| DE8383103860T DE3361974D1 (en) | 1982-04-29 | 1983-04-20 | Electrographic recording materials with special compounds transporting charge carriers |
| JP58073098A JPS58214163A (ja) | 1982-04-29 | 1983-04-27 | 電荷担体を送る特殊な化合物を有する電子写真記録材料 |
| US06/489,012 US4456672A (en) | 1982-04-29 | 1983-04-27 | Electrophotographic recording materials containing triazole charge carrier-transporting compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823215967 DE3215967A1 (de) | 1982-04-29 | 1982-04-29 | Elektrographische aufzeichnungsmaterialien mit speziellen ladungstraeger transportierenden verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3215967A1 true DE3215967A1 (de) | 1983-11-03 |
Family
ID=6162262
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823215967 Withdrawn DE3215967A1 (de) | 1982-04-29 | 1982-04-29 | Elektrographische aufzeichnungsmaterialien mit speziellen ladungstraeger transportierenden verbindungen |
| DE8383103860T Expired DE3361974D1 (en) | 1982-04-29 | 1983-04-20 | Electrographic recording materials with special compounds transporting charge carriers |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383103860T Expired DE3361974D1 (en) | 1982-04-29 | 1983-04-20 | Electrographic recording materials with special compounds transporting charge carriers |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4456672A (enExample) |
| EP (1) | EP0093329B1 (enExample) |
| JP (1) | JPS58214163A (enExample) |
| DE (2) | DE3215967A1 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3304330A1 (de) * | 1983-02-09 | 1984-08-09 | Basf Ag, 6700 Ludwigshafen | Neue 2h-v-triazolyl(4,5-d)-pyrimidine und deren verwendung |
| DE3410700A1 (de) * | 1984-03-23 | 1985-09-26 | Basf Ag, 6700 Ludwigshafen | 2,4,5-triphenyl-v-triazole und deren verwendung |
| US4599286A (en) * | 1984-12-24 | 1986-07-08 | Xerox Corporation | Photoconductive imaging member with stabilizer in charge transfer layer |
| US4563408A (en) * | 1984-12-24 | 1986-01-07 | Xerox Corporation | Photoconductive imaging member with hydroxyaromatic antioxidant |
| DE3514182A1 (de) * | 1985-04-19 | 1986-10-23 | Basf Ag, 6700 Ludwigshafen | Elektrophotographisches aufzeichnungsmaterial |
| JP2551469B2 (ja) * | 1988-10-05 | 1996-11-06 | ミノルタ株式会社 | 感光体 |
| US5545499A (en) * | 1995-07-07 | 1996-08-13 | Lexmark International, Inc. | Electrophotographic photoconductor having improved cycling stability and oil resistance |
| CN1321112C (zh) * | 2000-03-24 | 2007-06-13 | 欧洲凯尔特股份有限公司 | 作为钠通道阻滞剂的芳基取代的吡唑、三唑和四唑化合物 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU35237A1 (enExample) * | 1956-06-27 | |||
| BE581404A (enExample) * | 1958-08-09 | |||
| NL129066C (enExample) * | 1959-01-07 | |||
| DE1522497C3 (de) * | 1966-05-13 | 1974-09-19 | Kalle Ag, 6202 Wiesbaden-Biebrich | Verfahren zum Herstellen von Druckformen |
| DE2712496A1 (de) * | 1976-03-26 | 1977-10-06 | Ciba Geigy Ag | Neue v-triazolyl-phenyl-cumarine |
| JPS5323635A (en) * | 1976-08-18 | 1978-03-04 | Fuji Photo Film Co Ltd | Conductive formation material an d its conductive picture recording method |
| JPS5782844A (en) * | 1980-11-11 | 1982-05-24 | Canon Inc | Electrophotographic receptor |
| JPS57191646A (en) * | 1981-05-21 | 1982-11-25 | Canon Inc | Electrophotographic receptor |
| JPS589150A (ja) * | 1981-07-09 | 1983-01-19 | Canon Inc | 電子写真感光体 |
| JPS589151A (ja) * | 1981-07-09 | 1983-01-19 | Canon Inc | 電子写真感光体 |
-
1982
- 1982-04-29 DE DE19823215967 patent/DE3215967A1/de not_active Withdrawn
-
1983
- 1983-04-20 DE DE8383103860T patent/DE3361974D1/de not_active Expired
- 1983-04-20 EP EP83103860A patent/EP0093329B1/de not_active Expired
- 1983-04-27 US US06/489,012 patent/US4456672A/en not_active Expired - Lifetime
- 1983-04-27 JP JP58073098A patent/JPS58214163A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0093329A1 (de) | 1983-11-09 |
| EP0093329B1 (de) | 1986-01-29 |
| DE3361974D1 (en) | 1986-03-13 |
| JPH0230500B2 (enExample) | 1990-07-06 |
| JPS58214163A (ja) | 1983-12-13 |
| US4456672A (en) | 1984-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3110960A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| EP0198488B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0116341B1 (de) | Neue 2H-v-Triazolyl(4,5-d)-pyrimidine und deren Verwendung | |
| EP0093329B1 (de) | Elektrographische Aufzeichnungsmaterialien mit speziellen Ladungsträger transportierenden Verbindungen | |
| EP0061090B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0093330B1 (de) | Elektrographische Aufzeichnungsmaterialien mit speziellen Ladungsträger transportierenden Verbindungen | |
| EP0131215B1 (de) | Elektrophotographische Aufzeichnungsmaterialien mit verbesserter Photoempfindlichkeit | |
| EP0133469B1 (de) | Elektrophotographische Aufzeichnungsmaterialien mit verbesserter Photoempfindlichkeit | |
| CH641282A5 (de) | Elektrophotographische platte vom komplex-typ und elektrophotographisches verfahren, das unter verwendung einer solchen platte durchgefuehrt wird. | |
| DE3889426T2 (de) | Tetraphenylthiophen-Derivate und sie enthaltendes elektrophotographisches Element. | |
| DE3338903C2 (enExample) | ||
| DE1797137A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE69208230T2 (de) | Azoverbindung und elektrophotographisches, lichtempfindliches Element mit einer lichtempfindlichem Schicht, die diese Azoverbindung enthält | |
| EP0318758A2 (de) | Mehrschichtiges, elektrophotographisches Aufzeichnungsmaterial | |
| EP0318759B1 (de) | Mehrschichtiges elektrophotographisches Aufzeichnungsmaterial | |
| DE2059540B2 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfänigen Schicht | |
| DE3324641A1 (de) | Neue benztriazolverbindungen und deren verwendung | |
| EP0150419B1 (de) | Neue 2H-v-Triazolyl 4,5-b -pyridine und deren Verwendung | |
| EP0218981B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2047338A1 (de) | Elektrophotographisches Aufzeichnungs material | |
| DE1597826C (de) | Photoleitfahige Schicht | |
| DE69023907T2 (de) | Laminiertes organisches lichtempfindliches Material. | |
| EP0089602B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3304240A1 (de) | Verfahren zur herstellung einer transparenten leitfaehigen schicht | |
| DE1597826B2 (de) | Photoleitfaehige schicht |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |