DE3045634C2 - Pharmazeutisches Präparat mit langsamer Wirkstofffreisetzung und Verfahren zu dessen Herstellung - Google Patents
Pharmazeutisches Präparat mit langsamer Wirkstofffreisetzung und Verfahren zu dessen HerstellungInfo
- Publication number
- DE3045634C2 DE3045634C2 DE3045634A DE3045634A DE3045634C2 DE 3045634 C2 DE3045634 C2 DE 3045634C2 DE 3045634 A DE3045634 A DE 3045634A DE 3045634 A DE3045634 A DE 3045634A DE 3045634 C2 DE3045634 C2 DE 3045634C2
- Authority
- DE
- Germany
- Prior art keywords
- carrier material
- cps
- viscosity
- hydroxypropylmethylcellulose
- aqueous solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 20
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 7
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 68
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 68
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 65
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 claims description 65
- 239000012876 carrier material Substances 0.000 claims description 52
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 40
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 40
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 39
- 239000007864 aqueous solution Substances 0.000 claims description 27
- 239000004480 active ingredient Substances 0.000 claims description 23
- 239000008194 pharmaceutical composition Substances 0.000 claims description 23
- 239000003826 tablet Substances 0.000 claims description 21
- 239000003814 drug Substances 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 11
- 229940124597 therapeutic agent Drugs 0.000 claims description 10
- 239000007937 lozenge Substances 0.000 claims description 9
- 238000013268 sustained release Methods 0.000 claims description 7
- 239000012730 sustained-release form Substances 0.000 claims description 7
- 238000009472 formulation Methods 0.000 claims description 6
- 239000000829 suppository Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000004615 ingredient Substances 0.000 claims description 4
- 239000000314 lubricant Substances 0.000 claims description 3
- 230000001225 therapeutic effect Effects 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims 2
- 229920003063 hydroxymethyl cellulose Polymers 0.000 claims 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 claims 1
- 239000000463 material Substances 0.000 description 19
- 239000000843 powder Substances 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 229910052814 silicon oxide Inorganic materials 0.000 description 13
- 235000021355 Stearic acid Nutrition 0.000 description 11
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 11
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 11
- 239000008117 stearic acid Substances 0.000 description 11
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 229960004889 salicylic acid Drugs 0.000 description 5
- 239000013543 active substance Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 230000003111 delayed effect Effects 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 229920003091 Methocel™ Polymers 0.000 description 2
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 2
- 239000000006 Nitroglycerin Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 238000013270 controlled release Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 150000002168 ethanoic acid esters Chemical class 0.000 description 2
- 229960003711 glyceryl trinitrate Drugs 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 235000010603 pastilles Nutrition 0.000 description 2
- 235000020183 skimmed milk Nutrition 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 208000032974 Gagging Diseases 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- MKXZASYAUGDDCJ-SZMVWBNQSA-N LSM-2525 Chemical compound C1CCC[C@H]2[C@@]3([H])N(C)CC[C@]21C1=CC(OC)=CC=C1C3 MKXZASYAUGDDCJ-SZMVWBNQSA-N 0.000 description 1
- 229920003102 Methocel™ E4M Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 206010038776 Retching Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229960003556 aminophylline Drugs 0.000 description 1
- FQPFAHBPWDRTLU-UHFFFAOYSA-N aminophylline Chemical compound NCCN.O=C1N(C)C(=O)N(C)C2=C1NC=N2.O=C1N(C)C(=O)N(C)C2=C1NC=N2 FQPFAHBPWDRTLU-UHFFFAOYSA-N 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 239000006189 buccal tablet Substances 0.000 description 1
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 229960001985 dextromethorphan Drugs 0.000 description 1
- ADYPXRFPBQGGAH-UMYZUSPBSA-N dihydroergotamine mesylate Chemical compound CS(O)(=O)=O.C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C)C1=CC=CC=C1 ADYPXRFPBQGGAH-UMYZUSPBSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000002200 mouth mucosa Anatomy 0.000 description 1
- 229960000564 nitrofurantoin Drugs 0.000 description 1
- NXFQHRVNIOXGAQ-YCRREMRBSA-N nitrofurantoin Chemical compound O1C([N+](=O)[O-])=CC=C1\C=N\N1C(=O)NC(=O)C1 NXFQHRVNIOXGAQ-YCRREMRBSA-N 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- IWVCMVBTMGNXQD-PXOLEDIWSA-N oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 1
- 229960003924 oxytetracycline dihydrate Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- -1 polyethylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- XHKUDCCTVQUHJQ-LCYSNFERSA-N quinidine D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 XHKUDCCTVQUHJQ-LCYSNFERSA-N 0.000 description 1
- 229960002454 quinidine gluconate Drugs 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 235000019615 sensations Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/205—Polysaccharides, e.g. alginate, gums; Cyclodextrin
- A61K9/2054—Cellulose; Cellulose derivatives, e.g. hydroxypropyl methylcellulose
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/02—Suppositories; Bougies; Bases therefor; Ovules
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/102,227 US4259314A (en) | 1979-12-10 | 1979-12-10 | Method and composition for the preparation of controlled long-acting pharmaceuticals |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3045634A1 DE3045634A1 (de) | 1981-06-11 |
| DE3045634C2 true DE3045634C2 (de) | 1987-03-19 |
Family
ID=22288794
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3045634A Expired DE3045634C2 (de) | 1979-12-10 | 1980-12-03 | Pharmazeutisches Präparat mit langsamer Wirkstofffreisetzung und Verfahren zu dessen Herstellung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4259314A (enExample) |
| JP (2) | JPS5692816A (enExample) |
| AR (1) | AR225478A1 (enExample) |
| CH (1) | CH644759A5 (enExample) |
| DE (1) | DE3045634C2 (enExample) |
| FR (1) | FR2471786A1 (enExample) |
| GB (1) | GB2065145B (enExample) |
| IT (2) | IT1134636B (enExample) |
| SE (1) | SE446060B (enExample) |
Families Citing this family (140)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE49324B1 (en) * | 1979-12-19 | 1985-09-18 | Euro Celtique Sa | Controlled release compositions |
| US4547358A (en) * | 1980-05-06 | 1985-10-15 | Mead Johnson & Company | Sustained release tablet containing at least 95 percent theophylline |
| US4465660A (en) * | 1981-04-01 | 1984-08-14 | Mead Johnson & Company | Sustained release tablet containing at least 95 percent theophylline |
| DE3125178A1 (de) * | 1981-06-26 | 1983-01-13 | Gödecke AG, 1000 Berlin | Verfahren zur zeitlichen steuerung der freisetzung von wirkstoffen aus wirkstoffzubereitungen, insbesondere arzneimittelzubereitungen |
| US4369172A (en) * | 1981-12-18 | 1983-01-18 | Forest Laboratories Inc. | Prolonged release therapeutic compositions based on hydroxypropylmethylcellulose |
| US4389393A (en) * | 1982-03-26 | 1983-06-21 | Forest Laboratories, Inc. | Sustained release therapeutic compositions based on high molecular weight hydroxypropylmethylcellulose |
| US4508702A (en) * | 1982-06-14 | 1985-04-02 | Key Pharmaceuticals, Inc. | Sustained release aspirin |
| US4634587A (en) * | 1982-07-09 | 1987-01-06 | Key Pharmaceuticals, Inc. | Sustained release quinidine dosage form |
| FR2535202B1 (fr) * | 1982-11-03 | 1985-08-09 | Fabre Sa Pierre | Comprimes de theophylline a liberation controlee et leur procede de fabrication |
| DE3435325A1 (de) * | 1983-04-09 | 1986-04-17 | Nikken Chemicals Co., Ltd., Tokio/Tokyo | Langzeitwirkende theophyllin-tablette und verfahren zu deren herstellung |
| US4571333A (en) * | 1983-06-14 | 1986-02-18 | Syntex (U.S.A.) Inc. | Controlled release naproxen and naproxen sodium tablets |
| US4505890A (en) * | 1983-06-30 | 1985-03-19 | E. R. Squibb & Sons, Inc. | Controlled release formulation and method |
| JPS6038322A (ja) * | 1983-08-11 | 1985-02-27 | Fujisawa Pharmaceut Co Ltd | ジヒドロピリジンa物質含有易溶性固形製剤 |
| ZA836031B (en) * | 1983-08-16 | 1985-02-27 | Verex Lab | Constant release rate solid dosage theophylline formulation |
| US4693887A (en) * | 1983-09-15 | 1987-09-15 | The Kendall Company | Microphase separated hydrogels for controlled release of bioactive materials |
| US4555399A (en) * | 1983-11-18 | 1985-11-26 | Key Pharmaceuticals, Inc. | Aspirin tablet |
| US4680323A (en) * | 1983-12-01 | 1987-07-14 | Hans Lowey | Method and composition for the preparation of controlled long-acting pharmaceuticals for oral administration |
| GB2154874B (en) * | 1984-02-29 | 1987-11-04 | Sandoz Ltd | Bromoscriptine compositions |
| US4795327A (en) * | 1984-03-26 | 1989-01-03 | Forest Laboratories, Inc. | Controlled release solid drug dosage forms based on mixtures of water soluble nonionic cellulose ethers and anionic surfactants |
| US4849229A (en) * | 1984-03-26 | 1989-07-18 | Forest Laboratories, Inc. | Controlled release solid drug dosage forms based on mixtures of water soluble nonionic cellulose ethers and anionic surfactants |
| US4540566A (en) * | 1984-04-02 | 1985-09-10 | Forest Laboratories, Inc. | Prolonged release drug dosage forms based on modified low viscosity grade hydroxypropylmethylcellulose |
| JPS6143108A (ja) * | 1984-08-03 | 1986-03-01 | Nippon Shinyaku Co Ltd | 医薬品製剤及びその製造法 |
| US4610870A (en) * | 1984-10-05 | 1986-09-09 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| US4678516A (en) * | 1984-10-09 | 1987-07-07 | The Dow Chemical Company | Sustained release dosage form based on highly plasticized cellulose ether gels |
| US4695464A (en) * | 1984-10-09 | 1987-09-22 | The Dow Chemical Company | Sustained release dosage form based on highly plasticized cellulose ether gels |
| US5069911A (en) * | 1985-02-05 | 1991-12-03 | Sandoz Ltd. | Pharmaceutical 9,10-dihydrogenated ergot alkaloid containing compositions |
| JPS61218516A (ja) * | 1985-03-25 | 1986-09-29 | Ichimaru Fuarukosu Kk | 徐放性マイクロカプセルの製造法 |
| US4695591A (en) * | 1985-03-29 | 1987-09-22 | Schering Corporation | Controlled release dosage forms comprising hydroxypropylmethylcellulose |
| US4657757A (en) * | 1985-03-29 | 1987-04-14 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4601894A (en) * | 1985-03-29 | 1986-07-22 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4666705A (en) * | 1985-06-03 | 1987-05-19 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| GB8514665D0 (en) * | 1985-06-11 | 1985-07-10 | Eroceltique Sa | Oral pharmaceutical composition |
| US4734285A (en) * | 1985-10-28 | 1988-03-29 | The Dow Chemical Company | Sustained release compositions |
| US4704285A (en) * | 1985-11-18 | 1987-11-03 | The Dow Chemical Company | Sustained release compositions comprising hydroxypropyl cellulose ethers |
| US4837032A (en) * | 1986-02-04 | 1989-06-06 | Farval Ag | Theophylline sustained release tablet |
| GB8608080D0 (en) * | 1986-04-02 | 1986-05-08 | Fujisawa Pharmaceutical Co | Solid dispersion composition |
| US4775535A (en) * | 1986-04-04 | 1988-10-04 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4855143A (en) * | 1986-04-04 | 1989-08-08 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4756911A (en) * | 1986-04-16 | 1988-07-12 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| US4851232A (en) * | 1987-02-13 | 1989-07-25 | Alza Corporation | Drug delivery system with means for obtaining desirable in vivo release rate pattern |
| FR2610827B1 (fr) * | 1987-02-18 | 1991-09-13 | Pf Medicament | Comprime de dihydroergotamine (d.h.e.) du type a matrice hydrophile et son procede de fabrication |
| SI8710406B (sl) * | 1987-03-11 | 1998-08-31 | Lek | Tablete s podaljšanim delovanjem na osnovi hidroksipropilmetilceluloze z veliko molsko maso in postopek za njihovo pripravo |
| US4786503A (en) * | 1987-04-06 | 1988-11-22 | Alza Corporation | Dosage form comprising parallel lamine |
| US4994276A (en) * | 1988-09-19 | 1991-02-19 | Edward Mendell Co., Inc. | Directly compressible sustained release excipient |
| FR2621483B1 (fr) * | 1987-10-08 | 1991-09-20 | Medibrevex | Nouvelles formes galeniques de corticoides pour administration par voie per- et sublinguale et leur procede de preparation |
| SE8703881D0 (sv) * | 1987-10-08 | 1987-10-08 | Haessle Ab | New pharmaceutical preparation |
| US4983398A (en) * | 1987-12-21 | 1991-01-08 | Forest Laboratories, Inc. | Sustained release drug dosage forms containing hydroxypropylmethylcellulose and alkali metal carboxylates |
| US5128143A (en) * | 1988-09-19 | 1992-07-07 | Edward Mendell Co., Inc. | Sustained release excipient and tablet formulation |
| US5169639A (en) * | 1988-09-19 | 1992-12-08 | Edward Mendell Co., Inc. | Controlled release verapamil tablets |
| US5135757A (en) * | 1988-09-19 | 1992-08-04 | Edward Mendell Co., Inc. | Compressible sustained release solid dosage forms |
| US5268181A (en) * | 1989-04-13 | 1993-12-07 | Upsher-Smith Laboratories, Inc. | Method of using niacin to control nocturnal cholesterol synthesis |
| US5126145A (en) * | 1989-04-13 | 1992-06-30 | Upsher Smith Laboratories Inc | Controlled release tablet containing water soluble medicament |
| US5133974A (en) * | 1989-05-05 | 1992-07-28 | Kv Pharmaceutical Company | Extended release pharmaceutical formulations |
| US5009895A (en) * | 1990-02-02 | 1991-04-23 | Merck & Co., Inc. | Sustained release with high and low viscosity HPMC |
| EP0465992B1 (en) * | 1990-07-02 | 1998-06-17 | Aqualon Company | High solids low viscosity polysaccharide composition |
| US5476668A (en) * | 1990-08-24 | 1995-12-19 | Shin-Etsu Chemical Co., Ltd. | Base for film-coating pharmaceuticals and method for preparing same |
| US5204116A (en) * | 1991-05-01 | 1993-04-20 | Alza Corporation | Dosage form providing immediate therapy followed by prolonged therapy |
| GB2261372A (en) * | 1991-11-15 | 1993-05-19 | Gregor Reid | Lactobacillus and skim milk compositions for prevention of urogenital infection |
| US5266331A (en) * | 1991-11-27 | 1993-11-30 | Euroceltique, S.A. | Controlled release oxycodone compositions |
| US5472711A (en) * | 1992-07-30 | 1995-12-05 | Edward Mendell Co., Inc. | Agglomerated hydrophilic complexes with multi-phasic release characteristics |
| DE4226753A1 (de) * | 1992-08-13 | 1994-02-17 | Basf Ag | Wirkstoffe enthaltende Zubereitungen in Form fester Teilchen |
| US20080075781A1 (en) * | 1992-11-25 | 2008-03-27 | Purdue Pharma Lp | Controlled release oxycodone compositions |
| NZ260408A (en) | 1993-05-10 | 1996-05-28 | Euro Celtique Sa | Controlled release preparation comprising tramadol |
| US6440457B1 (en) * | 1993-05-27 | 2002-08-27 | Alza Corporation | Method of administering antidepressant dosage form |
| US20070275062A1 (en) * | 1993-06-18 | 2007-11-29 | Benjamin Oshlack | Controlled release oxycodone compositions |
| DE4329794C2 (de) * | 1993-09-03 | 1997-09-18 | Gruenenthal Gmbh | Tramadolsalz enthaltende Arzneimittel mit verzögerter Wirkstofffreisetzung |
| US20060263428A1 (en) * | 1993-09-20 | 2006-11-23 | Eugenio Cefali | Methods for treating hyperlipidemia with intermediate release nicotinic acid compositions having unique biopharmaceutical characteristics |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US6676967B1 (en) * | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6080428A (en) * | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US5484607A (en) * | 1993-10-13 | 1996-01-16 | Horacek; H. Joseph | Extended release clonidine formulation |
| US5891471A (en) * | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| KR100354702B1 (ko) * | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| US5393765A (en) * | 1993-12-13 | 1995-02-28 | Hoffmann-La Roche Inc. | Pharmaceutical compositions with constant erosion volume for zero order controlled release |
| US5843480A (en) * | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| US6239172B1 (en) * | 1997-04-10 | 2001-05-29 | Nitrosystems, Inc. | Formulations for treating disease and methods of using same |
| US5968983A (en) * | 1994-10-05 | 1999-10-19 | Nitrosystems, Inc | Method and formulation for treating vascular disease |
| US6425881B1 (en) * | 1994-10-05 | 2002-07-30 | Nitrosystems, Inc. | Therapeutic mixture useful in inhibiting lesion formation after vascular injury |
| US20110196039A9 (en) * | 1994-10-05 | 2011-08-11 | Kaesemeyer Wayne H | Controlled release arginine formulations |
| GB9422154D0 (en) * | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| SI9500173B (sl) * | 1995-05-19 | 2002-02-28 | Lek, | Trofazna farmacevtska oblika s konstantnim in kontroliranim sproščanjem amorfne učinkovine za enkrat dnevno aplikacijo |
| US5840756A (en) * | 1995-07-21 | 1998-11-24 | Teva Pharmaceutical Industries Ltd. | Pharmaceutical composition of L-DOPA ester |
| US5948437A (en) * | 1996-05-23 | 1999-09-07 | Zeneca Limited | Pharmaceutical compositions using thiazepine |
| CA2275604A1 (en) * | 1997-01-03 | 1998-07-09 | Kenneth Iain Cumming | Sustained release cisapride mini-tablet formulation |
| US7179486B1 (en) | 1997-04-01 | 2007-02-20 | Nostrum Pharmaceuticals, Inc. | Process for preparing sustained release tablets |
| CA2216215A1 (en) | 1997-04-05 | 1998-10-05 | Isa Odidi | Controlled release formulations using intelligent polymers having opposing wettability characteristics of hydrophobicity and hydrophilicity |
| US6210710B1 (en) | 1997-04-28 | 2001-04-03 | Hercules Incorporated | Sustained release polymer blend for pharmaceutical applications |
| US5895663A (en) * | 1997-07-31 | 1999-04-20 | L. Perrigo Company | Pseudoephedrine hydrochloride extended-release tablets |
| IN186245B (enExample) | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| US6337091B1 (en) | 1997-10-27 | 2002-01-08 | Temple University - Of The Commonwealth System Of Higher Education | Matrix for controlled delivery of highly soluble pharmaceutical agents |
| US5948440A (en) * | 1997-12-17 | 1999-09-07 | Ranbaxy Laboratories Limited | Modified release matrix formulation of cefaclor and cephalexin |
| US6264974B1 (en) | 1998-07-07 | 2001-07-24 | Salvagnini Italia Spa | Buccal and sublingual administration of physostigmine |
| US6214381B1 (en) | 1998-09-08 | 2001-04-10 | Effcon, Inc. | Methazolamide composition and method of use |
| US20020169145A1 (en) * | 1998-10-14 | 2002-11-14 | Rajen Shah | Sustained release pharmaceutical composition and method of releasing pharmaceutically active agent |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| US20050037073A1 (en) * | 2000-01-13 | 2005-02-17 | Alpharx Inc. | Solid self-emulsifying dosage form for improved delivery of poorly soluble hydrophobic compounds and the process for preparation thereof |
| US6242003B1 (en) | 2000-04-13 | 2001-06-05 | Novartis Ag | Organic compounds |
| US7985420B2 (en) * | 2000-04-28 | 2011-07-26 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US6372252B1 (en) | 2000-04-28 | 2002-04-16 | Adams Laboratories, Inc. | Guaifenesin sustained release formulation and tablets |
| US8012504B2 (en) * | 2000-04-28 | 2011-09-06 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US7838032B2 (en) * | 2000-04-28 | 2010-11-23 | Reckitt Benckiser Inc. | Sustained release of guaifenesin |
| US6955821B2 (en) * | 2000-04-28 | 2005-10-18 | Adams Laboratories, Inc. | Sustained release formulations of guaifenesin and additional drug ingredients |
| US6740333B2 (en) * | 2000-07-07 | 2004-05-25 | Anestic Aps | Suppository and composition comprising at least one polyethylene glycol |
| US20060127474A1 (en) * | 2001-04-11 | 2006-06-15 | Oskar Kalb | Pharmaceutical compositions comprising fluvastatin |
| UA81224C2 (uk) * | 2001-05-02 | 2007-12-25 | Euro Celtic S A | Дозована форма оксикодону та її застосування |
| US6821532B2 (en) | 2001-11-16 | 2004-11-23 | Unitel Technologies, Inc. | Methods and compositions for the treatment of benign prostatic hypertrophy |
| US20030167556A1 (en) * | 2002-03-05 | 2003-09-11 | Consumers Choice Systems, Inc. | Methods and devices for transdermal delivery of anti-aging compounds for treatment and prevention of facial or neck skin aging |
| US20060134193A1 (en) * | 2002-09-24 | 2006-06-22 | Pieter De Haan | Method to improve pharmaceutical tablets having a matrix of cellulose ether |
| EP1556014A1 (en) * | 2002-10-22 | 2005-07-27 | Ranbaxy Laboratories, Ltd. | Sustained release compositions containing alfuzosin |
| US20040086566A1 (en) * | 2002-11-04 | 2004-05-06 | Alpharma, Inc. | Waxy matrix dosage forms |
| WO2005046655A1 (en) * | 2003-11-04 | 2005-05-26 | Shire Laboratories, Inc. | Sustained release of positively charged pharmacologically active molecules from a matrix containing polymers with polarized oxygen atoms |
| DE602004030931D1 (enExample) * | 2003-11-04 | 2011-02-17 | Supernus Pharmaceuticals Inc | |
| US8709476B2 (en) | 2003-11-04 | 2014-04-29 | Supernus Pharmaceuticals, Inc. | Compositions of quaternary ammonium compounds containing bioavailability enhancers |
| US20050143350A1 (en) * | 2003-11-19 | 2005-06-30 | Seed John C. | Combination drug therapy to treat obesity |
| US20060210614A1 (en) * | 2003-12-26 | 2006-09-21 | Nastech Pharmaceutical Company Inc. | Method of treatment of a metabolic disease using intranasal administration of exendin peptide |
| US20050143303A1 (en) * | 2003-12-26 | 2005-06-30 | Nastech Pharmaceutical Company Inc. | Intranasal administration of glucose-regulating peptides |
| US20080318837A1 (en) * | 2003-12-26 | 2008-12-25 | Nastech Pharmaceutical Company Inc. | Pharmaceutical Formation For Increased Epithelial Permeability of Glucose-Regulating Peptide |
| CA2518650A1 (en) * | 2004-09-10 | 2006-03-10 | Dimitrios Dimitrakoudis | Clostridium botulinum toxin formulation and method for reducing weight |
| JP2009520693A (ja) * | 2005-12-08 | 2009-05-28 | エムディーアールエヌエー,インコーポレイテッド | 安定化されたエキセンディン製剤の粘膜送達 |
| US20070185035A1 (en) * | 2005-12-23 | 2007-08-09 | Nastech Pharmaceutical Company Inc. | Enhanced mucosal administration of neuroprotective peptides |
| CN101420937B (zh) | 2006-04-12 | 2011-06-22 | 日本曹达株式会社 | 缓释性片剂的制造方法 |
| US7538652B2 (en) * | 2006-08-29 | 2009-05-26 | International Business Machines Corporation | Electrical component tuned by conductive layer deletion |
| US7731604B2 (en) * | 2006-10-31 | 2010-06-08 | Taylor Made Golf Company, Inc. | Golf club iron head |
| US20100172991A1 (en) * | 2007-06-08 | 2010-07-08 | Henry Joseph Horacek | Extended Release Formulation and Methods of Treating Adrenergic Dysregulation |
| AU2008261957A1 (en) * | 2007-06-08 | 2008-12-18 | Addrenex Pharmaceuticals, Inc. | Extended release formulation and method of treating adrenergic dysregulation |
| US20110038931A1 (en) * | 2008-02-22 | 2011-02-17 | Hanall Biopharma Co., Ltd. | Composite preparation |
| GB2462022B (en) | 2008-06-16 | 2011-05-25 | Biovascular Inc | Controlled release compositions of agents that reduce circulating levels of platelets and methods thereof |
| RU2013135224A (ru) | 2011-01-20 | 2015-03-10 | Бионевиа Фармасьютикалс Инк. | Композиции с модифицированным высвобождением эпалрестата или его производных и способы их использования |
| TW201507726A (zh) * | 2013-05-10 | 2015-03-01 | Glaxosmithkline Llc | 菸鹼菱形錠配製物 |
| WO2014186410A1 (en) | 2013-05-13 | 2014-11-20 | NeuOra Microceuticals, LLC | Long lasting breath mint |
| US10105320B2 (en) | 2013-10-03 | 2018-10-23 | Altria Client Services | Soluble fiber lozenge |
| GB201506755D0 (en) | 2015-04-21 | 2015-06-03 | Reckitt Benckiser Llc | Novel pharmaceutical formulation |
| CA2936746C (en) | 2014-10-31 | 2017-06-27 | Purdue Pharma | Methods and compositions particularly for treatment of attention deficit disorder |
| WO2017062997A1 (en) | 2015-10-09 | 2017-04-13 | Reckitt Benckiser Llc | Pharmaceutical formulation |
| US9980946B1 (en) | 2017-01-25 | 2018-05-29 | Effcon Laboratories, Inc. | Extended release methazolamide formulation |
| JP7426685B2 (ja) * | 2018-06-14 | 2024-02-02 | 株式会社東洋新薬 | 錠剤 |
| US10722473B2 (en) | 2018-11-19 | 2020-07-28 | Purdue Pharma L.P. | Methods and compositions particularly for treatment of attention deficit disorder |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1228029C2 (de) * | 1964-05-09 | 1973-05-17 | Merck Ag E | Verfahren zur Herstellung von Tabletten durch Pressen von Pulvergemischen ohne vorhergehende Granulation |
| GB1171691A (en) | 1967-02-24 | 1969-11-26 | Forest Laboratories | Lond-Acting Oral Carrier |
| US3870790A (en) * | 1970-01-22 | 1975-03-11 | Forest Laboratories | Solid pharmaceutical formulations containing hydroxypropyl methyl cellulose |
| JPS4917565B1 (enExample) * | 1970-12-29 | 1974-05-01 | ||
| US3845201A (en) * | 1972-04-24 | 1974-10-29 | S Loucas | Solid state ophthalmic medication delivery method |
| CA1018456A (en) * | 1972-06-26 | 1977-10-04 | Hans Lowey | Prolonged release lozenges |
| SE375007B (enExample) * | 1972-11-30 | 1975-04-07 | Pharmacia Ab | |
| US3875300A (en) * | 1972-12-18 | 1975-04-01 | Ortho Pharma Corp | Composition for sustained release of a medicament and method of using same |
| US3776001A (en) * | 1973-01-16 | 1973-12-04 | Kimberly Clark Co | Self-lubricating compound for use in hygienic and medical applications, and suppositories made therefrom |
| US4179497A (en) * | 1973-12-17 | 1979-12-18 | Merck & Co., Inc. | Solid state ophthalmic medication |
| YU43437B (en) | 1976-05-05 | 1989-08-31 | Lowey Hans | Process for obtaining tablets containing an active component with long lasting effect |
| JPS587605B2 (ja) * | 1977-09-08 | 1983-02-10 | 帝人株式会社 | 徐放性製剤およびその製造法 |
-
1979
- 1979-12-10 US US06/102,227 patent/US4259314A/en not_active Expired - Lifetime
-
1980
- 1980-12-03 DE DE3045634A patent/DE3045634C2/de not_active Expired
- 1980-12-09 GB GB8039445A patent/GB2065145B/en not_active Expired
- 1980-12-09 SE SE8008646A patent/SE446060B/sv not_active IP Right Cessation
- 1980-12-09 IT IT26513/80A patent/IT1134636B/it active Protection Beyond IP Right Term
- 1980-12-09 IT IT8026522A patent/IT8026522A0/it unknown
- 1980-12-10 CH CH911680A patent/CH644759A5/de not_active IP Right Cessation
- 1980-12-10 AR AR283562A patent/AR225478A1/es active
- 1980-12-10 JP JP17334980A patent/JPS5692816A/ja active Granted
- 1980-12-10 FR FR8026243A patent/FR2471786A1/fr active Granted
-
1986
- 1986-05-14 JP JP61108725A patent/JPS62123133A/ja active Granted
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2471786A1 (fr) | 1981-06-26 |
| CH644759A5 (de) | 1984-08-31 |
| JPS62123133A (ja) | 1987-06-04 |
| US4259314A (en) | 1981-03-31 |
| JPS5692816A (en) | 1981-07-27 |
| IT1134636B (it) | 1986-08-13 |
| DE3045634A1 (de) | 1981-06-11 |
| SE446060B (sv) | 1986-08-11 |
| GB2065145B (en) | 1983-07-20 |
| IT8026522A0 (it) | 1980-12-09 |
| JPH0567612B2 (enExample) | 1993-09-27 |
| FR2471786B1 (enExample) | 1985-03-01 |
| AR225478A1 (es) | 1982-03-31 |
| GB2065145A (en) | 1981-06-24 |
| IT8026513A0 (it) | 1980-12-09 |
| JPH044301B2 (enExample) | 1992-01-27 |
| SE8008646L (sv) | 1981-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3045634C2 (de) | Pharmazeutisches Präparat mit langsamer Wirkstofffreisetzung und Verfahren zu dessen Herstellung | |
| AT394948B (de) | Pharmazeutischer traegerstoff zur dauerabgabe von arzneimitteln mit einem gehalt an celluloseaethern und carboxyvinylpolymer | |
| DE69518820T2 (de) | Rotogranulat und Beschichtung von Acetaminophen, Pseudoephedrin, Chlorpheniramin und, gegebenenfalls, Dextromethorphan | |
| DE69724424T2 (de) | Mundfreisetzungssystem | |
| DE69532110T2 (de) | Intraoral löslicher formpressling und verfahren zu seiner herstellung | |
| DE69811236T2 (de) | Ein brause-säure-basepaar enthaltende arzneimittel | |
| DE3780222T2 (de) | Pharmazeutische zusammensetzung mit kontrollierter wirkstofffreisetzung. | |
| DE602004001209T3 (de) | Schnell wirkende pharmazeutische zusammensetzung | |
| DE69232837T3 (de) | Oxycodonhaltiges Arzneimittel mit verzögerter Wirkstoffabgabe | |
| DE69618934T2 (de) | Verbesserte organische zusammensetzungen | |
| DE69426382T2 (de) | Bioadhesive pharmazeutische Zusammensetzung zur kontrollierten Freigabe von Wirkstoffen | |
| DE2542158A1 (de) | Pharmazeutisches mittel fuer die verabreichung in der mundhoehle und verfahren zu seiner herstellung | |
| DE1667888C3 (de) | Langwirkende geformte pharmazeutische Zubereitungen | |
| DE2224534B2 (de) | Pharmazeutisches praeparat mit langsamer wirkstoffabgabe | |
| EP0283434A2 (de) | Pharmazeutisches Pflaster | |
| DE2908847A1 (de) | Pharmazeutische zubereitung mit verzoegerter freigabe | |
| EP0582186A1 (de) | Verfahren zur Herstellung von festen Arzneiformkörpern mit protrahierter 2-Stufen-Freisetzung | |
| AT5350U1 (de) | Medikament zur oralen verabreichung | |
| DE69814850T2 (de) | Paracetamol enthaltende schlickbare tablette | |
| EP0715846A1 (de) | Pharmazeutische, oral anwendbare Zubereitung mit Aminosäure | |
| DE69111574T2 (de) | Polycarbophil-Kalzium enthaltendes Arzneimittel. | |
| EP0625355B1 (de) | Tablette mit verbesserter Bioverfügbarkeit enthaltend Dichlormethylendiphosphonsäure als Wirkstoff | |
| EP0471967A1 (de) | Sucralfat-Kautablette | |
| EP0399479B1 (de) | Kaugummi zur Mund- und Rachendesinfektion, sowie Verfahren zu seiner Herstellung | |
| DE69232143T2 (de) | Verwendung von Amlexanox zur Herstellung eines Arzneimittels zur Behandlung von aphtösen Ulcera |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| V448 | Application of spc |
Free format text: PRODUCT NAME: THEOPHYLLIN; REGISTRATION NO/DATE: 8783.00.00, 19881031 Spc suppl protection certif: 193 75 036 Filing date: 19930611 |
|
| V472 | Application for supplementary protection certificate rejected |
Free format text: PRODUCT NAME: THEOPHYLLIN; REGISTRATION NO/DATE: 8783.00.00, 19881031 Spc suppl protection certif: 193 75 036 Filing date: 19930611 |