DE3043915C2 - - Google Patents
Info
- Publication number
- DE3043915C2 DE3043915C2 DE3043915A DE3043915A DE3043915C2 DE 3043915 C2 DE3043915 C2 DE 3043915C2 DE 3043915 A DE3043915 A DE 3043915A DE 3043915 A DE3043915 A DE 3043915A DE 3043915 C2 DE3043915 C2 DE 3043915C2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- formula
- hydrogen
- compounds
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 150000002431 hydrogen Chemical group 0.000 claims description 15
- 238000004043 dyeing Methods 0.000 claims description 14
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000004450 alkenylene group Chemical group 0.000 claims description 4
- -1 amino monoazo compound Chemical class 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 239000003086 colorant Substances 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 3
- 239000004627 regenerated cellulose Substances 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- 125000003031 C5-C7 cycloalkylene group Chemical group 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 239000010985 leather Substances 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 239000004753 textile Substances 0.000 claims description 2
- 239000000975 dye Substances 0.000 description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 14
- 235000002639 sodium chloride Nutrition 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 6
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 5
- 125000004956 cyclohexylene group Chemical group 0.000 description 5
- 239000000985 reactive dye Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 3
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical class C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 125000002993 cycloalkylene group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- HKTWHHAJDJCUPC-UHFFFAOYSA-N 7-aminonaphthalene-1,3,5-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 HKTWHHAJDJCUPC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- ZNXSFVXZQBETRJ-UHFFFAOYSA-N (3-aminophenyl)urea Chemical compound NC(=O)NC1=CC=CC(N)=C1 ZNXSFVXZQBETRJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- HIMMCCJEMMCUJS-UHFFFAOYSA-N 4-fluorotriazine Chemical class FC1=CC=NN=N1 HIMMCCJEMMCUJS-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- FDWBUGCBGXWJLC-UHFFFAOYSA-N naphthalen-1-yl(phenyl)diazene Chemical class C1=CC=CC=C1N=NC1=CC=CC2=CC=CC=C12 FDWBUGCBGXWJLC-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/08—Azo dyes
- C09B62/09—Disazo or polyazo dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/043—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring containing two or more triazine rings linked together by a non-chromophoric link
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1083379A CH651583A5 (en) | 1979-12-06 | 1979-12-06 | Halotriazinyldisazo compounds, preparation thereof, and process for dyeing leather |
| CH270080A CH647256A5 (en) | 1980-04-08 | 1980-04-08 | Halotriazinedisazo compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3043915A1 DE3043915A1 (de) | 1981-06-11 |
| DE3043915C2 true DE3043915C2 (enExample) | 1989-07-20 |
Family
ID=25691182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803043915 Granted DE3043915A1 (de) | 1979-12-06 | 1980-11-21 | Halo-triazinyl verbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4502866A (enExample) |
| BR (1) | BR8007928A (enExample) |
| DE (1) | DE3043915A1 (enExample) |
| ES (1) | ES497525A0 (enExample) |
| FR (1) | FR2471401A1 (enExample) |
| GB (1) | GB2064571B (enExample) |
| IT (1) | IT1188969B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5395925A (en) * | 1980-10-07 | 1995-03-07 | Sandoz Ltd. | Asymmetric sulfo group-containing disazo compounds containing two 6-halo-1,3,5-triazinyl groups |
| CH669305GA3 (enExample) * | 1981-12-11 | 1989-03-15 | ||
| US4575142A (en) * | 1984-09-13 | 1986-03-11 | Witco Chemical Corporation | Safety grip handle for a hose |
| DE3575571D1 (de) * | 1985-01-08 | 1990-03-01 | Ici Plc | Wasserloeslicher farbstoff. |
| EP0458743A3 (en) * | 1990-05-21 | 1992-10-21 | Ciba-Geigy Ag | Reactive dyestuffs, methods of their preparation and use |
| ES2150620T3 (es) * | 1990-09-25 | 2000-12-01 | Ciba Sc Holding Ag | Colorantes reactivos con las fibras y utilizacion de los mismos. |
| GB9122318D0 (en) * | 1991-10-21 | 1991-12-04 | Courtaulds Plc | Treatment of elongate members |
| GB9304887D0 (en) * | 1993-03-10 | 1993-04-28 | Courtaulds Plc | Fibre treatment |
| GB9407496D0 (en) * | 1994-04-15 | 1994-06-08 | Courtaulds Fibres Holdings Ltd | Fibre treatment |
| GB9408742D0 (en) * | 1994-05-03 | 1994-06-22 | Courtaulds Fibres Holdings Ltd | Fabric treatment |
| GB9410912D0 (en) * | 1994-06-01 | 1994-07-20 | Courtaulds Plc | Fibre treatment |
| TW406117B (en) * | 1995-06-14 | 2000-09-21 | Ciba Sc Holding Ag | Fibre-reactive dyes containing two triazinyl radicals which are linked via an aliphatic bridge member |
| CA2695838C (en) | 1999-05-19 | 2011-11-01 | Bridgestone Corporation | Low molecular weight high-cis polybutadienes and their use in high molecular weight/low molecular weight high-cis polybutadiene blends |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB774925A (en) * | 1954-11-29 | 1957-05-15 | Ici Ltd | New monoazo dyestuffs derived from cyanuric chloride |
| GB785222A (en) * | 1954-11-29 | 1957-10-23 | Ici Ltd | New monoazo dyestuffs derived from cyanuric chloride |
| FR1228184A (fr) * | 1958-03-05 | 1960-08-26 | Ici Ltd | Nouvelles matières colorantes azoïques |
| GB854432A (en) * | 1958-03-05 | 1960-11-16 | Ici Ltd | New triazine azo dyestuffs |
| CH422196A (de) * | 1958-08-11 | 1966-10-15 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
| GB1015932A (en) * | 1961-05-24 | 1966-01-05 | Ici Ltd | New reactive dyestuffs containing triazine residues |
| GB1283771A (en) * | 1969-01-16 | 1972-08-02 | Ici Ltd | New reactive disazo dyestuffs |
| GB1272291A (en) * | 1969-01-16 | 1972-04-26 | Ici Ltd | New reactive metallised disazo dyestuffs |
| BE787122A (fr) * | 1971-08-04 | 1973-02-05 | Ciba Geigy | Composes azoiques, leur preparation et leur utilisation |
| US4148790A (en) * | 1973-05-24 | 1979-04-10 | Sumitomo Chemical Company Limited | Metallized triazine reactive dyes |
| JPS50107277A (enExample) * | 1974-02-01 | 1975-08-23 | ||
| JPS5126386A (en) * | 1974-08-24 | 1976-03-04 | Mitsubishi Chem Ind | Seruroosukeisenino senshokuhoho |
| GB1461125A (en) * | 1974-10-02 | 1977-01-13 | Ici Ltd | Fluorotriazinyl reactive dyestuff |
| IT1061627B (it) * | 1975-03-20 | 1983-04-30 | Ciba Geigy | Coloranti reattivi per fibre e procedimento per la loro produzione ed applicazione |
| FR2304651A1 (fr) * | 1976-03-18 | 1976-10-15 | Ciba Geigy Ag | Colorants reactifs vis-a-vis de la fibre, leur procede de preparation et leur utilisation |
-
1980
- 1980-11-21 DE DE19803043915 patent/DE3043915A1/de active Granted
- 1980-11-28 US US06/210,770 patent/US4502866A/en not_active Expired - Lifetime
- 1980-12-02 GB GB8038641A patent/GB2064571B/en not_active Expired
- 1980-12-04 BR BR8007928A patent/BR8007928A/pt unknown
- 1980-12-05 IT IT50315/80A patent/IT1188969B/it active
- 1980-12-05 ES ES497525A patent/ES497525A0/es active Granted
- 1980-12-05 FR FR8025882A patent/FR2471401A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES8205837A1 (es) | 1982-07-01 |
| US4502866A (en) | 1985-03-05 |
| GB2064571B (en) | 1983-07-06 |
| FR2471401B1 (enExample) | 1984-11-09 |
| ES497525A0 (es) | 1982-07-01 |
| GB2064571A (en) | 1981-06-17 |
| IT8050315A1 (it) | 1982-06-05 |
| IT8050315A0 (it) | 1980-12-05 |
| BR8007928A (pt) | 1981-06-16 |
| FR2471401A1 (fr) | 1981-06-19 |
| DE3043915A1 (de) | 1981-06-11 |
| IT1188969B (it) | 1988-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3043915C2 (enExample) | ||
| DE3029699C2 (enExample) | ||
| DE3930738B4 (de) | Phthalocyanin-Reaktivfarbstoffe, ihre Herstellung und ihre Verwendung | |
| CH690649A5 (de) | Phthalocyanin-Reaktivfarbstoffe für Fasern. | |
| AT395981B (de) | Faserreaktive phthalocyanin-azoverbindungen | |
| DE2704364C2 (enExample) | ||
| CH655735A5 (de) | Reaktive monoazoverbindungen. | |
| AT390441B (de) | Verfahren zur herstellung von reaktiven disazoverbindungen und ihre verwendung | |
| DE2507120C2 (de) | Asymmetrische 1 zu 2-Chromkomplexverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3138019C2 (enExample) | ||
| DE19521056A1 (de) | Aluminium Phthalocyanin Reaktivfarbstoffe | |
| CH643872A5 (de) | Disazoverbindungen, verfahren zur herstellung und verwendung. | |
| CH674849A5 (enExample) | ||
| DE2854517A1 (de) | Azo reaktivfarbstoffverbindungen | |
| DE4304242A1 (de) | Phthalocyanin-Reaktivfarbstoffe | |
| CH671232A5 (enExample) | ||
| DE19515251B4 (de) | Faserreaktive Disazofarbstoffe | |
| DE2944624C2 (enExample) | ||
| DE3923483A1 (de) | Faserreaktive disazofarbstoffe | |
| DE3835724A1 (de) | Faserreaktive metallisierte monoazoverbindungen | |
| CH651583A5 (en) | Halotriazinyldisazo compounds, preparation thereof, and process for dyeing leather | |
| CH639121A5 (en) | Monoazo compounds having a fibre-reactive radical, preparation thereof and use thereof in dyeing and printing leather | |
| DE3046451A1 (de) | "halo-triazinyl-verbindungen, deren herstellung und verwendung" | |
| DE4327005B4 (de) | Faserreaktive Disazofarbstoffe | |
| CH679400A5 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |