DE3023970C2 - Nichtwäßriges galvanisches Element - Google Patents
Nichtwäßriges galvanisches ElementInfo
- Publication number
- DE3023970C2 DE3023970C2 DE3023970A DE3023970A DE3023970C2 DE 3023970 C2 DE3023970 C2 DE 3023970C2 DE 3023970 A DE3023970 A DE 3023970A DE 3023970 A DE3023970 A DE 3023970A DE 3023970 C2 DE3023970 C2 DE 3023970C2
- Authority
- DE
- Germany
- Prior art keywords
- positive electrode
- electrolyte
- chloride
- galvanic element
- active
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003792 electrolyte Substances 0.000 claims description 49
- 239000007788 liquid Substances 0.000 claims description 47
- 229920002554 vinyl polymer Polymers 0.000 claims description 27
- 229910052751 metal Inorganic materials 0.000 claims description 22
- 239000002184 metal Substances 0.000 claims description 22
- 239000008151 electrolyte solution Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 description 23
- -1 reducible Substances 0.000 description 16
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 150000003839 salts Chemical class 0.000 description 13
- 229910052744 lithium Inorganic materials 0.000 description 12
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 11
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 239000007774 positive electrode material Substances 0.000 description 11
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 7
- 230000000737 periodic effect Effects 0.000 description 7
- 238000003860 storage Methods 0.000 description 7
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 239000002841 Lewis acid Substances 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 150000007517 lewis acids Chemical class 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 238000002161 passivation Methods 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- FZKPQHFEMFIDNR-UHFFFAOYSA-N 2-hydroxyethyl hydrogen sulfite Chemical compound OCCOS(O)=O FZKPQHFEMFIDNR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229920001567 vinyl ester resin Polymers 0.000 description 3
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- VWIIJDNADIEEDB-UHFFFAOYSA-N 3-methyl-1,3-oxazolidin-2-one Chemical compound CN1CCOC1=O VWIIJDNADIEEDB-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- JBSLOWBPDRZSMB-FPLPWBNLSA-N dibutyl (z)-but-2-enedioate Chemical compound CCCCOC(=O)\C=C/C(=O)OCCCC JBSLOWBPDRZSMB-FPLPWBNLSA-N 0.000 description 2
- BDUPRNVPXOHWIL-UHFFFAOYSA-N dimethyl sulfite Chemical compound COS(=O)OC BDUPRNVPXOHWIL-UHFFFAOYSA-N 0.000 description 2
- 238000007599 discharging Methods 0.000 description 2
- 230000009977 dual effect Effects 0.000 description 2
- 239000011532 electronic conductor Substances 0.000 description 2
- 238000009713 electroplating Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- GLNWILHOFOBOFD-UHFFFAOYSA-N lithium sulfide Chemical compound [Li+].[Li+].[S-2] GLNWILHOFOBOFD-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000007773 negative electrode material Substances 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical class CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 2
- 239000011241 protective layer Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- OBSLLHNATPQFMJ-UHFFFAOYSA-N 2,4-Dimethylthiazole Chemical compound CC1=CSC(C)=N1 OBSLLHNATPQFMJ-UHFFFAOYSA-N 0.000 description 1
- MCFSNYMQISXQTF-UHFFFAOYSA-N 2-chlorosulfonylacetyl chloride Chemical compound ClC(=O)CS(Cl)(=O)=O MCFSNYMQISXQTF-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- CMJLMPKFQPJDKP-UHFFFAOYSA-N 3-methylthiolane 1,1-dioxide Chemical compound CC1CCS(=O)(=O)C1 CMJLMPKFQPJDKP-UHFFFAOYSA-N 0.000 description 1
- SGDKTJPVCKQTHK-UHFFFAOYSA-N 5-bromo-2-fluoro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Br)=CN=C1F SGDKTJPVCKQTHK-UHFFFAOYSA-N 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 101000939500 Homo sapiens UBX domain-containing protein 11 Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 102100029645 UBX domain-containing protein 11 Human genes 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- BOFZOTMTKBQRAB-UHFFFAOYSA-N azanium;2-carboxyphenolate Chemical compound N.OC(=O)C1=CC=CC=C1O BOFZOTMTKBQRAB-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- YXWZBDDFTDHQGT-UHFFFAOYSA-J bromo(trichloro)stannane Chemical compound [Cl-].[Cl-].[Cl-].[Br-].[Sn+4] YXWZBDDFTDHQGT-UHFFFAOYSA-J 0.000 description 1
- UTOVMEACOLCUCK-PLNGDYQASA-N butyl maleate Chemical compound CCCCOC(=O)\C=C/C(O)=O UTOVMEACOLCUCK-PLNGDYQASA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HGAZMNJKRQFZKS-UHFFFAOYSA-N chloroethene;ethenyl acetate Chemical compound ClC=C.CC(=O)OC=C HGAZMNJKRQFZKS-UHFFFAOYSA-N 0.000 description 1
- AHXGRMIPHCAXFP-UHFFFAOYSA-L chromyl dichloride Chemical compound Cl[Cr](Cl)(=O)=O AHXGRMIPHCAXFP-UHFFFAOYSA-L 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000010961 commercial manufacture process Methods 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- HOBKJDRIWYGNQZ-UHFFFAOYSA-J dibromo(dichloro)stannane Chemical compound Cl[Sn](Cl)(Br)Br HOBKJDRIWYGNQZ-UHFFFAOYSA-J 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 239000011808 electrode reactant Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920000140 heteropolymer Polymers 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910001502 inorganic halide Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000011244 liquid electrolyte Substances 0.000 description 1
- GCICAPWZNUIIDV-UHFFFAOYSA-N lithium magnesium Chemical compound [Li].[Mg] GCICAPWZNUIIDV-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000011255 nonaqueous electrolyte Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- NFVUDQKTAWONMJ-UHFFFAOYSA-I pentafluorovanadium Chemical compound [F-].[F-].[F-].[F-].[F-].[V+5] NFVUDQKTAWONMJ-UHFFFAOYSA-I 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000012667 polymer degradation Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- PMOBWAXBGUSOPS-UHFFFAOYSA-N selenium tetrafluoride Chemical compound F[Se](F)(F)F PMOBWAXBGUSOPS-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- PJYXVICYYHGLSW-UHFFFAOYSA-J tetrachloroplumbane Chemical compound Cl[Pb](Cl)(Cl)Cl PJYXVICYYHGLSW-UHFFFAOYSA-J 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- LFQCEHFDDXELDD-UHFFFAOYSA-N tetramethyl orthosilicate Chemical compound CO[Si](OC)(OC)OC LFQCEHFDDXELDD-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- WQYSXVGEZYESBR-UHFFFAOYSA-N thiophosphoryl chloride Chemical compound ClP(Cl)(Cl)=S WQYSXVGEZYESBR-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- AHCHEGZCJVSHOL-UHFFFAOYSA-J tribromo(chloro)stannane Chemical compound Cl[Sn](Br)(Br)Br AHCHEGZCJVSHOL-UHFFFAOYSA-J 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M6/00—Primary cells; Manufacture thereof
- H01M6/14—Cells with non-aqueous electrolyte
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Primary Cells (AREA)
- Battery Electrode And Active Subsutance (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- External Artificial Organs (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5246779A | 1979-06-27 | 1979-06-27 | |
| US06/147,218 US4277545A (en) | 1979-06-27 | 1980-05-06 | Nonaqueous cell |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3023970A1 DE3023970A1 (de) | 1981-01-15 |
| DE3023970C2 true DE3023970C2 (de) | 1983-02-17 |
Family
ID=26730636
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3023970A Expired DE3023970C2 (de) | 1979-06-27 | 1980-06-26 | Nichtwäßriges galvanisches Element |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4277545A (en:Method) |
| AR (1) | AR242468A1 (en:Method) |
| AU (1) | AU538474B2 (en:Method) |
| CA (1) | CA1149861A (en:Method) |
| CH (1) | CH636733A5 (en:Method) |
| DE (1) | DE3023970C2 (en:Method) |
| DK (1) | DK156152C (en:Method) |
| ES (1) | ES492812A0 (en:Method) |
| FR (1) | FR2460047A1 (en:Method) |
| GB (1) | GB2054254B (en:Method) |
| HK (1) | HK81185A (en:Method) |
| IE (1) | IE49927B1 (en:Method) |
| IL (1) | IL60404A (en:Method) |
| IT (1) | IT1131389B (en:Method) |
| LU (1) | LU82557A1 (en:Method) |
| MX (1) | MX155991A (en:Method) |
| NL (1) | NL190091C (en:Method) |
| NO (1) | NO151563C (en:Method) |
| SE (1) | SE445866B (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3912954C1 (en:Method) * | 1989-04-20 | 1990-08-23 | Sonnenschein Lithium Gmbh, 6470 Buedingen, De |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4351888A (en) * | 1981-07-30 | 1982-09-28 | Gte Laboratories Incorporated | Electrochemical cell |
| US4560632A (en) * | 1982-09-29 | 1985-12-24 | Union Carbide Corporation | Polyvinyl-coated cathode collector for cells employing liquid cathodes |
| EP0105173A3 (en) * | 1982-09-29 | 1985-11-27 | Union Carbide Corporation | Porous cathode collector for cells employing liquid cathodes |
| US4654280A (en) * | 1984-12-27 | 1987-03-31 | Eveready Battery Company | Nonaqueous cell employing a cathode-electrolyte solution containing a boron-containing additive |
| EP0186200A3 (en) * | 1984-12-27 | 1988-03-23 | Eveready Battery Company, Inc. | Nonaqueous cell employing a cathode-electrolyte solution containing a boron-containing additive |
| EP0384572B1 (en) * | 1989-01-24 | 1994-09-07 | Matsushita Electric Industrial Co., Ltd. | A nonaqueous electrochemical cell and a method of manufacturing the same |
| US5182177A (en) * | 1992-02-20 | 1993-01-26 | Battery Engineering, Inc. | Primary cell having minimized drop in the start-up potential |
| US5569558A (en) * | 1995-06-05 | 1996-10-29 | Wilson Greatbatch Ltd. | Reduced voltage delay additive for nonaqueous electrolyte in alkali metal electrochemical cell |
| US20080026296A1 (en) * | 2006-07-27 | 2008-01-31 | Bowden William L | Battery |
| US20090191466A1 (en) * | 2006-07-27 | 2009-07-30 | The Gillette Company | Battery |
| US20080076029A1 (en) * | 2006-07-27 | 2008-03-27 | Bowden William L | Battery |
| US8067108B1 (en) * | 2007-02-14 | 2011-11-29 | Electrochem Solutions, Inc. | Hybrid battery for use over extended temperature range |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE22065E (en) | 1942-04-07 | Anode | ||
| BE554629A (en:Method) | 1956-02-01 | |||
| US3098770A (en) * | 1958-02-03 | 1963-07-23 | Yardney International Corp | Anhydrous electric battery |
| BE793372A (fr) * | 1971-12-27 | 1973-06-27 | Union Carbide Corp | Pile electro-chimique non aqueuse |
| US3928070A (en) * | 1974-03-28 | 1975-12-23 | Yardney Electric Corp | Electrolyte for organic electrolyte cells |
| US3928067A (en) * | 1974-09-06 | 1975-12-23 | Bell Telephone Labor Inc | Polyalkylene glycol ethers in rechargeable lithium nonaqueous batteries |
| US3993501A (en) * | 1975-03-24 | 1976-11-23 | Union Carbide Corporation | Nonaqueous electrochemical cell |
| US4170693A (en) * | 1977-10-11 | 1979-10-09 | Catanzarite Vincent Owen | Coating for lithium anode, thionyl chloride active cathode electrochemical cell |
| US4218523A (en) * | 1979-02-28 | 1980-08-19 | Union Carbide Corporation | Nonaqueous electrochemical cell |
| FR2478377A1 (fr) * | 1980-03-14 | 1981-09-18 | Union Carbide Corp | Pile non aqueuse |
-
1980
- 1980-03-20 DK DK121480A patent/DK156152C/da not_active IP Right Cessation
- 1980-05-06 US US06/147,218 patent/US4277545A/en not_active Expired - Lifetime
- 1980-06-25 SE SE8004691A patent/SE445866B/sv not_active IP Right Cessation
- 1980-06-25 NO NO801906A patent/NO151563C/no unknown
- 1980-06-26 GB GB8020881A patent/GB2054254B/en not_active Expired
- 1980-06-26 IE IE1333/80A patent/IE49927B1/en unknown
- 1980-06-26 AU AU59671/80A patent/AU538474B2/en not_active Ceased
- 1980-06-26 MX MX182927A patent/MX155991A/es unknown
- 1980-06-26 CH CH493080A patent/CH636733A5/fr not_active IP Right Cessation
- 1980-06-26 IL IL60404A patent/IL60404A/xx unknown
- 1980-06-26 CA CA000354888A patent/CA1149861A/en not_active Expired
- 1980-06-26 LU LU82557A patent/LU82557A1/fr unknown
- 1980-06-26 NL NLAANVRAGE8003710,A patent/NL190091C/xx not_active IP Right Cessation
- 1980-06-26 IT IT23060/80A patent/IT1131389B/it active
- 1980-06-26 FR FR8014230A patent/FR2460047A1/fr active Granted
- 1980-06-26 ES ES492812A patent/ES492812A0/es active Granted
- 1980-06-26 DE DE3023970A patent/DE3023970C2/de not_active Expired
- 1980-06-27 AR AR80281560A patent/AR242468A1/es active
-
1985
- 1985-10-24 HK HK811/85A patent/HK81185A/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3912954C1 (en:Method) * | 1989-04-20 | 1990-08-23 | Sonnenschein Lithium Gmbh, 6470 Buedingen, De | |
| EP0393418A1 (de) * | 1989-04-20 | 1990-10-24 | Sonnenschein Lithium Gmbh | Elektrochemische Zelle |
Also Published As
| Publication number | Publication date |
|---|---|
| AU5967180A (en) | 1981-01-08 |
| IT8023060A0 (it) | 1980-06-26 |
| LU82557A1 (fr) | 1981-02-03 |
| DK156152B (da) | 1989-06-26 |
| NL190091C (nl) | 1993-10-18 |
| DK121480A (da) | 1980-12-28 |
| GB2054254A (en) | 1981-02-11 |
| AU538474B2 (en) | 1984-08-16 |
| ES8103484A1 (es) | 1981-02-16 |
| IE49927B1 (en) | 1986-01-08 |
| ES492812A0 (es) | 1981-02-16 |
| DK156152C (da) | 1989-11-20 |
| DE3023970A1 (de) | 1981-01-15 |
| IL60404A0 (en) | 1980-09-16 |
| NL190091B (nl) | 1993-05-17 |
| GB2054254B (en) | 1983-02-16 |
| NL8003710A (nl) | 1980-12-30 |
| HK81185A (en) | 1985-11-01 |
| SE8004691L (sv) | 1980-12-28 |
| AR242468A1 (es) | 1993-03-31 |
| IT1131389B (it) | 1986-06-18 |
| US4277545A (en) | 1981-07-07 |
| MX155991A (es) | 1988-06-13 |
| FR2460047A1 (fr) | 1981-01-16 |
| CH636733A5 (fr) | 1983-06-15 |
| FR2460047B1 (en:Method) | 1985-02-01 |
| NO151563B (no) | 1985-01-14 |
| IL60404A (en) | 1983-07-31 |
| NO801906L (no) | 1980-12-29 |
| SE445866B (sv) | 1986-07-21 |
| NO151563C (no) | 1985-05-02 |
| CA1149861A (en) | 1983-07-12 |
| IE801333L (en) | 1980-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3023971C2 (de) | Nichtwäßriges galvanisches Element | |
| DE3005869C2 (de) | Nichtwäßriges galvanisches Element | |
| DE2262256C3 (de) | Galvanisches Element | |
| DE3788845T2 (de) | Ionenleitendes Material. | |
| DE2848962C2 (de) | Galvanische Zelle | |
| DE3048286C2 (en:Method) | ||
| DE60205922T2 (de) | Direkter zusatz von beta-aminoenonen in organischen elektrolyten nichtwässriger zellen mit festkörperkathoden | |
| DE69401246T2 (de) | Batterie mit nicht-wässrigen Elektrolyte | |
| DE3023970C2 (de) | Nichtwäßriges galvanisches Element | |
| DE3783848T2 (de) | Nichtwaesserige batterie mit besonderem separator. | |
| DE2608547A1 (de) | Nichtwaessrige elektrochemische zelle | |
| GB2139409A (en) | Nonaqueous cell | |
| DE1917907A1 (de) | Batterie | |
| DE2521216C3 (de) | Galvanisches Element | |
| DE3032556A1 (de) | Gegen fehlanwendung widerstandsfaehige elemente mit einer negativen aktivmetallelektrode und fluessigem positivem elektrodendepolarisator | |
| DE3323333A1 (de) | Glasfaserseparatoren fuer zellen mit fluessigen positiven elektroden | |
| DE69837368T2 (de) | Kathode mit Gemischtphase-Metalloxid, Herstellungsverfahren und Elektrochemische Zelle dafür | |
| DE3235941C2 (de) | Nichtwäßrige Zelle mit einer positiven Antimontrisulfidelektrode | |
| DE3024151C2 (de) | Wiederaufladbares galvanisches Lithiumelement mit einem organischen Elektrolyten | |
| CH493944A (de) | Elektrochemisches Primärelement | |
| DE3022977A1 (de) | Nichtwaessriges galvanisches element | |
| DE2756926C3 (de) | Galvanische Bleioxidzelle mit einer negativen Elektrode aus einem sehr aktiven Metall, einer positiven Elektrode und einem organischen Lösungsmittel für das Elektrolytsalz | |
| DE2756927C3 (de) | Galvanische Bleioxidzelle mit organischem Lösungsmittel für das Elektrolytsalz | |
| CH642778A5 (de) | Stromliefernde zellen. | |
| DE2557600C3 (de) | Galvanisches Element mit einem Nitril als Lösungsmittel für das Elektrolytsalz |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: EVEREADY BATTERY CO. INC., ST. LOUIS, MO., US |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: FUCHS, J., DR.-ING. DIPL.-ING. B.COM. LUDERSCHMIDT, W., DIPL.-CHEM. DR.PHIL.NAT., PAT.-ANWAELTE, 6200 WIESBADEN |
|
| 8339 | Ceased/non-payment of the annual fee |