DE3022784A1 - Verfahren zum modifizieren eines azoarylamid-pigments, nach diesem verfahren hergestellte azopigmentmasse und diese azopigmentmasse enthaltende druckfarbe - Google Patents
Verfahren zum modifizieren eines azoarylamid-pigments, nach diesem verfahren hergestellte azopigmentmasse und diese azopigmentmasse enthaltende druckfarbeInfo
- Publication number
- DE3022784A1 DE3022784A1 DE19803022784 DE3022784A DE3022784A1 DE 3022784 A1 DE3022784 A1 DE 3022784A1 DE 19803022784 DE19803022784 DE 19803022784 DE 3022784 A DE3022784 A DE 3022784A DE 3022784 A1 DE3022784 A1 DE 3022784A1
- Authority
- DE
- Germany
- Prior art keywords
- pigment
- amine
- parts
- acid
- produced
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000049 pigment Substances 0.000 title claims description 55
- 238000000034 method Methods 0.000 title claims description 33
- 239000002253 acid Substances 0.000 claims description 27
- 150000001412 amines Chemical class 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 20
- 238000007639 printing Methods 0.000 claims description 20
- 239000000539 dimer Substances 0.000 claims description 15
- KYXHKHDZJSDWEF-LHLOQNFPSA-N CCCCCCC1=C(CCCCCC)C(\C=C\CCCCCCCC(O)=O)C(CCCCCCCC(O)=O)CC1 Chemical compound CCCCCCC1=C(CCCCCC)C(\C=C\CCCCCCCC(O)=O)C(CCCCCCCC(O)=O)CC1 KYXHKHDZJSDWEF-LHLOQNFPSA-N 0.000 claims description 6
- 159000000021 acetate salts Chemical class 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 239000000976 ink Substances 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 230000008878 coupling Effects 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- MZZSDCJQCLYLLL-UHFFFAOYSA-N Secalonsaeure A Natural products COC(=O)C12OC3C(CC1=C(O)CC(C)C2O)C(=CC=C3c4ccc(O)c5C(=O)C6=C(O)CC(C)C(O)C6(Oc45)C(=O)OC)O MZZSDCJQCLYLLL-UHFFFAOYSA-N 0.000 description 5
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 5
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- HUWXDEQWWKGHRV-UHFFFAOYSA-N 3,3'-Dichlorobenzidine Chemical compound C1=C(Cl)C(N)=CC=C1C1=CC=C(N)C(Cl)=C1 HUWXDEQWWKGHRV-UHFFFAOYSA-N 0.000 description 4
- 238000007646 gravure printing Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- -1 aliphatic amines Chemical class 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 239000010802 sludge Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 description 1
- SLQUMEDOQAYLAY-UHFFFAOYSA-N 1-[2,4-bis(methylamino)phenyl]butane-1,3-dione Chemical compound CNC1=CC=C(C(=O)CC(C)=O)C(NC)=C1 SLQUMEDOQAYLAY-UHFFFAOYSA-N 0.000 description 1
- RESTWAHJFMZUIZ-UHFFFAOYSA-N 1-ethyl-4-nitrobenzene Chemical compound CCC1=CC=C([N+]([O-])=O)C=C1 RESTWAHJFMZUIZ-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- NMWSKOLWZZWHPL-UHFFFAOYSA-N 3-chlorobiphenyl Chemical group ClC1=CC=CC(C=2C=CC=CC=2)=C1 NMWSKOLWZZWHPL-UHFFFAOYSA-N 0.000 description 1
- MSYFITFSZJKRQJ-UHFFFAOYSA-N 4,5-dihydroimidazol-1-amine Chemical class NN1CCN=C1 MSYFITFSZJKRQJ-UHFFFAOYSA-N 0.000 description 1
- YQSHOXUUKDJLJD-UHFFFAOYSA-N 4-(4-aminophenyl)-2,3,5,6-tetrachloroaniline Chemical group C1=CC(N)=CC=C1C1=C(Cl)C(Cl)=C(N)C(Cl)=C1Cl YQSHOXUUKDJLJD-UHFFFAOYSA-N 0.000 description 1
- GTZJIQDLDUWGMH-UHFFFAOYSA-N 4-aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1.NC(=O)C1=CC=C(N)C=C1 GTZJIQDLDUWGMH-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- MBHRHUJRKGNOKX-UHFFFAOYSA-N [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol Chemical class NC1=NC(N)=NC(NCO)=N1 MBHRHUJRKGNOKX-UHFFFAOYSA-N 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 description 1
- 235000020661 alpha-linolenic acid Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229960004488 linolenic acid Drugs 0.000 description 1
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 description 1
- HGVIAKXYAZRSEG-UHFFFAOYSA-N n-(2,4-dimethylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1C HGVIAKXYAZRSEG-UHFFFAOYSA-N 0.000 description 1
- KYYRTDXOHQYZPO-UHFFFAOYSA-N n-(2-methoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC=CC=C1NC(=O)CC(C)=O KYYRTDXOHQYZPO-UHFFFAOYSA-N 0.000 description 1
- TVZIWRMELPWPPR-UHFFFAOYSA-N n-(2-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1C TVZIWRMELPWPPR-UHFFFAOYSA-N 0.000 description 1
- KOHNUEXAOQRRPI-UHFFFAOYSA-N n-benzyl-3-oxobutanamide Chemical compound CC(=O)CC(=O)NCC1=CC=CC=C1 KOHNUEXAOQRRPI-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 235000020777 polyunsaturated fatty acids Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical group 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001052 yellow pigment Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0001—Post-treatment of organic pigments or dyes
- C09B67/002—Influencing the physical properties by treatment with an amine
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/050,678 US4220473A (en) | 1979-06-21 | 1979-06-21 | Process for treating azo pigments |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3022784A1 true DE3022784A1 (de) | 1981-01-22 |
| DE3022784C2 DE3022784C2 (enExample) | 1988-01-07 |
Family
ID=21966720
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803022784 Granted DE3022784A1 (de) | 1979-06-21 | 1980-06-18 | Verfahren zum modifizieren eines azoarylamid-pigments, nach diesem verfahren hergestellte azopigmentmasse und diese azopigmentmasse enthaltende druckfarbe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4220473A (enExample) |
| DE (1) | DE3022784A1 (enExample) |
| DK (1) | DK155949C (enExample) |
| FR (1) | FR2459270A1 (enExample) |
| GB (1) | GB2055878B (enExample) |
| IT (1) | IT1193941B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2043092B (en) * | 1979-01-23 | 1982-12-15 | Toyo Aluminium Kk | Pigment composition and method of producing same |
| JPS55164252A (en) * | 1979-05-18 | 1980-12-20 | Toyo Ink Mfg Co Ltd | Preparation of azo pigment |
| DE3104257A1 (de) * | 1981-02-07 | 1983-02-03 | Hoechst Ag, 6000 Frankfurt | Azopigmentpraeparationen, verfahren zu ihrer herstellung und ihre verwendung |
| US5062894A (en) * | 1991-02-12 | 1991-11-05 | Sun Chemical Corporation | Poly (alkylene oxide)-modified diarylide pigment composition |
| EP0717086B1 (de) * | 1994-12-15 | 2000-04-26 | Ciba SC Holding AG | Mit Metallphosphatkomplexen und Aminen beschichtete organische Pigmente |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2192956A (en) * | 1936-07-22 | 1940-03-12 | Du Pont | Pigment manufacture |
| US2442972A (en) * | 1941-01-23 | 1948-06-08 | Sidney M Edelstein | Aqueous dispersions of electropositive materials |
| US2638702A (en) * | 1949-08-19 | 1953-05-19 | Francis C Holbrook | Knockdown stool-easel |
| US3336147A (en) * | 1963-08-12 | 1967-08-15 | Ici Ltd | Manufacture of pigment compositions |
| US3655641A (en) * | 1968-06-05 | 1972-04-11 | Ciba Geigy Ag | Unsymmetrical disazo pigments derived from dichlorobenzidine and acetylarylamides |
| US3728143A (en) * | 1971-03-31 | 1973-04-17 | Plastic Molders Supply Co | Pigment dispersion |
| US3759733A (en) * | 1970-07-16 | 1973-09-18 | Ciba Geigy Ag | Pigment compositions |
| US3766230A (en) * | 1970-07-03 | 1973-10-16 | Ciba Geigy Ag | Azomethine complex pigments |
| US3775148A (en) * | 1970-07-16 | 1973-11-27 | Ciba Geigy Ag | Pigment compositions |
| US3827902A (en) * | 1971-05-03 | 1974-08-06 | Hoechst Ag | Process for preparing pigment compositions |
| US3844810A (en) * | 1971-03-31 | 1974-10-29 | Plastic Molders Supply Co | Pigment dispersion |
| US3905825A (en) * | 1970-12-19 | 1975-09-16 | Acna | Azo-acetyl-acetaryl pigment compositions readily dispersed in organic media |
| US3953218A (en) * | 1971-03-31 | 1976-04-27 | Pms Consolidated | Pigment dispersion |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3075849A (en) * | 1959-03-30 | 1963-01-29 | Byk Gulden Lomberg Chem Fab | Process of retarding sedimentation of pigments in film-forming coating materials, and compositions |
| FR1348085A (fr) * | 1962-02-07 | 1964-01-04 | Ici Ltd | Procédé pour rendre des pigments plus oléophiles |
| DE1719414B2 (de) * | 1964-11-17 | 1973-05-10 | Verhuetung des sedimentierens von pigmentsuspensionen | |
| GB1096362A (en) * | 1965-06-01 | 1967-12-29 | Ici Ltd | Azoacylacetarylamide/amine condensation products |
| DE1469740A1 (de) * | 1965-10-08 | 1969-01-02 | Hoechst Ag | Verfahren zur Behandlung eines Azopigmentes |
| FR1469298A (fr) * | 1966-01-26 | 1967-02-10 | Machine décavaillonneuse et broyeuse de sarments |
-
1979
- 1979-06-21 US US06/050,678 patent/US4220473A/en not_active Expired - Lifetime
-
1980
- 1980-05-28 GB GB8017468A patent/GB2055878B/en not_active Expired
- 1980-05-30 IT IT22456/80A patent/IT1193941B/it active
- 1980-06-03 DK DK239080A patent/DK155949C/da not_active IP Right Cessation
- 1980-06-18 FR FR8013498A patent/FR2459270A1/fr active Granted
- 1980-06-18 DE DE19803022784 patent/DE3022784A1/de active Granted
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2192956A (en) * | 1936-07-22 | 1940-03-12 | Du Pont | Pigment manufacture |
| US2442972A (en) * | 1941-01-23 | 1948-06-08 | Sidney M Edelstein | Aqueous dispersions of electropositive materials |
| US2638702A (en) * | 1949-08-19 | 1953-05-19 | Francis C Holbrook | Knockdown stool-easel |
| US3336147A (en) * | 1963-08-12 | 1967-08-15 | Ici Ltd | Manufacture of pigment compositions |
| US3655641A (en) * | 1968-06-05 | 1972-04-11 | Ciba Geigy Ag | Unsymmetrical disazo pigments derived from dichlorobenzidine and acetylarylamides |
| US3766230A (en) * | 1970-07-03 | 1973-10-16 | Ciba Geigy Ag | Azomethine complex pigments |
| US3759733A (en) * | 1970-07-16 | 1973-09-18 | Ciba Geigy Ag | Pigment compositions |
| US3775148A (en) * | 1970-07-16 | 1973-11-27 | Ciba Geigy Ag | Pigment compositions |
| US3905825A (en) * | 1970-12-19 | 1975-09-16 | Acna | Azo-acetyl-acetaryl pigment compositions readily dispersed in organic media |
| US3728143A (en) * | 1971-03-31 | 1973-04-17 | Plastic Molders Supply Co | Pigment dispersion |
| US3844810A (en) * | 1971-03-31 | 1974-10-29 | Plastic Molders Supply Co | Pigment dispersion |
| US3953218A (en) * | 1971-03-31 | 1976-04-27 | Pms Consolidated | Pigment dispersion |
| US3827902A (en) * | 1971-05-03 | 1974-08-06 | Hoechst Ag | Process for preparing pigment compositions |
Non-Patent Citations (1)
| Title |
|---|
| E.C.LEONARD the Dimer Acids, Library of Congress Catalog Card Number: 75-3895, 1975 * |
Also Published As
| Publication number | Publication date |
|---|---|
| IT8022456A0 (it) | 1980-05-30 |
| DE3022784C2 (enExample) | 1988-01-07 |
| GB2055878A (en) | 1981-03-11 |
| FR2459270B1 (enExample) | 1983-12-16 |
| DK239080A (da) | 1980-12-22 |
| IT1193941B (it) | 1988-08-31 |
| DK155949C (da) | 1989-10-30 |
| DK155949B (da) | 1989-06-05 |
| FR2459270A1 (fr) | 1981-01-09 |
| US4220473A (en) | 1980-09-02 |
| GB2055878B (en) | 1983-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1444621A1 (de) | Neuer reaktionsfaehiger Farbstoff,Verfahren zu dessen Herstellung sowie Verfahren zum Faerben von Gegenstaenden mit diesem Farbstoff | |
| DE2135468B2 (de) | Pigmentzusammensetzung, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2835651A1 (de) | Verfahren zum herstellen einer verlaufbestaendigen lithographischen druckfarbmasse | |
| DE1469782A1 (de) | Verfahren zur Herstellung leicht dispergierbarer Pigmente | |
| EP0062304B1 (de) | Verfahren zur Herstellung von Azopigmentpräparationen und ihre Verwendung | |
| DE69620693T2 (de) | Pigmentszusammensetzungen | |
| US4462833A (en) | Process for treating diarylide yellow pigment | |
| CH620238A5 (enExample) | ||
| DE3016717C2 (enExample) | ||
| DE69423417T2 (de) | Pigmentkompositionen | |
| DE1619596C3 (de) | Verfahren zur Herstellung vorbehandelter Pigmente | |
| DE69715697T2 (de) | Polymorph von einem gelben Diarylidpigment | |
| DE3022784C2 (enExample) | ||
| DE69213830T2 (de) | Herstellung von Pigmenten | |
| DE69007537T2 (de) | Tintenzusammensetzungen auf wässeriger Basis. | |
| DE2704362A1 (de) | Pigmentzubereitungen auf der basis von estern von harzsaeuren und von aminoalkoholen und verfahren zu ihrer herstellung | |
| DE1619597C3 (de) | Verfahren zur Herstellung aminhaltiger vorbehandelter Pigmente | |
| US2616861A (en) | Pigment coloring compositions containing a reaction product of melamine, formaldehyde, glycerine, and an alkylolamine | |
| DE2401597C2 (de) | Azoarylamide enthaltende Pigmentzusammensetzungen, ihre Herstellung und Verwendung | |
| DE2526872A1 (de) | Verfahren zur herstellung von gelben acrylamidpigmenten | |
| DE1936311B1 (de) | Verfahren zur Herstellung leicht dispergierbarer Pigmente fuer Druckfarbenfirnisse auf Aromatenbasis | |
| DE1595524A1 (de) | Verfahren zur Herstellung und Verwendung von chromogen gebundenen Polymeren | |
| DE68916164T2 (de) | Disazopigmentzusammensetzung. | |
| DE2312301C3 (de) | Leichtverteilbare Pigmentzubereitungen | |
| DE2835650A1 (de) | Verfahren zum herstellen einer verlaufbestaendigen lithographischen druckfarbmasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| PK | Publication date corrected |
Effective date: 19880121 |
|
| 8380 | Miscellaneous part iii |
Free format text: "AUF DEM TITELBLATT DER PATENTSCHRIFT IST DER VEROEFFENTLICHUNGSTAG DER PATENTERTEILUNG ZU AENDERN IN 21.01.88" |
|
| 8380 | Miscellaneous part iii |
Free format text: SEITE 2, ZEILE 17 "MIT 5 BIS 36 MASSE %,...." AENDERN IN "MIT 5 BIS 35 MASSE %,...." |
|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |