DE3004770A1 - Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselben - Google Patents
Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselbenInfo
- Publication number
- DE3004770A1 DE3004770A1 DE19803004770 DE3004770A DE3004770A1 DE 3004770 A1 DE3004770 A1 DE 3004770A1 DE 19803004770 DE19803004770 DE 19803004770 DE 3004770 A DE3004770 A DE 3004770A DE 3004770 A1 DE3004770 A1 DE 3004770A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- fatty acid
- ppm
- alkyl group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 title claims description 34
- 239000004009 herbicide Substances 0.000 title claims description 22
- 229940053200 antiepileptics fatty acid derivative Drugs 0.000 title claims description 15
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical class O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 70
- 239000004480 active ingredient Substances 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 16
- -1 phenoxy fatty acid Chemical class 0.000 claims description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims description 13
- 239000004563 wettable powder Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 8
- 239000000194 fatty acid Substances 0.000 claims description 8
- 229930195729 fatty acid Natural products 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 150000003839 salts Chemical group 0.000 claims description 8
- 150000007529 inorganic bases Chemical class 0.000 claims description 7
- 150000007530 organic bases Chemical class 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000005055 alkyl alkoxy group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical group NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims 1
- 239000002671 adjuvant Substances 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical group 0.000 claims 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 150000001342 alkaline earth metals Chemical group 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- RUDATBOHQWOJDD-BSWAIDMHSA-N chenodeoxycholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)CC1 RUDATBOHQWOJDD-BSWAIDMHSA-N 0.000 description 41
- 125000001309 chloro group Chemical group Cl* 0.000 description 38
- 239000000243 solution Substances 0.000 description 24
- 241000196324 Embryophyta Species 0.000 description 22
- 230000002363 herbicidal effect Effects 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 239000013256 coordination polymer Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 235000010469 Glycine max Nutrition 0.000 description 13
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 231100000674 Phytotoxicity Toxicity 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002689 soil Substances 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- 240000007594 Oryza sativa Species 0.000 description 6
- 235000007164 Oryza sativa Nutrition 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 230000012010 growth Effects 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 235000009566 rice Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- VYQNWZOUAUKGHI-UHFFFAOYSA-N monobenzone Chemical compound C1=CC(O)=CC=C1OCC1=CC=CC=C1 VYQNWZOUAUKGHI-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 240000007124 Brassica oleracea Species 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001077837 Galinsoga quadriradiata Species 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 235000011999 Panicum crusgalli Nutrition 0.000 description 3
- 241000209504 Poaceae Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 244000088415 Raphanus sativus Species 0.000 description 3
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 3
- 240000006586 Rorippa indica var. indica Species 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 244000061458 Solanum melongena Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000009969 flowable effect Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229960000990 monobenzone Drugs 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ABOOPXYCKNFDNJ-UHFFFAOYSA-N 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 ABOOPXYCKNFDNJ-UHFFFAOYSA-N 0.000 description 2
- CQWFZBPLGQDNQW-UHFFFAOYSA-N 4-quinolin-2-yloxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C=CC=C2)C2=N1 CQWFZBPLGQDNQW-UHFFFAOYSA-N 0.000 description 2
- RNMDNPCBIKJCQP-UHFFFAOYSA-N 5-nonyl-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-ol Chemical compound C(CCCCCCCC)C1=C2C(=C(C=C1)O)O2 RNMDNPCBIKJCQP-UHFFFAOYSA-N 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 244000035395 Chenopodium ficifolium Species 0.000 description 2
- 235000009731 Chenopodium ficifolium Nutrition 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000002597 Solanum melongena Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241001148683 Zostera marina Species 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- WFOKVKYNVKVWFK-UHFFFAOYSA-N 2,6-dichloroquinoxaline Chemical compound N1=C(Cl)C=NC2=CC(Cl)=CC=C21 WFOKVKYNVKVWFK-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- JLJCUGQBTWIIKL-UHFFFAOYSA-N 2-(4-phenylmethoxyphenoxy)quinoline Chemical compound C=1C=C(OC=2N=C3C=CC=CC3=CC=2)C=CC=1OCC1=CC=CC=C1 JLJCUGQBTWIIKL-UHFFFAOYSA-N 0.000 description 1
- QEFFBAMWRRIPTQ-UHFFFAOYSA-N 2-(4-quinoxalin-2-yloxyphenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CN=C(C=CC=C2)C2=N1 QEFFBAMWRRIPTQ-UHFFFAOYSA-N 0.000 description 1
- QQEWXGTYYUSXII-UHFFFAOYSA-N 2-chloro-6-fluoroquinoxaline Chemical compound N1=C(Cl)C=NC2=CC(F)=CC=C21 QQEWXGTYYUSXII-UHFFFAOYSA-N 0.000 description 1
- OFUFXTHGZWIDDB-UHFFFAOYSA-N 2-chloroquinoline Chemical compound C1=CC=CC2=NC(Cl)=CC=C21 OFUFXTHGZWIDDB-UHFFFAOYSA-N 0.000 description 1
- BYHVGQHIAFURIL-UHFFFAOYSA-N 2-chloroquinoxaline Chemical compound C1=CC=CC2=NC(Cl)=CN=C21 BYHVGQHIAFURIL-UHFFFAOYSA-N 0.000 description 1
- MNYCPGVPVPAADT-UHFFFAOYSA-N 4-(6-fluoroquinoxalin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CN=C(C=C(F)C=C2)C2=N1 MNYCPGVPVPAADT-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 244000020518 Carthamus tinctorius Species 0.000 description 1
- 235000003255 Carthamus tinctorius Nutrition 0.000 description 1
- 102100024479 Cell division cycle-associated protein 3 Human genes 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 101000980907 Homo sapiens Cell division cycle-associated protein 3 Proteins 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- PPNUOIBDZBOUST-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl]-phenylcarbamic acid Chemical compound CCOC(=O)NC1=CC=CC(N(C(O)=O)C=2C=CC=CC=2)=C1 PPNUOIBDZBOUST-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- ILYSHPJWNMPBPE-UHFFFAOYSA-N ethyl 2-(4-hydroxyphenoxy)propanoate Chemical compound CCOC(=O)C(C)OC1=CC=C(O)C=C1 ILYSHPJWNMPBPE-UHFFFAOYSA-N 0.000 description 1
- QJYILTQZWOXFNJ-UHFFFAOYSA-N ethyl 2-(4-quinoxalin-2-yloxyphenoxy)propanoate Chemical compound C1=CC(OC(C)C(=O)OCC)=CC=C1OC1=CN=C(C=CC=C2)C2=N1 QJYILTQZWOXFNJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- LPEKGGXMPWTOCB-VKHMYHEASA-N methyl (S)-lactate Chemical compound COC(=O)[C@H](C)O LPEKGGXMPWTOCB-VKHMYHEASA-N 0.000 description 1
- YGHJGQYNECSZDY-UHFFFAOYSA-N methyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate Chemical compound C1=CC(OC(C)C(=O)OC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 YGHJGQYNECSZDY-UHFFFAOYSA-N 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- GHKGUEZUGFJUEJ-UHFFFAOYSA-M potassium;4-methylbenzenesulfonate Chemical compound [K+].CC1=CC=C(S([O-])(=O)=O)C=C1 GHKGUEZUGFJUEJ-UHFFFAOYSA-M 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RVULBHWZFCBODE-UHFFFAOYSA-M sodium;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate Chemical compound [Na+].C1=C([N+]([O-])=O)C(C(=O)[O-])=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 RVULBHWZFCBODE-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
- A01N43/42—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings condensed with carbocyclic rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/60—1,4-Diazines; Hydrogenated 1,4-diazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP54020164A JPS6033389B2 (ja) | 1979-02-22 | 1979-02-22 | 複素環エ−テル系フェノシキ脂肪酸誘導体、その製造法および該誘導体を含有する除草剤 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3004770A1 true DE3004770A1 (de) | 1980-08-28 |
| DE3004770C2 DE3004770C2 (https=) | 1993-06-03 |
Family
ID=12019508
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803004770 Granted DE3004770A1 (de) | 1979-02-22 | 1980-02-08 | Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselben |
| DE3051172A Expired - Lifetime DE3051172C2 (https=) | 1979-02-22 | 1980-02-08 | |
| DE3051251A Expired - Lifetime DE3051251C2 (de) | 1979-02-22 | 1980-02-08 | Herbizide Mittel, enthaltend Phenoxyfettsäurederivate vom Typ heterocyclischer Ether |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3051172A Expired - Lifetime DE3051172C2 (https=) | 1979-02-22 | 1980-02-08 | |
| DE3051251A Expired - Lifetime DE3051251C2 (de) | 1979-02-22 | 1980-02-08 | Herbizide Mittel, enthaltend Phenoxyfettsäurederivate vom Typ heterocyclischer Ether |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4629493A (https=) |
| JP (1) | JPS6033389B2 (https=) |
| AR (1) | AR226300A1 (https=) |
| AT (1) | AT365407B (https=) |
| AU (1) | AU533042B2 (https=) |
| BE (1) | BE881815A (https=) |
| BR (1) | BR8001061A (https=) |
| CA (2) | CA1306259C (https=) |
| CH (1) | CH647510A5 (https=) |
| CS (1) | CS226009B2 (https=) |
| DD (1) | DD151038A5 (https=) |
| DE (3) | DE3004770A1 (https=) |
| EG (1) | EG14184A (https=) |
| ES (1) | ES8103044A1 (https=) |
| FR (1) | FR2449683A1 (https=) |
| GB (2) | GB2042539B (https=) |
| IL (1) | IL59281A (https=) |
| IT (1) | IT1195260B (https=) |
| NL (2) | NL185280C (https=) |
| PL (1) | PL128652B1 (https=) |
| SE (1) | SE447108B (https=) |
| SU (1) | SU1452455A3 (https=) |
| ZA (1) | ZA80574B (https=) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0052798A1 (de) * | 1980-11-26 | 1982-06-02 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Oximester, Verfahren zu deren Herstellung, ihre Verwendung, sowie diese Oximester enthaltende Mittel |
| EP0058639A3 (en) * | 1981-02-16 | 1982-10-13 | Ciba-Geigy Ag | 2-(4-(6-halogen-quinoxalinyl-2-oxy)-phenoxy)-propionic-acid esters, processes for their preparation and their application as herbicides and plant growth regulators |
| EP0159290A1 (de) * | 1984-03-28 | 1985-10-23 | Ciba-Geigy Ag | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen |
| EP0082699B1 (en) * | 1981-12-17 | 1985-11-13 | E.I. Du Pont De Nemours And Company | Herbicidal quinoxalinyl ethers |
| EP0148119A3 (en) * | 1983-12-06 | 1986-07-02 | Ciba-Geigy Ag | Amides of 2-phenoxypropionic acid |
| US4609396A (en) * | 1980-06-23 | 1986-09-02 | E. I. Du Pont De Nemours And Company | Quinoxalinyloxy ethers as selective weed control agents |
| EP0387582A1 (de) * | 1989-03-11 | 1990-09-19 | BASF Aktiengesellschaft | 2,3-substituierte 1,8-Naphthyridine, Verfahren zu ihrer Herstellung und ihre Verwendung als Antidots |
| EP0385084A3 (de) * | 1989-01-27 | 1990-11-22 | BASF Aktiengesellschaft | Pflanzenschützende Mittel auf Basis von 1-Aryl- bzw. 1-Hetarylimidazolcarbonsäureestern |
| DE4042098A1 (de) * | 1990-12-28 | 1992-07-02 | Hoechst Ag | Verfahren zur herstellung optisch aktiver chinoxalinyloxyphenoxypropionsaeureester |
| US5801272A (en) * | 1993-06-01 | 1998-09-01 | Basf Aktiengesellschaft | Preparation of mixtures of (R)- and (S)-2-(4-alkanoylphenoxy)- or (R)- and (S)-2-(4-aroylphenoxy)propionic esters |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ194196A (en) * | 1979-07-17 | 1983-07-15 | Ici Australia Ltd | -(quinoxalin-2-yl(oxy or thio) phen (oxy or ylthio)-alkanoic acid derivatives or precursors |
| US4738710A (en) * | 1979-11-19 | 1988-04-19 | Ici Australia Limited | Herbicidal alkane carboxylic acid derivatives |
| AU541697B2 (en) * | 1979-11-19 | 1985-01-17 | Ici Australia Limited | Quinoline derivatives |
| CA1317299C (en) * | 1980-06-23 | 1993-05-04 | Maged Mohamed Fawzi | Quinoxalinyloxy ethers as selective weed control agents |
| NZ197420A (en) * | 1980-07-01 | 1984-04-27 | Ici Australia Ltd | -(quinazolin-(2-or 4-)(oxy,ylthio or amino)phen(oxy or ylthio)alkanoic acid derivatives |
| NZ197419A (en) * | 1980-07-01 | 1984-08-24 | Ici Australia Ltd | Omega-(cinnolin-(2 or 3-)yl(oxy,thio or amino)phen-(oxy or ylthio))alkanoic acid derivatives |
| DE3172019D1 (en) * | 1980-07-01 | 1985-10-03 | Ici Australia Ltd | Isoquinolyloxy(amino)phenoxyalkane carboxylic acid derivatives, process for their synthesis, herbicidal compositions containing them and their use as herbicides |
| US5364831A (en) * | 1980-08-06 | 1994-11-15 | Nissan Chemical Industries Ltd. | Quinoxaline derivatives and herbicidal composition |
| US6197728B1 (en) | 1980-08-06 | 2001-03-06 | Nissan Chemical Industries Ltd. | Quinoxaline derivatives and herbicidal composition |
| EP0046468A1 (en) * | 1980-08-21 | 1982-03-03 | Nissan Chemical Industries Ltd. | Quinoxaline derivatives and herbicidal composition |
| NZ199342A (en) * | 1981-01-12 | 1985-08-16 | Ici Australia Ltd | Quinoxaline derivatives and herbicides |
| NZ200031A (en) * | 1981-04-02 | 1984-11-09 | Ici Australia Ltd | Quinoline derivatives and herbicidal compositions containing such |
| AU590676B2 (en) * | 1981-04-02 | 1989-11-09 | Ici Australia Limited | Herbicidal quinoline derivatives |
| JPS5929604A (ja) * | 1982-08-13 | 1984-02-16 | Nissan Chem Ind Ltd | 水性懸濁除草組成物 |
| NO174506B (no) * | 1984-10-30 | 1994-02-07 | Usv Pharma Corp | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
| JPS62190172A (ja) * | 1986-02-14 | 1987-08-20 | Teijin Ltd | フエノキシ脂肪族カルボン酸誘導体および除草剤 |
| US4976772A (en) * | 1986-08-29 | 1990-12-11 | The Dow Chemical Company | 4-((aryloxy)phenoxy)alkenol as intermediates and herbicides |
| US4900354A (en) * | 1986-08-29 | 1990-02-13 | The Dow Chemical Company | (Quinolinyl and quinoxalinyloxy)phenoxy alkenols and their use as post emergent herbicides |
| EP0270378A3 (en) * | 1986-12-05 | 1988-09-07 | E.I. Du Pont De Nemours And Company | Herbicidal aryloxybenzeneacetic acid derivatives |
| ES2058314T3 (es) * | 1988-01-06 | 1994-11-01 | Uniroyal Chem Co Inc | Herbicidas de quinoxaliniloxifenoxipropanoato de heterociclo-alquileno. |
| US5120348A (en) * | 1988-01-06 | 1992-06-09 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| US5319102A (en) * | 1988-01-06 | 1994-06-07 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| DE3806294A1 (de) * | 1988-02-27 | 1989-09-07 | Hoechst Ag | Herbizide mittel in form von waessrigen mikroemulsionen |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| AU5686794A (en) * | 1992-12-15 | 1994-07-04 | Du Pont Merck Pharmaceutical Company, The | (2-quinoxalinyloxy)phenoxypropanoic acids and related derivatives as anticancer agents |
| US5541152A (en) * | 1994-08-19 | 1996-07-30 | Platte Chemical Company | Herbicide and fertilizer composition and method of using same |
| US5637553A (en) * | 1994-08-19 | 1997-06-10 | Platte Chemical Company | Herbicide and fertilizer composition and method of using same |
| AU742672B2 (en) * | 1997-07-11 | 2002-01-10 | Nissan Chemical Industries Ltd. | Aqueous suspension-type pesticide composition |
| AU2001250783A1 (en) * | 2000-02-29 | 2001-09-12 | Cor Therapeutics, Inc. | Benzamides and related inhibitors of factor xa |
| PT1412332E (pt) * | 2001-07-31 | 2005-06-30 | Jerome P Horwitz | Derivados de quinolina e sua utilizacao como agentes antitumorais |
| JP2003128501A (ja) * | 2001-10-18 | 2003-05-08 | Nissan Chem Ind Ltd | 農薬乳剤組成物 |
| UA79293C2 (en) * | 2002-07-03 | 2007-06-11 | Univ Wayne State | 4-(7'-halo-2-quino (xa-) linyloxy)phenoxy propionic acid derivatives as antineoplastic agents |
| US8183379B2 (en) * | 2005-09-07 | 2012-05-22 | Wayne State University | Antitumor agents |
| US7470788B2 (en) * | 2005-09-07 | 2008-12-30 | Wayne State University | Antitumor agents |
| JO2685B1 (en) * | 2006-12-06 | 2013-03-03 | جانسين فارماسوتيكا ان في | Quinoline antibacterial derivatives |
| EP2052607A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037622A1 (de) * | 2008-08-14 | 2010-02-25 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN106632007B (zh) * | 2016-12-15 | 2019-12-31 | 三峡大学 | 吡啶-3-基芳氧基苯氧基烷酸酯化合物及其应用 |
| CN106632293B (zh) * | 2016-12-15 | 2019-02-26 | 三峡大学 | 具有生物活性的芳氧苯氧烷酸衍生物及其制备方法 |
| CN106699648B (zh) * | 2016-12-15 | 2019-10-08 | 三峡大学 | 2-(4-芳氧基苯氧基)烷酸萘酯化合物及其应用 |
| CN115322159B (zh) * | 2022-06-17 | 2024-01-30 | 聊城大学 | (r)-2-[4-((喹唑啉-4-酮)-2-氧基)苯氧基]丙酸酯衍生物及其应用 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954442A (en) * | 1972-05-17 | 1976-05-04 | Hoechst Aktiengesellschaft | Herbicidal compositions |
| DE2609461A1 (de) | 1976-03-08 | 1977-09-22 | Hoechst Ag | Phenoxy-phenoxy-alkancarbonsaeurederivate |
| GB1491274A (en) | 1974-10-17 | 1977-11-09 | Ishihara Mining & Chemical Co | Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides |
| US4130431A (en) | 1976-07-05 | 1978-12-19 | Kansai Paint Co., Ltd. | Metal surface treatment liquid and rust preventive paint |
| EP0000176A1 (de) * | 1977-06-29 | 1979-01-10 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL260074A (https=) * | 1960-01-14 | |||
| NL297470A (https=) * | 1962-09-05 | |||
| US3415878A (en) * | 1962-09-10 | 1968-12-10 | Geigy Chem Corp | Process for the production of alkali metal salts of nitrilo triacetic acid |
| US3472848A (en) * | 1966-11-17 | 1969-10-14 | Merck & Co Inc | 3-hydroxy and 3-mercapto-pyrazinoyl-guanidines,corresponding ethers and thioethers and processes for their preparation |
| US3582315A (en) * | 1968-03-22 | 1971-06-01 | Lilly Co Eli | Methods and compositions for inhibiting plant growth |
| US3752812A (en) * | 1970-02-05 | 1973-08-14 | Pfizer | 2-trifluoromethylquinoxalinedi n oxides |
| US3928608A (en) * | 1972-03-14 | 1975-12-23 | Ici Ltd | Certain quinoxaline N-oxides used to combat fungi |
| US4115102A (en) * | 1974-10-17 | 1978-09-19 | Ishihara Sangyo Kaisha, Ltd. | Pyridyl compound, herbicidal composition containing the same and method of use thereof |
| DE2640730C2 (de) * | 1976-09-10 | 1983-08-25 | Hoechst Ag, 6230 Frankfurt | Benzoxazolyloxy- und Benzothiazolyloxy-phenoxy-Verbindungen und diese enthaltende herbizide Mittel |
| EP0004414B1 (en) * | 1978-03-01 | 1985-07-24 | Imperial Chemical Industries Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| US4391628A (en) * | 1981-02-16 | 1983-07-05 | Ciba-Geigy Corporation | 2-[4-(6-Haloquinoxalinyl-2-oxy)phenoxy]propionic acid esters |
-
1979
- 1979-02-22 JP JP54020164A patent/JPS6033389B2/ja not_active Expired
-
1980
- 1980-01-29 US US06/116,381 patent/US4629493A/en not_active Expired - Lifetime
- 1980-01-31 IL IL59281A patent/IL59281A/xx unknown
- 1980-01-31 ZA ZA00800574A patent/ZA80574B/xx unknown
- 1980-02-07 GB GB8004144A patent/GB2042539B/en not_active Expired
- 1980-02-08 DE DE19803004770 patent/DE3004770A1/de active Granted
- 1980-02-08 DE DE3051172A patent/DE3051172C2/de not_active Expired - Lifetime
- 1980-02-08 DE DE3051251A patent/DE3051251C2/de not_active Expired - Lifetime
- 1980-02-13 NL NLAANVRAGE8000888,A patent/NL185280C/xx not_active IP Right Cessation
- 1980-02-14 CH CH1207/80A patent/CH647510A5/de not_active IP Right Cessation
- 1980-02-18 CA CA000345903A patent/CA1306259C/en not_active Expired - Lifetime
- 1980-02-18 FR FR8003505A patent/FR2449683A1/fr active Granted
- 1980-02-19 CS CS801157A patent/CS226009B2/cs unknown
- 1980-02-20 AU AU55729/80A patent/AU533042B2/en not_active Expired
- 1980-02-20 DD DD80219165A patent/DD151038A5/de not_active IP Right Cessation
- 1980-02-20 PL PL1980222116A patent/PL128652B1/pl unknown
- 1980-02-20 AT AT0093280A patent/AT365407B/de not_active IP Right Cessation
- 1980-02-20 ES ES488795A patent/ES8103044A1/es not_active Expired
- 1980-02-20 BE BE0/199466A patent/BE881815A/fr not_active IP Right Cessation
- 1980-02-20 EG EG101/80A patent/EG14184A/xx active
- 1980-02-21 SU SU802883702A patent/SU1452455A3/ru active
- 1980-02-21 SE SE8001368A patent/SE447108B/sv not_active IP Right Cessation
- 1980-02-21 AR AR280042A patent/AR226300A1/es active
- 1980-02-22 BR BR8001061A patent/BR8001061A/pt not_active IP Right Cessation
- 1980-02-22 IT IT20112/80A patent/IT1195260B/it active
-
1983
- 1983-04-13 CA CA000425818A patent/CA1304377C/en not_active Expired - Lifetime
- 1983-07-26 GB GB08320051A patent/GB2126580B/en not_active Expired
-
1989
- 1989-06-02 NL NL8901398A patent/NL8901398A/nl active Search and Examination
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954442A (en) * | 1972-05-17 | 1976-05-04 | Hoechst Aktiengesellschaft | Herbicidal compositions |
| GB1491274A (en) | 1974-10-17 | 1977-11-09 | Ishihara Mining & Chemical Co | Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides |
| DE2609461A1 (de) | 1976-03-08 | 1977-09-22 | Hoechst Ag | Phenoxy-phenoxy-alkancarbonsaeurederivate |
| US4130431A (en) | 1976-07-05 | 1978-12-19 | Kansai Paint Co., Ltd. | Metal surface treatment liquid and rust preventive paint |
| EP0000176A1 (de) * | 1977-06-29 | 1979-01-10 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
Non-Patent Citations (3)
| Title |
|---|
| A. Pesticide Sci. 10, 1985, 61-67 * |
| J. Chem. Soc., Perkin I, 1974, S. 129-132 |
| WEGLER, R.: Chemie der Pflanzenschutz- und Schädlingsbekämpfungsmittel, Springer-Verlag, Bd. 8, 1982, S.19-25, 236-247 * |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4609396A (en) * | 1980-06-23 | 1986-09-02 | E. I. Du Pont De Nemours And Company | Quinoxalinyloxy ethers as selective weed control agents |
| EP0052798A1 (de) * | 1980-11-26 | 1982-06-02 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Oximester, Verfahren zu deren Herstellung, ihre Verwendung, sowie diese Oximester enthaltende Mittel |
| EP0058639A3 (en) * | 1981-02-16 | 1982-10-13 | Ciba-Geigy Ag | 2-(4-(6-halogen-quinoxalinyl-2-oxy)-phenoxy)-propionic-acid esters, processes for their preparation and their application as herbicides and plant growth regulators |
| US4391628A (en) | 1981-02-16 | 1983-07-05 | Ciba-Geigy Corporation | 2-[4-(6-Haloquinoxalinyl-2-oxy)phenoxy]propionic acid esters |
| EP0082699B1 (en) * | 1981-12-17 | 1985-11-13 | E.I. Du Pont De Nemours And Company | Herbicidal quinoxalinyl ethers |
| EP0305593A2 (de) | 1983-12-06 | 1989-03-08 | Ciba-Geigy Ag | Neue Zwischenprodukte für 2-Pyridinyloxyphenoxypropionsäure-cyanamide |
| EP0148119A3 (en) * | 1983-12-06 | 1986-07-02 | Ciba-Geigy Ag | Amides of 2-phenoxypropionic acid |
| US4640703A (en) * | 1983-12-06 | 1987-02-03 | Ciba-Geigy Corporation | 2-phenoxypropionic acid cyanamides as herbicides |
| EP0159290A1 (de) * | 1984-03-28 | 1985-10-23 | Ciba-Geigy Ag | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen |
| EP0385084A3 (de) * | 1989-01-27 | 1990-11-22 | BASF Aktiengesellschaft | Pflanzenschützende Mittel auf Basis von 1-Aryl- bzw. 1-Hetarylimidazolcarbonsäureestern |
| EP0387582A1 (de) * | 1989-03-11 | 1990-09-19 | BASF Aktiengesellschaft | 2,3-substituierte 1,8-Naphthyridine, Verfahren zu ihrer Herstellung und ihre Verwendung als Antidots |
| DE4042098A1 (de) * | 1990-12-28 | 1992-07-02 | Hoechst Ag | Verfahren zur herstellung optisch aktiver chinoxalinyloxyphenoxypropionsaeureester |
| US5801272A (en) * | 1993-06-01 | 1998-09-01 | Basf Aktiengesellschaft | Preparation of mixtures of (R)- and (S)-2-(4-alkanoylphenoxy)- or (R)- and (S)-2-(4-aroylphenoxy)propionic esters |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3004770A1 (de) | Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselben | |
| EP0363818B1 (de) | Oximether-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| DE68920963T2 (de) | Aralkylamin-Derivate, deren Herstellung und diese enthaltende fungizide Mittel. | |
| DE3875546T2 (de) | Herbizide fluorphenoxy-phenoxyalkancarbonsaeure und ihre derivate. | |
| DD141775A5 (de) | Herbizide mittel | |
| US5364831A (en) | Quinoxaline derivatives and herbicidal composition | |
| EP0431421A2 (de) | Hetaryl-substituierte Pyridinylpyrimidin-Derivate | |
| DE2637886C2 (https=) | ||
| EP0431424A2 (de) | Pyridinylpyrimidin-Derivate | |
| EP1527052A1 (de) | 3-heterocyclyl-substituierte benzoesäurederivate | |
| DD209718A5 (de) | Schaedlingsbekaempfungsmittel | |
| US4968343A (en) | Fluoroalkyl anilide derivatives of 2-(4-aryloxyphenoxy)alkanoic or alkenoic acids as selective herbicides | |
| EP0046468A1 (en) | Quinoxaline derivatives and herbicidal composition | |
| US4731108A (en) | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses | |
| EP0851858A1 (de) | Substituierte 2-phenylpyridine als herbizide | |
| EP1034166B1 (de) | Substituierte 2-phenyl-3(2h)-pyridazinone | |
| EP0142040A2 (de) | Substituierte Pyrimidine | |
| EP0024260B1 (de) | Neue Pyrimidin-Verbindungen, deren Herstellung, Zwischenprodukte dazu und herbizide Mittel, welche die Pyrimidinverbindungen als Wirkstoffe enthalten | |
| DE3419127A1 (de) | 1-heteroaryl-4-aryl-pyrazolin-5-one | |
| EP0557860B1 (de) | Substituierte Pyridylpyrimidine und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| US6197728B1 (en) | Quinoxaline derivatives and herbicidal composition | |
| CA1150267A (en) | Heterocyclic ether type phenoxy fatty acid derivatives and herbicidal composition | |
| US5034050A (en) | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses | |
| CH625940A5 (en) | A composition for regulating the growth of plants containing, as active ingredient, 3-pyridinol compounds | |
| DE4001557A1 (de) | Halogenalkyl-substituierte pyridinylpyrimidin-derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3051172 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3051172 |
|
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3051251 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3051251 |
|
| AH | Division in |
Ref country code: DE Ref document number: 3051172 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 3051251 Format of ref document f/p: P Ref country code: DE Ref document number: 3051172 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 3051251 Format of ref document f/p: P |