DE297442A - - Google Patents
Info
- Publication number
- DE297442A DE297442A DE297442A DE 297442 A DE297442 A DE 297442A DE 297442 A DE297442 A DE 297442A
- Authority
- DE
- Germany
- Prior art keywords
- parts
- acetylene
- acid
- mercury
- acetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 21
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 9
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 3
- 150000002731 mercury compounds Chemical class 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000243 solution Substances 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 239000012295 chemical reaction liquid Substances 0.000 description 2
- 229910000474 mercury oxide Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical class [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- 229940008718 metallic mercury Drugs 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- DAFQZPUISLXFBF-UHFFFAOYSA-N tetraoxathiolane 5,5-dioxide Chemical compound O=S1(=O)OOOO1 DAFQZPUISLXFBF-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE297442A (enExample) | ||
| DE269937C (enExample) | ||
| DE1768339C3 (de) | Verfahren zur Herstellung von Orthokieselsäuretetramethylester | |
| DE1059453B (de) | Verfahren zur Herstellung von Carbonylverbindungen aus sauerstoffhaltigen, eine odermehrere Kohlenstoff-Kohlenstoff-Doppelbindungen enthaltenden organischen Verbindungen | |
| DE1258858B (de) | Verfahren zur Herstellung von epsilon-Caprolacton und seiner Alkylderivate | |
| DE1230005B (de) | Verfahren zur Herstellung von 1, 2-Alkanepoxyden | |
| AT73500B (de) | Verfahren zur Darstellung von Essigsäure aus Acetylen. | |
| DE889440C (de) | Verfahren zur Herstellung von Cyanhydrinen | |
| DE899501C (de) | Verfahren zur Herstellung von Isopropylbenzolhydroperoxyd | |
| US1876454A (en) | humphkjey | |
| DE370972C (de) | Verfahren zur Herstellung von Oxalsaeure | |
| DE228664C (enExample) | ||
| DE937058C (de) | Verfahren zur Herstellung von niedrigmolekularen Trialkylaminoxyden und deren Hydraten | |
| DE2622692C2 (de) | Verfahren zur Nitrierung von 3-Nitrobenzotrifluorid und von 4-Halogen-3-nitrobenzotrifluorid | |
| DE2614827A1 (de) | Verfahren zur jerstellung von 3-phenylpyridazon-(6) | |
| DE604640C (de) | Verfahren zur Herstellung von Vinylestern | |
| DE214252C (enExample) | ||
| DE820299C (de) | Verfahren zur Herstellung von Glutarsaeure | |
| DE86914C (enExample) | ||
| DE834091C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE329591C (de) | Verfahren zur Darstellung von Oxalsaeure aus Kohlenhydraten durch Oxydation mit Salpetersaeure | |
| DE276185C (enExample) | ||
| DE949052C (de) | Verfahren zur Herstellung von Terephthalsaeure aus p-Xylylendichlorid | |
| DE610306C (de) | Verfahren zur Darstellung von gemischten Anhydriden zwischen Borsaeure und organischen Saeuren | |
| DE1191362B (de) | Verfahren zur Herstellung von Vinylestern |