DE2948465C2 - - Google Patents
Info
- Publication number
- DE2948465C2 DE2948465C2 DE2948465A DE2948465A DE2948465C2 DE 2948465 C2 DE2948465 C2 DE 2948465C2 DE 2948465 A DE2948465 A DE 2948465A DE 2948465 A DE2948465 A DE 2948465A DE 2948465 C2 DE2948465 C2 DE 2948465C2
- Authority
- DE
- Germany
- Prior art keywords
- emulsifier
- explosive
- water
- fuel
- mass
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003995 emulsifying agent Substances 0.000 claims description 44
- 239000000446 fuel Substances 0.000 claims description 34
- 239000007788 liquid Substances 0.000 claims description 30
- 239000002360 explosive Substances 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 13
- 230000003647 oxidation Effects 0.000 claims description 12
- 238000007254 oxidation reaction Methods 0.000 claims description 12
- 150000002430 hydrocarbons Chemical group 0.000 claims description 10
- 239000002480 mineral oil Substances 0.000 claims description 8
- 235000010446 mineral oil Nutrition 0.000 claims description 8
- 239000003921 oil Substances 0.000 claims description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000012266 salt solution Substances 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 239000011521 glass Substances 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 239000007762 w/o emulsion Substances 0.000 claims description 3
- 150000001767 cationic compounds Chemical class 0.000 claims description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims description 2
- 239000003208 petroleum Substances 0.000 claims description 2
- 239000003209 petroleum derivative Substances 0.000 claims description 2
- 239000004033 plastic Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 150000004670 unsaturated fatty acids Chemical class 0.000 claims description 2
- 235000021122 unsaturated fatty acids Nutrition 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 125000003504 2-oxazolinyl group Chemical class O1C(=NCC1)* 0.000 claims 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims 1
- 239000004744 fabric Substances 0.000 claims 1
- 238000005187 foaming Methods 0.000 claims 1
- 229910017053 inorganic salt Inorganic materials 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 230000035945 sensitivity Effects 0.000 description 10
- -1 salt ammonium nitrate Chemical class 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000005474 detonation Methods 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 125000002091 cationic group Chemical group 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 239000000084 colloidal system Substances 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000008014 freezing Effects 0.000 description 2
- 238000007710 freezing Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 150000002918 oxazolines Chemical class 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000004449 solid propellant Substances 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- 239000003784 tall oil Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- HZTVIZREFBBQMG-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O HZTVIZREFBBQMG-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 235000013580 sausages Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Colloid Chemistry (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/004,958 US4216040A (en) | 1979-01-19 | 1979-01-19 | Emulsion blasting composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2948465A1 DE2948465A1 (de) | 1980-07-31 |
| DE2948465C2 true DE2948465C2 (enExample) | 1989-03-02 |
Family
ID=21713394
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792948465 Granted DE2948465A1 (de) | 1979-01-19 | 1979-12-01 | Emulsionssprengstoffmischung |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4216040A (enExample) |
| JP (1) | JPS5938182B2 (enExample) |
| AT (1) | AT379579B (enExample) |
| BE (1) | BE881116A (enExample) |
| CA (1) | CA1103033A (enExample) |
| CH (1) | CH643523A5 (enExample) |
| DE (1) | DE2948465A1 (enExample) |
| FR (1) | FR2446804A1 (enExample) |
| GB (1) | GB2042495B (enExample) |
| IE (1) | IE49354B1 (enExample) |
| IN (1) | IN153261B (enExample) |
| IT (1) | IT1143051B (enExample) |
| NO (1) | NO150797C (enExample) |
| NZ (1) | NZ192316A (enExample) |
| PH (1) | PH16816A (enExample) |
| PL (1) | PL135024B1 (enExample) |
| SE (1) | SE458202B (enExample) |
| ZA (1) | ZA796591B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19649763A1 (de) * | 1996-11-30 | 1998-06-04 | Appenzeller Albert | Sprengstoff für zivile, insbesondere bergmännische Zwecke |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4456494A (en) * | 1980-05-29 | 1984-06-26 | Energy Sciences Partners, Ltd. | System for making an aqueous slurry-type blasting composition |
| US4343663A (en) * | 1980-06-30 | 1982-08-10 | E. I. Du Pont De Nemours And Company | Resin-bonded water-bearing explosive |
| US4394198A (en) * | 1980-08-25 | 1983-07-19 | Nippon Oil And Fats Company, Limited | Water-in-oil emulsion explosive composition |
| US4364782A (en) * | 1980-09-12 | 1982-12-21 | Ireco Chemicals | Permissible slurry explosive |
| US4371408A (en) * | 1980-10-27 | 1983-02-01 | Atlas Powder Company | Low water emulsion explosive compositions optionally containing inert salts |
| US4383873A (en) * | 1980-10-27 | 1983-05-17 | Atlas Powder Company | Sensitive low water emulsion explosive compositions |
| US4356044A (en) * | 1981-03-23 | 1982-10-26 | Ireco Chemicals | Emulsion explosives containing high concentrations of calcium nitrate |
| AR241896A1 (es) * | 1982-05-12 | 1993-01-29 | Union Explosivos Rio Tinto | Composicion y procedimiento para la obtencion de explosivos en emulsion. |
| EP0099695B1 (en) * | 1982-07-21 | 1988-01-27 | Imperial Chemical Industries Plc | Emulsion explosive composition |
| GB2131787B (en) * | 1982-10-29 | 1986-08-20 | Cil Inc | Emulsion explosive composition |
| US4491489A (en) * | 1982-11-17 | 1985-01-01 | Aeci Limited | Method and means for making an explosive in the form of an emulsion |
| US4428784A (en) | 1983-03-07 | 1984-01-31 | Ireco Chemicals | Blasting compositions containing sodium nitrate |
| CA1188898A (en) * | 1983-04-21 | 1985-06-18 | Howard A. Bampfield | Water-in-wax emulsion blasting agents |
| JPS6033283A (ja) * | 1983-08-01 | 1985-02-20 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造法 |
| JPS6033284A (ja) * | 1983-08-01 | 1985-02-20 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造方法 |
| US4525225A (en) * | 1984-03-05 | 1985-06-25 | Atlas Powder Company | Solid water-in-oil emulsion explosives compositions and processes |
| GB2156799B (en) * | 1984-03-21 | 1987-12-16 | Ici Plc | Emulsion explosive |
| US4548659A (en) * | 1984-04-05 | 1985-10-22 | Ireco Incorporated | Cast emulsion explosive composition |
| AU578460B2 (en) * | 1984-04-19 | 1988-10-27 | Ici Australia Limited | Water in oil emulsion explosives and stabilizers therefor |
| US4685375A (en) * | 1984-05-14 | 1987-08-11 | Les Explosifs Nordex Ltee/Nordex Explosives Ltd. | Mix-delivery system for explosives |
| US4523967A (en) * | 1984-08-06 | 1985-06-18 | Hercules Incorporated | Invert emulsion explosives containing a one-component oil phase |
| US4615752A (en) * | 1984-11-23 | 1986-10-07 | Ireco Incorporated | Methods of pumping and loading emulsion slurry blasting compositions |
| US4844756A (en) * | 1985-12-06 | 1989-07-04 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4844321A (en) * | 1986-08-11 | 1989-07-04 | Nippon Kayaku Kabushiki Kaisha | Method for explosive cladding |
| US5047175A (en) * | 1987-12-23 | 1991-09-10 | The Lubrizol Corporation | Salt composition and explosives using same |
| US4863534A (en) * | 1987-12-23 | 1989-09-05 | The Lubrizol Corporation | Explosive compositions using a combination of emulsifying salts |
| US4840687A (en) * | 1986-11-14 | 1989-06-20 | The Lubrizol Corporation | Explosive compositions |
| US4828633A (en) * | 1987-12-23 | 1989-05-09 | The Lubrizol Corporation | Salt compositions for explosives |
| US5527491A (en) * | 1986-11-14 | 1996-06-18 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US5129972A (en) * | 1987-12-23 | 1992-07-14 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| CA1325724C (en) * | 1988-11-07 | 1994-01-04 | C-I-L Inc. | Aromatic hydrocarbon-based emulsion explosive composition |
| CA1325723C (en) * | 1988-12-05 | 1994-01-04 | Anh D. Nguyen | Nitroalkane-based emulsion explosive composition |
| US4940497A (en) * | 1988-12-14 | 1990-07-10 | Atlas Powder Company | Emulsion explosive composition containing expanded perlite |
| US5017251A (en) * | 1989-12-26 | 1991-05-21 | Ireco Incorporated | Shock-resistant, low density emulsion explosive |
| US5920031A (en) * | 1992-03-17 | 1999-07-06 | The Lubrizol Corporation | Water-in-oil emulsions |
| US5401341A (en) * | 1993-04-14 | 1995-03-28 | The Lubrizol Corporation | Cross-linked emulsion explosive composition |
| US6022428A (en) * | 1998-02-10 | 2000-02-08 | Dyno Nobel Inc. | Gassed emulsion explosive |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3161551A (en) * | 1961-04-07 | 1964-12-15 | Commercial Solvents Corp | Ammonium nitrate-containing emulsion sensitizers for blasting agents |
| CH543463A (de) * | 1967-06-02 | 1973-10-31 | Du Pont | Verwendung von Salzen als Sensibilisatoren in wasserhaltigen Sprengstoffmischungen |
| US3674578A (en) * | 1970-02-17 | 1972-07-04 | Du Pont | Water-in-oil emulsion type blasting agent |
| US3765964A (en) * | 1972-10-06 | 1973-10-16 | Ici America Inc | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts |
| AU515896B2 (en) * | 1976-11-09 | 1981-05-07 | Atlas Powder Company | Water-in-oil explosive |
| US4104092A (en) * | 1977-07-18 | 1978-08-01 | Atlas Powder Company | Emulsion sensitized gelled explosive composition |
-
1979
- 1979-01-19 US US06/004,958 patent/US4216040A/en not_active Expired - Lifetime
- 1979-12-01 DE DE19792948465 patent/DE2948465A1/de active Granted
- 1979-12-04 IN IN1267/CAL/79A patent/IN153261B/en unknown
- 1979-12-04 ZA ZA00796591A patent/ZA796591B/xx unknown
- 1979-12-04 NZ NZ192316A patent/NZ192316A/xx unknown
- 1979-12-07 PH PH23384A patent/PH16816A/en unknown
- 1979-12-13 CA CA341,871A patent/CA1103033A/en not_active Expired
- 1979-12-13 AT AT0787579A patent/AT379579B/de not_active IP Right Cessation
- 1979-12-20 NO NO794200A patent/NO150797C/no unknown
-
1980
- 1980-01-08 GB GB8000579A patent/GB2042495B/en not_active Expired
- 1980-01-09 IE IE37/80A patent/IE49354B1/en not_active IP Right Cessation
- 1980-01-11 BE BE0/198938A patent/BE881116A/fr not_active IP Right Cessation
- 1980-01-15 PL PL1980221366A patent/PL135024B1/pl unknown
- 1980-01-15 IT IT47604/80A patent/IT1143051B/it active
- 1980-01-16 JP JP55002656A patent/JPS5938182B2/ja not_active Expired
- 1980-01-18 CH CH41280A patent/CH643523A5/de not_active IP Right Cessation
- 1980-01-18 SE SE8000441A patent/SE458202B/sv not_active IP Right Cessation
- 1980-01-18 FR FR8001081A patent/FR2446804A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19649763A1 (de) * | 1996-11-30 | 1998-06-04 | Appenzeller Albert | Sprengstoff für zivile, insbesondere bergmännische Zwecke |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2042495B (en) | 1982-12-22 |
| PL135024B1 (en) | 1985-09-30 |
| ATA787579A (de) | 1985-06-15 |
| FR2446804A1 (fr) | 1980-08-14 |
| IT8047604A0 (it) | 1980-01-15 |
| FR2446804B1 (enExample) | 1983-07-29 |
| CA1103033A (en) | 1981-06-16 |
| NZ192316A (en) | 1982-08-17 |
| ZA796591B (en) | 1981-07-29 |
| IN153261B (enExample) | 1984-06-23 |
| NO150797B (no) | 1984-09-10 |
| SE458202B (sv) | 1989-03-06 |
| PL221366A1 (enExample) | 1980-09-22 |
| AT379579B (de) | 1986-01-27 |
| CH643523A5 (de) | 1984-06-15 |
| SE8000441L (sv) | 1980-07-20 |
| PH16816A (en) | 1984-03-06 |
| US4216040A (en) | 1980-08-05 |
| NO794200L (no) | 1980-07-22 |
| IE800037L (en) | 1980-07-19 |
| IT1143051B (it) | 1986-10-22 |
| JPS5938182B2 (ja) | 1984-09-14 |
| NO150797C (no) | 1984-12-27 |
| GB2042495A (en) | 1980-09-24 |
| BE881116A (fr) | 1980-05-02 |
| DE2948465A1 (de) | 1980-07-31 |
| IE49354B1 (en) | 1985-09-18 |
| JPS55167198A (en) | 1980-12-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2948465C2 (enExample) | ||
| DE2731609C2 (de) | Wasser-in-Öl-Emulsionssprengstoffmischung | |
| DE69011161T2 (de) | Polymerische Emulgiermittel enthaltende Emulsionssprengstoffe. | |
| DE3141980C2 (enExample) | ||
| DE3141979C2 (enExample) | ||
| DE2735357A1 (de) | Waessrige sprengstoffmischung | |
| CH630325A5 (de) | Verfahren zur herstellung von sprengstoffen vom emulsionstyp. | |
| DE3210273C2 (enExample) | ||
| DE2947982B2 (de) | Wasser-in-Öl-Sprengmittelemulsionen | |
| EP0028908B1 (en) | Emulsion explosive composition | |
| CH661266A5 (de) | Sprengstoff in form einer w/o-emulsion. | |
| DE2141213A1 (de) | Emulsionssprengstoff | |
| DE3840735A1 (de) | Verfahren zur herstellung eines sprengstoffs | |
| DE69220157T2 (de) | Emulsionssprengstoff | |
| DE4001917A1 (de) | Sprengstoffzusammensetzung | |
| DE3880984T2 (de) | Emulgator enthaltender emmulsionssprengstoff. | |
| DE3313246A1 (de) | Emulsionssprengstoff und verfahren zu dessen herstellung | |
| DE3786115T2 (de) | Gegossene sprengstoffzusammensetzung und verfahren. | |
| DE1644942A1 (de) | Stabile,thixotrope Emulsion und Verfahren zur Herstellung derselben | |
| DE2601162C2 (de) | Sprengstoffmischung | |
| DE3700783A1 (de) | Wasser-in-oel-emulsionssprengstoff | |
| DE69827498T2 (de) | Rheologieänderung und rheologiemodifiziermittel | |
| DE3134639C2 (enExample) | ||
| DE69005735T2 (de) | Emulsionssprengstoff vom Wasser-in-Öl-Typ. | |
| DE2219249A1 (de) | Explosivmischungen mit einem Gehalt an Calciumnitrat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: IRECO INC., SALT LAKE CITY, UTAH, US |
|
| 8128 | New person/name/address of the agent |
Representative=s name: DICKEL, K., DIPL.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |