DE2924228C2 - - Google Patents
Info
- Publication number
- DE2924228C2 DE2924228C2 DE19792924228 DE2924228A DE2924228C2 DE 2924228 C2 DE2924228 C2 DE 2924228C2 DE 19792924228 DE19792924228 DE 19792924228 DE 2924228 A DE2924228 A DE 2924228A DE 2924228 C2 DE2924228 C2 DE 2924228C2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- parts
- solution
- dye
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 22
- 230000008878 coupling Effects 0.000 claims description 17
- 238000010168 coupling process Methods 0.000 claims description 17
- 238000005859 coupling reaction Methods 0.000 claims description 17
- 239000000985 reactive dye Substances 0.000 claims description 16
- -1 amino compound Chemical class 0.000 claims description 13
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 13
- 238000004043 dyeing Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 229920003043 Cellulose fiber Polymers 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- 239000000975 dye Substances 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229920000742 Cotton Polymers 0.000 description 10
- 230000007935 neutral effect Effects 0.000 description 9
- 239000007859 condensation product Substances 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 7
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 6
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 6
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 235000002639 sodium chloride Nutrition 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 3
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 3
- 239000003929 acidic solution Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 2
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- MKARNSWMMBGSHX-UHFFFAOYSA-N 3,5-dimethylaniline Chemical compound CC1=CC(C)=CC(N)=C1 MKARNSWMMBGSHX-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- XPVPPZLJRZSNTD-UHFFFAOYSA-N 5-fluorotriazine Chemical compound FC1=CN=NN=C1 XPVPPZLJRZSNTD-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001366278 Leptotes marina Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 2
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- YMJXNYUOEJPKHH-UHFFFAOYSA-N 2-amino-4-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1S(O)(=O)=O YMJXNYUOEJPKHH-UHFFFAOYSA-N 0.000 description 1
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- RKDUVPVDHFMLPC-UHFFFAOYSA-N 4,6-difluorotriazine Chemical compound FC1=CC(F)=NN=N1 RKDUVPVDHFMLPC-UHFFFAOYSA-N 0.000 description 1
- KRLKXOLFFQWKPZ-UHFFFAOYSA-N 4-(bromomethyl)pyridine Chemical compound BrCC1=CC=NC=C1 KRLKXOLFFQWKPZ-UHFFFAOYSA-N 0.000 description 1
- FOINSAWEWXUXPQ-UHFFFAOYSA-N 4-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(S(O)(=O)=O)C(N)=C1 FOINSAWEWXUXPQ-UHFFFAOYSA-N 0.000 description 1
- IMUUNYPYNWXUBO-UHFFFAOYSA-N 4-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1S(O)(=O)=O IMUUNYPYNWXUBO-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- GBWNQBBVSVGAAL-UHFFFAOYSA-N 5-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 GBWNQBBVSVGAAL-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/08—Azo dyes
- C09B62/09—Disazo or polyazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH664678A CH638555A5 (de) | 1978-06-19 | 1978-06-19 | Reaktivfarbstoffe und deren herstellung. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2924228A1 DE2924228A1 (de) | 1979-12-20 |
| DE2924228C2 true DE2924228C2 (enExample) | 1990-02-15 |
Family
ID=4312825
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792924228 Granted DE2924228A1 (de) | 1978-06-19 | 1979-06-15 | Reaktivfarbstoffe, deren herstellung und verwendung |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS55799A (enExample) |
| BE (1) | BE877051A (enExample) |
| BR (1) | BR7903817A (enExample) |
| CA (1) | CA1117938A (enExample) |
| CH (1) | CH638555A5 (enExample) |
| CS (1) | CS209926B2 (enExample) |
| DE (1) | DE2924228A1 (enExample) |
| ES (1) | ES481659A1 (enExample) |
| FR (1) | FR2429244A1 (enExample) |
| GB (1) | GB2029850B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3010161A1 (de) * | 1980-03-17 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Farbstoffe, verfahren zu ihrer herstellung sowie ihre verwendung zum faerben hydroxylgruppen- oder stickstoffhaltiger materialien |
| DE3019960A1 (de) * | 1980-05-24 | 1981-12-03 | Hoechst Ag, 6000 Frankfurt | Verfahren zum faerben und bedrucken von hydroxy- und/oder carbonamidgruppen enthaltenden fasermaterialien |
| DE3151959A1 (de) * | 1981-12-30 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | Bisazoreaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken von hydroxylgruppen- oder stickstoffhaltigem fasermaterial |
| DE3317383A1 (de) * | 1983-05-13 | 1984-11-15 | Bayer Ag, 5090 Leverkusen | Disazoreaktivfarbstoffe |
| DE3513261A1 (de) * | 1985-04-13 | 1986-10-23 | Bayer Ag, 5090 Leverkusen | Disazoreaktivfarbstoffe |
| DE3542025A1 (de) * | 1985-11-28 | 1987-06-11 | Hoechst Ag | Mischungen wasserloeslicher faserreaktiver farbstoffe und ihre verwendung zum faerben |
| GB8530024D0 (en) * | 1985-12-05 | 1986-01-15 | Ici Plc | Reactive dyes |
| JPS63112781A (ja) * | 1986-10-27 | 1988-05-17 | 三菱化学株式会社 | セルロ−ス含有繊維類の染色法 |
| WO1989000184A1 (fr) * | 1987-06-30 | 1989-01-12 | Mitsubishi Chemical Industries Limited | Melange de teintures reactives soluble dans l'eau et procede permettant la teinture de fibres cellulosiques utilisant ledit melange |
| CN101817996B (zh) * | 2009-11-16 | 2013-05-08 | 天津德凯化工股份有限公司 | 一种用于尼龙染色的活性藏青染料 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH429986A (de) * | 1959-06-23 | 1967-02-15 | Ciba Geigy | Verfahren zur Herstellung organischer Farbstoffe |
| CH400416A (de) * | 1960-09-01 | 1965-10-15 | Ciba Geigy | Verfahren zur Herstellung organischer Farbstoffe |
| CH449818A (de) * | 1961-05-23 | 1968-01-15 | Ciba Geigy | Verfahren zur Herstellung neuer Disazofarbstoffe |
| GB961078A (en) * | 1961-05-23 | 1964-06-17 | Ciba Ltd | New disazo-dyestuffs and their manufacture and use |
| DE1644208C3 (de) * | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| CH527258A (de) * | 1968-11-04 | 1972-08-31 | Ciba Geigy Ag | Verfahren zur Herstellung von Disazoverbindungen |
| CH626650A5 (enExample) * | 1974-12-18 | 1981-11-30 | Ciba Geigy Ag | |
| GB1515030A (en) * | 1976-02-11 | 1978-06-21 | Ici Ltd | Fibre reactive disazo dyestuffs |
-
1978
- 1978-06-19 CH CH664678A patent/CH638555A5/de not_active IP Right Cessation
-
1979
- 1979-06-15 GB GB7920997A patent/GB2029850B/en not_active Expired
- 1979-06-15 CA CA000329891A patent/CA1117938A/en not_active Expired
- 1979-06-15 DE DE19792924228 patent/DE2924228A1/de active Granted
- 1979-06-15 CS CS414279A patent/CS209926B2/cs unknown
- 1979-06-18 BR BR7903817A patent/BR7903817A/pt unknown
- 1979-06-18 BE BE0/195798A patent/BE877051A/xx not_active IP Right Cessation
- 1979-06-18 FR FR7915605A patent/FR2429244A1/fr active Granted
- 1979-06-18 ES ES481659A patent/ES481659A1/es not_active Expired
- 1979-06-19 JP JP7641479A patent/JPS55799A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2029850A (en) | 1980-03-26 |
| CA1117938A (en) | 1982-02-09 |
| JPS6261622B2 (enExample) | 1987-12-22 |
| ES481659A1 (es) | 1980-06-16 |
| FR2429244B1 (enExample) | 1983-10-21 |
| CH638555A5 (de) | 1983-09-30 |
| CS209926B2 (en) | 1981-12-31 |
| FR2429244A1 (fr) | 1980-01-18 |
| JPS55799A (en) | 1980-01-07 |
| BE877051A (fr) | 1979-12-18 |
| GB2029850B (en) | 1982-12-01 |
| DE2924228A1 (de) | 1979-12-20 |
| BR7903817A (pt) | 1980-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH628670A5 (de) | Verfahren zur herstellung von reaktivfarbstoffen. | |
| DE2500062C2 (de) | Faserreaktive Tetrazofarbstoffe und ihre Verwendung | |
| DE2924228C2 (enExample) | ||
| DE2905654C2 (enExample) | ||
| CH629239A5 (en) | Process for the preparation of fibre-reactive disazo dyes | |
| EP0041922B1 (de) | Verfahren zur Herstellung von aminosubstituierten 1-Amino-8-hydroxynaphthalin-sulfonsäuren | |
| DE2601043A1 (de) | Tetrareaktive disazofarbstoffe, deren herstellung und verwendung | |
| EP0428482B1 (de) | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0073178B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE2847173C2 (enExample) | ||
| DE3879476T2 (de) | Faserreaktiv-azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von hydroxy und/oder carboxamidgruppen enthaltendem fasermaterial. | |
| EP0170612B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| AT390441B (de) | Verfahren zur herstellung von reaktiven disazoverbindungen und ihre verwendung | |
| DE2729240A1 (de) | Azo-reaktivfarbstoffe | |
| EP0189081B1 (de) | Azo-Reaktivfarbstoffe | |
| DE2839209C2 (de) | Azofarbstoffe, deren Herstellung und Verwendung | |
| EP0083052B1 (de) | Bisazoreaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von hydroxylgruppen- oder stickstoffhaltigem Fasermaterial | |
| CH628919A5 (de) | Verfahren zur herstellung von azofarbstoffen. | |
| EP0134197B1 (de) | Reaktivfarbstoffe der Disazoreihe, deren Herstellung und Verwendung | |
| DE3325788A1 (de) | Faserreaktive disazofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben oder bedrucken von stubstraten | |
| EP0105027B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0122881B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| CH635858A5 (de) | Faserreaktive azofarbstoffe, sowie deren herstellung. | |
| DE3009788A1 (de) | Wasserloesliche nickelphtalocyaninazofarbstoffe | |
| DE1419795C3 (de) | Verfahren zur Herstellung von Disazoreaktivfarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: CIBA SPECIALTY CHEMICALS HOLDING INC., BASEL, CH |
|
| 8339 | Ceased/non-payment of the annual fee |