DE2855845C2 - - Google Patents
Info
- Publication number
- DE2855845C2 DE2855845C2 DE2855845A DE2855845A DE2855845C2 DE 2855845 C2 DE2855845 C2 DE 2855845C2 DE 2855845 A DE2855845 A DE 2855845A DE 2855845 A DE2855845 A DE 2855845A DE 2855845 C2 DE2855845 C2 DE 2855845C2
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen chloride
- isobutyronitrile
- reaction
- methanol
- hydrochloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 36
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 36
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 36
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 19
- -1 iminoisobutyric acid methyl ester hydrochloride Chemical compound 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 11
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- AJPIUNPJBFBUKK-UHFFFAOYSA-N 2-isopropyl-6-methylpyrimidin-4-ol Chemical compound CC(C)C1=NC(C)=CC(O)=N1 AJPIUNPJBFBUKK-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000003580 thiophosphoric acid esters Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- GRANJKXKUKPLSM-UHFFFAOYSA-N methyl 3-imino-2-methylpropanoate Chemical compound COC(=O)C(C)C=N GRANJKXKUKPLSM-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- GDYWRHDWSRJUOT-UHFFFAOYSA-N 3-imino-2-methylpropanoic acid Chemical compound N=CC(C)C(O)=O GDYWRHDWSRJUOT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/04—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines without replacement of the other oxygen atom of the carboxyl group, e.g. imino-ethers
- C07C257/06—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines without replacement of the other oxygen atom of the carboxyl group, e.g. imino-ethers having carbon atoms of imino-carboxyl groups bound to hydrogen atoms, to acyclic carbon atoms, or to carbon atoms of rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/865,099 US4111976A (en) | 1977-12-27 | 1977-12-27 | Process for the preparation of methyliminoisobutyrate hydrochloride |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2855845A1 DE2855845A1 (de) | 1979-06-28 |
| DE2855845C2 true DE2855845C2 (enExample) | 1988-09-15 |
Family
ID=25344715
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782855845 Granted DE2855845A1 (de) | 1977-12-27 | 1978-12-22 | Verfahren zur herstellung von iminoisobuttersaeuremethylesterhydrochlorid |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4111976A (enExample) |
| JP (1) | JPS5498712A (enExample) |
| CH (1) | CH637921A5 (enExample) |
| DE (1) | DE2855845A1 (enExample) |
| FR (1) | FR2413364A1 (enExample) |
| GB (1) | GB2011394B (enExample) |
| IL (1) | IL56295A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6084254A (ja) * | 1983-10-13 | 1985-05-13 | Takeda Chem Ind Ltd | アミジン塩酸塩の製造法 |
| US4942245A (en) * | 1987-04-20 | 1990-07-17 | Kyorin Pharmaceutical Co., Ltd. | Benzimidazole Derivatives |
| JP4861835B2 (ja) * | 2005-01-18 | 2012-01-25 | 日宝化学株式会社 | イミドエーテル化合物の製造方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2553564A (en) * | 1948-04-16 | 1951-05-22 | Martin L Fein | Esters of hydracrylic acid and imino ethers |
-
1977
- 1977-12-27 US US05/865,099 patent/US4111976A/en not_active Expired - Lifetime
-
1978
- 1978-12-19 GB GB7849026A patent/GB2011394B/en not_active Expired
- 1978-12-21 CH CH1301878A patent/CH637921A5/de not_active IP Right Cessation
- 1978-12-22 DE DE19782855845 patent/DE2855845A1/de active Granted
- 1978-12-25 IL IL56295A patent/IL56295A/xx unknown
- 1978-12-26 FR FR7836307A patent/FR2413364A1/fr active Granted
- 1978-12-27 JP JP16458178A patent/JPS5498712A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2011394A (en) | 1979-07-11 |
| JPS6154019B2 (enExample) | 1986-11-20 |
| CH637921A5 (de) | 1983-08-31 |
| IL56295A0 (en) | 1979-03-12 |
| IL56295A (en) | 1983-02-23 |
| FR2413364A1 (fr) | 1979-07-27 |
| GB2011394B (en) | 1982-05-26 |
| FR2413364B1 (enExample) | 1983-08-05 |
| JPS5498712A (en) | 1979-08-03 |
| DE2855845A1 (de) | 1979-06-28 |
| US4111976A (en) | 1978-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69104312T2 (de) | Verfahren zur Herstellung von Hydroxyamiden. | |
| DE2212604C3 (de) | Verfahren zur Herstellung von 2-Halogenäthylphosphonsauren | |
| DE2855845C2 (enExample) | ||
| CH619447A5 (enExample) | ||
| DE2007864C3 (de) | Verfahren zur Herstellung von S-2-Alkyl-thioäthylestern von Thiophosphorsäuren, neue S-2-Alkyl-thioäthylester von Thiophosphorsäuren und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| EP1019356B1 (de) | Verfahren zur herstellung von 3-hydroxy-2-methylbenzoesäure | |
| DE2521293C3 (de) | Verfahren zur Herstellung von Diphenylamin | |
| DE2345360A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure und deren alkylestern | |
| DE3812208A1 (de) | Verfahren zur herstellung von 4-guanidinomethyl-cyclohexancarbonsaeure | |
| EP0542086B1 (de) | Verfahren zur Herstellung von N-[(2-Chlor-pyridin-5-yl)methyl]-ethylendiamin | |
| DE2627779A1 (de) | Cyclopropinderivate | |
| DE749643C (de) | Verfahren zur Herstellung ungesaettigter Carbonsaeureamide | |
| EP0144669B1 (de) | Verfahren zur Herstellung von praktisch isomerenfreiem 4-Amino-3-ethylthio-6-tert.-butyl-1,2,4-triazin-5-on | |
| DE946710C (de) | Verfahren zur Herstellung von N-disubstituierten Sulfamidsaeurechloriden | |
| DE2926828A1 (de) | Verfahren zur herstellung von n,n'- disubstituierten 2-naphthalinaethanimidamiden und ihren salzen und 2-nphthylimidoessigsaeureestersalze | |
| AT249048B (de) | Verfahren zur Herstellung von neuen Benzimidazolonderivaten | |
| CH624668A5 (enExample) | ||
| DE1142859B (de) | Verfahren zur Herstellung von Acetessigsaeureamiden | |
| AT237632B (de) | Verfahren zur Herstellung des N-Monomethylamids der O, O-Dimethyldithiophosphorylessigsäure | |
| AT201612B (de) | Verfahren zur Herstellung von neuen Phosphor- und Thiophosphorsäureestern | |
| DE2646884C3 (de) | Verfahren zur Herstellung von Schwefelsäurediamiden | |
| DE2221109A1 (de) | Verfahren zur Herstellung von alpha-anilincarbonsaeureestern und -nitrilen | |
| DE3718803A1 (de) | Verfahren zur herstellung von e-2-propyl-2-pentensaeure und physiologisch vertraeglichen salzen derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ASSMANN, E., DIPL.-CHEM. DR.RER.NAT. ZUMSTEIN, F., |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |