DE2748536C2 - - Google Patents
Info
- Publication number
- DE2748536C2 DE2748536C2 DE2748536A DE2748536A DE2748536C2 DE 2748536 C2 DE2748536 C2 DE 2748536C2 DE 2748536 A DE2748536 A DE 2748536A DE 2748536 A DE2748536 A DE 2748536A DE 2748536 C2 DE2748536 C2 DE 2748536C2
- Authority
- DE
- Germany
- Prior art keywords
- parallel
- charge transfer
- charge
- register
- serial
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000015654 memory Effects 0.000 claims description 67
- 239000007943 implant Substances 0.000 claims description 10
- 230000005540 biological transmission Effects 0.000 claims description 9
- 230000001788 irregular Effects 0.000 claims 1
- 238000010586 diagram Methods 0.000 description 7
- 230000008929 regeneration Effects 0.000 description 7
- 238000011069 regeneration method Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 6
- 239000004065 semiconductor Substances 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 238000009792 diffusion process Methods 0.000 description 4
- 238000010276 construction Methods 0.000 description 3
- 238000002513 implantation Methods 0.000 description 3
- 108010076504 Protein Sorting Signals Proteins 0.000 description 1
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 1
- 238000010351 charge transfer process Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 229920002120 photoresistant polymer Polymers 0.000 description 1
- 238000012876 topography Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/28—Digital stores in which the information is moved stepwise, e.g. shift registers using semiconductor elements
- G11C19/287—Organisation of a multiplicity of shift registers
Landscapes
- Solid State Image Pick-Up Elements (AREA)
- Networks Using Active Elements (AREA)
- Complex Calculations (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/736,904 US4103347A (en) | 1976-10-29 | 1976-10-29 | Zig-zag sps ccd memory |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2748536A1 DE2748536A1 (de) | 1978-05-03 |
| DE2748536C2 true DE2748536C2 (enExample) | 1988-08-04 |
Family
ID=24961802
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772748536 Granted DE2748536A1 (de) | 1976-10-29 | 1977-10-28 | Speicher aus ladungsgekoppelten schaltungselementen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4103347A (enExample) |
| JP (1) | JPS5356945A (enExample) |
| DE (1) | DE2748536A1 (enExample) |
| FR (1) | FR2369654A1 (enExample) |
| GB (1) | GB1590087A (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS546779A (en) * | 1977-06-17 | 1979-01-19 | Fujitsu Ltd | Composition charge transfer device |
| US4365261A (en) * | 1977-08-26 | 1982-12-21 | Texas Instruments Incorporated | Co-planar barrier-type charge coupled device with enhanced storage capacity and decreased leakage current |
| US4379306A (en) * | 1977-08-26 | 1983-04-05 | Texas Instruments Incorporated | Non-coplanar barrier-type charge coupled device with enhanced storage capacity and reduced leakage current |
| US4364076A (en) * | 1977-08-26 | 1982-12-14 | Texas Instruments Incorporated | Co-planar well-type charge coupled device with enhanced storage capacity and reduced leakage current |
| US4211936A (en) * | 1978-06-16 | 1980-07-08 | Rca Corporation | CCD Gate electrode structures and systems employing the same |
| DE2842285C2 (de) * | 1978-09-28 | 1980-09-18 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Ladungsverschiebespeicher in Seriell-Parallel-Seriell-Organisation |
| DE2842856C3 (de) * | 1978-10-02 | 1981-09-03 | Siemens AG, 1000 Berlin und 8000 München | Ladungsverschiebespeicher in Seriell-Parallel-Seriell-Organisation mit vollständigem Grundladungsbetrieb |
| US4236830A (en) * | 1978-12-29 | 1980-12-02 | International Business Machines Corporation | CCD Parallel-serial and serial-parallel charge transfer method and apparatus |
| US4371885A (en) * | 1979-10-10 | 1983-02-01 | Hughes Aircraft Company | Charge coupled device improved meander channel serial register |
| US4319342A (en) * | 1979-12-26 | 1982-03-09 | International Business Machines Corporation | One device field effect transistor (FET) AC stable random access memory (RAM) array |
| USRE32236E (en) * | 1979-12-26 | 1986-08-26 | International Business Machines Corporation | One device field effect transistor (FET) AC stable random access memory (RAM) array |
| JPS5726466A (en) * | 1980-07-23 | 1982-02-12 | Sony Corp | Charge transfer element |
| US4380056A (en) * | 1980-10-10 | 1983-04-12 | Hughes Aircraft Company | Charge coupled device focal plane with serial register having interdigitated electrodes |
| JPS5768070A (en) * | 1980-10-16 | 1982-04-26 | Sony Corp | Charge transfer device |
| US4446473A (en) * | 1981-04-30 | 1984-05-01 | Fairchild Camera & Instrument Corporation | Serpentine charge transfer device |
| JPS58184760A (ja) * | 1982-04-22 | 1983-10-28 | Sony Corp | 電荷転送素子 |
| NL8701392A (nl) * | 1987-06-16 | 1989-01-16 | Philips Nv | In verschillende modes schakelbare geheugeninrichting. |
| US4862235A (en) * | 1988-06-30 | 1989-08-29 | Tektronix, Inc. | Electrode structure for a corner turn in a series-parallel-series charge coupled device |
| JPH03114236A (ja) * | 1989-09-28 | 1991-05-15 | Sony Corp | 電荷転送装置 |
| FR2657739B1 (fr) * | 1990-01-26 | 1992-05-07 | Sgc Thomson Microelectronics Sa | Serialiseur/deserialiseur. |
| JPH0682168A (ja) * | 1991-03-01 | 1994-03-22 | Nippon Mozaiku Tile Kk | タイルの施釉方法および施釉用匣鉢 |
| US5892542A (en) * | 1994-06-09 | 1999-04-06 | Intel Corporation | Sectional raster output image sensor |
| JP5487178B2 (ja) | 2011-09-22 | 2014-05-07 | 株式会社東芝 | メモリ用シフトレジスタ |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3700932A (en) * | 1970-02-16 | 1972-10-24 | Bell Telephone Labor Inc | Charge coupled devices |
| US3789240A (en) * | 1970-10-26 | 1974-01-29 | Rca Corp | Bucket brigade scanning of sensor array |
| US3763480A (en) * | 1971-10-12 | 1973-10-02 | Rca Corp | Digital and analog data handling devices |
| JPS551709B2 (enExample) * | 1974-07-19 | 1980-01-16 | ||
| JPS5154781A (ja) * | 1974-10-28 | 1976-05-14 | Fujitsu Ltd | Denkatensosochi |
| US3967254A (en) * | 1974-11-18 | 1976-06-29 | Rca Corporation | Charge transfer memory |
| US3953837A (en) * | 1974-11-27 | 1976-04-27 | Texas Instruments Incorporated | Dual serial-parallel-serial analog memory |
| US4024509A (en) * | 1975-06-30 | 1977-05-17 | Honeywell Information Systems, Inc. | CCD register array addressing system including apparatus for by-passing selected arrays |
-
1976
- 1976-10-29 US US05/736,904 patent/US4103347A/en not_active Expired - Lifetime
-
1977
- 1977-10-06 GB GB41619/77A patent/GB1590087A/en not_active Expired
- 1977-10-28 DE DE19772748536 patent/DE2748536A1/de active Granted
- 1977-10-28 FR FR7732742A patent/FR2369654A1/fr active Pending
- 1977-10-28 JP JP12955177A patent/JPS5356945A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1590087A (en) | 1981-05-28 |
| JPS6236399B2 (enExample) | 1987-08-06 |
| JPS5356945A (en) | 1978-05-23 |
| FR2369654A1 (fr) | 1978-05-26 |
| DE2748536A1 (de) | 1978-05-03 |
| US4103347A (en) | 1978-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2748536C2 (enExample) | ||
| DE2557359C2 (de) | Gegen Datenverlust bei Netzausfall gesichertes dynamisches Speichersystem | |
| EP0025130B1 (de) | Hochintegrierter Festwertspeicher | |
| DE3427285C2 (enExample) | ||
| DE2203423A1 (de) | Speicheranordnung | |
| DE3802363A1 (de) | Halbleiterspeicher | |
| DE2235801B2 (de) | Monolithischer Festwertspeicher und Verfahren zur Herstellung | |
| DE3736387A1 (de) | Nicht-fluechtige halbleiterspeichervorrichtung | |
| DE4112070A1 (de) | Elektrisch loeschbarer programmierbarer festwertspeicher mit steuereinheit zur verringerung der elektrischen feldstaerke | |
| DE2311994C3 (de) | Latenzbildspeicher | |
| DE10015193A1 (de) | Hochintegrierte System-on-Chip-Systeme mit nichtflüchtigen Speichereinheiten | |
| DE2751592A1 (de) | Dynamische speichereinrichtung | |
| DE2526722A1 (de) | Stapel-speicher-organisation mit ladungskopplung | |
| DE2162140A1 (de) | Dreidimensionale ladungsgekoppelte Baueinheit | |
| DE2325922C2 (de) | Aus Schieberegistern aufgebaute Speicheranordnung mit dynamischer Umordnung | |
| DE2629263A1 (de) | Ccd-schieberegister | |
| DE2629329A1 (de) | Ccd-schieberegister | |
| DE2532594B2 (de) | Halbleiterspeicher | |
| DE2142721A1 (de) | Integrierte bistabile Speicherzelle | |
| DE2543023C3 (de) | Speicheranordnung mit Bausteinen aus Ladungsverschiebespeichern | |
| DE2424858A1 (de) | Integrierte treiberschaltung | |
| DE2146905B2 (de) | Datenspeicher, insbesondere monolithisch integrierter Halbleiter-Datenspeicher | |
| DE69032419T2 (de) | Halbleiterspeicher mit metallischer Verbindungsschicht vom selben Potential wie Wortleitung und verbunden mit dieser ausserhalb des Speichergebietes | |
| DE2711542A1 (de) | Kapazitiver halbleiterspeicher | |
| DE2705992A1 (de) | Halbleiterspeicher |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |