DE2747358C2 - Verfahren zur Nachbehandlung von Reaktivfärbungen - Google Patents
Verfahren zur Nachbehandlung von ReaktivfärbungenInfo
- Publication number
- DE2747358C2 DE2747358C2 DE19772747358 DE2747358A DE2747358C2 DE 2747358 C2 DE2747358 C2 DE 2747358C2 DE 19772747358 DE19772747358 DE 19772747358 DE 2747358 A DE2747358 A DE 2747358A DE 2747358 C2 DE2747358 C2 DE 2747358C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- minutes
- bath
- bis
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 26
- 230000008569 process Effects 0.000 title claims description 19
- 238000004045 reactive dyeing Methods 0.000 title description 7
- 229920000768 polyamine Polymers 0.000 claims description 21
- 238000004043 dyeing Methods 0.000 claims description 15
- 239000004952 Polyamide Substances 0.000 claims description 14
- 229920002647 polyamide Polymers 0.000 claims description 14
- 125000001302 tertiary amino group Chemical group 0.000 claims description 11
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 10
- 239000000985 reactive dye Substances 0.000 claims description 9
- 229920002396 Polyurea Polymers 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 229920002635 polyurethane Polymers 0.000 claims description 5
- 239000004814 polyurethane Substances 0.000 claims description 5
- 239000002657 fibrous material Substances 0.000 claims description 4
- 229920000642 polymer Polymers 0.000 claims description 2
- 239000000975 dye Substances 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 150000001412 amines Chemical class 0.000 description 14
- 239000000835 fiber Substances 0.000 description 14
- 238000009835 boiling Methods 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- -1 ethyl bis (3-aminopropyl) amine Chemical compound 0.000 description 10
- 125000003277 amino group Chemical group 0.000 description 8
- 239000004744 fabric Substances 0.000 description 8
- 229920000742 Cotton Polymers 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- KRPRVQWGKLEFKN-UHFFFAOYSA-N 3-(3-aminopropoxy)propan-1-amine Chemical compound NCCCOCCCN KRPRVQWGKLEFKN-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 229920003043 Cellulose fiber Polymers 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
- 238000010409 ironing Methods 0.000 description 4
- KMBPCQSCMCEPMU-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-methylpropane-1,3-diamine Chemical compound NCCCN(C)CCCN KMBPCQSCMCEPMU-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 238000010640 amide synthesis reaction Methods 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000002964 rayon Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-N sodium;hydron;carbonate Chemical compound [Na+].OC(O)=O UIIMBOGNXHQVGW-UHFFFAOYSA-N 0.000 description 3
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920002873 Polyethylenimine Polymers 0.000 description 2
- 241001584775 Tunga penetrans Species 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 2
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical class N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- JEQDSBVHLKBEIZ-REOHCLBHSA-N (2s)-2-chloropropanoyl chloride Chemical compound C[C@H](Cl)C(Cl)=O JEQDSBVHLKBEIZ-REOHCLBHSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- OVISMSJCKCDOPU-UHFFFAOYSA-N 1,6-dichlorohexane Chemical compound ClCCCCCCCl OVISMSJCKCDOPU-UHFFFAOYSA-N 0.000 description 1
- XAZDZMUGHYYPQM-UHFFFAOYSA-N 1-chloro-3-(3-chloro-2-hydroxypropoxy)propan-2-ol Chemical compound ClCC(O)COCC(O)CCl XAZDZMUGHYYPQM-UHFFFAOYSA-N 0.000 description 1
- QVWCHVAUHZEAAT-UHFFFAOYSA-N 2-fluoro-1,3-benzothiazole Chemical compound C1=CC=C2SC(F)=NC2=C1 QVWCHVAUHZEAAT-UHFFFAOYSA-N 0.000 description 1
- YZOXPLQWARQVEJ-UHFFFAOYSA-N 2-methylsulfonyl-1,3-benzothiazole Chemical compound C1=CC=C2SC(S(=O)(=O)C)=NC2=C1 YZOXPLQWARQVEJ-UHFFFAOYSA-N 0.000 description 1
- OIGXNHYFKZCTCH-UHFFFAOYSA-N 2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=CC=N1 OIGXNHYFKZCTCH-UHFFFAOYSA-N 0.000 description 1
- QPIOXOJERGNNMX-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propan-1-amine Chemical compound NCCCSCCCN QPIOXOJERGNNMX-UHFFFAOYSA-N 0.000 description 1
- FRXLFVNGTPQFEJ-UHFFFAOYSA-N 3-bromopropanoyl bromide Chemical compound BrCCC(Br)=O FRXLFVNGTPQFEJ-UHFFFAOYSA-N 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical group ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 description 1
- SZINXEOBIAOWBV-UHFFFAOYSA-N 4-methylsulfonyltriazine Chemical compound CS(=O)(=O)C1=CC=NN=N1 SZINXEOBIAOWBV-UHFFFAOYSA-N 0.000 description 1
- ALEBYBVYXQTORU-UHFFFAOYSA-N 6-hydrazinyl-6-oxohexanoic acid Chemical compound NNC(=O)CCCCC(O)=O ALEBYBVYXQTORU-UHFFFAOYSA-N 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- ZFIVKAOQEXOYFY-UHFFFAOYSA-N Diepoxybutane Chemical compound C1OC1C1OC1 ZFIVKAOQEXOYFY-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 239000000982 direct dye Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000007730 finishing process Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 150000005694 halopyrimidines Chemical class 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009981 jet dyeing Methods 0.000 description 1
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QMXSDTGNCZVWTB-UHFFFAOYSA-N n',n'-bis(3-aminopropyl)propane-1,3-diamine Chemical compound NCCCN(CCCN)CCCN QMXSDTGNCZVWTB-UHFFFAOYSA-N 0.000 description 1
- HUWUUMUEMQWJKZ-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-benzylpropane-1,3-diamine Chemical compound NCCCN(CCCN)CC1=CC=CC=C1 HUWUUMUEMQWJKZ-UHFFFAOYSA-N 0.000 description 1
- CMDGBXZMCXCQFG-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-butylpropane-1,3-diamine Chemical compound CCCCN(CCCN)CCCN CMDGBXZMCXCQFG-UHFFFAOYSA-N 0.000 description 1
- LSHROXHEILXKHM-UHFFFAOYSA-N n'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine Chemical compound NCCNCCNCCNCCNCCN LSHROXHEILXKHM-UHFFFAOYSA-N 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000962 poly(amidoamine) Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000000979 synthetic dye Substances 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 239000010981 turquoise Substances 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- 238000009970 yarn dyeing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P5/00—Other features in dyeing or printing textiles, or dyeing leather, furs, or solid macromolecular substances in any form
- D06P5/02—After-treatment
- D06P5/04—After-treatment with organic compounds
- D06P5/08—After-treatment with organic compounds macromolecular
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P3/00—Special processes of dyeing or printing textiles, or dyeing leather, furs, or solid macromolecular substances in any form, classified according to the material treated
- D06P3/58—Material containing hydroxyl groups
- D06P3/60—Natural or regenerated cellulose
- D06P3/66—Natural or regenerated cellulose using reactive dyes
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772747358 DE2747358C2 (de) | 1977-10-21 | 1977-10-21 | Verfahren zur Nachbehandlung von Reaktivfärbungen |
| GB7840934A GB2006279B (en) | 1977-10-21 | 1978-10-18 | Process for the after-treatment of reactive dyeings |
| JP12794178A JPS5468475A (en) | 1977-10-21 | 1978-10-19 | Postttreating of reactive dyestuff |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772747358 DE2747358C2 (de) | 1977-10-21 | 1977-10-21 | Verfahren zur Nachbehandlung von Reaktivfärbungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2747358A1 DE2747358A1 (de) | 1979-04-26 |
| DE2747358C2 true DE2747358C2 (de) | 1986-12-04 |
Family
ID=6021986
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772747358 Expired DE2747358C2 (de) | 1977-10-21 | 1977-10-21 | Verfahren zur Nachbehandlung von Reaktivfärbungen |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5468475A (show.php) |
| DE (1) | DE2747358C2 (show.php) |
| GB (1) | GB2006279B (show.php) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2070006B (en) * | 1980-02-22 | 1984-05-02 | Sandoz Ltd | Amine condencates useful in textile treatment |
| JPS56136204A (en) * | 1980-03-26 | 1981-10-24 | Nippon Steel Corp | Highly efficient cold rolling method |
| DE3129562C2 (de) * | 1980-07-29 | 1994-10-06 | Kao Corp | Farbvertiefendes Mittel |
| GB2084597B (en) * | 1980-09-24 | 1984-09-19 | Sandoz Ltd | Quaternary polyalkylene polyamine n-methylol resin reaction products and dye after-treatments |
| US4424061A (en) * | 1981-02-27 | 1984-01-03 | Dainippon Pharmaceutical Co., Ltd. | Color fastness of dyed cotton textiles to chlorinated water and process for improving the color fastness of dyed cotton textiles to chlorinated water |
| JPS58115183A (ja) * | 1981-12-29 | 1983-07-08 | 大日本製薬株式会社 | 染色された綿繊維製品の塩素堅牢度増進剤及びその増進方法 |
| CH673195B5 (show.php) * | 1981-05-14 | 1990-08-31 | Sandoz Ag | |
| CH669081GA3 (show.php) * | 1981-05-14 | 1989-02-28 | ||
| US4436524A (en) | 1981-05-16 | 1984-03-13 | Sandoz Ltd. | After treating composition for direct or reactive dyeings on cellulose |
| FR2513279B1 (fr) * | 1981-05-18 | 1985-10-18 | Sandoz Sa | Procede de post-traitement de substrats contenant des groupes hydroxy |
| FR2513278A1 (en) * | 1981-06-15 | 1983-03-25 | Sandoz Sa | Treating dyed cellulosic fibrous substrates with precondensate - to improve wet fastness and crease resistance |
| JPS5824453A (ja) * | 1981-08-06 | 1983-02-14 | Nippon Senka Kogyo Kk | 湿式転写捺染方法 |
| DE3329029A1 (de) * | 1983-08-11 | 1985-02-28 | Cassella Ag, 6000 Frankfurt | Verfahren zur herstellung von faerbungen mit reaktivfarbstoffen |
| US4718918A (en) * | 1984-01-03 | 1988-01-12 | Sandoz Ltd. | Treatment of textile materials to improve the fastness of dyeings made thereon and polymers useful therefor |
| FR2557603B1 (fr) * | 1984-01-03 | 1988-02-19 | Sandoz Sa | Procede de teinture et de post-traitement de substrats textiles |
| DE3446284A1 (de) * | 1984-01-03 | 1985-07-11 | Sandoz-Patent-GmbH, 7850 Lörrach | Faerbeverfahren |
| CH674786B5 (show.php) * | 1984-01-03 | 1991-01-31 | Sandoz Ag | |
| DE3416693A1 (de) * | 1984-05-05 | 1985-11-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur behandlung von cellulosischen fasermaterialien |
| JPS6134292A (ja) * | 1984-07-20 | 1986-02-18 | 株式会社日本触媒 | 染色物処理方法 |
| DE3526101A1 (de) * | 1985-07-22 | 1987-01-22 | Basf Ag | Verfahren zur nachbehandlung von faerbungen mit reaktivfarbstoffen auf cellulose-fasermaterialien |
| DE3537458A1 (de) * | 1985-10-22 | 1987-04-23 | Basf Ag | Verfahren zur nachbehandlung von reaktivfaerbungen auf cellulosefasern |
| DE3607963A1 (de) * | 1986-03-11 | 1987-09-17 | Bayer Ag | Kondensationsprodukte und verfahren zur nachbehandlung von gefaerbten polyamiden |
| DE3609984A1 (de) * | 1986-03-25 | 1987-10-01 | Bayer Ag | Verfahren zur behandlung von fasermaterialien |
| DE3709766A1 (de) * | 1987-03-25 | 1988-10-06 | Hoechst Ag | Verfahren zum alkali-freien faerben mit reaktivfarbstoffen |
| DE3816699A1 (de) * | 1988-05-17 | 1989-11-30 | Bayer Ag | Verfahren zur nachbehandlung von gefaerbten textilmaterialien |
| DE3831139A1 (de) * | 1988-09-13 | 1990-03-15 | Hoechst Ag | Verfahren zum ungleichmaessigen, alkali-freien faerben von cellulosefasern |
| WO1990010747A1 (en) * | 1989-03-08 | 1990-09-20 | Commonwealth Scientific And Industrial Research Organisation | Modification of the properties of textile fibres and keratinous materials |
| AU633066B2 (en) * | 1989-03-08 | 1993-01-21 | Commonwealth Scientific And Industrial Research Organisation | Modification of the properties of textile fibres and keratinous materials |
| DE4413007A1 (de) * | 1994-04-15 | 1995-10-19 | Bayer Ag | Neue Farbstoffe und ihre Verwendung in Tinten für ink-jet-Druckverfahren |
| FR2746808B1 (fr) * | 1996-03-27 | 1998-05-07 | Protex Manuf Prod Chimiq | Agent et procede d'amelioration de la solidite au frottement de teintures ou d'impressions |
| GB9608505D0 (en) * | 1996-04-25 | 1996-07-03 | Zeneca Ltd | Compositions processes and uses |
| TR199902509T2 (xx) * | 1997-02-26 | 2000-06-21 | Textilcolor Ag | Karbamatla modifiye edilmiş düşük moleküler polimer bileşim ve bu bileşimin boyanmış veya basılmış selülöz tekstil materyalinin sonradan gördüğü muamelede kullanılışı. |
| BRPI0416400B1 (pt) * | 2003-11-11 | 2014-12-30 | Ciba Sc Holding Ag | Método para tingimento ou impressão de materiais de fibras têxteis usando corantes reativos |
| DE102004045861B4 (de) * | 2004-09-20 | 2008-05-08 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Verfahren zur Ringfärbung von textilen Flächengebilden aus cellulosischen Fasern und Mischmaterialien enthaltend cellulosische Fasern und danach hergestellte ringgefärbte Gewebe und Mischmaterialien |
| CN102330368B (zh) * | 2011-06-30 | 2013-02-13 | 北京泛博化学股份有限公司 | 一种媒介染色后处理剂、其制备方法及应用 |
| CN102493054B (zh) * | 2011-11-24 | 2015-07-29 | 无锡市天然绿色纤维科技有限公司 | 一种混纺可拔染色纺纱线的加工方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB879980A (en) * | 1959-08-04 | 1961-10-11 | Ici Ltd | Textile colouration process |
| GB1409568A (en) * | 1972-11-24 | 1975-10-08 | Ici Ltd | Colouration process |
-
1977
- 1977-10-21 DE DE19772747358 patent/DE2747358C2/de not_active Expired
-
1978
- 1978-10-18 GB GB7840934A patent/GB2006279B/en not_active Expired
- 1978-10-19 JP JP12794178A patent/JPS5468475A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2006279B (en) | 1982-10-06 |
| JPS6220309B2 (show.php) | 1987-05-06 |
| JPS5468475A (en) | 1979-06-01 |
| DE2747358A1 (de) | 1979-04-26 |
| GB2006279A (en) | 1979-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2747358C2 (de) | Verfahren zur Nachbehandlung von Reaktivfärbungen | |
| DE69034010T2 (de) | Polymere und Vorpolymere und ihre Verwendung in einem Verfahren zur Behandlung von Wolle | |
| DE3709766A1 (de) | Verfahren zum alkali-freien faerben mit reaktivfarbstoffen | |
| EP0133933A2 (de) | Verfahren zur Herstellung von Färbungen mit Reaktivfarbstoffen | |
| DE1419042A1 (de) | Verfahren zur Ausruestung von geformten Gebilden | |
| EP0636742B1 (de) | Verfahren zum Modifizieren und Färben von modifizierten Fasermaterialien | |
| EP0447352A1 (de) | Verfahren zur Verbesserung der Ausbeute und der Nassechtheiten von mit anionischen Farbstoffen auf Cellulosefasermaterial erzeugten Färbungen oder Drucken | |
| EP0359188A2 (de) | Verfahren zum Färben und Bedrucken von Cellulosefasern in Abwesenheit von Alkali oder Reduktionsmitteln | |
| DE3814208A1 (de) | Verwendung von ungefaerbten und/oder gefaerbten substraten | |
| DE3526101A1 (de) | Verfahren zur nachbehandlung von faerbungen mit reaktivfarbstoffen auf cellulose-fasermaterialien | |
| DE4422865A1 (de) | Verfahren zur Herstellung von aminierten Fasern aus Regeneratcellulose | |
| DE2843645A1 (de) | Verfahren zum auswaschen von nicht fixierten reaktivfarbstoffen von cellulosefasern | |
| DE2251280A1 (de) | Antistatische fasern und verfahren zu deren herstellung | |
| EP0250365B1 (de) | Verfahren zur Nachbehandlung von gefärbtem Cellulosefasermaterial | |
| EP0242577A2 (de) | Verfahren zur Behandlung von Fasermaterialien | |
| US3691110A (en) | Antistatic treating agent from polyepoxide-polyamine reaction | |
| DE3881095T2 (de) | Färben und Bedrucken von Fasern. | |
| DE3422822A1 (de) | Faerbeverfahren | |
| DE3320629A1 (de) | Verfahren zum faerben von textilen materialien aus hydrophilen fasern | |
| EP0405409A1 (de) | Verfahren zum Färben von Glasfasern | |
| DE69706062T2 (de) | Polykondensationsprodukte sowie deren verwendung als färbereihilfsmittel | |
| EP0824156B1 (de) | Wasserlösliche Harnstoffderivat-Polymere mit quaternären Ammonium-Gruppen und deren Verwendung | |
| DE2853652A1 (de) | Verfahren zum faerben von textilmaterialien in gegenwart von polymeren quaternaeren ammoniumsalzen als reservierungsmitteln unter erzeugung von ton in ton- oder mehrton-effekten | |
| DE2117182A1 (en) | Increasing anionic dye receptivity of polyamide fibres - - by treating with amine-conggtg epoxy cpds, and heat-treatment | |
| DE2650967A1 (de) | Verfahren zum faerben von textilmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |