DE2734336C2 - Lichtempfindliches photographisches Silberhalogenidaufzeichnungsmaterial vom Lith-Typ - Google Patents
Lichtempfindliches photographisches Silberhalogenidaufzeichnungsmaterial vom Lith-TypInfo
- Publication number
- DE2734336C2 DE2734336C2 DE19772734336 DE2734336A DE2734336C2 DE 2734336 C2 DE2734336 C2 DE 2734336C2 DE 19772734336 DE19772734336 DE 19772734336 DE 2734336 A DE2734336 A DE 2734336A DE 2734336 C2 DE2734336 C2 DE 2734336C2
- Authority
- DE
- Germany
- Prior art keywords
- tetrazolium
- diphenyl
- phenyl
- silver halide
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 silver halide Chemical class 0.000 title claims description 91
- 229910052709 silver Inorganic materials 0.000 title claims description 38
- 239000004332 silver Substances 0.000 title claims description 38
- 239000000463 material Substances 0.000 title claims description 19
- 239000000839 emulsion Substances 0.000 claims description 18
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 claims description 6
- 125000000732 arylene group Chemical group 0.000 claims description 5
- 239000004305 biphenyl Substances 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- 229910021607 Silver chloride Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000002091 cationic group Chemical group 0.000 claims description 4
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- WFTGTFCWWWPJAF-UHFFFAOYSA-N 1-(2,3-diphenyl-1H-tetrazol-5-yl)ethanone Chemical compound N1C(C(=O)C)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 WFTGTFCWWWPJAF-UHFFFAOYSA-N 0.000 claims description 2
- QOIRFXTZHVPXLR-UHFFFAOYSA-N 2,3,5-triphenyl-1h-tetrazole Chemical compound N1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N=C1C1=CC=CC=C1 QOIRFXTZHVPXLR-UHFFFAOYSA-N 0.000 claims description 2
- OMPBPIPZACGTHR-UHFFFAOYSA-N 2,3-diphenyl-1H-tetrazole Chemical compound N1C=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 OMPBPIPZACGTHR-UHFFFAOYSA-N 0.000 claims description 2
- RKOYIQDBENDSSV-UHFFFAOYSA-N 2-(4-iodophenyl)-3,5-diphenyl-1H-tetrazole Chemical compound C1=CC(I)=CC=C1N1N(C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 RKOYIQDBENDSSV-UHFFFAOYSA-N 0.000 claims description 2
- HWLXUQATWPNSAO-UHFFFAOYSA-N 2-[3-(4-methoxyphenyl)-5-phenyl-1H-tetrazol-2-yl]-1,3-benzothiazole Chemical compound C1=CC(OC)=CC=C1N1N(C=2SC3=CC=CC=C3N=2)NC(C=2C=CC=CC=2)=N1 HWLXUQATWPNSAO-UHFFFAOYSA-N 0.000 claims description 2
- KNMZXRUWMYCXSG-UHFFFAOYSA-N 2-[3-(4-methylphenyl)-5-phenyl-1H-tetrazol-2-yl]-1,3-benzothiazole Chemical compound C1=CC(C)=CC=C1N1N(C=2SC3=CC=CC=C3N=2)NC(C=2C=CC=CC=2)=N1 KNMZXRUWMYCXSG-UHFFFAOYSA-N 0.000 claims description 2
- FQYLAHZWZVBJMI-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)-3-(4-nitrophenyl)-1H-tetrazol-2-yl]-1,3-benzothiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1N(C=2SC3=CC=CC=C3N=2)NC(C=2C=CC(Cl)=CC=2)=N1 FQYLAHZWZVBJMI-UHFFFAOYSA-N 0.000 claims description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 2
- BKFGFBHIORTGEL-UHFFFAOYSA-N 3-[4-[2,3-bis[4-(2-carboxyethyl)phenyl]-1H-tetrazol-5-yl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1N1N(C=2C=CC(CCC(O)=O)=CC=2)N=C(C=2C=CC(CCC(O)=O)=CC=2)N1 BKFGFBHIORTGEL-UHFFFAOYSA-N 0.000 claims description 2
- NDQDVFVHOJQAII-UHFFFAOYSA-N 4-[5-(4-nitrophenyl)-3-phenyl-1H-tetrazol-2-yl]phenol Chemical compound C1=CC(O)=CC=C1N1N(C=2C=CC=CC=2)N=C(C=2C=CC(=CC=2)[N+]([O-])=O)N1 NDQDVFVHOJQAII-UHFFFAOYSA-N 0.000 claims description 2
- XHIPMTBCWNNSFM-UHFFFAOYSA-N 5-hexyl-2,3-diphenyl-1H-tetrazole Chemical compound N1C(CCCCCC)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 XHIPMTBCWNNSFM-UHFFFAOYSA-N 0.000 claims description 2
- XMFHLCILBOUUDK-UHFFFAOYSA-N C1=CC(OC(C)(C)CC(C)(C)C)=CC=C1C1=NN(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N1 Chemical compound C1=CC(OC(C)(C)CC(C)(C)C)=CC=C1C1=NN(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N1 XMFHLCILBOUUDK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- ZEUDGVUWMXAXEF-UHFFFAOYSA-L bromo(chloro)silver Chemical compound Cl[Ag]Br ZEUDGVUWMXAXEF-UHFFFAOYSA-L 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical group C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- UJGJMZVYYVWKOY-UHFFFAOYSA-O 1-(3-nitrophenyl)-2h-tetrazol-1-ium Chemical compound [O-][N+](=O)C1=CC=CC([N+]=2NN=NC=2)=C1 UJGJMZVYYVWKOY-UHFFFAOYSA-O 0.000 claims 1
- UBJIPDGISJLPQU-UHFFFAOYSA-N 2,3-diphenyl-5-thiophen-2-yl-1H-tetrazole Chemical compound N1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N=C1C1=CC=CS1 UBJIPDGISJLPQU-UHFFFAOYSA-N 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 1
- 125000000972 4,5-dimethylthiazol-2-yl group Chemical group [H]C([H])([H])C1=C(N=C(*)S1)C([H])([H])[H] 0.000 claims 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- LPNMSTZIECKPKI-UHFFFAOYSA-N 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trichlorophenyl)-1H-tetrazole Chemical compound ClC1=CC(Cl)=CC(Cl)=C1N1N(C=2C=CC=CC=2)N=C(C=2C=CC(Br)=CC=2)N1 LPNMSTZIECKPKI-UHFFFAOYSA-N 0.000 claims 1
- DWFDADZCRATSDV-UHFFFAOYSA-N 5-methyl-2-phenyltetrazole Chemical compound N1=C(C)N=NN1C1=CC=CC=C1 DWFDADZCRATSDV-UHFFFAOYSA-N 0.000 claims 1
- SCRSUBWYUBGSPK-UHFFFAOYSA-N 5-nitro-2,3-diphenyl-1H-tetrazole Chemical compound N1C([N+](=O)[O-])=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 SCRSUBWYUBGSPK-UHFFFAOYSA-N 0.000 claims 1
- IEIREBQISNYNTN-UHFFFAOYSA-K [Ag](I)(Br)Cl Chemical compound [Ag](I)(Br)Cl IEIREBQISNYNTN-UHFFFAOYSA-K 0.000 claims 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 14
- 108010010803 Gelatin Proteins 0.000 description 13
- 239000008273 gelatin Substances 0.000 description 13
- 229920000159 gelatin Polymers 0.000 description 13
- 235000019322 gelatine Nutrition 0.000 description 13
- 235000011852 gelatine desserts Nutrition 0.000 description 13
- 125000003831 tetrazolyl group Chemical group 0.000 description 12
- 230000000052 comparative effect Effects 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 9
- 239000010410 layer Substances 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 5
- 229920000058 polyacrylate Polymers 0.000 description 5
- LVPFIQLQEJUWCB-UHFFFAOYSA-N 2,2-diethyl-3-hexyl-3-sulfobutanedioic acid Chemical compound CCCCCCC(C(O)=O)(S(O)(=O)=O)C(CC)(CC)C(O)=O LVPFIQLQEJUWCB-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 4
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- 239000000084 colloidal system Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000123 paper Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000005020 polyethylene terephthalate Substances 0.000 description 3
- 239000011241 protective layer Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 3
- PKDBCJSWQUOKDO-UHFFFAOYSA-M 2,3,5-triphenyltetrazolium chloride Chemical compound [Cl-].C1=CC=CC=C1C(N=[N+]1C=2C=CC=CC=2)=NN1C1=CC=CC=C1 PKDBCJSWQUOKDO-UHFFFAOYSA-M 0.000 description 2
- FJMPZWOQMLJCRS-UHFFFAOYSA-N 2,3-diphenyl-1h-tetrazole-5-carbonitrile Chemical compound N1C(C#N)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 FJMPZWOQMLJCRS-UHFFFAOYSA-N 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- XHFJGLIQDYVTSE-UHFFFAOYSA-N 4-(5-methyl-2-phenyl-1h-tetrazol-1-ium-3-yl)phenol;chloride Chemical compound [Cl-].N1C(C)=N[NH+](C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 XHFJGLIQDYVTSE-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 description 2
- QSRWBKPZDIVSSZ-UHFFFAOYSA-N 5-ethyl-2,3-diphenyl-1,3-dihydrotetrazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C(CC)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 QSRWBKPZDIVSSZ-UHFFFAOYSA-N 0.000 description 2
- VJCOKEVBHOFHLO-UHFFFAOYSA-N 5-nitro-1,3-diphenyl-2H-tetrazole Chemical compound [O-][N+](=O)C1=NN(C=2C=CC=CC=2)NN1C1=CC=CC=C1 VJCOKEVBHOFHLO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DPSKVWTXACOIJH-UHFFFAOYSA-N O.O.O.O.O.O.O.O.O.O.S(=S)(=O)([O-])[O-].[NH4+].[NH4+] Chemical compound O.O.O.O.O.O.O.O.O.O.S(=S)(=O)([O-])[O-].[NH4+].[NH4+] DPSKVWTXACOIJH-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 2
- AOGQQMWRSVSSEK-UHFFFAOYSA-M [Cl-].[Ag+].IBr Chemical compound [Cl-].[Ag+].IBr AOGQQMWRSVSSEK-UHFFFAOYSA-M 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 2
- 229940043264 dodecyl sulfate Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 235000012149 noodles Nutrition 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- NNVNAJGCZFCILW-UHFFFAOYSA-N 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride Chemical compound Cl.C1CN(C)CCC21OC1=CC=CC=C1C(N)C2 NNVNAJGCZFCILW-UHFFFAOYSA-N 0.000 description 1
- JZLLHLCEVVEDGF-UHFFFAOYSA-N 1-(2,3-diphenyl-1,3-dihydrotetrazol-3-ium-5-yl)ethanone;chloride Chemical compound [Cl-].[NH2+]1C(C(=O)C)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 JZLLHLCEVVEDGF-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- XXWAHKICOZTQOW-UHFFFAOYSA-N 1-[2,3-bis(4-ethoxyphenyl)-1H-tetrazol-5-yl]ethanone Chemical compound C1=CC(OCC)=CC=C1N1N(C=2C=CC(OCC)=CC=2)N=C(C(C)=O)N1 XXWAHKICOZTQOW-UHFFFAOYSA-N 0.000 description 1
- WLDWSGZHNBANIO-UHFFFAOYSA-N 2',5'-Dihydroxyacetophenone Chemical compound CC(=O)C1=CC(O)=CC=C1O WLDWSGZHNBANIO-UHFFFAOYSA-N 0.000 description 1
- XIWRQEFBSZWJTH-UHFFFAOYSA-N 2,3-dibromobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Br)=C1Br XIWRQEFBSZWJTH-UHFFFAOYSA-N 0.000 description 1
- DBCKMJVEAUXWJJ-UHFFFAOYSA-N 2,3-dichlorobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Cl)=C1Cl DBCKMJVEAUXWJJ-UHFFFAOYSA-N 0.000 description 1
- QQYNCBUCYXJFCT-UHFFFAOYSA-N 2,3-diphenyl-1,3-dihydrotetrazol-3-ium;4-octylbenzenesulfonate Chemical compound N1C=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1.CCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1 QQYNCBUCYXJFCT-UHFFFAOYSA-N 0.000 description 1
- CDNHHFDCGUXITF-UHFFFAOYSA-N 2,3-diphenyl-5-[4-(2,4,4-trimethylpentan-2-yloxy)phenyl]-1h-tetrazol-1-ium;chloride Chemical compound [Cl-].C1=CC(OC(C)(C)CC(C)(C)C)=CC=C1C1=NN(C=2C=CC=CC=2)N(C=2C=CC=CC=2)[NH2+]1 CDNHHFDCGUXITF-UHFFFAOYSA-N 0.000 description 1
- AQPVLFWWOYVUOV-UHFFFAOYSA-N 2,3-diphenyl-5-thiophen-2-yl-1,3-dihydrotetrazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N=C1C1=CC=CS1 AQPVLFWWOYVUOV-UHFFFAOYSA-N 0.000 description 1
- YZDIUKPBJDYTOM-UHFFFAOYSA-N 2,5-diethylbenzene-1,4-diol Chemical compound CCC1=CC(O)=C(CC)C=C1O YZDIUKPBJDYTOM-UHFFFAOYSA-N 0.000 description 1
- GPASWZHHWPVSRG-UHFFFAOYSA-N 2,5-dimethylbenzene-1,4-diol Chemical compound CC1=CC(O)=C(C)C=C1O GPASWZHHWPVSRG-UHFFFAOYSA-N 0.000 description 1
- IPZIKIFFPGSDIV-UHFFFAOYSA-N 2-(2,3-diphenyl-1,3-dihydrotetrazol-3-ium-5-yl)-1,3-benzoxazole;chloride Chemical compound [Cl-].N1=C(C=2OC3=CC=CC=C3N=2)NN(C=2C=CC=CC=2)[NH+]1C1=CC=CC=C1 IPZIKIFFPGSDIV-UHFFFAOYSA-N 0.000 description 1
- OPRFPVHIAQGVQF-UHFFFAOYSA-N 2-(2,3-diphenyl-1,3-dihydrotetrazol-3-ium-5-yl)quinoline;chloride Chemical compound [Cl-].N1=C(C=2N=C3C=CC=CC3=CC=2)NN(C=2C=CC=CC=2)[NH+]1C1=CC=CC=C1 OPRFPVHIAQGVQF-UHFFFAOYSA-N 0.000 description 1
- PRRVATRGEFUPRF-UHFFFAOYSA-N 2-(2,3-diphenyl-1H-tetrazol-5-yl)quinoline Chemical compound N1=C(C=2N=C3C=CC=CC3=CC=2)NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 PRRVATRGEFUPRF-UHFFFAOYSA-N 0.000 description 1
- KYENMFWIKMBWJG-UHFFFAOYSA-N 2-(2,5-diphenyl-1h-tetrazol-1-ium-3-yl)-4,5-dimethyl-1,3-thiazole;chloride Chemical compound [Cl-].S1C(C)=C(C)N=C1N1N(C=2C=CC=CC=2)[NH2+]C(C=2C=CC=CC=2)=N1 KYENMFWIKMBWJG-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- PXQRJXAUOHSZPF-UHFFFAOYSA-N 2-(3,5-diphenyl-1h-tetrazol-1-ium-2-yl)-1h-triazine;sulfate Chemical compound [O-]S([O-])(=O)=O.N1C=CC=NN1N1N(C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)[NH2+]1.N1C=CC=NN1N1N(C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)[NH2+]1 PXQRJXAUOHSZPF-UHFFFAOYSA-N 0.000 description 1
- ASJSXUWOFZATJM-UHFFFAOYSA-N 2-(3,5-diphenyl-1h-tetrazol-2-yl)-4,5-dimethyl-1,3-thiazole Chemical compound S1C(C)=C(C)N=C1N1N(C=2C=CC=CC=2)NC(C=2C=CC=CC=2)=N1 ASJSXUWOFZATJM-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- ZIEJYVUUSNXZQD-UHFFFAOYSA-N 2-(4-iodophenyl)-3,5-diphenyl-1,3-dihydrotetrazol-3-ium;4-octylbenzenesulfonate Chemical compound CCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(I)=CC=C1N1[NH+](C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 ZIEJYVUUSNXZQD-UHFFFAOYSA-N 0.000 description 1
- FBCHOEIZLLKXOF-UHFFFAOYSA-N 2-(4-methylphenyl)-3,5-diphenyl-1,3-dihydrotetrazol-3-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC(C)=CC=C1N1[NH+](C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 FBCHOEIZLLKXOF-UHFFFAOYSA-N 0.000 description 1
- IXNKNVCYDIVHSA-UHFFFAOYSA-N 2-(4-methylphenyl)-3,5-diphenyl-1h-tetrazole Chemical compound C1=CC(C)=CC=C1N1N(C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 IXNKNVCYDIVHSA-UHFFFAOYSA-N 0.000 description 1
- ZNVBVIZZKGKHRB-UHFFFAOYSA-N 2-(5-dodecyl-3-phenyl-1H-tetrazol-2-yl)-1,3-benzothiazole Chemical compound N=1C2=CC=CC=C2SC=1N1NC(CCCCCCCCCCCC)=NN1C1=CC=CC=C1 ZNVBVIZZKGKHRB-UHFFFAOYSA-N 0.000 description 1
- HIGSPBFIOSHWQG-UHFFFAOYSA-N 2-Isopropyl-1,4-benzenediol Chemical compound CC(C)C1=CC(O)=CC=C1O HIGSPBFIOSHWQG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- RAECFAXTJBDZOD-UHFFFAOYSA-N 2-[5-(2-chlorophenyl)-3-phenyl-1H-tetrazol-2-yl]-1,3-benzothiazole Chemical compound ClC1=CC=CC=C1C1=NN(C=2C=CC=CC=2)N(C=2SC3=CC=CC=C3N=2)N1 RAECFAXTJBDZOD-UHFFFAOYSA-N 0.000 description 1
- BLWMNAXCPBTEKO-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)-2-(4-nitrophenyl)-1,3-dihydrotetrazol-3-ium-3-yl]-1,3-benzothiazole;chloride Chemical compound [Cl-].C1=CC([N+](=O)[O-])=CC=C1N1[NH+](C=2SC3=CC=CC=C3N=2)N=C(C=2C=CC(Cl)=CC=2)N1 BLWMNAXCPBTEKO-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- REFDOIWRJDGBHY-UHFFFAOYSA-N 2-bromobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Br)=C1 REFDOIWRJDGBHY-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- JXCNUCFTHLGXDQ-UHFFFAOYSA-N 2h-tetrazol-2-ium;chloride Chemical compound Cl.C1=NN=NN1 JXCNUCFTHLGXDQ-UHFFFAOYSA-N 0.000 description 1
- WITVSXXDJMKFFE-UHFFFAOYSA-N 3,3-dimethyl-1,2-dihydroindene-5,6-diol Chemical compound OC1=C(O)C=C2C(C)(C)CCC2=C1 WITVSXXDJMKFFE-UHFFFAOYSA-N 0.000 description 1
- SQUBXDNNVZQUPT-UHFFFAOYSA-N 3-[4-[2,3-bis[4-(2-carboxyethyl)phenyl]-1,3-dihydrotetrazol-3-ium-5-yl]phenyl]propanoic acid;4-dodecylbenzenesulfonate Chemical compound CCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(CCC(=O)O)=CC=C1N1[NH+](C=2C=CC(CCC(O)=O)=CC=2)N=C(C=2C=CC(CCC(O)=O)=CC=2)N1 SQUBXDNNVZQUPT-UHFFFAOYSA-N 0.000 description 1
- ZLDCPPFCDAPKSM-UHFFFAOYSA-N 3-[4-[2,3-bis[4-(2-carboxyethyl)phenyl]-1,3-dihydrotetrazol-3-ium-5-yl]phenyl]propanoic acid;iodide Chemical compound [I-].C1=CC(CCC(=O)O)=CC=C1N1[NH+](C=2C=CC(CCC(O)=O)=CC=2)N=C(C=2C=CC(CCC(O)=O)=CC=2)N1 ZLDCPPFCDAPKSM-UHFFFAOYSA-N 0.000 description 1
- UAYRQYDAMDWXHD-UHFFFAOYSA-N 4-(2,3-diphenyl-1,3-dihydrotetrazol-3-ium-5-yl)benzonitrile;chloride Chemical compound [Cl-].C1=CC(C#N)=CC=C1C1=N[NH+](C=2C=CC=CC=2)N(C=2C=CC=CC=2)N1 UAYRQYDAMDWXHD-UHFFFAOYSA-N 0.000 description 1
- VDSHEVQLMONAMR-UHFFFAOYSA-O 4-(2,3-diphenyl-1,3-dihydrotetrazol-3-ium-5-yl)pyridine;nitrate Chemical compound [O-][N+]([O-])=O.N1N(C=2C=CC=CC=2)[NH+](C=2C=CC=CC=2)N=C1C1=CC=NC=C1 VDSHEVQLMONAMR-UHFFFAOYSA-O 0.000 description 1
- KPXPTOUFIZYILY-UHFFFAOYSA-N 4-(2,3-diphenyl-1H-tetrazol-5-yl)pyridine Chemical compound N1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N=C1C1=CC=NC=C1 KPXPTOUFIZYILY-UHFFFAOYSA-N 0.000 description 1
- LNLXWNTVDOIVPK-UHFFFAOYSA-N 4-(5-methyl-2-phenyl-1h-tetrazol-1-ium-3-yl)phenol;sulfate Chemical compound [O-]S([O-])(=O)=O.N1C(C)=N[NH+](C=2C=CC=CC=2)N1C1=CC=C(O)C=C1.N1C(C)=N[NH+](C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 LNLXWNTVDOIVPK-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- KWXICGTUELOLSQ-UHFFFAOYSA-N 4-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=C(S(O)(=O)=O)C=C1 KWXICGTUELOLSQ-UHFFFAOYSA-N 0.000 description 1
- LTRYTFOYRKRJLU-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)-2-(2-ethoxyphenyl)-3-(4-methoxyphenyl)-1,3-dihydrotetrazol-3-ium;chloride Chemical compound [Cl-].CCOC1=CC=CC=C1N1[NH+](C=2C=CC(OC)=CC=2)N=C(C=2C=C(OC)C(OC)=CC=2)N1 LTRYTFOYRKRJLU-UHFFFAOYSA-N 0.000 description 1
- DVYWKCIYDKCQGG-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)-2-(2-ethoxyphenyl)-3-(4-methoxyphenyl)-1h-tetrazole Chemical compound CCOC1=CC=CC=C1N1N(C=2C=CC(OC)=CC=2)N=C(C=2C=C(OC)C(OC)=CC=2)N1 DVYWKCIYDKCQGG-UHFFFAOYSA-N 0.000 description 1
- KWEKLFATGLFLST-UHFFFAOYSA-N 5-(furan-2-yl)-2,3-diphenyl-1H-tetrazole Chemical compound N1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)N=C1C1=CC=CO1 KWEKLFATGLFLST-UHFFFAOYSA-N 0.000 description 1
- UWXJPFCATNGVAS-UHFFFAOYSA-N 5-(furan-2-yl)-2,3-diphenyl-1h-tetrazol-1-ium;chloride Chemical compound [Cl-].N1N(C=2C=CC=CC=2)[NH+](C=2C=CC=CC=2)N=C1C1=CC=CO1 UWXJPFCATNGVAS-UHFFFAOYSA-N 0.000 description 1
- HLQLADJVXUGAKG-UHFFFAOYSA-N 5-ethyl-2,3-diphenyl-1h-tetrazole Chemical compound N1C(CC)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 HLQLADJVXUGAKG-UHFFFAOYSA-N 0.000 description 1
- UOSGISDWERJLNR-UHFFFAOYSA-N 5-hexyl-2,3-diphenyl-1h-tetrazol-1-ium;chloride Chemical compound [Cl-].N1C(CCCCCC)=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1 UOSGISDWERJLNR-UHFFFAOYSA-N 0.000 description 1
- INVVMIXYILXINW-UHFFFAOYSA-N 5-methyl-1h-[1,2,4]triazolo[1,5-a]pyrimidin-7-one Chemical compound CC1=CC(=O)N2NC=NC2=N1 INVVMIXYILXINW-UHFFFAOYSA-N 0.000 description 1
- RFZVUKSHEUPSMN-UHFFFAOYSA-N 5-methyl-2,3-diphenyl-1,3-dihydrotetrazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C(C)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 RFZVUKSHEUPSMN-UHFFFAOYSA-N 0.000 description 1
- TXCKVRLFZFJSDF-UHFFFAOYSA-N 5-methyl-2,3-diphenyl-1h-tetrazole Chemical compound N1C(C)=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 TXCKVRLFZFJSDF-UHFFFAOYSA-N 0.000 description 1
- BEWBNXXFBYJSPN-UHFFFAOYSA-N 5-nitro-2,3-diphenyl-1h-tetrazol-1-ium;chloride Chemical compound [Cl-].[NH2+]1C([N+](=O)[O-])=NN(C=2C=CC=CC=2)N1C1=CC=CC=C1 BEWBNXXFBYJSPN-UHFFFAOYSA-N 0.000 description 1
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- BMFMQGXDDJALKQ-BYPYZUCNSA-N Argininic acid Chemical compound NC(N)=NCCC[C@H](O)C(O)=O BMFMQGXDDJALKQ-BYPYZUCNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WDCHPTNIKQRFNV-UHFFFAOYSA-N CC(C)OS(C1=CC=CC2=CC=CC=C12)(=O)=O.CC1=NN(C(C=C2)=CC=C2O)N(C2=CC=CC=C2)N1 Chemical compound CC(C)OS(C1=CC=CC2=CC=CC=C12)(=O)=O.CC1=NN(C(C=C2)=CC=C2O)N(C2=CC=CC=C2)N1 WDCHPTNIKQRFNV-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229930194542 Keto Chemical group 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- HGMHKDIQDVYKON-UHFFFAOYSA-N N-[4-(3,5-diphenyl-1H-tetrazol-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1N1N(C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 HGMHKDIQDVYKON-UHFFFAOYSA-N 0.000 description 1
- HLRFVQODVVUZEA-UHFFFAOYSA-N N1N(C=2C=CC=CC=2)N(N2N=CC=CN2)N=C1C1=CC=CC=C1 Chemical compound N1N(C=2C=CC=CC=2)N(N2N=CC=CN2)N=C1C1=CC=CC=C1 HLRFVQODVVUZEA-UHFFFAOYSA-N 0.000 description 1
- WIZYKMMPVSCESV-UHFFFAOYSA-N N1NC(C=2C=CC=CC=2)=NN1C1=CC=CC=C1 Chemical compound N1NC(C=2C=CC=CC=2)=NN1C1=CC=CC=C1 WIZYKMMPVSCESV-UHFFFAOYSA-N 0.000 description 1
- BNIUVQHHCJXGHT-UHFFFAOYSA-N N=1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)NC=1CC(C=1C=CC=CC=1)C(C=1C=CC=CC=1)CC=1N=NNN=1 Chemical compound N=1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)NC=1CC(C=1C=CC=CC=1)C(C=1C=CC=CC=1)CC=1N=NNN=1 BNIUVQHHCJXGHT-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229910021612 Silver iodide Inorganic materials 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001513 alkali metal bromide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- SSRHZSLSLDOUJB-UHFFFAOYSA-N benzene-1,4-diol;toluene Chemical compound CC1=CC=CC=C1.OC1=CC=C(O)C=C1 SSRHZSLSLDOUJB-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical group C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- BAKCDOQBCGHVRG-UHFFFAOYSA-N dioxido-oxo-sulfanylidene-$l^{6}-sulfane;2,3-diphenyl-1h-tetrazol-1-ium Chemical compound [O-]S([O-])(=O)=S.N1C=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1.N1C=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1 BAKCDOQBCGHVRG-UHFFFAOYSA-N 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- SRPOMGSPELCIGZ-UHFFFAOYSA-N disulfino carbonate Chemical compound OS(=O)OC(=O)OS(O)=O SRPOMGSPELCIGZ-UHFFFAOYSA-N 0.000 description 1
- XPTRLDKYALTEST-UHFFFAOYSA-N dodecyl sulfate;5-methyl-2,3-diphenyl-1,3-dihydrotetrazol-3-ium Chemical compound CCCCCCCCCCCCOS([O-])(=O)=O.N1C(C)=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1 XPTRLDKYALTEST-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- LYDCUOFGCBHSPA-UHFFFAOYSA-N ethyl 2,3-bis(3-nitrophenyl)-1,3-dihydrotetrazol-3-ium-5-carboxylate;bromide Chemical compound [Br-].N1C(C(=O)OCC)=N[NH+](C=2C=C(C=CC=2)[N+]([O-])=O)N1C1=CC=CC([N+]([O-])=O)=C1 LYDCUOFGCBHSPA-UHFFFAOYSA-N 0.000 description 1
- GXNZYSHGDTVEFI-UHFFFAOYSA-N ethyl 2,3-bis(3-nitrophenyl)-1H-tetrazole-5-carboxylate Chemical compound N1C(C(=O)OCC)=NN(C=2C=C(C=CC=2)[N+]([O-])=O)N1C1=CC=CC([N+]([O-])=O)=C1 GXNZYSHGDTVEFI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QOUPOTMFXXDUBF-UHFFFAOYSA-N methyl sulfate;5-nitro-2,3-diphenyl-1,3-dihydrotetrazol-3-ium Chemical compound COS([O-])(=O)=O.N1C([N+](=O)[O-])=N[NH+](C=2C=CC=CC=2)N1C1=CC=CC=C1 QOUPOTMFXXDUBF-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- QQPSGKLPTFKHCN-UHFFFAOYSA-N n-(4-benzamido-2,5-dihydroxyphenyl)benzamide Chemical compound OC=1C=C(NC(=O)C=2C=CC=CC=2)C(O)=CC=1NC(=O)C1=CC=CC=C1 QQPSGKLPTFKHCN-UHFFFAOYSA-N 0.000 description 1
- KPEWKUNOQLFQPB-UHFFFAOYSA-N n-[4-(3,5-diphenyl-1,3-dihydrotetrazol-3-ium-2-yl)phenyl]acetamide;dodecyl sulfate Chemical compound CCCCCCCCCCCCOS([O-])(=O)=O.C1=CC(NC(=O)C)=CC=C1N1[NH+](C=2C=CC=CC=2)N=C(C=2C=CC=CC=2)N1 KPEWKUNOQLFQPB-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical group 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- CENHPXAQKISCGD-UHFFFAOYSA-N trioxathietane 4,4-dioxide Chemical compound O=S1(=O)OOO1 CENHPXAQKISCGD-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/067—Additives for high contrast images, other than hydrazine compounds
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP51091918A JPS6015936B2 (ja) | 1976-07-31 | 1976-07-31 | ハロゲン化銀写真感光材料 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2734336A1 DE2734336A1 (de) | 1978-02-02 |
| DE2734336C2 true DE2734336C2 (de) | 1985-12-05 |
Family
ID=14039951
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772734336 Expired DE2734336C2 (de) | 1976-07-31 | 1977-07-29 | Lichtempfindliches photographisches Silberhalogenidaufzeichnungsmaterial vom Lith-Typ |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS6015936B2 (show.php) |
| AU (1) | AU500387B2 (show.php) |
| CA (1) | CA1110484A (show.php) |
| DE (1) | DE2734336C2 (show.php) |
| FR (1) | FR2360910A1 (show.php) |
| GB (1) | GB1589593A (show.php) |
| SE (1) | SE7708669L (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3709724A1 (de) * | 1986-03-25 | 1987-10-01 | Fuji Photo Film Co Ltd | Verfahren und einrichtung zum bildschirmkopieren zur herstellung einer kopie eines bildeindruckes von einem bildschirm mit buchstaben |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5917819B2 (ja) * | 1977-01-27 | 1984-04-24 | コニカ株式会社 | ハロゲン化銀写真感光材料 |
| JPS5950975B2 (ja) * | 1977-02-01 | 1984-12-11 | コニカ株式会社 | 高コントラスト銀画像の形成方法 |
| JPS5919886B2 (ja) * | 1978-02-02 | 1984-05-09 | セントラル硝子株式会社 | フロ−ト法における板ガラス製造方法 |
| JPS58189629A (ja) * | 1982-04-07 | 1983-11-05 | Konishiroku Photo Ind Co Ltd | 銀画像形成方法 |
| JPS5979244A (ja) * | 1982-10-29 | 1984-05-08 | Konishiroku Photo Ind Co Ltd | 銀画像形成方法 |
| JPS60126645A (ja) * | 1983-12-13 | 1985-07-06 | Konishiroku Photo Ind Co Ltd | 明室用直接ポジハロゲン化銀写真感光材料による画像形成方法 |
| EP0181728A3 (en) * | 1984-11-13 | 1988-08-24 | Konishiroku Photo Industry Co. Ltd. | Light-sensitive silver halide photographic material |
| DE3684430D1 (de) | 1985-12-25 | 1992-04-23 | Fuji Photo Film Co Ltd | Verfahren zur herstellung eines bildes. |
| JPH051571A (ja) * | 1991-06-21 | 1993-01-08 | Kubota Corp | デイーゼルエンジンのガバナ装置 |
| EP4006330A4 (en) | 2019-07-30 | 2022-11-23 | Mitsubishi Jidosha Kogyo Kabushiki Kaisha | Fuel tank system |
| US11698044B2 (en) | 2019-07-30 | 2023-07-11 | Mitsubishi Jidosha Kogyo Kabushtkt Kaisha | Fuel tank system |
| WO2021020488A1 (ja) | 2019-07-30 | 2021-02-04 | 三菱自動車工業株式会社 | 燃料タンクシステム |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE615097A (show.php) * | 1961-03-14 | |||
| IT984942B (it) * | 1973-05-07 | 1974-11-20 | Minnesota Mining & Mfg | C ossi betaine di tetrazolio come agenti antivelo per emulsioni foto grafiche agli alogenuri d argento |
| JPS5917825B2 (ja) * | 1975-08-02 | 1984-04-24 | コニカ株式会社 | 高コントラスト銀画像の形成方法 |
-
1976
- 1976-07-31 JP JP51091918A patent/JPS6015936B2/ja not_active Expired
-
1977
- 1977-07-26 AU AU27318/77A patent/AU500387B2/en not_active Expired
- 1977-07-27 GB GB3145077A patent/GB1589593A/en not_active Expired
- 1977-07-28 SE SE7708669A patent/SE7708669L/ not_active Application Discontinuation
- 1977-07-29 DE DE19772734336 patent/DE2734336C2/de not_active Expired
- 1977-07-29 CA CA283,721A patent/CA1110484A/en not_active Expired
- 1977-08-01 FR FR7723667A patent/FR2360910A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3709724A1 (de) * | 1986-03-25 | 1987-10-01 | Fuji Photo Film Co Ltd | Verfahren und einrichtung zum bildschirmkopieren zur herstellung einer kopie eines bildeindruckes von einem bildschirm mit buchstaben |
Also Published As
| Publication number | Publication date |
|---|---|
| AU500387B2 (en) | 1979-05-17 |
| GB1589593A (en) | 1981-05-13 |
| JPS5317719A (en) | 1978-02-18 |
| DE2734336A1 (de) | 1978-02-02 |
| SE7708669L (sv) | 1978-02-01 |
| AU2731877A (en) | 1979-02-01 |
| JPS6015936B2 (ja) | 1985-04-23 |
| FR2360910B1 (show.php) | 1980-04-18 |
| FR2360910A1 (fr) | 1978-03-03 |
| CA1110484A (en) | 1981-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69121965T2 (de) | Photographisches Hochkontrastelement, das ein eine Alkylpyridiniumgruppe enthaltendes Arylsulphonamidophenylhydrazid einschliesst | |
| DE2734336C2 (de) | Lichtempfindliches photographisches Silberhalogenidaufzeichnungsmaterial vom Lith-Typ | |
| DE3873121T2 (de) | Hochgeschwindigkeitsverarbeitung von photographisches lichtempfindliches silberhalogenidmaterialen. | |
| DE2324161A1 (de) | Verfahren zur herstellung kontrastreicher bilder mit entwicklerhaltigen silberhalogenidmaterialien | |
| DE3328755A1 (de) | Lichtempfindliches photographisches aufzeichnungsmaterial | |
| DE1929223A1 (de) | Entwickler-Vorlaeufer-Verbindungen und ihre Verwendung in der Photographie | |
| DE69307777T2 (de) | Photographisches lichtempfindliches Silberhalogenidmaterial | |
| DE2128498A1 (de) | Verfahren zur Entwicklung einer photographischen Druckplatte | |
| DE2734335C2 (de) | Lichtempfindliches, photographisches, spektral sensibilisiertes Silberhalogenidaufzeichnungsmaterial vom Lith-Typ | |
| DE3881427T2 (de) | Kontrastreiche photographische Materialien. | |
| DE2426177C2 (show.php) | ||
| DE3539930A1 (de) | Lichtempfindliches photographisches silberhalogenidmaterial | |
| DE2553127A1 (de) | Verfahren zur erhoehung der empfindlichkeit einer photographischen silberhalogenidemulsion, die dabei erhaltenen produkte und deren verwendung zur herstellung eines photographischen materials | |
| DE2936081A1 (de) | Lichtempfindliches, fotografisches silberhalogenidaufzeichnungsmaterial | |
| DE2803178C2 (de) | Lichtempfindliches photographisches Silberhalogenidaufzeichnungsmaterial vom Lith-Typ | |
| DE69325335T2 (de) | Verfahren zur Entwicklung schwarzweisser photographischer lichtempfindlicher Silberhalogenidmaterialien | |
| DE2032049C2 (de) | Verfahren zur Entwicklung eines photographischen Aufzeichnungsmaterials | |
| DE2803231A1 (de) | Hochkontrastreiches, lichtempfindliches, photographisches silberhalogenid-aufzeichnungsmaterial | |
| DE2850612A1 (de) | Photomaterial und photographischer entwickler | |
| DE3231820A1 (de) | Photographisches silberhalogenid-material | |
| DE2329142A1 (de) | Photographisches silberhalogenidmaterial | |
| DE3707849A1 (de) | Verfahren zur erzeugung eines bildes | |
| DE2112728C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2040876A1 (de) | Lichtempfindliches,fotografisches silberhalogenidhaltiges Aufzeichnungsmaterial | |
| DE69302923T2 (de) | Verfahren zum Verarbeiten eines photographischen Silberhalogenidmaterials |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| 8128 | New person/name/address of the agent |
Representative=s name: HENKEL, G., DR.PHIL. FEILER, L., DR.RER.NAT. HAENZ |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |