DE2720798C2 - Behälter, bestehend aus linearen Copolyestern - Google Patents
Behälter, bestehend aus linearen CopolyesternInfo
- Publication number
- DE2720798C2 DE2720798C2 DE2720798A DE2720798A DE2720798C2 DE 2720798 C2 DE2720798 C2 DE 2720798C2 DE 2720798 A DE2720798 A DE 2720798A DE 2720798 A DE2720798 A DE 2720798A DE 2720798 C2 DE2720798 C2 DE 2720798C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- ethylene glycol
- polyesters
- acid
- beta
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001634 Copolyester Polymers 0.000 title claims description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 73
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 24
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000003457 sulfones Chemical class 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 27
- 229920000728 polyester Polymers 0.000 description 22
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 18
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 17
- 230000035699 permeability Effects 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- -1 polyethylene terephthalate Polymers 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 11
- 230000009477 glass transition Effects 0.000 description 11
- 229920000139 polyethylene terephthalate Polymers 0.000 description 10
- 239000005020 polyethylene terephthalate Substances 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 9
- 229910052760 oxygen Inorganic materials 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 9
- 239000001569 carbon dioxide Substances 0.000 description 8
- 229910002092 carbon dioxide Inorganic materials 0.000 description 8
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000012299 nitrogen atmosphere Substances 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000004246 zinc acetate Substances 0.000 description 4
- UTNSTOOXQPHXJQ-UHFFFAOYSA-N 2-[4-[4-(2-hydroxyethoxy)phenyl]sulfonylphenoxy]ethanol Chemical compound C1=CC(OCCO)=CC=C1S(=O)(=O)C1=CC=C(OCCO)C=C1 UTNSTOOXQPHXJQ-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical class [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- ADVORQMAWLEPOI-XHTSQIMGSA-N (e)-4-hydroxypent-3-en-2-one;oxotitanium Chemical compound [Ti]=O.C\C(O)=C/C(C)=O.C\C(O)=C/C(C)=O ADVORQMAWLEPOI-XHTSQIMGSA-N 0.000 description 2
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 235000014171 carbonated beverage Nutrition 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- JVLRYPRBKSMEBF-UHFFFAOYSA-K diacetyloxystibanyl acetate Chemical compound [Sb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JVLRYPRBKSMEBF-UHFFFAOYSA-K 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- QYIGOGBGVKONDY-UHFFFAOYSA-N 1-(2-bromo-5-chlorophenyl)-3-methylpyrazole Chemical compound N1=C(C)C=CN1C1=CC(Cl)=CC=C1Br QYIGOGBGVKONDY-UHFFFAOYSA-N 0.000 description 1
- IZDRSEBCBNFCJA-UHFFFAOYSA-N 6-sulfonylcyclohexa-2,4-dien-1-ol Chemical class OC1C=CC=CC1=S(=O)=O IZDRSEBCBNFCJA-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- MGIAHHJRDZCTHG-UHFFFAOYSA-N benzene-1,3-dicarboxylic acid;terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1.OC(=O)C1=CC=CC(C(O)=O)=C1 MGIAHHJRDZCTHG-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- ULCGAWLDXLEIIR-UHFFFAOYSA-N bis(2-hydroxyethyl) benzene-1,3-dicarboxylate Chemical compound OCCOC(=O)C1=CC=CC(C(=O)OCCO)=C1 ULCGAWLDXLEIIR-UHFFFAOYSA-N 0.000 description 1
- LRAKVEVOONLDGD-UHFFFAOYSA-N bis(2-hydroxyethyl) sulfate Chemical class OCCOS(=O)(=O)OCCO LRAKVEVOONLDGD-UHFFFAOYSA-N 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 239000012611 container material Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ILYCWAKSDCYMBB-OPCMSESCSA-N dihydrotachysterol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1/C[C@@H](O)CC[C@@H]1C ILYCWAKSDCYMBB-OPCMSESCSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical class [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 1
- DJWUNCQRNNEAKC-UHFFFAOYSA-L zinc acetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O DJWUNCQRNNEAKC-UHFFFAOYSA-L 0.000 description 1
- 229960000314 zinc acetate Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/688—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur
- C08G63/6884—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6886—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Containers Having Bodies Formed In One Piece (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69048476A | 1976-05-27 | 1976-05-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2720798A1 DE2720798A1 (de) | 1977-12-08 |
| DE2720798C2 true DE2720798C2 (de) | 1982-12-16 |
Family
ID=24772646
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2720798A Expired DE2720798C2 (de) | 1976-05-27 | 1977-05-09 | Behälter, bestehend aus linearen Copolyestern |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4098769A (enExample) |
| JP (1) | JPS52146497A (enExample) |
| DE (1) | DE2720798C2 (enExample) |
| FR (1) | FR2352849A1 (enExample) |
| GB (1) | GB1582168A (enExample) |
| HK (1) | HK47581A (enExample) |
| MY (1) | MY8200134A (enExample) |
| NL (1) | NL166269C (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188357A (en) * | 1977-12-16 | 1980-02-12 | Owens-Illinois, Inc. | Method of preparing hollow articles from thermoplastic polyesters |
| US4388456A (en) * | 1982-03-01 | 1983-06-14 | Eastman Kodak Company | Copolyesters having improved gas barrier properties |
| US4401805A (en) * | 1982-03-01 | 1983-08-30 | Eastman Kodak Company | Modified poly(ethylene terephthalate) having improved gas barrier properties |
| US4398017A (en) * | 1982-03-09 | 1983-08-09 | Owens-Illinois, Inc. | Copolyesters |
| US4482586A (en) * | 1982-09-07 | 1984-11-13 | The Goodyear Tire & Rubber Company | Multi-layer polyisophthalate and polyterephthalate articles and process therefor |
| US4578437A (en) * | 1983-08-01 | 1986-03-25 | Eastman Kodak Company | Copolyester/polyester blends having reduced carbon dioxide permeability |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2593411A (en) * | 1949-12-21 | 1952-04-22 | Eastman Kodak Co | Bis (4-beta-hydroxyalkoxyphenyl) sulfones and polyesters prepared therefrom |
| JPS5744695B2 (enExample) * | 1973-09-10 | 1982-09-22 | ||
| JPS5096692A (enExample) * | 1973-12-27 | 1975-07-31 |
-
1977
- 1977-04-27 NL NL7704594.A patent/NL166269C/xx not_active IP Right Cessation
- 1977-05-09 DE DE2720798A patent/DE2720798C2/de not_active Expired
- 1977-05-24 GB GB21828/77A patent/GB1582168A/en not_active Expired
- 1977-05-25 JP JP5997077A patent/JPS52146497A/ja active Granted
- 1977-05-26 FR FR7716199A patent/FR2352849A1/fr active Granted
- 1977-07-05 US US05/812,922 patent/US4098769A/en not_active Expired - Lifetime
-
1981
- 1981-09-24 HK HK475/81A patent/HK47581A/xx unknown
-
1982
- 1982-12-30 MY MY134/82A patent/MY8200134A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5544097B2 (enExample) | 1980-11-10 |
| NL166269B (nl) | 1981-02-16 |
| FR2352849A1 (fr) | 1977-12-23 |
| FR2352849B1 (enExample) | 1981-01-02 |
| NL166269C (nl) | 1981-07-15 |
| DE2720798A1 (de) | 1977-12-08 |
| GB1582168A (en) | 1980-12-31 |
| NL7704594A (nl) | 1977-11-29 |
| HK47581A (en) | 1981-10-02 |
| MY8200134A (en) | 1982-12-31 |
| US4098769A (en) | 1978-07-04 |
| JPS52146497A (en) | 1977-12-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2431072C3 (de) | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung | |
| EP0117912B1 (de) | Verfahren zur Herstellung von hellfarbigen Polyestern unter Verwendung von Titankatalysatoren | |
| DE69707757T2 (de) | Veresterungsverfahren | |
| DE19537930B4 (de) | Verfahren zur Herstellung von klarsichtigem Polyester | |
| EP0525463A2 (de) | Verfahren zur Herstellung eines Modifizierten Co-Polyethylenterephthalates | |
| DE2313903B2 (de) | Verfahren zur Herstellung von segmentierten thermoplastischen Copolyesterelastomeren | |
| EP0346735A2 (de) | Verfahren zur kontinuierlichen Herstellung von linearen thermoplastischen Polyestern | |
| DE3233653A1 (de) | Modifizierte polyethylen-terephthalat-formmasse | |
| DE2720806C2 (de) | Behälter mit niedriger Durchlässigkeit der Wandungen gegenüber Sauerstoff und CO↓2↓ | |
| DE69704424T2 (de) | Verfahren zur rückgewinnung von polyolen und nach diesem verfahren hergestellte polyole | |
| DE1495585B2 (de) | Verfahren zur herstellung von polyestern | |
| DE2720798C2 (de) | Behälter, bestehend aus linearen Copolyestern | |
| DE2720845C2 (de) | Lineare Copolyester und deren Verwendung | |
| DE1495955A1 (de) | Verfahren zur Harzherstellung | |
| DE1545024C3 (de) | Verfahren zur Herstellung von Polyestern | |
| DE3925607A1 (de) | Verfahren zur synthese von polyesterharzen | |
| DE2653918C3 (de) | Verfahren zur Herstellung von Polyestern und deren Verwendung | |
| DE2653972C3 (de) | Verfahren zur Herstellung von Polyestern und deren Verwendung | |
| DE2502911B2 (de) | Verfahren zur Herstellung von Polyestern | |
| DE2544069B2 (de) | Verfahren zur Herstellung von Polyestern | |
| DE1495667A1 (de) | Verfahren zur Herstellung linearer Polykondensate | |
| DE1300301B (de) | Verfahren zur Herstellung linearer, gesaettigter Polyester | |
| DE2734924C2 (de) | Kontinuierliches Verfahren zur Herstellung von Polybutylenterephthalaten | |
| DE10009769A1 (de) | Biologisch abbaubarer aliphatischer Copolyester und Verfahren zu seiner Herstellung | |
| CH418641A (de) | Verfahren zur Herstellung linearer Copolyester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |