DE2708182C3 - Verfahren zur Herstellung von Acylcyaniden - Google Patents
Verfahren zur Herstellung von AcylcyanidenInfo
- Publication number
- DE2708182C3 DE2708182C3 DE2708182A DE2708182A DE2708182C3 DE 2708182 C3 DE2708182 C3 DE 2708182C3 DE 2708182 A DE2708182 A DE 2708182A DE 2708182 A DE2708182 A DE 2708182A DE 2708182 C3 DE2708182 C3 DE 2708182C3
- Authority
- DE
- Germany
- Prior art keywords
- cyanide
- chloride
- mol
- acid
- cyanides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000001264 acyl cyanides Chemical class 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000002360 preparation method Methods 0.000 claims description 2
- -1 alkyl radical Chemical class 0.000 description 37
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 239000002253 acid Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 238000009835 boiling Methods 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- 150000004820 halides Chemical class 0.000 description 9
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 8
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 5
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- NPBLQPWAISGYEU-UHFFFAOYSA-N 2,2-dimethylpropanoyl cyanide Chemical compound CC(C)(C)C(=O)C#N NPBLQPWAISGYEU-UHFFFAOYSA-N 0.000 description 3
- ZZHRFRDHPAPENB-UHFFFAOYSA-N 4-methylbenzoyl cyanide Chemical compound CC1=CC=C(C(=O)C#N)C=C1 ZZHRFRDHPAPENB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- QLDHWVVRQCGZLE-UHFFFAOYSA-N acetyl cyanide Chemical compound CC(=O)C#N QLDHWVVRQCGZLE-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- WYXWANVHOUGOBI-UHFFFAOYSA-N 2-methylbenzoyl cyanide Chemical compound CC1=CC=CC=C1C(=O)C#N WYXWANVHOUGOBI-UHFFFAOYSA-N 0.000 description 2
- JEOHRIFJRDJKGQ-UHFFFAOYSA-N 3-methylbenzoyl cyanide Chemical compound CC1=CC=CC(C(=O)C#N)=C1 JEOHRIFJRDJKGQ-UHFFFAOYSA-N 0.000 description 2
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- KVTSVGLONDUACT-UHFFFAOYSA-N cyclohexanecarbonyl cyanide Chemical compound N#CC(=O)C1CCCCC1 KVTSVGLONDUACT-UHFFFAOYSA-N 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- QPDVWLJUGXELAE-UHFFFAOYSA-N 2,2-dichloro-1,3-dimethylcyclopropane-1-carbonyl cyanide Chemical compound CC1C(Cl)(Cl)C1(C)C(=O)C#N QPDVWLJUGXELAE-UHFFFAOYSA-N 0.000 description 1
- CXMLTRONLWEVGI-UHFFFAOYSA-N 2,2-dichloro-1-methylcyclopropane-1-carbonyl cyanide Chemical compound N#CC(=O)C1(C)CC1(Cl)Cl CXMLTRONLWEVGI-UHFFFAOYSA-N 0.000 description 1
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical compound CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 1
- RTKMFQOHBDVEBC-UHFFFAOYSA-N 3-bromo-3-buten-1-ol Chemical compound OCCC(Br)=C RTKMFQOHBDVEBC-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- JIMIZSCETMDNEU-UHFFFAOYSA-N 4-methoxybenzoyl cyanide Chemical compound COC1=CC=C(C(=O)C#N)C=C1 JIMIZSCETMDNEU-UHFFFAOYSA-N 0.000 description 1
- UYLDYONACMPODJ-UHFFFAOYSA-N 4-methylidenecyclohexa-1,5-diene-1-carbonyl chloride Chemical compound C=C1CC=C(C=C1)C(=O)Cl UYLDYONACMPODJ-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 240000004160 Capsicum annuum Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940075610 mercuric cyanide Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/14—Preparation of carboxylic acid nitriles by reaction of cyanides with halogen-containing compounds with replacement of halogen atoms by cyano groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Toxicology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2708182A DE2708182C3 (de) | 1977-02-25 | 1977-02-25 | Verfahren zur Herstellung von Acylcyaniden |
| BE6046032A BE855254A (fr) | 1977-02-25 | 1977-05-31 | Procede pour la preparation de cyanures d'acyle et produits obtenus |
| IT49653/77A IT1143579B (it) | 1977-02-25 | 1977-06-01 | Procedimento per la produzione di cianuri acilici |
| AT392577A AT356643B (de) | 1977-02-25 | 1977-06-02 | Verfahren zur herstellung von acylcyaniden |
| SU772491918A SU799653A3 (ru) | 1977-02-25 | 1977-06-02 | Способ получени нитриловКЕТОКАРбОНОВыХ КиСлОТ |
| US05/802,942 US4108875A (en) | 1977-02-25 | 1977-06-02 | Process for the production of acyl cyanides (B) |
| GB23667/77A GB1527967A (en) | 1977-02-25 | 1977-06-03 | Process for the production of acyl cyanides |
| DD7700199294A DD131015A5 (de) | 1977-02-25 | 1977-06-03 | Verfahren zur herstellung von acylcyaniden(b) |
| NL7706158A NL7706158A (nl) | 1977-02-25 | 1977-06-03 | Werkwijze voor het bereiden van acylcyaniden. |
| CH690177A CH627442A5 (de) | 1977-02-25 | 1977-06-03 | Verfahren zur herstellung von acylcyaniden. |
| IL52237A IL52237A (en) | 1977-02-25 | 1977-06-03 | Preparation of acyl cyanides and some novel 1-methylcyclopropyl-glyoxylonitriles |
| JP6565277A JPS53105426A (en) | 1977-02-25 | 1977-06-03 | Process for preparing acylcyanate |
| FR7717126A FR2381748A1 (fr) | 1977-02-25 | 1977-06-03 | Procede pour la fabrication de cyanures d'acyle (b) et produits ainsi obtenus |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2708182A DE2708182C3 (de) | 1977-02-25 | 1977-02-25 | Verfahren zur Herstellung von Acylcyaniden |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2708182A1 DE2708182A1 (de) | 1978-08-31 |
| DE2708182B2 DE2708182B2 (de) | 1978-12-21 |
| DE2708182C3 true DE2708182C3 (de) | 1979-08-30 |
Family
ID=6002150
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2708182A Expired DE2708182C3 (de) | 1977-02-25 | 1977-02-25 | Verfahren zur Herstellung von Acylcyaniden |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4108875A (enExample) |
| JP (1) | JPS53105426A (enExample) |
| AT (1) | AT356643B (enExample) |
| BE (1) | BE855254A (enExample) |
| CH (1) | CH627442A5 (enExample) |
| DD (1) | DD131015A5 (enExample) |
| DE (1) | DE2708182C3 (enExample) |
| FR (1) | FR2381748A1 (enExample) |
| GB (1) | GB1527967A (enExample) |
| IL (1) | IL52237A (enExample) |
| IT (1) | IT1143579B (enExample) |
| NL (1) | NL7706158A (enExample) |
| SU (1) | SU799653A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4339591A (en) | 1980-03-24 | 1982-07-13 | Degussa Aktiengesellschaft | Process for the production of caboxylic acid cyanides |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2753656C2 (de) * | 1977-12-02 | 1982-11-25 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Benzoylcyanid |
| DE2753657C2 (de) * | 1977-12-02 | 1982-11-25 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Benzoylcyanid |
| US4209462A (en) * | 1978-12-18 | 1980-06-24 | Stauffer Chemical Company | Method for preparing acyl cyanides |
| NL8006594A (nl) * | 1979-12-21 | 1981-07-16 | Ciba Geigy | Alfa-oxonitrilen, werkwijzen ter bereiding ervan en hun toepassing. |
| DE3015587A1 (de) * | 1980-04-23 | 1981-10-29 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von acylcyaniden |
| DE3045181A1 (de) * | 1980-12-01 | 1982-07-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von pivaloylcyanid |
| DE102005027149A1 (de) * | 2005-06-11 | 2006-12-14 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von substituierten Benzoylcyaniden |
| CN104387293B (zh) * | 2014-10-27 | 2017-02-22 | 河北诚信有限责任公司 | 一种肟菌酯中间体邻甲基苯甲酰腈的合成方法 |
| CN113666841A (zh) * | 2021-09-23 | 2021-11-19 | 抚顺顺能化工有限公司 | 一种邻甲基苯甲酰腈的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2528211C3 (de) * | 1975-06-25 | 1980-03-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Acylcyaniden |
-
1977
- 1977-02-25 DE DE2708182A patent/DE2708182C3/de not_active Expired
- 1977-05-31 BE BE6046032A patent/BE855254A/xx not_active IP Right Cessation
- 1977-06-01 IT IT49653/77A patent/IT1143579B/it active
- 1977-06-02 AT AT392577A patent/AT356643B/de not_active IP Right Cessation
- 1977-06-02 SU SU772491918A patent/SU799653A3/ru active
- 1977-06-02 US US05/802,942 patent/US4108875A/en not_active Expired - Lifetime
- 1977-06-03 GB GB23667/77A patent/GB1527967A/en not_active Expired
- 1977-06-03 NL NL7706158A patent/NL7706158A/xx not_active Application Discontinuation
- 1977-06-03 CH CH690177A patent/CH627442A5/de not_active IP Right Cessation
- 1977-06-03 JP JP6565277A patent/JPS53105426A/ja active Granted
- 1977-06-03 FR FR7717126A patent/FR2381748A1/fr active Granted
- 1977-06-03 DD DD7700199294A patent/DD131015A5/xx unknown
- 1977-06-03 IL IL52237A patent/IL52237A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4339591A (en) | 1980-03-24 | 1982-07-13 | Degussa Aktiengesellschaft | Process for the production of caboxylic acid cyanides |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1143579B (it) | 1986-10-22 |
| ATA392577A (de) | 1979-10-15 |
| DE2708182A1 (de) | 1978-08-31 |
| NL7706158A (nl) | 1978-08-29 |
| DE2708182B2 (de) | 1978-12-21 |
| BE855254A (fr) | 1977-11-30 |
| AT356643B (de) | 1980-05-12 |
| IL52237A0 (en) | 1977-08-31 |
| CH627442A5 (de) | 1982-01-15 |
| DD131015A5 (de) | 1978-05-24 |
| GB1527967A (en) | 1978-10-11 |
| US4108875A (en) | 1978-08-22 |
| FR2381748A1 (fr) | 1978-09-22 |
| JPS6140659B2 (enExample) | 1986-09-10 |
| JPS53105426A (en) | 1978-09-13 |
| IL52237A (en) | 1981-02-27 |
| FR2381748B1 (enExample) | 1981-01-30 |
| SU799653A3 (ru) | 1981-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2708182C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2437882C3 (de) | Verfahren zur Herstellung von Estern des 3-Phenoxybenzylalkohols | |
| DE2710174A1 (de) | Verfahren zur herstellung von dihalogenvinyl-cyclopropancarbonsaeuren und deren ester | |
| DE2624891C2 (de) | Verfahren zur Herstellung von Benzoylcyanid | |
| DE2642140C2 (de) | Verfahren zur Herstellung von Benzoylcyanid | |
| DE2708183C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2614241C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| EP0048370B1 (de) | Verfahren zur Herstellung von trans-3-(Z-2-Chlor-2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbon-säure-derivaten, neue Zwischenprodukte hierfür, Verfahren zu deren Herstellung und Verwendung von Zwischenprodukten in Schädlingsbekämpfungsmitteln | |
| CH626332A5 (enExample) | ||
| DE1768578A1 (de) | Verfahren zur Herstellung von 2,4-disubstituierten Phenylketonen | |
| CH626874A5 (enExample) | ||
| EP0012108B1 (de) | Verfahren zur Herstellung von 4,5-Dichlor-2-(4-chlorphenoxy)-phenol und 4,5-Dichlor-2-(4-chlorphenoxy)-anisol | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| EP0109625B1 (de) | Verfahren zur Herstellung von Dihydro-4,4-dimethyl-2,3-furandion | |
| DE2365421C3 (de) | Verfahren zur Herstellung von Methylfumardialdehydmonoacetalen | |
| DE69218898T2 (de) | Verfahren zur Herstellung von Bisphenolen | |
| DE3031385A1 (de) | 1-hydroxypyrazol und verfahren zu seiner herstellung | |
| DE3310954A1 (de) | Verfahren zur herstellung von substituierten trialkylsilyloxymalonsaeuredinitrilen | |
| DE4042283A1 (de) | Verfahren zur herstellung von 2-phenoxymethylbenzoesaeuren | |
| DE4042282A1 (de) | O-substituierte benzoylcyanide | |
| DE2435098B2 (de) | Verfahren zur herstellung von beta- bromalkyl- und beta-bromalkenylsulfonen | |
| DE2807935A1 (de) | Verfahren zur herstellung von gemischen aus dichloressigsaeure- (1-cyan-2,2-dichlor)-vinylester und 2-dichlormethyl-2-dichloracetoxy- malonsaeuredinitril | |
| DE2710151A1 (de) | Verfahren zur herstellung von dihalogenvinyl-gamma-butyrolactonen | |
| DE2849312A1 (de) | Verfahren zur herstellung nitrierter derivate | |
| DE2827977A1 (de) | Verfahren zur herstellung von mandelsaeureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) |