DE2658545C3 - Verfahren zur Kernhydroxylierung von aromatischen V erbindungen - Google Patents
Verfahren zur Kernhydroxylierung von aromatischen V erbindungenInfo
- Publication number
- DE2658545C3 DE2658545C3 DE2658545A DE2658545A DE2658545C3 DE 2658545 C3 DE2658545 C3 DE 2658545C3 DE 2658545 A DE2658545 A DE 2658545A DE 2658545 A DE2658545 A DE 2658545A DE 2658545 C3 DE2658545 C3 DE 2658545C3
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- hydrogen peroxide
- acid
- aromatic
- hydroxylation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 37
- 230000008569 process Effects 0.000 title claims description 23
- 238000005805 hydroxylation reaction Methods 0.000 title claims description 21
- 230000033444 hydroxylation Effects 0.000 title claims description 20
- 150000001491 aromatic compounds Chemical class 0.000 title claims description 18
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 69
- 238000006243 chemical reaction Methods 0.000 claims description 42
- 239000012190 activator Substances 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000012429 reaction media Substances 0.000 claims description 10
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical class C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000008139 complexing agent Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 125000003172 aldehyde group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910021645 metal ion Inorganic materials 0.000 claims description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 32
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 28
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 24
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 17
- 150000001299 aldehydes Chemical class 0.000 description 14
- -1 ortho- Chemical class 0.000 description 14
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 12
- 230000000694 effects Effects 0.000 description 10
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 9
- 150000003934 aromatic aldehydes Chemical class 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- FXHGMKSSBGDXIY-UHFFFAOYSA-N heptanal Chemical compound CCCCCCC=O FXHGMKSSBGDXIY-UHFFFAOYSA-N 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 235000011007 phosphoric acid Nutrition 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 150000001241 acetals Chemical class 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 4
- QATSOLLSVDVSAL-UHFFFAOYSA-N 4-[hydroxy(phenyl)methyl]phenol Chemical compound C=1C=C(O)C=CC=1C(O)C1=CC=CC=C1 QATSOLLSVDVSAL-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 3
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 3
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 3
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 2
- DUVJMSPTZMCSTQ-UHFFFAOYSA-N 2-ethoxybenzaldehyde Chemical compound CCOC1=CC=CC=C1C=O DUVJMSPTZMCSTQ-UHFFFAOYSA-N 0.000 description 2
- VFZRZRDOXPRTSC-UHFFFAOYSA-N 3,5-Dimethoxybenzaldehyde Chemical compound COC1=CC(OC)=CC(C=O)=C1 VFZRZRDOXPRTSC-UHFFFAOYSA-N 0.000 description 2
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 2
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 2
- 230000008034 disappearance Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000004967 organic peroxy acids Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 150000008379 phenol ethers Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940005657 pyrophosphoric acid Drugs 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000036632 reaction speed Effects 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RCNDZZXAGKIREF-UHFFFAOYSA-N (3-ethoxyphenyl)-phenylmethanol Chemical compound CCOC1=CC=CC(C(O)C=2C=CC=CC=2)=C1 RCNDZZXAGKIREF-UHFFFAOYSA-N 0.000 description 1
- TXFIIWAEXNZLOZ-UHFFFAOYSA-N (4-ethoxyphenyl)-phenylmethanol Chemical compound C1=CC(OCC)=CC=C1C(O)C1=CC=CC=C1 TXFIIWAEXNZLOZ-UHFFFAOYSA-N 0.000 description 1
- BEGZWXVLBIZFKQ-UHFFFAOYSA-N (4-methoxyphenyl)-phenylmethanol Chemical compound C1=CC(OC)=CC=C1C(O)C1=CC=CC=C1 BEGZWXVLBIZFKQ-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 description 1
- SMUVABOERCFKRW-UHFFFAOYSA-N 2,5-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1 SMUVABOERCFKRW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- XDXWZLLYPRIPGW-UHFFFAOYSA-N 2-[hydroxy-(3-hydroxyphenyl)methyl]phenol Chemical compound C=1C=CC=C(O)C=1C(O)C1=CC=CC(O)=C1 XDXWZLLYPRIPGW-UHFFFAOYSA-N 0.000 description 1
- CFZGVQKYFOXIBL-UHFFFAOYSA-N 2-[hydroxy-(4-hydroxyphenyl)methyl]phenol Chemical compound C=1C=CC=C(O)C=1C(O)C1=CC=C(O)C=C1 CFZGVQKYFOXIBL-UHFFFAOYSA-N 0.000 description 1
- NTWBHJYRDKBGBR-UHFFFAOYSA-N 2-ethylbenzaldehyde Chemical compound CCC1=CC=CC=C1C=O NTWBHJYRDKBGBR-UHFFFAOYSA-N 0.000 description 1
- ZRUOTKQBVMWMDK-UHFFFAOYSA-N 2-hydroxy-6-methylbenzaldehyde Chemical compound CC1=CC=CC(O)=C1C=O ZRUOTKQBVMWMDK-UHFFFAOYSA-N 0.000 description 1
- KTOQRRDVVIDEAA-UHFFFAOYSA-N 2-methylpropane Chemical compound [CH2]C(C)C KTOQRRDVVIDEAA-UHFFFAOYSA-N 0.000 description 1
- NBEFMISJJNGCIZ-UHFFFAOYSA-N 3,5-dimethylbenzaldehyde Chemical compound CC1=CC(C)=CC(C=O)=C1 NBEFMISJJNGCIZ-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- QZMGMXBYJZVAJN-UHFFFAOYSA-N 3-ethoxybenzaldehyde Chemical compound CCOC1=CC=CC(C=O)=C1 QZMGMXBYJZVAJN-UHFFFAOYSA-N 0.000 description 1
- LLYXUFQXCNIGDG-UHFFFAOYSA-N 3-ethylbenzaldehyde Chemical compound CCC1=CC=CC(C=O)=C1 LLYXUFQXCNIGDG-UHFFFAOYSA-N 0.000 description 1
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 1
- FFQXEFNKZVGJDI-UHFFFAOYSA-N 3-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC(C=O)=C1 FFQXEFNKZVGJDI-UHFFFAOYSA-N 0.000 description 1
- NOBKCEXLDDGYID-UHFFFAOYSA-N 3-propan-2-yloxybenzaldehyde Chemical compound CC(C)OC1=CC=CC(C=O)=C1 NOBKCEXLDDGYID-UHFFFAOYSA-N 0.000 description 1
- XHPWXDIDEOJTHC-UHFFFAOYSA-N 4-[hydroxy-(2-methoxyphenyl)methyl]phenol Chemical compound COC1=CC=CC=C1C(O)C1=CC=C(O)C=C1 XHPWXDIDEOJTHC-UHFFFAOYSA-N 0.000 description 1
- LVXZIGWFYJWWPR-UHFFFAOYSA-N 4-[hydroxy-(3-methylphenyl)methyl]phenol Chemical compound CC1=CC=CC(C(O)C=2C=CC(O)=CC=2)=C1 LVXZIGWFYJWWPR-UHFFFAOYSA-N 0.000 description 1
- YROLENHJECWGMN-UHFFFAOYSA-N 4-[hydroxy-(4-methylphenyl)methyl]phenol Chemical compound C1=CC(C)=CC=C1C(O)C1=CC=C(O)C=C1 YROLENHJECWGMN-UHFFFAOYSA-N 0.000 description 1
- LGYXARHGMQFGTJ-UHFFFAOYSA-N 4-ethoxy-2-methylbenzaldehyde Chemical compound CCOC1=CC=C(C=O)C(C)=C1 LGYXARHGMQFGTJ-UHFFFAOYSA-N 0.000 description 1
- XXTRGLCPRZQPHJ-UHFFFAOYSA-N 4-hydroxy-2,6-dimethylbenzaldehyde Chemical compound CC1=CC(O)=CC(C)=C1C=O XXTRGLCPRZQPHJ-UHFFFAOYSA-N 0.000 description 1
- JDWWIEFMFPWBST-UHFFFAOYSA-N 4-hydroxy-2-methylbenzaldehyde Chemical compound CC1=CC(O)=CC=C1C=O JDWWIEFMFPWBST-UHFFFAOYSA-N 0.000 description 1
- WICYVKGMEJSDAO-UHFFFAOYSA-N 4-methoxy-2-methylbenzaldehyde Chemical compound COC1=CC=C(C=O)C(C)=C1 WICYVKGMEJSDAO-UHFFFAOYSA-N 0.000 description 1
- MYLBIQHZWFWSMH-UHFFFAOYSA-N 4-methoxy-3-methylbenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C MYLBIQHZWFWSMH-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- DETXZQGDWUJKMO-UHFFFAOYSA-N alpha-hydroxymethanesulfonic acid Natural products OCS(O)(=O)=O DETXZQGDWUJKMO-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 description 1
- IZALUMVGBVKPJD-UHFFFAOYSA-N benzene-1,3-dicarbaldehyde Chemical compound O=CC1=CC=CC(C=O)=C1 IZALUMVGBVKPJD-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- YTFJQDNGSQJFNA-UHFFFAOYSA-L benzyl phosphate Chemical compound [O-]P([O-])(=O)OCC1=CC=CC=C1 YTFJQDNGSQJFNA-UHFFFAOYSA-L 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- AKAUCGJQKLOHHK-UHFFFAOYSA-N cyclohexyl dihydrogen phosphate Chemical compound OP(O)(=O)OC1CCCCC1 AKAUCGJQKLOHHK-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PHNWGDTYCJFUGZ-UHFFFAOYSA-L hexyl phosphate Chemical compound CCCCCCOP([O-])([O-])=O PHNWGDTYCJFUGZ-UHFFFAOYSA-L 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000000640 hydroxylating effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical compound O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7540382A FR2336364A1 (fr) | 1975-12-24 | 1975-12-24 | Hydroxylation de composes aromatiques |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2658545A1 DE2658545A1 (de) | 1977-07-07 |
| DE2658545B2 DE2658545B2 (de) | 1980-08-28 |
| DE2658545C3 true DE2658545C3 (de) | 1981-05-07 |
Family
ID=9164431
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2658545A Expired DE2658545C3 (de) | 1975-12-24 | 1976-12-23 | Verfahren zur Kernhydroxylierung von aromatischen V erbindungen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4208536A (index.php) |
| JP (1) | JPS5289625A (index.php) |
| AT (1) | AT345269B (index.php) |
| BE (1) | BE849860A (index.php) |
| BR (1) | BR7608678A (index.php) |
| CA (1) | CA1069538A (index.php) |
| CH (1) | CH617416A5 (index.php) |
| CS (1) | CS194681B2 (index.php) |
| DD (1) | DD127489A5 (index.php) |
| DE (1) | DE2658545C3 (index.php) |
| FR (1) | FR2336364A1 (index.php) |
| GB (1) | GB1521400A (index.php) |
| IT (1) | IT1065507B (index.php) |
| LU (1) | LU76462A1 (index.php) |
| NL (1) | NL177746C (index.php) |
| PL (1) | PL105048B1 (index.php) |
| RO (1) | RO70266A (index.php) |
| SE (1) | SE435053B (index.php) |
| SU (1) | SU784757A3 (index.php) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2928743A1 (de) * | 1979-07-17 | 1981-02-05 | Bayer Ag | Verfahren zur herstellung mehrwertiger phenole |
| DE2942366A1 (de) * | 1979-10-19 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung mehrwertiger phenole |
| US4588845A (en) * | 1983-07-18 | 1986-05-13 | Fmc Corporation | Oxidation of unsaturated organic compounds with hydrogen peroxide |
| DE3643206C1 (de) * | 1986-12-18 | 1988-03-24 | Degussa | Verfahren zur Herstellung von substituierten Dihydroxybenzolen |
| FR2649695A1 (fr) * | 1989-07-11 | 1991-01-18 | Rhone Poulenc Chimie | Procede d'hydroxylation de phenols et d'ethers de phenols |
| FR2655332A1 (fr) * | 1989-12-05 | 1991-06-07 | Rhone Poulenc Chimie | Procede d'hydroxylation de phenols et d'ethers de phenols. |
| FR2700332B1 (fr) * | 1993-01-08 | 1995-03-10 | Rhone Poulenc Chimie | Procédé d'hydroxylation de composés phénoliques. |
| FR2710339B1 (fr) * | 1993-09-22 | 1995-11-24 | Rhone Poulenc Chimie | Procédé de préparation de fuchsones. |
| EP0606183B1 (fr) * | 1993-01-08 | 1999-04-14 | Rhodia Chimie | Procédé de préparation d'une p-fuchsone |
| FR2700333B1 (fr) * | 1993-01-08 | 1995-03-10 | Rhone Poulenc Chimie | Procédé de préparation de composés aromatiques dihydroxyles. |
| DE102010008393A1 (de) | 2010-02-10 | 2011-10-06 | Technische Universität Dresden | Substrat zur Bodenverbesserung mit Wasser speichernder Eigenschaft, Verfahren zur Herstellung und dessen Verwendung |
| CN105597755B (zh) * | 2015-11-10 | 2018-06-29 | 扬州大学 | 一种立方相CuO催化剂及其制备方法 |
| EP3398925B1 (en) * | 2015-12-18 | 2022-03-30 | Earth Corporation | Method for producing oxidation reaction product of hydrocarbon or derivative thereof, and method for producing oxidation reaction product of olefin |
| JP6080281B1 (ja) * | 2016-03-04 | 2017-02-15 | 株式会社 エースネット | 炭化水素またはその誘導体の酸化反応生成物の製造方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2439812A (en) * | 1944-11-30 | 1948-04-20 | Socony Vacuum Oil Co Inc | Method for making phenol |
| US3850995A (en) * | 1969-09-22 | 1974-11-26 | Celanese Corp | Conversion of aromatic aldehydes to phenolic compounds |
| FR2071464A5 (index.php) * | 1969-12-30 | 1971-09-17 | Rhone Poulenc Sa | |
| DE2150657C3 (de) * | 1971-07-17 | 1978-10-26 | Brichima S.P.A., Mailand (Italien) | Verfahren zur Herstellung einer Mischung aus Brenzcatechin und Hydrochinon |
| DE2138735A1 (de) * | 1971-08-03 | 1973-03-01 | Haarmann & Reimer Gmbh | Verfahren zur herstellung von polyhydroxybenzolen |
| BE791582A (fr) * | 1971-11-19 | 1973-05-17 | Rhone Poulenc Sa | Procede de preparation de phenols par oxydation d'aldehydes aromatique |
| IT964049B (it) * | 1972-08-18 | 1974-01-21 | Brichima Spa | Processo per la preparazione di difenoli |
| US3839467A (en) * | 1972-08-31 | 1974-10-01 | Universal Oil Prod Co | Preparation of hydroxylated aromatic compounds |
| JPS4930330A (index.php) * | 1973-03-23 | 1974-03-18 | ||
| DE2410742C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol |
| GB1448358A (en) * | 1974-04-04 | 1976-09-08 | Ube Industries | Process for preparint dihydric phenol derivatives |
-
1975
- 1975-12-24 FR FR7540382A patent/FR2336364A1/fr active Granted
-
1976
- 1976-12-16 CS CS768289A patent/CS194681B2/cs unknown
- 1976-12-21 US US05/752,903 patent/US4208536A/en not_active Expired - Lifetime
- 1976-12-21 JP JP15299276A patent/JPS5289625A/ja active Granted
- 1976-12-22 DD DD196541A patent/DD127489A5/xx unknown
- 1976-12-22 RO RO7688814A patent/RO70266A/ro unknown
- 1976-12-23 GB GB53717/76A patent/GB1521400A/en not_active Expired
- 1976-12-23 NL NLAANVRAGE7614357,A patent/NL177746C/xx not_active IP Right Cessation
- 1976-12-23 CA CA268,607A patent/CA1069538A/fr not_active Expired
- 1976-12-23 CH CH1627776A patent/CH617416A5/fr not_active IP Right Cessation
- 1976-12-23 BR BR7608678A patent/BR7608678A/pt unknown
- 1976-12-23 LU LU76462A patent/LU76462A1/xx unknown
- 1976-12-23 AT AT958676A patent/AT345269B/de not_active IP Right Cessation
- 1976-12-23 SE SE7614536A patent/SE435053B/xx not_active IP Right Cessation
- 1976-12-23 DE DE2658545A patent/DE2658545C3/de not_active Expired
- 1976-12-23 PL PL1976194663A patent/PL105048B1/pl unknown
- 1976-12-24 BE BE173636A patent/BE849860A/xx not_active IP Right Cessation
- 1976-12-24 IT IT30864/76A patent/IT1065507B/it active
- 1976-12-24 SU SU762432954A patent/SU784757A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2336364A1 (fr) | 1977-07-22 |
| ATA958676A (de) | 1978-01-15 |
| PL105048B1 (pl) | 1979-09-29 |
| JPS5289625A (en) | 1977-07-27 |
| GB1521400A (en) | 1978-08-16 |
| CS194681B2 (en) | 1979-12-31 |
| DE2658545A1 (de) | 1977-07-07 |
| SE7614536L (sv) | 1977-06-25 |
| DD127489A5 (index.php) | 1977-09-28 |
| US4208536A (en) | 1980-06-17 |
| FR2336364B1 (index.php) | 1979-07-06 |
| NL7614357A (nl) | 1977-06-28 |
| NL177746B (nl) | 1985-06-17 |
| RO70266A (ro) | 1982-10-11 |
| SU784757A3 (ru) | 1980-11-30 |
| AT345269B (de) | 1978-09-11 |
| DE2658545B2 (de) | 1980-08-28 |
| NL177746C (nl) | 1985-11-18 |
| CH617416A5 (index.php) | 1980-05-30 |
| CA1069538A (fr) | 1980-01-08 |
| BR7608678A (pt) | 1978-01-03 |
| BE849860A (fr) | 1977-06-24 |
| JPS5647891B2 (index.php) | 1981-11-12 |
| SE435053B (sv) | 1984-09-03 |
| IT1065507B (it) | 1985-02-25 |
| LU76462A1 (index.php) | 1978-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2658545C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen V erbindungen | |
| DE2064497C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen | |
| DE2633302C2 (de) | Verfahren zur Herstellung von Phenolen durch Hydroxylierung von aromatischen Verbindungen | |
| DE69103243T2 (de) | Verfahren zur Hydroxylierung von Phenolverbindungen. | |
| DE69314365T2 (de) | Verfahren zur Monohydroxylierung von Phenolverbindungen | |
| DE3109339C2 (de) | Verfahren zur Herstellung von Resorcin | |
| DE1593968C3 (de) | Verfahren zur Herstellung von Hydrochinon und Brenzcatechin | |
| DE3109442C2 (de) | Verfahren zur Herstellung von Resorcin | |
| DE2450086A1 (de) | Herstellung von resorcinen aus deltaketocarbonsaeuren oder ihren lactonen | |
| DE2658943C3 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| EP0121693B1 (de) | Verfahren zur selektiven Herstellung von Dihydroxybenzolen | |
| DE2508452C2 (de) | Verfahren zur Herstellung von Alkylphenolen | |
| WO2002004432A1 (de) | Verfahren zur herstellung von 2-alkyl-3-aryl- und -heteroaryloxaziridinen und neue 2-alkyl-3-aryloxaziridine | |
| DE2435979A1 (de) | Verfahren zur spaltung von alkylaromatischen hydroperoxyden | |
| DE2256513A1 (de) | Verfahren zur herstellung von phenolen durch oxydation von aromatischen aldehyden | |
| DE2638559C2 (de) | Verfahren zur Herstellung von zweiwertigen Phenolen oder deren Monoethern | |
| DE1262282B (de) | Verfahren zur Herstellung von Phenolen durch Oxydieren von aromatischen Kohlenwasserstoffen | |
| DE2658866A1 (de) | Verfahren zur herstellung von mehrwertigen phenolen | |
| DE2548384A1 (de) | Verfahren zur herstellung von hydroxyphenylaethern | |
| EP0230625B1 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| DE1643158C3 (index.php) | ||
| CH631146A5 (de) | Verfahren zur herstellung von 2,6-dimethoxy-4-(quaternaeren-alkyl)phenolen. | |
| DE3618643A1 (de) | Verfahren zum herstellen von 2,6-naphthalindiol, und 2,6 diacetoxynaphthalin | |
| EP0027593A1 (de) | Verfahren zur Herstellung mehrwertiger Phenole | |
| DE680023C (de) | Verfahren zur Herstellung von Methacrylsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |